\n\n\n\n\n","import { FileRestrictions } from \"@progress/kendo-angular-upload\";\n\nexport const SUPPORT_ATTACHMENT_RESTRICTIONS: FileRestrictions = {\n maxFileSize: 20 * 1048576, // 20MB in bytes\n allowedExtensions: [\n \".doc\", \".docx\", \".dot\", \".dotx\", \".xls\", \".xlsx\", \".xlsm\", \".xlt\", \".xltx\",\n \".ppt\", \".pptx\", \".pptm\", \".pot\", \".potx\", \".pdf\", \".txt\", \".rtf\", \".jpg\",\n \".jpeg\", \".png\", \".gif\", \".bmp\", \".tiff\", \".tif\", \".svg\", \".webp\", \".ico\",\n \".heic\", \".heif\", \".psd\", \".raw\"\n ] \n };","import * as i0 from '@angular/core';\nimport { InjectionToken, PLATFORM_ID, Injectable, Inject, Optional, EventEmitter, Component, Input, HostBinding, Output, NgModule, forwardRef, Directive, HostListener } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\nimport { of, BehaviorSubject, Subject } from 'rxjs';\nimport { NG_VALUE_ACCESSOR, FormsModule } from '@angular/forms';\n\nconst RECAPTCHA_LANGUAGE = new InjectionToken(\"recaptcha-language\");\nconst RECAPTCHA_BASE_URL = new InjectionToken(\"recaptcha-base-url\");\nconst RECAPTCHA_NONCE = new InjectionToken(\"recaptcha-nonce-tag\");\nconst RECAPTCHA_SETTINGS = new InjectionToken(\"recaptcha-settings\");\nconst RECAPTCHA_V3_SITE_KEY = new InjectionToken(\"recaptcha-v3-site-key\");\n\nfunction loadScript(renderMode, onLoaded, urlParams, url, nonce) {\n window.ng2recaptchaloaded = () => {\n onLoaded(grecaptcha);\n };\n const script = document.createElement(\"script\");\n script.innerHTML = \"\";\n const baseUrl = url || \"https://www.google.com/recaptcha/api.js\";\n script.src = `${baseUrl}?render=${renderMode}&onload=ng2recaptchaloaded${urlParams}`;\n if (nonce) {\n script.nonce = nonce;\n }\n script.async = true;\n script.defer = true;\n document.head.appendChild(script);\n}\nconst loader = { loadScript };\n\nclass RecaptchaLoaderService {\n constructor(\n // eslint-disable-next-line @typescript-eslint/ban-types\n platformId, language, baseUrl, nonce, v3SiteKey) {\n this.platformId = platformId;\n this.language = language;\n this.baseUrl = baseUrl;\n this.nonce = nonce;\n this.v3SiteKey = v3SiteKey;\n this.init();\n this.ready = isPlatformBrowser(this.platformId) ? RecaptchaLoaderService.ready.asObservable() : of();\n }\n /** @internal */\n init() {\n if (RecaptchaLoaderService.ready) {\n return;\n }\n if (isPlatformBrowser(this.platformId)) {\n const subject = new BehaviorSubject(null);\n RecaptchaLoaderService.ready = subject;\n const langParam = this.language ? \"&hl=\" + this.language : \"\";\n const renderMode = this.v3SiteKey || \"explicit\";\n loader.loadScript(renderMode, (grecaptcha) => subject.next(grecaptcha), langParam, this.baseUrl, this.nonce);\n }\n }\n}\n/**\n * @internal\n * @nocollapse\n */\nRecaptchaLoaderService.ready = null;\nRecaptchaLoaderService.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaLoaderService, deps: [{ token: PLATFORM_ID }, { token: RECAPTCHA_LANGUAGE, optional: true }, { token: RECAPTCHA_BASE_URL, optional: true }, { token: RECAPTCHA_NONCE, optional: true }, { token: RECAPTCHA_V3_SITE_KEY, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nRecaptchaLoaderService.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaLoaderService });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaLoaderService, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_LANGUAGE]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_BASE_URL]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_NONCE]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_V3_SITE_KEY]\n }] }]; } });\n\nlet nextId = 0;\nclass RecaptchaComponent {\n constructor(elementRef, loader, zone, settings) {\n this.elementRef = elementRef;\n this.loader = loader;\n this.zone = zone;\n this.id = `ngrecaptcha-${nextId++}`;\n this.errorMode = \"default\";\n this.resolved = new EventEmitter();\n /**\n * @deprecated `(error) output will be removed in the next major version. Use (errored) instead\n */\n // eslint-disable-next-line @angular-eslint/no-output-native\n this.error = new EventEmitter();\n this.errored = new EventEmitter();\n if (settings) {\n this.siteKey = settings.siteKey;\n this.theme = settings.theme;\n this.type = settings.type;\n this.size = settings.size;\n this.badge = settings.badge;\n }\n }\n ngAfterViewInit() {\n this.subscription = this.loader.ready.subscribe((grecaptcha) => {\n if (grecaptcha != null && grecaptcha.render instanceof Function) {\n this.grecaptcha = grecaptcha;\n this.renderRecaptcha();\n }\n });\n }\n ngOnDestroy() {\n // reset the captcha to ensure it does not leave anything behind\n // after the component is no longer needed\n this.grecaptchaReset();\n if (this.subscription) {\n this.subscription.unsubscribe();\n }\n }\n /**\n * Executes the invisible recaptcha.\n * Does nothing if component's size is not set to \"invisible\".\n */\n execute() {\n if (this.size !== \"invisible\") {\n return;\n }\n if (this.widget != null) {\n this.grecaptcha.execute(this.widget);\n }\n else {\n // delay execution of recaptcha until it actually renders\n this.executeRequested = true;\n }\n }\n reset() {\n if (this.widget != null) {\n if (this.grecaptcha.getResponse(this.widget)) {\n // Only emit an event in case if something would actually change.\n // That way we do not trigger \"touching\" of the control if someone does a \"reset\"\n // on a non-resolved captcha.\n this.resolved.emit(null);\n }\n this.grecaptchaReset();\n }\n }\n /**\n * ⚠️ Warning! Use this property at your own risk!\n *\n * While this member is `public`, it is not a part of the component's public API.\n * The semantic versioning guarantees _will not be honored_! Thus, you might find that this property behavior changes in incompatible ways in minor or even patch releases.\n * You are **strongly advised** against using this property.\n * Instead, use more idiomatic ways to get reCAPTCHA value, such as `resolved` EventEmitter, or form-bound methods (ngModel, formControl, and the likes).å\n */\n get __unsafe_widgetValue() {\n return this.widget != null ? this.grecaptcha.getResponse(this.widget) : null;\n }\n /** @internal */\n expired() {\n this.resolved.emit(null);\n }\n /** @internal */\n onError(args) {\n this.error.emit(args);\n this.errored.emit(args);\n }\n /** @internal */\n captchaResponseCallback(response) {\n this.resolved.emit(response);\n }\n /** @internal */\n grecaptchaReset() {\n if (this.widget != null) {\n this.zone.runOutsideAngular(() => this.grecaptcha.reset(this.widget));\n }\n }\n /** @internal */\n renderRecaptcha() {\n // This `any` can be removed after @types/grecaptcha get updated\n const renderOptions = {\n badge: this.badge,\n callback: (response) => {\n this.zone.run(() => this.captchaResponseCallback(response));\n },\n \"expired-callback\": () => {\n this.zone.run(() => this.expired());\n },\n sitekey: this.siteKey,\n size: this.size,\n tabindex: this.tabIndex,\n theme: this.theme,\n type: this.type,\n };\n if (this.errorMode === \"handled\") {\n renderOptions[\"error-callback\"] = (...args) => {\n this.zone.run(() => this.onError(args));\n };\n }\n this.widget = this.grecaptcha.render(this.elementRef.nativeElement, renderOptions);\n if (this.executeRequested === true) {\n this.executeRequested = false;\n this.execute();\n }\n }\n}\nRecaptchaComponent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaComponent, deps: [{ token: i0.ElementRef }, { token: RecaptchaLoaderService }, { token: i0.NgZone }, { token: RECAPTCHA_SETTINGS, optional: true }], target: i0.ɵɵFactoryTarget.Component });\nRecaptchaComponent.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"15.0.0\", type: RecaptchaComponent, selector: \"re-captcha\", inputs: { id: \"id\", siteKey: \"siteKey\", theme: \"theme\", type: \"type\", size: \"size\", tabIndex: \"tabIndex\", badge: \"badge\", errorMode: \"errorMode\" }, outputs: { resolved: \"resolved\", error: \"error\", errored: \"errored\" }, host: { properties: { \"attr.id\": \"this.id\" } }, exportAs: [\"reCaptcha\"], ngImport: i0, template: ``, isInline: true });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaComponent, decorators: [{\n type: Component,\n args: [{\n exportAs: \"reCaptcha\",\n selector: \"re-captcha\",\n template: ``,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: RecaptchaLoaderService }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_SETTINGS]\n }] }]; }, propDecorators: { id: [{\n type: Input\n }, {\n type: HostBinding,\n args: [\"attr.id\"]\n }], siteKey: [{\n type: Input\n }], theme: [{\n type: Input\n }], type: [{\n type: Input\n }], size: [{\n type: Input\n }], tabIndex: [{\n type: Input\n }], badge: [{\n type: Input\n }], errorMode: [{\n type: Input\n }], resolved: [{\n type: Output\n }], error: [{\n type: Output\n }], errored: [{\n type: Output\n }] } });\n\nclass RecaptchaCommonModule {\n}\nRecaptchaCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaCommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nRecaptchaCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaCommonModule, declarations: [RecaptchaComponent], exports: [RecaptchaComponent] });\nRecaptchaCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaCommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaCommonModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [RecaptchaComponent],\n exports: [RecaptchaComponent],\n }]\n }] });\n\nclass RecaptchaModule {\n}\nRecaptchaModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nRecaptchaModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaModule, imports: [RecaptchaCommonModule], exports: [RecaptchaComponent] });\nRecaptchaModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaModule, providers: [RecaptchaLoaderService], imports: [RecaptchaCommonModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [RecaptchaComponent],\n imports: [RecaptchaCommonModule],\n providers: [RecaptchaLoaderService],\n }]\n }] });\n\n/**\n * The main service for working with reCAPTCHA v3 APIs.\n *\n * Use the `execute` method for executing a single action, and\n * `onExecute` observable for listening to all actions at once.\n */\nclass ReCaptchaV3Service {\n constructor(zone, siteKey, \n // eslint-disable-next-line @typescript-eslint/ban-types\n platformId, baseUrl, nonce, language) {\n /** @internal */\n this.onLoadComplete = (grecaptcha) => {\n this.grecaptcha = grecaptcha;\n if (this.actionBacklog && this.actionBacklog.length > 0) {\n this.actionBacklog.forEach(([action, subject]) => this.executeActionWithSubject(action, subject));\n this.actionBacklog = undefined;\n }\n };\n this.zone = zone;\n this.isBrowser = isPlatformBrowser(platformId);\n this.siteKey = siteKey;\n this.nonce = nonce;\n this.language = language;\n this.baseUrl = baseUrl;\n this.init();\n }\n get onExecute() {\n if (!this.onExecuteSubject) {\n this.onExecuteSubject = new Subject();\n this.onExecuteObservable = this.onExecuteSubject.asObservable();\n }\n return this.onExecuteObservable;\n }\n get onExecuteError() {\n if (!this.onExecuteErrorSubject) {\n this.onExecuteErrorSubject = new Subject();\n this.onExecuteErrorObservable = this.onExecuteErrorSubject.asObservable();\n }\n return this.onExecuteErrorObservable;\n }\n /**\n * Executes the provided `action` with reCAPTCHA v3 API.\n * Use the emitted token value for verification purposes on the backend.\n *\n * For more information about reCAPTCHA v3 actions and tokens refer to the official documentation at\n * https://developers.google.com/recaptcha/docs/v3.\n *\n * @param {string} action the action to execute\n * @returns {Observable} an `Observable` that will emit the reCAPTCHA v3 string `token` value whenever ready.\n * The returned `Observable` completes immediately after emitting a value.\n */\n execute(action) {\n const subject = new Subject();\n if (this.isBrowser) {\n if (!this.grecaptcha) {\n if (!this.actionBacklog) {\n this.actionBacklog = [];\n }\n this.actionBacklog.push([action, subject]);\n }\n else {\n this.executeActionWithSubject(action, subject);\n }\n }\n return subject.asObservable();\n }\n /** @internal */\n executeActionWithSubject(action, subject) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const onError = (error) => {\n this.zone.run(() => {\n subject.error(error);\n if (this.onExecuteErrorSubject) {\n // We don't know any better at this point, unfortunately, so have to resort to `any`\n // eslint-disable-next-line @typescript-eslint/no-unsafe-assignment\n this.onExecuteErrorSubject.next({ action, error });\n }\n });\n };\n this.zone.runOutsideAngular(() => {\n try {\n this.grecaptcha.execute(this.siteKey, { action }).then((token) => {\n this.zone.run(() => {\n subject.next(token);\n subject.complete();\n if (this.onExecuteSubject) {\n this.onExecuteSubject.next({ action, token });\n }\n });\n }, onError);\n }\n catch (e) {\n onError(e);\n }\n });\n }\n /** @internal */\n init() {\n if (this.isBrowser) {\n if (\"grecaptcha\" in window) {\n this.grecaptcha = grecaptcha;\n }\n else {\n const langParam = this.language ? \"&hl=\" + this.language : \"\";\n loader.loadScript(this.siteKey, this.onLoadComplete, langParam, this.baseUrl, this.nonce);\n }\n }\n }\n}\nReCaptchaV3Service.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: ReCaptchaV3Service, deps: [{ token: i0.NgZone }, { token: RECAPTCHA_V3_SITE_KEY }, { token: PLATFORM_ID }, { token: RECAPTCHA_BASE_URL, optional: true }, { token: RECAPTCHA_NONCE, optional: true }, { token: RECAPTCHA_LANGUAGE, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nReCaptchaV3Service.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: ReCaptchaV3Service });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: ReCaptchaV3Service, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [RECAPTCHA_V3_SITE_KEY]\n }] }, { type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_BASE_URL]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_NONCE]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [RECAPTCHA_LANGUAGE]\n }] }]; } });\n\nclass RecaptchaV3Module {\n}\nRecaptchaV3Module.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaV3Module, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nRecaptchaV3Module.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaV3Module });\nRecaptchaV3Module.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaV3Module, providers: [ReCaptchaV3Service] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaV3Module, decorators: [{\n type: NgModule,\n args: [{\n providers: [ReCaptchaV3Service],\n }]\n }] });\n\nclass RecaptchaValueAccessorDirective {\n constructor(host) {\n this.host = host;\n this.requiresControllerReset = false;\n }\n writeValue(value) {\n if (!value) {\n this.host.reset();\n }\n else {\n // In this case, it is most likely that a form controller has requested to write a specific value into the component.\n // This isn't really a supported case - reCAPTCHA values are single-use, and, in a sense, readonly.\n // What this means is that the form controller has recaptcha control state of X, while reCAPTCHA itself can't \"restore\"\n // to that state. In order to make form controller aware of this discrepancy, and to fix the said misalignment,\n // we'll be telling the controller to \"reset\" the value back to null.\n if (this.host.__unsafe_widgetValue !== value && Boolean(this.host.__unsafe_widgetValue) === false) {\n this.requiresControllerReset = true;\n }\n }\n }\n registerOnChange(fn) {\n this.onChange = fn;\n if (this.requiresControllerReset) {\n this.requiresControllerReset = false;\n this.onChange(null);\n }\n }\n registerOnTouched(fn) {\n this.onTouched = fn;\n }\n onResolve($event) {\n if (this.onChange) {\n this.onChange($event);\n }\n if (this.onTouched) {\n this.onTouched();\n }\n }\n}\nRecaptchaValueAccessorDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaValueAccessorDirective, deps: [{ token: RecaptchaComponent }], target: i0.ɵɵFactoryTarget.Directive });\nRecaptchaValueAccessorDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.0.0\", type: RecaptchaValueAccessorDirective, selector: \"re-captcha[formControlName],re-captcha[formControl],re-captcha[ngModel]\", host: { listeners: { \"resolved\": \"onResolve($event)\" } }, providers: [\n {\n multi: true,\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => RecaptchaValueAccessorDirective),\n },\n ], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaValueAccessorDirective, decorators: [{\n type: Directive,\n args: [{\n providers: [\n {\n multi: true,\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => RecaptchaValueAccessorDirective),\n },\n ],\n selector: \"re-captcha[formControlName],re-captcha[formControl],re-captcha[ngModel]\",\n }]\n }], ctorParameters: function () { return [{ type: RecaptchaComponent }]; }, propDecorators: { onResolve: [{\n type: HostListener,\n args: [\"resolved\", [\"$event\"]]\n }] } });\n\nclass RecaptchaFormsModule {\n}\nRecaptchaFormsModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaFormsModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nRecaptchaFormsModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaFormsModule, declarations: [RecaptchaValueAccessorDirective], imports: [FormsModule, RecaptchaCommonModule], exports: [RecaptchaValueAccessorDirective] });\nRecaptchaFormsModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaFormsModule, imports: [FormsModule, RecaptchaCommonModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.0.0\", ngImport: i0, type: RecaptchaFormsModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [RecaptchaValueAccessorDirective],\n exports: [RecaptchaValueAccessorDirective],\n imports: [FormsModule, RecaptchaCommonModule],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { RECAPTCHA_BASE_URL, RECAPTCHA_LANGUAGE, RECAPTCHA_NONCE, RECAPTCHA_SETTINGS, RECAPTCHA_V3_SITE_KEY, ReCaptchaV3Service, RecaptchaComponent, RecaptchaFormsModule, RecaptchaLoaderService, RecaptchaModule, RecaptchaV3Module, RecaptchaValueAccessorDirective };\n//# sourceMappingURL=ng-recaptcha.mjs.map\n","","import { Component, OnInit } from '@angular/core';\nimport { AbstractControl, UntypedFormBuilder, UntypedFormGroup, Validators } from '@angular/forms';\nimport { ImportExportService } from '../../dashboard/import-export/import-export.service';\nimport { ActivatedRoute, Router } from '@angular/router';\nimport { GoogleAnalyticsService } from '../../core/services/google-analytics.service';\nimport { UserStore } from '../../core/services/user-store.service';\nimport { CLIENT_VERSION, DEV_VERSION } from '../../../environments/version';\nimport { HttpResponse } from '@angular/common/http';\nimport { filter, map } from 'rxjs/operators';\nimport { FileInfo, FileRestrictions, FileSelectComponent, SelectEvent } from '@progress/kendo-angular-upload';\nimport { TranslateService } from '@ngx-translate/core';\nimport { NotificationService } from '../../core/services/notification.service';\nimport { SUPPORT_MEDIUM_QUERY_SIZE_CONST } from '../../dashboard/communication/shared/constants/mobileQueryParams';\nimport { SUPPORT_ATTACHMENT_RESTRICTIONS } from '../../core/helpers/support-attachment-restrictions';\nimport { ViewChild } from '@angular/core';\nimport { HostListener } from '@angular/core';\n\n@Component({\n selector: 'app-public-contact-us',\n templateUrl: './public-contact-us.component.html',\n styleUrls: ['./../../@pages/layouts/condensed/condensed.component.scss', './public-contact-us.component.scss']\n})\nexport class PublicContactUsComponent implements OnInit {\n @ViewChild('fileSelect', { static: false }) fileSelect: FileSelectComponent;\n @ViewChild('mobileFileSelect', { static: false }) mobileFileSelect: FileSelectComponent;\n\n contactForm: UntypedFormGroup;\n public readonly version = CLIENT_VERSION;\n public readonly devVersion = DEV_VERSION;\n yourRights_URL: string;\n personalDataPolicy_URL: string;\n contactUrl: string;\n year: number = new Date().getFullYear();\n constructor(\n private fb: UntypedFormBuilder,\n public userStore: UserStore,\n private importExportSvc: ImportExportService,\n private router: Router,\n private googleAnalyticsSvc: GoogleAnalyticsService,\n private activatedRoute: ActivatedRoute,\n private translate: TranslateService,\n private notificationService: NotificationService\n ) {\n this.googleAnalyticsSvc.sendTagWithPageName('Contact us');\n const lang = this.activatedRoute.snapshot.params.lang;\n this.setupDocumentLinks(lang ?? 'en');\n this.checkScreenSize();\n }\n\n ngOnInit(): void {\n this.contactForm = this.fb.group({\n lastName: ['', Validators.required],\n firstName: ['', Validators.required],\n email: ['', [Validators.required, Validators.email]],\n mobilePhone: [''],\n companyName: [''],\n emailSubject: ['', Validators.required],\n emailContent: ['', Validators.required],\n recaptcha: [null, Validators.required],\n attachments: [new Array()]\n });\n }\n\n submit(): void {\n if (this.contactForm.valid) {\n const formValue = { ...this.contactForm.getRawValue() };\n this.importExportSvc\n .sendEmailPublic(formValue)\n .pipe(\n filter((event) => event instanceof HttpResponse),\n map((e) => e.body)\n )\n .subscribe((res) => {\n this.contactForm.reset();\n this.router.navigate(['/tpc']);\n });\n }\n {\n this.contactForm.markAllAsTouched();\n }\n }\n\n // GETTERS\n get lastNameControl(): AbstractControl {\n return this.contactForm.get('lastName');\n }\n get firstNameControl(): AbstractControl {\n return this.contactForm.get('firstName');\n }\n get emailControl(): AbstractControl {\n return this.contactForm.get('email');\n }\n get mobilePhoneControl(): AbstractControl {\n return this.contactForm.get('mobilePhone');\n }\n get subjectControl(): AbstractControl {\n return this.contactForm.get('emailSubject');\n }\n get contentControl(): AbstractControl {\n return this.contactForm.get('emailContent');\n }\n get companyNameControl(): AbstractControl {\n return this.contactForm.get('companyName');\n }\n get recaptchaControl(): AbstractControl {\n return this.contactForm.get('recaptcha');\n }\n get attachmentsControl(): AbstractControl {\n return this.contactForm.get('attachments');\n }\n\n setupDocumentLinks = (lang: string): void => {\n switch (lang.toLowerCase()) {\n case 'en':\n this.yourRights_URL = '../../../assets/documents/NewsecOnlineYourRights.pdf';\n this.personalDataPolicy_URL = '../../../assets/documents/PersonalDataPolicy-NewsecOnline.pdf';\n break;\n case 'da':\n this.yourRights_URL = '../../../assets/documents/NewsecOnlineDineRettigheder.pdf';\n this.personalDataPolicy_URL = '../../../assets/documents/PolitikPersonadata-NewsecOnline.pdf';\n break;\n case 'fi':\n this.yourRights_URL = '../../../assets/documents/NewsecOnlineSinunOikeutesi.pdf';\n this.personalDataPolicy_URL = '../../../assets/documents/Tietosuojaperiaatteet-NewsecOnline.pdf';\n break;\n case 'no':\n this.yourRights_URL = '../../../assets/documents/NewsecOnlineDineRettigheter.pdf';\n this.personalDataPolicy_URL = '../../../assets/documents/Personvernerklaering-NewsecOnline.pdf';\n break;\n case 'sv':\n this.yourRights_URL = '../../../assets/documents/NewsecOnlineDinaRattigheter.pdf';\n this.personalDataPolicy_URL = '../../../assets/documents/Personuppgiftspolicy-NewsecOnline.pdf';\n break;\n default:\n this.yourRights_URL = '../../../assets/documents/NewsecOnlineYourRights.pdf';\n this.personalDataPolicy_URL = '../../../assets/documents/PersonalDataPolicy-NewsecOnline.pdf';\n break;\n }\n };\n\n // #region attachments\n\n restrictions: FileRestrictions = SUPPORT_ATTACHMENT_RESTRICTIONS;\n currentTotalSize = 0;\n\n public onFileSelect(event: SelectEvent): void {\n // Calculate the total size of all new files\n let newFilesTotalSize = 0;\n event.files.forEach((fileInfo: FileInfo) => {\n newFilesTotalSize += fileInfo.size;\n });\n\n // Check if adding new files exceeds the total size limit\n const totalSize = this.currentTotalSize + newFilesTotalSize;\n\n if (totalSize > this.restrictions.maxFileSize) {\n this.translate\n .get('maxFileSize')\n .toPromise()\n .then((m) => {\n this.notificationService.error(`${m}`);\n });\n event.preventDefault();\n return;\n }\n\n event.files.forEach((fileInfo: FileInfo) => {\n if (this.contactForm.get('attachments')?.value?.filter((f) => f.name === fileInfo.name).length > 0) {\n this.translate\n .get('AttachmentAddedError')\n .toPromise()\n .then((m) => {\n this.notificationService.error(`${m}: ${fileInfo.name}`);\n });\n event.preventDefault(); // Prevent adding duplicate files\n } else if (fileInfo.validationErrors) {\n this.translate\n .get('invalidFileExtensionSupport')\n .toPromise()\n .then((m) => {\n this.notificationService.error(m);\n });\n event.preventDefault();\n } else {\n // Add the file to the form control\n var currentFiles: Array = this.contactForm.get('attachments')?.value || [];\n currentFiles.push(fileInfo.rawFile);\n this.contactForm.get('attachments').patchValue(currentFiles);\n\n // Update the current total size\n this.currentTotalSize += newFilesTotalSize;\n }\n });\n\n if (!this.contactForm.get('attachments').value) {\n this.contactForm.get('attachments')?.setValue([]);\n }\n }\n\n onFileListChange(event: Array) {\n if (event) {\n const namesArray = event.map((file) => file.name);\n const filteredArray = event.filter((ev, i) => namesArray.indexOf(ev.name) == i);\n this.contactForm.get('attachments').setValue(filteredArray);\n }\n }\n\n public removeFile(fileName: string, event: Event): void {\n event.stopPropagation();\n const currentAttachments = this.contactForm.get('attachments')?.value || [];\n const updatedAttachments = currentAttachments.filter((file) => file.name !== fileName);\n this.contactForm.get('attachments').setValue(updatedAttachments);\n\n // Update the current total size\n this.currentTotalSize = updatedAttachments.reduce((total, file) => total + file.size, 0);\n }\n\n fileSelectButtonClick() {\n this.fileSelect.fileSelectButton.nativeElement.click();\n }\n\n triggerFileSelect() {\n this.mobileFileSelect.fileSelectButton.nativeElement.click();\n }\n //#endregion\n\n //#region Mobile View\n showMobile = false;\n\n @HostListener('window:resize', ['$event'])\n onResize() {\n this.checkScreenSize();\n }\n\n private checkScreenSize() {\n this.showMobile = window.innerWidth < SUPPORT_MEDIUM_QUERY_SIZE_CONST;\n }\n //#endregion\n\n onCancel(){\n this.router.navigate(['/']);\n }\n}\n","import { Routes } from '@angular/router';\nimport { LandingPageComponent } from './landing-page/landing-page.component';\nimport { NotFoundPageComponent } from './not-found-page/not-found-page.component';\nimport { CookieDeclarationComponent } from './cookie-declaration/cookie-declaration.component';\nimport { ForbiddenPageComponent } from './forbidden-page/forbidden-page.component';\nimport { ThankYouPageComponent } from './thank-you-page/thank-you-page.component';\nimport { LogoutPageComponent } from './logout-page/logout-page.component';\nimport { SessionGuard } from './core/guards/session.guard';\nimport { NoAccessComponent } from './no-access/no-access.component';\nimport { PublicContactUsComponent } from './public/public-contact-us/public-contact-us.component';\nimport { MsalGuard } from '@azure/msal-angular';\n\nconst lang = navigator.language.split('-')[0] ? navigator.language.split('-')[0] : 'en';\n\nexport const AppRoutes: Routes = [\n { path: '', redirectTo: `${lang}/home`, pathMatch: 'full' },\n {\n path: 'home',\n // loadChildren: './dashboard/dashboard.module#DashboardModule',\n loadChildren: () => import('./dashboard/dashboard.module').then((m) => m.DashboardModule),\n canActivate: [SessionGuard, MsalGuard]\n },\n {\n path: 'code',\n // loadChildren: './dashboard/dashboard.module#DashboardModule',\n loadChildren: () => import('./dashboard/dashboard.module').then((m) => m.DashboardModule),\n canActivate: [SessionGuard, MsalGuard]\n },\n {\n path: `:lang/home`,\n component: LandingPageComponent,\n data: {\n language: lang,\n gaTitle: 'Landing page'\n }\n },\n {\n path: 'cookies',\n component: CookieDeclarationComponent,\n data: {\n gaTitle: 'Cookie declaration'\n }\n },\n {\n path: 'forbidden',\n component: ForbiddenPageComponent,\n data: {\n gaTitle: 'Forbidden page'\n }\n },\n {\n path: 'tpc',\n component: ThankYouPageComponent,\n data: {\n language: lang,\n gaTitle: 'Thank you page'\n }\n },\n {\n path: 'error',\n component: LogoutPageComponent,\n data: {\n gaTitle: 'Error page'\n }\n },\n {\n path: 'logout',\n component: LogoutPageComponent,\n data: {\n gaTitle: 'Logout page'\n }\n },\n {\n path: 'no-access',\n component: NoAccessComponent,\n data: {\n gaTitle: 'No access page'\n }\n },\n {\n path: ':lang/contact',\n component: PublicContactUsComponent,\n data: {\n language: lang,\n gaTitle: 'Contact us'\n }\n },\n {\n path: '**',\n component: NotFoundPageComponent,\n data: {\n language: lang,\n gaTitle: 'Not found page'\n }\n }\n];\n","\n
\n \n
\n","import { ChangeDetectorRef, Component } from '@angular/core';\nimport { Title } from '@angular/platform-browser';\nimport { ActivatedRoute, NavigationEnd, Router } from '@angular/router';\nimport { TranslateService } from '@ngx-translate/core';\nimport { Observable, of } from 'rxjs';\nimport { filter, map, switchMap, tap } from 'rxjs/operators';\nimport { AuthServiceWrapper } from './core/services/auth.service';\nimport { BreadcrumbService } from './core/services/breadcrumb.service';\nimport { LoaderService } from './core/services/loader.service';\n\nconst ROUTE_TITLE_DICTIONARY = {\n '/home/services': ''\n};\n@Component({\n selector: 'app-root',\n templateUrl: './app.component.html',\n styleUrls: ['./app.component.scss']\n})\nexport class AppComponent {\n titleBase = 'Newsec Online';\n spinner$ = this.loaderSvc.active.pipe(\n tap((e) => {\n this.cdRef.detectChanges();\n })\n );\n constructor(\n private router: Router,\n private translateSvc: TranslateService,\n private titleSvc: Title,\n private route: ActivatedRoute,\n private auth: AuthServiceWrapper,\n private bCrumb: BreadcrumbService,\n public loaderSvc: LoaderService,\n private cdRef: ChangeDetectorRef\n ) {\n this.router.events\n .pipe(\n filter((e) => e instanceof NavigationEnd),\n map((t) => {\n const title = this.findTitleInRoute(this.route);\n return title;\n }),\n switchMap((t: string) => {\n if (t) {\n return this.translateSvc.get(t);\n } else {\n return of('');\n }\n })\n )\n .subscribe((suffix) => {\n const title = `${this.titleBase} ${suffix ? '-' : ''} ${suffix}`;\n this.titleSvc.setTitle(title);\n });\n window.addEventListener('storage', (ev: StorageEvent) => {\n if (ev && ev.key === 'ns-logout' && ev.newValue === '1') {\n window.removeEventListener('storage', () => {\n this.auth.logout();\n });\n }\n });\n }\n\n findTitleInRoute(route: ActivatedRoute): string {\n if ('title' in route.snapshot.data) {\n return route.snapshot.data['title'];\n }\n return route.firstChild ? this.findTitleInRoute(route.firstChild) : '';\n }\n}\n","import { Injectable } from '@angular/core';\nimport { Observable, Subject } from 'rxjs';\n\n@Injectable()\nexport class pagesToggleService {\n // Search Toggle\n private _searchToggle = new Subject();\n searchToggle = this._searchToggle.asObservable();\n\n // Quickview Toggle\n private _quickViewToggle = new Subject();\n quickViewToggle = this._quickViewToggle.asObservable();\n\n // Sidebar Toggle - Mobile\n private _sideBarToggle = >new Subject();\n sideBarToggle = this._sideBarToggle.asObservable();\n\n // Secondary Sidebar Toggle - Mobile\n private _secondarySideBarToggle = >new Subject();\n secondarySideBarToggle = this._secondarySideBarToggle.asObservable();\n\n // Horizontal Menu Toggle - Mobile\n private _mobileHorizontaMenu = >new Subject();\n mobileHorizontaMenu = this._mobileHorizontaMenu.asObservable();\n\n // Menu Pin Toggle\n private _menuPinToggle = new Subject();\n menuPinToggle = this._menuPinToggle.asObservable();\n\n // Menu Pin Toggle\n private _menuDrawer = >new Subject();\n menuDrawer = this._menuDrawer.asObservable();\n\n // Page Wrapper Class\n private _pageContainerClass = >new Subject();\n pageContainerClass = this._pageContainerClass.asObservable();\n\n // Page Content Class\n private _contentClass = >new Subject();\n contentClass = this._contentClass.asObservable();\n\n // Header Class\n private _headerClass = >new Subject();\n headerClass = this._headerClass.asObservable();\n\n // Body Layout Class\n private _bodyLayoutClass = >new Subject();\n bodyLayoutClass = this._bodyLayoutClass.asObservable();\n\n // App Layout\n private _layout = >new Subject();\n Applayout = this._layout.asObservable();\n\n // Footer Visiblity\n private _footer = >new Subject();\n Footer = this._footer.asObservable();\n\n // Page Container Hover Event - Used for sidebar\n private _pageContainerHover = >new Subject();\n pageContainerHover = this._pageContainerHover.asObservable();\n\n setContent(className: string) {\n this._contentClass.next(className);\n }\n\n setPageContainer(className: string) {\n this._pageContainerClass.next(className);\n }\n\n setHeaderClass(className: string) {\n this._headerClass.next(className);\n }\n\n setBodyLayoutClass(className: string) {\n this._bodyLayoutClass.next(className);\n }\n\n removeBodyLayoutClass(className: string) {\n this._bodyLayoutClass.next(className);\n }\n\n changeLayout(className: string) {\n this._layout.next(className);\n }\n\n toggleSearch(toggle: boolean) {\n this._searchToggle.next({ text: toggle });\n }\n\n toggleMenuPin(toggle: boolean) {\n this._menuPinToggle.next({ text: toggle });\n }\n\n toggleMenuDrawer() {\n this._menuDrawer.next();\n }\n\n toggleQuickView() {\n this._quickViewToggle.next();\n }\n\n toggleMobileSideBar(toggle: boolean) {\n this._sideBarToggle.next(toggle);\n }\n\n toggleSecondarySideBar(toggle) {\n this._secondarySideBarToggle.next(toggle);\n }\n\n toggleMobileHorizontalMenu(toggle) {\n this._mobileHorizontaMenu.next(toggle);\n }\n\n toggleFooter(toggle: boolean) {\n this._footer.next(toggle);\n }\n\n triggerPageContainerHover(toggle: boolean) {\n this._pageContainerHover.next(toggle);\n }\n}\n","import { HttpErrorResponse, HttpEvent, HttpHandler, HttpInterceptor, HttpRequest } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { TranslateService } from '@ngx-translate/core';\nimport { Observable, throwError } from 'rxjs';\nimport { catchError, take } from 'rxjs/operators';\nimport { NotificationService } from './notification.service';\nimport { IErrorCode } from '../interfaces/errorCode.interface';\n\n@Injectable({\n providedIn: 'root'\n})\nexport class HttpErrorInterceptor implements HttpInterceptor {\n constructor(private notificationSvc: NotificationService, private translateSvc: TranslateService) {}\n\n excludedRoutes = ['/get-roles'];\n\n intercept(req: HttpRequest, next: HttpHandler): Observable> {\n return next.handle(req).pipe(\n catchError((error: HttpErrorResponse) => {\n if (this.isUrlExcluded(req.url)) return;\n this.parseError(error)\n .pipe(take(1))\n .subscribe((result) => {\n this.notificationSvc.error(result);\n });\n\n return throwError(error);\n })\n );\n }\n\n private parseError(httpResponseError: HttpErrorResponse): Observable {\n const error = httpResponseError.error;\n let errorCode = 'Error - 0';\n if (error && error.error) {\n errorCode = `Error - ${error.error}`;\n } else if (error && error.errors[0] && error.errors[0].errorCode) {\n errorCode = `Error - ${error.errors[0].errorCode}`;\n }\n return this.translateSvc.get(errorCode);\n }\n\n isUrlExcluded(requestUrl: string): boolean {\n return !!this.excludedRoutes.find((excludedUrl: string) => requestUrl.includes(excludedUrl));\n }\n}\n","import { Inject, Injectable } from '@angular/core';\nimport { HttpEvent, HttpInterceptor, HttpHandler, HttpRequest } from '@angular/common/http';\nimport { Observable } from 'rxjs';\nimport { TranslateService } from '@ngx-translate/core';\n\n@Injectable({\n providedIn: 'root'\n})\nexport class LanguageInterceptor implements HttpInterceptor {\n constructor(private translateSvc: TranslateService, @Inject('USERS_BROWSER_LANG') public browserLang: string) {}\n\n intercept(req: HttpRequest, next: HttpHandler): Observable> {\n const lang = this.translateSvc?.currentLang || this.translateSvc?.defaultLang || this.browserLang;\n const headers = req.headers.set('language', lang);\n const authReq = req.clone({ headers });\n return next.handle(authReq);\n }\n}\n","import {\n HttpInterceptor,\n HttpHandler,\n HttpRequest,\n HttpEvent,\n HttpResponse,\n HttpErrorResponse\n} from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { BehaviorSubject, Observable } from 'rxjs';\nimport { filter, finalize, tap } from 'rxjs/operators';\nimport { LoaderService } from './loader.service';\n\n@Injectable({\n providedIn: 'root'\n})\nexport class SpinnerInterceptor implements HttpInterceptor {\n private requestedRoutes = [];\n\n constructor(private loaderSvc: LoaderService) {}\n\n excludedRotues = [\n '/Home/get-homepage-config/',\n '/Home/save-homepage-config/',\n '/Home/get-client-data/',\n 'User/check-user-azure/',\n 'user/get-my-language',\n 'User/get-my-language',\n 'Home/get-user-info',\n 'User/get-roles',\n 'Home/get-session-lock-timeout',\n 'InfoMessageDelivery/get-unread-count',\n 'Home/get-user-clients',\n 'User/update-active-client',\n 'LocalizedResource/get-all',\n 'Communication/threadId',\n 'Communication/task-id',\n 'Communication/get-profile-picture/',\n 'Communication/get-profile-picture',\n 'Communication/send-email',\n 'Communication/update-last-message-read'\n ];\n\n intercept(req: HttpRequest, next: HttpHandler): Observable> {\n if (!this.isUrlExcluded(req.url)) {\n this.requestedRoutes.push(req.url);\n //console.log('spinSVC - POSTAVLJAM SPINNER NA ' + this.displaySpinner);\n this.loaderSvc.activeLoader = this.displaySpinner;\n }\n\n return next.handle(req).pipe(\n filter((e) => e instanceof HttpResponse),\n finalize(() => {\n const url = req.url;\n if (this.isUrlExcluded(url)) return;\n this.requestedRoutes = this.requestedRoutes.filter((route) => req.url !== route);\n //console.log('spinSVC - POSTAVLJAM SPINNER NA ' + this.displaySpinner);\n this.loaderSvc.activeLoader = this.displaySpinner;\n })\n );\n }\n get displaySpinner(): boolean {\n return !!this.requestedRoutes.length;\n }\n\n isUrlExcluded(requestUrl: string): boolean {\n return !!this.excludedRotues.find((excludedUrl: string) => requestUrl.includes(excludedUrl));\n }\n}\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Enumeration of operations that are instrumented by have their performance measured by the PerformanceClient.\r\n *\r\n * @export\r\n * @enum {number}\r\n */\r\nvar PerformanceEvents;\r\n(function (PerformanceEvents) {\r\n /**\r\n * acquireTokenByCode API (msal-browser and msal-node).\r\n * Used to acquire tokens by trading an authorization code against the token endpoint.\r\n */\r\n PerformanceEvents[\"AcquireTokenByCode\"] = \"acquireTokenByCode\";\r\n /**\r\n * acquireTokenByRefreshToken API (msal-browser and msal-node).\r\n * Used to renew an access token using a refresh token against the token endpoint.\r\n */\r\n PerformanceEvents[\"AcquireTokenByRefreshToken\"] = \"acquireTokenByRefreshToken\";\r\n /**\r\n * acquireTokenSilent API (msal-browser and msal-node).\r\n * Used to silently acquire a new access token (from the cache or the network).\r\n */\r\n PerformanceEvents[\"AcquireTokenSilent\"] = \"acquireTokenSilent\";\r\n /**\r\n * acquireTokenSilentAsync (msal-browser).\r\n * Internal API for acquireTokenSilent.\r\n */\r\n PerformanceEvents[\"AcquireTokenSilentAsync\"] = \"acquireTokenSilentAsync\";\r\n /**\r\n * acquireTokenPopup (msal-browser).\r\n * Used to acquire a new access token interactively through pop ups\r\n */\r\n PerformanceEvents[\"AcquireTokenPopup\"] = \"acquireTokenPopup\";\r\n /**\r\n * getPublicKeyThumbprint API in CryptoOpts class (msal-browser).\r\n * Used to generate a public/private keypair and generate a public key thumbprint for pop requests.\r\n */\r\n PerformanceEvents[\"CryptoOptsGetPublicKeyThumbprint\"] = \"cryptoOptsGetPublicKeyThumbprint\";\r\n /**\r\n * signJwt API in CryptoOpts class (msal-browser).\r\n * Used to signed a pop token.\r\n */\r\n PerformanceEvents[\"CryptoOptsSignJwt\"] = \"cryptoOptsSignJwt\";\r\n /**\r\n * acquireToken API in the SilentCacheClient class (msal-browser).\r\n * Used to read access tokens from the cache.\r\n */\r\n PerformanceEvents[\"SilentCacheClientAcquireToken\"] = \"silentCacheClientAcquireToken\";\r\n /**\r\n * acquireToken API in the SilentIframeClient class (msal-browser).\r\n * Used to acquire a new set of tokens from the authorize endpoint in a hidden iframe.\r\n */\r\n PerformanceEvents[\"SilentIframeClientAcquireToken\"] = \"silentIframeClientAcquireToken\";\r\n /**\r\n * acquireToken API in SilentRereshClient (msal-browser).\r\n * Used to acquire a new set of tokens from the token endpoint using a refresh token.\r\n */\r\n PerformanceEvents[\"SilentRefreshClientAcquireToken\"] = \"silentRefreshClientAcquireToken\";\r\n /**\r\n * ssoSilent API (msal-browser).\r\n * Used to silently acquire an authorization code and set of tokens using a hidden iframe.\r\n */\r\n PerformanceEvents[\"SsoSilent\"] = \"ssoSilent\";\r\n /**\r\n * getDiscoveredAuthority API in StandardInteractionClient class (msal-browser).\r\n * Used to load authority metadata for a request.\r\n */\r\n PerformanceEvents[\"StandardInteractionClientGetDiscoveredAuthority\"] = \"standardInteractionClientGetDiscoveredAuthority\";\r\n /**\r\n * acquireToken APIs in msal-browser.\r\n * Used to make an /authorize endpoint call with native brokering enabled.\r\n */\r\n PerformanceEvents[\"FetchAccountIdWithNativeBroker\"] = \"fetchAccountIdWithNativeBroker\";\r\n /**\r\n * acquireToken API in NativeInteractionClient class (msal-browser).\r\n * Used to acquire a token from Native component when native brokering is enabled.\r\n */\r\n PerformanceEvents[\"NativeInteractionClientAcquireToken\"] = \"nativeInteractionClientAcquireToken\";\r\n /**\r\n * Time spent creating default headers for requests to token endpoint\r\n */\r\n PerformanceEvents[\"BaseClientCreateTokenRequestHeaders\"] = \"baseClientCreateTokenRequestHeaders\";\r\n /**\r\n * Used to measure the time taken for completing embedded-broker handshake (PW-Broker).\r\n */\r\n PerformanceEvents[\"BrokerHandhshake\"] = \"brokerHandshake\";\r\n /**\r\n * acquireTokenByRefreshToken API in BrokerClientApplication (PW-Broker) .\r\n */\r\n PerformanceEvents[\"AcquireTokenByRefreshTokenInBroker\"] = \"acquireTokenByRefreshTokenInBroker\";\r\n /**\r\n * Time taken for token acquisition by broker\r\n */\r\n PerformanceEvents[\"AcquireTokenByBroker\"] = \"acquireTokenByBroker\";\r\n /**\r\n * Time spent on the network for refresh token acquisition\r\n */\r\n PerformanceEvents[\"RefreshTokenClientExecuteTokenRequest\"] = \"refreshTokenClientExecuteTokenRequest\";\r\n /**\r\n * Time taken for acquiring refresh token , records RT size\r\n */\r\n PerformanceEvents[\"RefreshTokenClientAcquireToken\"] = \"refreshTokenClientAcquireToken\";\r\n /**\r\n * Time taken for acquiring cached refresh token\r\n */\r\n PerformanceEvents[\"RefreshTokenClientAcquireTokenWithCachedRefreshToken\"] = \"refreshTokenClientAcquireTokenWithCachedRefreshToken\";\r\n /**\r\n * acquireTokenByRefreshToken API in RefreshTokenClient (msal-common).\r\n */\r\n PerformanceEvents[\"RefreshTokenClientAcquireTokenByRefreshToken\"] = \"refreshTokenClientAcquireTokenByRefreshToken\";\r\n /**\r\n * Helper function to create token request body in RefreshTokenClient (msal-common).\r\n */\r\n PerformanceEvents[\"RefreshTokenClientCreateTokenRequestBody\"] = \"refreshTokenClientCreateTokenRequestBody\";\r\n /**\r\n * acquireTokenFromCache (msal-browser).\r\n * Internal API for acquiring token from cache\r\n */\r\n PerformanceEvents[\"AcquireTokenFromCache\"] = \"acquireTokenFromCache\";\r\n /**\r\n * acquireTokenBySilentIframe (msal-browser).\r\n * Internal API for acquiring token by silent Iframe\r\n */\r\n PerformanceEvents[\"AcquireTokenBySilentIframe\"] = \"acquireTokenBySilentIframe\";\r\n /**\r\n * Internal API for initializing base request in BaseInteractionClient (msal-browser)\r\n */\r\n PerformanceEvents[\"InitializeBaseRequest\"] = \"initializeBaseRequest\";\r\n /**\r\n * Internal API for initializing silent request in SilentCacheClient (msal-browser)\r\n */\r\n PerformanceEvents[\"InitializeSilentRequest\"] = \"initializeSilentRequest\";\r\n PerformanceEvents[\"InitializeClientApplication\"] = \"initializeClientApplication\";\r\n /**\r\n * Helper function in SilentIframeClient class (msal-browser).\r\n */\r\n PerformanceEvents[\"SilentIframeClientTokenHelper\"] = \"silentIframeClientTokenHelper\";\r\n /**\r\n * SilentHandler\r\n */\r\n PerformanceEvents[\"SilentHandlerInitiateAuthRequest\"] = \"silentHandlerInitiateAuthRequest\";\r\n PerformanceEvents[\"SilentHandlerMonitorIframeForHash\"] = \"silentHandlerMonitorIframeForHash\";\r\n PerformanceEvents[\"SilentHandlerLoadFrame\"] = \"silentHandlerLoadFrame\";\r\n /**\r\n * Helper functions in StandardInteractionClient class (msal-browser)\r\n */\r\n PerformanceEvents[\"StandardInteractionClientCreateAuthCodeClient\"] = \"standardInteractionClientCreateAuthCodeClient\";\r\n PerformanceEvents[\"StandardInteractionClientGetClientConfiguration\"] = \"standardInteractionClientGetClientConfiguration\";\r\n PerformanceEvents[\"StandardInteractionClientInitializeAuthorizationRequest\"] = \"standardInteractionClientInitializeAuthorizationRequest\";\r\n PerformanceEvents[\"StandardInteractionClientInitializeAuthorizationCodeRequest\"] = \"standardInteractionClientInitializeAuthorizationCodeRequest\";\r\n /**\r\n * getAuthCodeUrl API (msal-browser and msal-node).\r\n */\r\n PerformanceEvents[\"GetAuthCodeUrl\"] = \"getAuthCodeUrl\";\r\n /**\r\n * Functions from InteractionHandler (msal-browser)\r\n */\r\n PerformanceEvents[\"HandleCodeResponseFromServer\"] = \"handleCodeResponseFromServer\";\r\n PerformanceEvents[\"HandleCodeResponseFromHash\"] = \"handleCodeResponseFromHash\";\r\n PerformanceEvents[\"UpdateTokenEndpointAuthority\"] = \"updateTokenEndpointAuthority\";\r\n /**\r\n * APIs in Authorization Code Client (msal-common)\r\n */\r\n PerformanceEvents[\"AuthClientAcquireToken\"] = \"authClientAcquireToken\";\r\n PerformanceEvents[\"AuthClientExecuteTokenRequest\"] = \"authClientExecuteTokenRequest\";\r\n PerformanceEvents[\"AuthClientCreateTokenRequestBody\"] = \"authClientCreateTokenRequestBody\";\r\n PerformanceEvents[\"AuthClientCreateQueryString\"] = \"authClientCreateQueryString\";\r\n /**\r\n * Generate functions in PopTokenGenerator (msal-common)\r\n */\r\n PerformanceEvents[\"PopTokenGenerateCnf\"] = \"popTokenGenerateCnf\";\r\n PerformanceEvents[\"PopTokenGenerateKid\"] = \"popTokenGenerateKid\";\r\n /**\r\n * handleServerTokenResponse API in ResponseHandler (msal-common)\r\n */\r\n PerformanceEvents[\"HandleServerTokenResponse\"] = \"handleServerTokenResponse\";\r\n /**\r\n * Authority functions\r\n */\r\n PerformanceEvents[\"AuthorityFactoryCreateDiscoveredInstance\"] = \"authorityFactoryCreateDiscoveredInstance\";\r\n PerformanceEvents[\"AuthorityResolveEndpointsAsync\"] = \"authorityResolveEndpointsAsync\";\r\n PerformanceEvents[\"AuthorityGetCloudDiscoveryMetadataFromNetwork\"] = \"authorityGetCloudDiscoveryMetadataFromNetwork\";\r\n PerformanceEvents[\"AuthorityUpdateCloudDiscoveryMetadata\"] = \"authorityUpdateCloudDiscoveryMetadata\";\r\n PerformanceEvents[\"AuthorityGetEndpointMetadataFromNetwork\"] = \"authorityGetEndpointMetadataFromNetwork\";\r\n PerformanceEvents[\"AuthorityUpdateEndpointMetadata\"] = \"authorityUpdateEndpointMetadata\";\r\n PerformanceEvents[\"AuthorityUpdateMetadataWithRegionalInformation\"] = \"authorityUpdateMetadataWithRegionalInformation\";\r\n /**\r\n * Region Discovery functions\r\n */\r\n PerformanceEvents[\"RegionDiscoveryDetectRegion\"] = \"regionDiscoveryDetectRegion\";\r\n PerformanceEvents[\"RegionDiscoveryGetRegionFromIMDS\"] = \"regionDiscoveryGetRegionFromIMDS\";\r\n PerformanceEvents[\"RegionDiscoveryGetCurrentVersion\"] = \"regionDiscoveryGetCurrentVersion\";\r\n PerformanceEvents[\"AcquireTokenByCodeAsync\"] = \"acquireTokenByCodeAsync\";\r\n PerformanceEvents[\"GetEndpointMetadataFromNetwork\"] = \"getEndpointMetadataFromNetwork\";\r\n PerformanceEvents[\"GetCloudDiscoveryMetadataFromNetworkMeasurement\"] = \"getCloudDiscoveryMetadataFromNetworkMeasurement\";\r\n PerformanceEvents[\"HandleRedirectPromiseMeasurement\"] = \"handleRedirectPromiseMeasurement\";\r\n PerformanceEvents[\"UpdateCloudDiscoveryMetadataMeasurement\"] = \"updateCloudDiscoveryMetadataMeasurement\";\r\n PerformanceEvents[\"UsernamePasswordClientAcquireToken\"] = \"usernamePasswordClientAcquireToken\";\r\n PerformanceEvents[\"NativeMessageHandlerHandshake\"] = \"nativeMessageHandlerHandshake\";\r\n /**\r\n * Cache operations\r\n */\r\n PerformanceEvents[\"ClearTokensAndKeysWithClaims\"] = \"clearTokensAndKeysWithClaims\";\r\n})(PerformanceEvents || (PerformanceEvents = {}));\r\n/**\r\n * State of the performance event.\r\n *\r\n * @export\r\n * @enum {number}\r\n */\r\nvar PerformanceEventStatus;\r\n(function (PerformanceEventStatus) {\r\n PerformanceEventStatus[PerformanceEventStatus[\"NotStarted\"] = 0] = \"NotStarted\";\r\n PerformanceEventStatus[PerformanceEventStatus[\"InProgress\"] = 1] = \"InProgress\";\r\n PerformanceEventStatus[PerformanceEventStatus[\"Completed\"] = 2] = \"Completed\";\r\n})(PerformanceEventStatus || (PerformanceEventStatus = {}));\r\nvar IntFields = new Set([\r\n \"accessTokenSize\",\r\n \"durationMs\",\r\n \"idTokenSize\",\r\n \"matsSilentStatus\",\r\n \"matsHttpStatus\",\r\n \"refreshTokenSize\",\r\n \"queuedTimeMs\",\r\n \"startTimeMs\",\r\n \"status\",\r\n]);\n\nexport { IntFields, PerformanceEventStatus, PerformanceEvents };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../_virtual/_tslib.js';\nimport { AuthError } from './AuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Error thrown when there is an error with the server code, for example, unavailability.\r\n */\r\nvar ServerError = /** @class */ (function (_super) {\r\n __extends(ServerError, _super);\r\n function ServerError(errorCode, errorMessage, subError) {\r\n var _this = _super.call(this, errorCode, errorMessage, subError) || this;\r\n _this.name = \"ServerError\";\r\n Object.setPrototypeOf(_this, ServerError.prototype);\r\n return _this;\r\n }\r\n return ServerError;\r\n}(AuthError));\n\nexport { ServerError };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../_virtual/_tslib.js';\nimport { Constants } from '../utils/Constants.js';\nimport { AuthError } from './AuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * InteractionRequiredServerErrorMessage contains string constants used by error codes and messages returned by the server indicating interaction is required\r\n */\r\nvar InteractionRequiredServerErrorMessage = [\r\n \"interaction_required\",\r\n \"consent_required\",\r\n \"login_required\"\r\n];\r\nvar InteractionRequiredAuthSubErrorMessage = [\r\n \"message_only\",\r\n \"additional_action\",\r\n \"basic_action\",\r\n \"user_password_expired\",\r\n \"consent_required\"\r\n];\r\n/**\r\n * Interaction required errors defined by the SDK\r\n */\r\nvar InteractionRequiredAuthErrorMessage = {\r\n noTokensFoundError: {\r\n code: \"no_tokens_found\",\r\n desc: \"No refresh token found in the cache. Please sign-in.\"\r\n },\r\n native_account_unavailable: {\r\n code: \"native_account_unavailable\",\r\n desc: \"The requested account is not available in the native broker. It may have been deleted or logged out. Please sign-in again using an interactive API.\"\r\n }\r\n};\r\n/**\r\n * Error thrown when user interaction is required.\r\n */\r\nvar InteractionRequiredAuthError = /** @class */ (function (_super) {\r\n __extends(InteractionRequiredAuthError, _super);\r\n function InteractionRequiredAuthError(errorCode, errorMessage, subError, timestamp, traceId, correlationId, claims) {\r\n var _this = _super.call(this, errorCode, errorMessage, subError) || this;\r\n Object.setPrototypeOf(_this, InteractionRequiredAuthError.prototype);\r\n _this.timestamp = timestamp || Constants.EMPTY_STRING;\r\n _this.traceId = traceId || Constants.EMPTY_STRING;\r\n _this.correlationId = correlationId || Constants.EMPTY_STRING;\r\n _this.claims = claims || Constants.EMPTY_STRING;\r\n _this.name = \"InteractionRequiredAuthError\";\r\n return _this;\r\n }\r\n /**\r\n * Helper function used to determine if an error thrown by the server requires interaction to resolve\r\n * @param errorCode\r\n * @param errorString\r\n * @param subError\r\n */\r\n InteractionRequiredAuthError.isInteractionRequiredError = function (errorCode, errorString, subError) {\r\n var isInteractionRequiredErrorCode = !!errorCode && InteractionRequiredServerErrorMessage.indexOf(errorCode) > -1;\r\n var isInteractionRequiredSubError = !!subError && InteractionRequiredAuthSubErrorMessage.indexOf(subError) > -1;\r\n var isInteractionRequiredErrorDesc = !!errorString && InteractionRequiredServerErrorMessage.some(function (irErrorCode) {\r\n return errorString.indexOf(irErrorCode) > -1;\r\n });\r\n return isInteractionRequiredErrorCode || isInteractionRequiredErrorDesc || isInteractionRequiredSubError;\r\n };\r\n /**\r\n * Creates an error thrown when the authorization code required for a token request is null or empty.\r\n */\r\n InteractionRequiredAuthError.createNoTokensFoundError = function () {\r\n return new InteractionRequiredAuthError(InteractionRequiredAuthErrorMessage.noTokensFoundError.code, InteractionRequiredAuthErrorMessage.noTokensFoundError.desc);\r\n };\r\n /**\r\n * Creates an error thrown when the native broker returns ACCOUNT_UNAVAILABLE status, indicating that the account was removed and interactive sign-in is required\r\n * @returns\r\n */\r\n InteractionRequiredAuthError.createNativeAccountUnavailableError = function () {\r\n return new InteractionRequiredAuthError(InteractionRequiredAuthErrorMessage.native_account_unavailable.code, InteractionRequiredAuthErrorMessage.native_account_unavailable.desc);\r\n };\r\n return InteractionRequiredAuthError;\r\n}(AuthError));\n\nexport { InteractionRequiredAuthError, InteractionRequiredAuthErrorMessage, InteractionRequiredAuthSubErrorMessage, InteractionRequiredServerErrorMessage };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { Separators, Constants } from '../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Function to build a client info object from server clientInfo string\r\n * @param rawClientInfo\r\n * @param crypto\r\n */\r\nfunction buildClientInfo(rawClientInfo, crypto) {\r\n if (StringUtils.isEmpty(rawClientInfo)) {\r\n throw ClientAuthError.createClientInfoEmptyError();\r\n }\r\n try {\r\n var decodedClientInfo = crypto.base64Decode(rawClientInfo);\r\n return JSON.parse(decodedClientInfo);\r\n }\r\n catch (e) {\r\n throw ClientAuthError.createClientInfoDecodingError(e.message);\r\n }\r\n}\r\n/**\r\n * Function to build a client info object from cached homeAccountId string\r\n * @param homeAccountId\r\n */\r\nfunction buildClientInfoFromHomeAccountId(homeAccountId) {\r\n if (StringUtils.isEmpty(homeAccountId)) {\r\n throw ClientAuthError.createClientInfoDecodingError(\"Home account ID was empty.\");\r\n }\r\n var clientInfoParts = homeAccountId.split(Separators.CLIENT_INFO_SEPARATOR, 2);\r\n return {\r\n uid: clientInfoParts[0],\r\n utid: clientInfoParts.length < 2 ? Constants.EMPTY_STRING : clientInfoParts[1]\r\n };\r\n}\n\nexport { buildClientInfo, buildClientInfoFromHomeAccountId };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Authority types supported by MSAL.\r\n */\r\nvar AuthorityType;\r\n(function (AuthorityType) {\r\n AuthorityType[AuthorityType[\"Default\"] = 0] = \"Default\";\r\n AuthorityType[AuthorityType[\"Adfs\"] = 1] = \"Adfs\";\r\n AuthorityType[AuthorityType[\"Dsts\"] = 2] = \"Dsts\";\r\n AuthorityType[AuthorityType[\"Ciam\"] = 3] = \"Ciam\";\r\n})(AuthorityType || (AuthorityType = {}));\n\nexport { AuthorityType };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Protocol modes supported by MSAL.\r\n */\r\nvar ProtocolMode;\r\n(function (ProtocolMode) {\r\n ProtocolMode[\"AAD\"] = \"AAD\";\r\n ProtocolMode[\"OIDC\"] = \"OIDC\";\r\n})(ProtocolMode || (ProtocolMode = {}));\n\nexport { ProtocolMode };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { Separators, CacheAccountType, Constants } from '../../utils/Constants.js';\nimport { buildClientInfo } from '../../account/ClientInfo.js';\nimport { StringUtils } from '../../utils/StringUtils.js';\nimport { ClientAuthError } from '../../error/ClientAuthError.js';\nimport { AuthorityType } from '../../authority/AuthorityType.js';\nimport { ProtocolMode } from '../../authority/ProtocolMode.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Type that defines required and optional parameters for an Account field (based on universal cache schema implemented by all MSALs).\r\n *\r\n * Key : Value Schema\r\n *\r\n * Key: --\r\n *\r\n * Value Schema:\r\n * {\r\n * homeAccountId: home account identifier for the auth scheme,\r\n * environment: entity that issued the token, represented as a full host\r\n * realm: Full tenant or organizational identifier that the account belongs to\r\n * localAccountId: Original tenant-specific accountID, usually used for legacy cases\r\n * username: primary username that represents the user, usually corresponds to preferred_username in the v2 endpt\r\n * authorityType: Accounts authority type as a string\r\n * clientInfo: Full base64 encoded client info received from ESTS\r\n * name: Full name for the account, including given name and family name\r\n * lastModificationTime: last time this entity was modified in the cache\r\n * lastModificationApp:\r\n * idTokenClaims: Object containing claims parsed from ID token\r\n * nativeAccountId: Account identifier on the native device\r\n * }\r\n */\r\nvar AccountEntity = /** @class */ (function () {\r\n function AccountEntity() {\r\n }\r\n /**\r\n * Generate Account Id key component as per the schema: -\r\n */\r\n AccountEntity.prototype.generateAccountId = function () {\r\n var accountId = [this.homeAccountId, this.environment];\r\n return accountId.join(Separators.CACHE_KEY_SEPARATOR).toLowerCase();\r\n };\r\n /**\r\n * Generate Account Cache Key as per the schema: --\r\n */\r\n AccountEntity.prototype.generateAccountKey = function () {\r\n return AccountEntity.generateAccountCacheKey({\r\n homeAccountId: this.homeAccountId,\r\n environment: this.environment,\r\n tenantId: this.realm,\r\n username: this.username,\r\n localAccountId: this.localAccountId\r\n });\r\n };\r\n /**\r\n * Returns the AccountInfo interface for this account.\r\n */\r\n AccountEntity.prototype.getAccountInfo = function () {\r\n return {\r\n homeAccountId: this.homeAccountId,\r\n environment: this.environment,\r\n tenantId: this.realm,\r\n username: this.username,\r\n localAccountId: this.localAccountId,\r\n name: this.name,\r\n idTokenClaims: this.idTokenClaims,\r\n nativeAccountId: this.nativeAccountId,\r\n authorityType: this.authorityType\r\n };\r\n };\r\n /**\r\n * Generates account key from interface\r\n * @param accountInterface\r\n */\r\n AccountEntity.generateAccountCacheKey = function (accountInterface) {\r\n var accountKey = [\r\n accountInterface.homeAccountId,\r\n accountInterface.environment || Constants.EMPTY_STRING,\r\n accountInterface.tenantId || Constants.EMPTY_STRING,\r\n ];\r\n return accountKey.join(Separators.CACHE_KEY_SEPARATOR).toLowerCase();\r\n };\r\n /**\r\n * Build Account cache from account properties.\r\n * @param accountDetails\r\n * @param authority\r\n */\r\n AccountEntity.createAccount = function (accountDetails, authority) {\r\n var account = new AccountEntity();\r\n if (authority.authorityType === AuthorityType.Adfs) {\r\n account.authorityType = CacheAccountType.ADFS_ACCOUNT_TYPE;\r\n }\r\n else if (authority.protocolMode === ProtocolMode.AAD) {\r\n account.authorityType = CacheAccountType.MSSTS_ACCOUNT_TYPE;\r\n }\r\n else {\r\n account.authorityType = CacheAccountType.GENERIC_ACCOUNT_TYPE;\r\n }\r\n account.clientInfo = accountDetails.clientInfo;\r\n account.homeAccountId = accountDetails.homeAccountId;\r\n account.nativeAccountId = accountDetails.nativeAccountId;\r\n var env = accountDetails.environment || (authority && authority.getPreferredCache());\r\n if (!env) {\r\n throw ClientAuthError.createInvalidCacheEnvironmentError();\r\n }\r\n account.environment = env;\r\n // non AAD scenarios can have empty realm\r\n account.realm = accountDetails.idTokenClaims.tid || Constants.EMPTY_STRING;\r\n account.idTokenClaims = accountDetails.idTokenClaims;\r\n // How do you account for MSA CID here?\r\n account.localAccountId = accountDetails.idTokenClaims.oid || accountDetails.idTokenClaims.sub || Constants.EMPTY_STRING;\r\n /*\r\n * In B2C scenarios the emails claim is used instead of preferred_username and it is an array.\r\n * In most cases it will contain a single email. This field should not be relied upon if a custom\r\n * policy is configured to return more than 1 email.\r\n */\r\n if (account.authorityType === CacheAccountType.MSSTS_ACCOUNT_TYPE) {\r\n var preferredUsername = accountDetails.idTokenClaims.preferred_username;\r\n var email = (accountDetails.idTokenClaims.emails) ? accountDetails.idTokenClaims.emails[0] : null;\r\n account.username = preferredUsername || email || \"\";\r\n }\r\n else {\r\n account.username = accountDetails.idTokenClaims.upn || \"\";\r\n }\r\n account.name = accountDetails.idTokenClaims.name;\r\n account.cloudGraphHostName = accountDetails.cloudGraphHostName;\r\n account.msGraphHost = accountDetails.msGraphHost;\r\n return account;\r\n };\r\n /**\r\n * Creates an account object from AccountInfo\r\n * @param accountInfo\r\n * @param cloudGraphHostName\r\n * @param msGraphHost\r\n * @returns AccountEntity\r\n */\r\n AccountEntity.createFromAccountInfo = function (accountInfo, cloudGraphHostName, msGraphHost) {\r\n var account = new AccountEntity();\r\n account.authorityType =\r\n accountInfo.authorityType || CacheAccountType.GENERIC_ACCOUNT_TYPE;\r\n account.homeAccountId = accountInfo.homeAccountId;\r\n account.localAccountId = accountInfo.localAccountId;\r\n account.nativeAccountId = accountInfo.nativeAccountId;\r\n account.realm = accountInfo.tenantId;\r\n account.environment = accountInfo.environment;\r\n account.username = accountInfo.username;\r\n account.name = accountInfo.name;\r\n account.idTokenClaims = accountInfo.idTokenClaims;\r\n account.cloudGraphHostName = cloudGraphHostName;\r\n account.msGraphHost = msGraphHost;\r\n return account;\r\n };\r\n /**\r\n * Generate HomeAccountId from server response\r\n * @param serverClientInfo\r\n * @param authType\r\n */\r\n AccountEntity.generateHomeAccountId = function (serverClientInfo, authType, logger, cryptoObj, idTokenClaims) {\r\n var accountId = (idTokenClaims === null || idTokenClaims === void 0 ? void 0 : idTokenClaims.sub) ? idTokenClaims.sub : Constants.EMPTY_STRING;\r\n // since ADFS does not have tid and does not set client_info\r\n if (authType === AuthorityType.Adfs || authType === AuthorityType.Dsts) {\r\n return accountId;\r\n }\r\n // for cases where there is clientInfo\r\n if (serverClientInfo) {\r\n try {\r\n var clientInfo = buildClientInfo(serverClientInfo, cryptoObj);\r\n if (!StringUtils.isEmpty(clientInfo.uid) && !StringUtils.isEmpty(clientInfo.utid)) {\r\n return \"\" + clientInfo.uid + Separators.CLIENT_INFO_SEPARATOR + clientInfo.utid;\r\n }\r\n }\r\n catch (e) { }\r\n }\r\n // default to \"sub\" claim\r\n logger.verbose(\"No client info in response\");\r\n return accountId;\r\n };\r\n /**\r\n * Validates an entity: checks for all expected params\r\n * @param entity\r\n */\r\n AccountEntity.isAccountEntity = function (entity) {\r\n if (!entity) {\r\n return false;\r\n }\r\n return (entity.hasOwnProperty(\"homeAccountId\") &&\r\n entity.hasOwnProperty(\"environment\") &&\r\n entity.hasOwnProperty(\"realm\") &&\r\n entity.hasOwnProperty(\"localAccountId\") &&\r\n entity.hasOwnProperty(\"username\") &&\r\n entity.hasOwnProperty(\"authorityType\"));\r\n };\r\n /**\r\n * Helper function to determine whether 2 accountInfo objects represent the same account\r\n * @param accountA\r\n * @param accountB\r\n * @param compareClaims - If set to true idTokenClaims will also be compared to determine account equality\r\n */\r\n AccountEntity.accountInfoIsEqual = function (accountA, accountB, compareClaims) {\r\n if (!accountA || !accountB) {\r\n return false;\r\n }\r\n var claimsMatch = true; // default to true so as to not fail comparison below if compareClaims: false\r\n if (compareClaims) {\r\n var accountAClaims = (accountA.idTokenClaims || {});\r\n var accountBClaims = (accountB.idTokenClaims || {});\r\n // issued at timestamp and nonce are expected to change each time a new id token is acquired\r\n claimsMatch = (accountAClaims.iat === accountBClaims.iat) &&\r\n (accountAClaims.nonce === accountBClaims.nonce);\r\n }\r\n return (accountA.homeAccountId === accountB.homeAccountId) &&\r\n (accountA.localAccountId === accountB.localAccountId) &&\r\n (accountA.username === accountB.username) &&\r\n (accountA.tenantId === accountB.tenantId) &&\r\n (accountA.environment === accountB.environment) &&\r\n (accountA.nativeAccountId === accountB.nativeAccountId) &&\r\n claimsMatch;\r\n };\r\n return AccountEntity;\r\n}());\n\nexport { AccountEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../_virtual/_tslib.js';\nimport { AuthError } from './AuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * ClientAuthErrorMessage class containing string constants used by error codes and messages.\r\n */\r\nvar JoseHeaderErrorMessage = {\r\n missingKidError: {\r\n code: \"missing_kid_error\",\r\n desc: \"The JOSE Header for the requested JWT, JWS or JWK object requires a keyId to be configured as the 'kid' header claim. No 'kid' value was provided.\"\r\n },\r\n missingAlgError: {\r\n code: \"missing_alg_error\",\r\n desc: \"The JOSE Header for the requested JWT, JWS or JWK object requires an algorithm to be specified as the 'alg' header claim. No 'alg' value was provided.\"\r\n },\r\n};\r\n/**\r\n * Error thrown when there is an error in the client code running on the browser.\r\n */\r\nvar JoseHeaderError = /** @class */ (function (_super) {\r\n __extends(JoseHeaderError, _super);\r\n function JoseHeaderError(errorCode, errorMessage) {\r\n var _this = _super.call(this, errorCode, errorMessage) || this;\r\n _this.name = \"JoseHeaderError\";\r\n Object.setPrototypeOf(_this, JoseHeaderError.prototype);\r\n return _this;\r\n }\r\n /**\r\n * Creates an error thrown when keyId isn't set on JOSE header.\r\n */\r\n JoseHeaderError.createMissingKidError = function () {\r\n return new JoseHeaderError(JoseHeaderErrorMessage.missingKidError.code, JoseHeaderErrorMessage.missingKidError.desc);\r\n };\r\n /**\r\n * Creates an error thrown when algorithm isn't set on JOSE header.\r\n */\r\n JoseHeaderError.createMissingAlgError = function () {\r\n return new JoseHeaderError(JoseHeaderErrorMessage.missingAlgError.code, JoseHeaderErrorMessage.missingAlgError.desc);\r\n };\r\n return JoseHeaderError;\r\n}(AuthError));\n\nexport { JoseHeaderError, JoseHeaderErrorMessage };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { JoseHeaderError } from '../error/JoseHeaderError.js';\nimport { JsonTypes } from '../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar JoseHeader = /** @class */ (function () {\r\n function JoseHeader(options) {\r\n this.typ = options.typ;\r\n this.alg = options.alg;\r\n this.kid = options.kid;\r\n }\r\n /**\r\n * Builds SignedHttpRequest formatted JOSE Header from the\r\n * JOSE Header options provided or previously set on the object and returns\r\n * the stringified header object.\r\n * Throws if keyId or algorithm aren't provided since they are required for Access Token Binding.\r\n * @param shrHeaderOptions\r\n * @returns\r\n */\r\n JoseHeader.getShrHeaderString = function (shrHeaderOptions) {\r\n // KeyID is required on the SHR header\r\n if (!shrHeaderOptions.kid) {\r\n throw JoseHeaderError.createMissingKidError();\r\n }\r\n // Alg is required on the SHR header\r\n if (!shrHeaderOptions.alg) {\r\n throw JoseHeaderError.createMissingAlgError();\r\n }\r\n var shrHeader = new JoseHeader({\r\n // Access Token PoP headers must have type pop, but the type header can be overriden for special cases\r\n typ: shrHeaderOptions.typ || JsonTypes.Pop,\r\n kid: shrHeaderOptions.kid,\r\n alg: shrHeaderOptions.alg\r\n });\r\n return JSON.stringify(shrHeader);\r\n };\r\n return JoseHeader;\r\n}());\n\nexport { JoseHeader };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Utility class for math specific functions in browser.\r\n */\r\nvar MathUtils = /** @class */ (function () {\r\n function MathUtils() {\r\n }\r\n /**\r\n * Decimal to Hex\r\n *\r\n * @param num\r\n */\r\n MathUtils.decimalToHex = function (num) {\r\n var hex = num.toString(16);\r\n while (hex.length < 2) {\r\n hex = \"0\" + hex;\r\n }\r\n return hex;\r\n };\r\n return MathUtils;\r\n}());\n\nexport { MathUtils };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { Constants } from '@azure/msal-common';\nimport { MathUtils } from '../utils/MathUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar GuidGenerator = /** @class */ (function () {\r\n function GuidGenerator(cryptoObj) {\r\n this.cryptoObj = cryptoObj;\r\n }\r\n /*\r\n * RFC4122: The version 4 UUID is meant for generating UUIDs from truly-random or\r\n * pseudo-random numbers.\r\n * The algorithm is as follows:\r\n * Set the two most significant bits (bits 6 and 7) of the\r\n * clock_seq_hi_and_reserved to zero and one, respectively.\r\n * Set the four most significant bits (bits 12 through 15) of the\r\n * time_hi_and_version field to the 4-bit version number from\r\n * Section 4.1.3. Version4\r\n * Set all the other bits to randomly (or pseudo-randomly) chosen\r\n * values.\r\n * UUID = time-low \"-\" time-mid \"-\"time-high-and-version \"-\"clock-seq-reserved and low(2hexOctet)\"-\" node\r\n * time-low = 4hexOctet\r\n * time-mid = 2hexOctet\r\n * time-high-and-version = 2hexOctet\r\n * clock-seq-and-reserved = hexOctet:\r\n * clock-seq-low = hexOctet\r\n * node = 6hexOctet\r\n * Format: xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx\r\n * y could be 1000, 1001, 1010, 1011 since most significant two bits needs to be 10\r\n * y values are 8, 9, A, B\r\n */\r\n GuidGenerator.prototype.generateGuid = function () {\r\n try {\r\n var buffer = new Uint8Array(16);\r\n this.cryptoObj.getRandomValues(buffer);\r\n // buffer[6] and buffer[7] represents the time_hi_and_version field. We will set the four most significant bits (4 through 7) of buffer[6] to represent decimal number 4 (UUID version number).\r\n buffer[6] |= 0x40; // buffer[6] | 01000000 will set the 6 bit to 1.\r\n buffer[6] &= 0x4f; // buffer[6] & 01001111 will set the 4, 5, and 7 bit to 0 such that bits 4-7 == 0100 = \"4\".\r\n // buffer[8] represents the clock_seq_hi_and_reserved field. We will set the two most significant bits (6 and 7) of the clock_seq_hi_and_reserved to zero and one, respectively.\r\n buffer[8] |= 0x80; // buffer[8] | 10000000 will set the 7 bit to 1.\r\n buffer[8] &= 0xbf; // buffer[8] & 10111111 will set the 6 bit to 0.\r\n return MathUtils.decimalToHex(buffer[0]) + MathUtils.decimalToHex(buffer[1])\r\n + MathUtils.decimalToHex(buffer[2]) + MathUtils.decimalToHex(buffer[3])\r\n + \"-\" + MathUtils.decimalToHex(buffer[4]) + MathUtils.decimalToHex(buffer[5])\r\n + \"-\" + MathUtils.decimalToHex(buffer[6]) + MathUtils.decimalToHex(buffer[7])\r\n + \"-\" + MathUtils.decimalToHex(buffer[8]) + MathUtils.decimalToHex(buffer[9])\r\n + \"-\" + MathUtils.decimalToHex(buffer[10]) + MathUtils.decimalToHex(buffer[11])\r\n + MathUtils.decimalToHex(buffer[12]) + MathUtils.decimalToHex(buffer[13])\r\n + MathUtils.decimalToHex(buffer[14]) + MathUtils.decimalToHex(buffer[15]);\r\n }\r\n catch (err) {\r\n var guidHolder = \"xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx\";\r\n var hex = \"0123456789abcdef\";\r\n var r = 0;\r\n var guidResponse = Constants.EMPTY_STRING;\r\n for (var i = 0; i < 36; i++) {\r\n if (guidHolder[i] !== \"-\" && guidHolder[i] !== \"4\") {\r\n // each x and y needs to be random\r\n r = Math.random() * 16 | 0;\r\n }\r\n if (guidHolder[i] === \"x\") {\r\n guidResponse += hex[r];\r\n }\r\n else if (guidHolder[i] === \"y\") {\r\n // clock-seq-and-reserved first hex is filtered and remaining hex values are random\r\n r &= 0x3; // bit and with 0011 to set pos 2 to zero ?0??\r\n r |= 0x8; // set pos 3 to 1 as 1???\r\n guidResponse += hex[r];\r\n }\r\n else {\r\n guidResponse += guidHolder[i];\r\n }\r\n }\r\n return guidResponse;\r\n }\r\n };\r\n /**\r\n * verifies if a string is GUID\r\n * @param guid\r\n */\r\n GuidGenerator.prototype.isGuid = function (guid) {\r\n var regexGuid = /^[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}$/i;\r\n return regexGuid.test(guid);\r\n };\r\n return GuidGenerator;\r\n}());\n\nexport { GuidGenerator };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { Constants } from '@azure/msal-common';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Utility functions for strings in a browser. See here for implementation details:\r\n * https://developer.mozilla.org/en-US/docs/Web/API/WindowBase64/Base64_encoding_and_decoding#Solution_2_%E2%80%93_JavaScript's_UTF-16_%3E_UTF-8_%3E_base64\r\n */\r\nvar BrowserStringUtils = /** @class */ (function () {\r\n function BrowserStringUtils() {\r\n }\r\n /**\r\n * Converts string to Uint8Array\r\n * @param sDOMStr\r\n */\r\n BrowserStringUtils.stringToUtf8Arr = function (sDOMStr) {\r\n var nChr;\r\n var nArrLen = 0;\r\n var nStrLen = sDOMStr.length;\r\n /* mapping... */\r\n for (var nMapIdx = 0; nMapIdx < nStrLen; nMapIdx++) {\r\n nChr = sDOMStr.charCodeAt(nMapIdx);\r\n nArrLen += nChr < 0x80 ? 1 : nChr < 0x800 ? 2 : nChr < 0x10000 ? 3 : nChr < 0x200000 ? 4 : nChr < 0x4000000 ? 5 : 6;\r\n }\r\n var aBytes = new Uint8Array(nArrLen);\r\n /* transcription... */\r\n for (var nIdx = 0, nChrIdx = 0; nIdx < nArrLen; nChrIdx++) {\r\n nChr = sDOMStr.charCodeAt(nChrIdx);\r\n if (nChr < 128) {\r\n /* one byte */\r\n aBytes[nIdx++] = nChr;\r\n }\r\n else if (nChr < 0x800) {\r\n /* two bytes */\r\n aBytes[nIdx++] = 192 + (nChr >>> 6);\r\n aBytes[nIdx++] = 128 + (nChr & 63);\r\n }\r\n else if (nChr < 0x10000) {\r\n /* three bytes */\r\n aBytes[nIdx++] = 224 + (nChr >>> 12);\r\n aBytes[nIdx++] = 128 + (nChr >>> 6 & 63);\r\n aBytes[nIdx++] = 128 + (nChr & 63);\r\n }\r\n else if (nChr < 0x200000) {\r\n /* four bytes */\r\n aBytes[nIdx++] = 240 + (nChr >>> 18);\r\n aBytes[nIdx++] = 128 + (nChr >>> 12 & 63);\r\n aBytes[nIdx++] = 128 + (nChr >>> 6 & 63);\r\n aBytes[nIdx++] = 128 + (nChr & 63);\r\n }\r\n else if (nChr < 0x4000000) {\r\n /* five bytes */\r\n aBytes[nIdx++] = 248 + (nChr >>> 24);\r\n aBytes[nIdx++] = 128 + (nChr >>> 18 & 63);\r\n aBytes[nIdx++] = 128 + (nChr >>> 12 & 63);\r\n aBytes[nIdx++] = 128 + (nChr >>> 6 & 63);\r\n aBytes[nIdx++] = 128 + (nChr & 63);\r\n }\r\n else /* if (nChr <= 0x7fffffff) */ {\r\n /* six bytes */\r\n aBytes[nIdx++] = 252 + (nChr >>> 30);\r\n aBytes[nIdx++] = 128 + (nChr >>> 24 & 63);\r\n aBytes[nIdx++] = 128 + (nChr >>> 18 & 63);\r\n aBytes[nIdx++] = 128 + (nChr >>> 12 & 63);\r\n aBytes[nIdx++] = 128 + (nChr >>> 6 & 63);\r\n aBytes[nIdx++] = 128 + (nChr & 63);\r\n }\r\n }\r\n return aBytes;\r\n };\r\n /**\r\n * Converst string to ArrayBuffer\r\n * @param dataString\r\n */\r\n BrowserStringUtils.stringToArrayBuffer = function (dataString) {\r\n var data = new ArrayBuffer(dataString.length);\r\n var dataView = new Uint8Array(data);\r\n for (var i = 0; i < dataString.length; i++) {\r\n dataView[i] = dataString.charCodeAt(i);\r\n }\r\n return data;\r\n };\r\n /**\r\n * Converts Uint8Array to a string\r\n * @param aBytes\r\n */\r\n BrowserStringUtils.utf8ArrToString = function (aBytes) {\r\n var sView = Constants.EMPTY_STRING;\r\n for (var nPart = void 0, nLen = aBytes.length, nIdx = 0; nIdx < nLen; nIdx++) {\r\n nPart = aBytes[nIdx];\r\n sView += String.fromCharCode(nPart > 251 && nPart < 254 && nIdx + 5 < nLen ? /* six bytes */\r\n /* (nPart - 252 << 30) may be not so safe in ECMAScript! So...: */\r\n (nPart - 252) * 1073741824 + (aBytes[++nIdx] - 128 << 24) + (aBytes[++nIdx] - 128 << 18) + (aBytes[++nIdx] - 128 << 12) + (aBytes[++nIdx] - 128 << 6) + aBytes[++nIdx] - 128\r\n : nPart > 247 && nPart < 252 && nIdx + 4 < nLen ? /* five bytes */\r\n (nPart - 248 << 24) + (aBytes[++nIdx] - 128 << 18) + (aBytes[++nIdx] - 128 << 12) + (aBytes[++nIdx] - 128 << 6) + aBytes[++nIdx] - 128\r\n : nPart > 239 && nPart < 248 && nIdx + 3 < nLen ? /* four bytes */\r\n (nPart - 240 << 18) + (aBytes[++nIdx] - 128 << 12) + (aBytes[++nIdx] - 128 << 6) + aBytes[++nIdx] - 128\r\n : nPart > 223 && nPart < 240 && nIdx + 2 < nLen ? /* three bytes */\r\n (nPart - 224 << 12) + (aBytes[++nIdx] - 128 << 6) + aBytes[++nIdx] - 128\r\n : nPart > 191 && nPart < 224 && nIdx + 1 < nLen ? /* two bytes */\r\n (nPart - 192 << 6) + aBytes[++nIdx] - 128\r\n : /* nPart < 127 ? */ /* one byte */\r\n nPart);\r\n }\r\n return sView;\r\n };\r\n /**\r\n * Returns stringified jwk.\r\n * @param jwk\r\n */\r\n BrowserStringUtils.getSortedObjectString = function (obj) {\r\n return JSON.stringify(obj, Object.keys(obj).sort());\r\n };\r\n return BrowserStringUtils;\r\n}());\n\nexport { BrowserStringUtils };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { Constants } from '@azure/msal-common';\nimport { BrowserStringUtils } from '../utils/BrowserStringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Class which exposes APIs to encode plaintext to base64 encoded string. See here for implementation details:\r\n * https://developer.mozilla.org/en-US/docs/Web/API/WindowBase64/Base64_encoding_and_decoding#Solution_2_%E2%80%93_JavaScript's_UTF-16_%3E_UTF-8_%3E_base64\r\n */\r\nvar Base64Encode = /** @class */ (function () {\r\n function Base64Encode() {\r\n }\r\n /**\r\n * Returns URL Safe b64 encoded string from a plaintext string.\r\n * @param input\r\n */\r\n Base64Encode.prototype.urlEncode = function (input) {\r\n return encodeURIComponent(this.encode(input)\r\n .replace(/=/g, Constants.EMPTY_STRING)\r\n .replace(/\\+/g, \"-\")\r\n .replace(/\\//g, \"_\"));\r\n };\r\n /**\r\n * Returns URL Safe b64 encoded string from an int8Array.\r\n * @param inputArr\r\n */\r\n Base64Encode.prototype.urlEncodeArr = function (inputArr) {\r\n return this.base64EncArr(inputArr)\r\n .replace(/=/g, Constants.EMPTY_STRING)\r\n .replace(/\\+/g, \"-\")\r\n .replace(/\\//g, \"_\");\r\n };\r\n /**\r\n * Returns b64 encoded string from plaintext string.\r\n * @param input\r\n */\r\n Base64Encode.prototype.encode = function (input) {\r\n var inputUtf8Arr = BrowserStringUtils.stringToUtf8Arr(input);\r\n return this.base64EncArr(inputUtf8Arr);\r\n };\r\n /**\r\n * Base64 encode byte array\r\n * @param aBytes\r\n */\r\n Base64Encode.prototype.base64EncArr = function (aBytes) {\r\n var eqLen = (3 - (aBytes.length % 3)) % 3;\r\n var sB64Enc = Constants.EMPTY_STRING;\r\n for (var nMod3 = void 0, nLen = aBytes.length, nUint24 = 0, nIdx = 0; nIdx < nLen; nIdx++) {\r\n nMod3 = nIdx % 3;\r\n /* Uncomment the following line in order to split the output in lines 76-character long: */\r\n /*\r\n *if (nIdx > 0 && (nIdx * 4 / 3) % 76 === 0) { sB64Enc += \"\\r\\n\"; }\r\n */\r\n nUint24 |= aBytes[nIdx] << (16 >>> nMod3 & 24);\r\n if (nMod3 === 2 || aBytes.length - nIdx === 1) {\r\n sB64Enc += String.fromCharCode(this.uint6ToB64(nUint24 >>> 18 & 63), this.uint6ToB64(nUint24 >>> 12 & 63), this.uint6ToB64(nUint24 >>> 6 & 63), this.uint6ToB64(nUint24 & 63));\r\n nUint24 = 0;\r\n }\r\n }\r\n return eqLen === 0 ? sB64Enc : sB64Enc.substring(0, sB64Enc.length - eqLen) + (eqLen === 1 ? \"=\" : \"==\");\r\n };\r\n /**\r\n * Base64 string to array encoding helper\r\n * @param nUint6\r\n */\r\n Base64Encode.prototype.uint6ToB64 = function (nUint6) {\r\n return nUint6 < 26 ?\r\n nUint6 + 65\r\n : nUint6 < 52 ?\r\n nUint6 + 71\r\n : nUint6 < 62 ?\r\n nUint6 - 4\r\n : nUint6 === 62 ?\r\n 43\r\n : nUint6 === 63 ?\r\n 47\r\n :\r\n 65;\r\n };\r\n return Base64Encode;\r\n}());\n\nexport { Base64Encode };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { Constants } from '@azure/msal-common';\nimport { BrowserStringUtils } from '../utils/BrowserStringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Class which exposes APIs to decode base64 strings to plaintext. See here for implementation details:\r\n * https://developer.mozilla.org/en-US/docs/Web/API/WindowBase64/Base64_encoding_and_decoding#Solution_2_%E2%80%93_JavaScript's_UTF-16_%3E_UTF-8_%3E_base64\r\n */\r\nvar Base64Decode = /** @class */ (function () {\r\n function Base64Decode() {\r\n }\r\n /**\r\n * Returns a URL-safe plaintext decoded string from b64 encoded input.\r\n * @param input\r\n */\r\n Base64Decode.prototype.decode = function (input) {\r\n var encodedString = input.replace(/-/g, \"+\").replace(/_/g, \"/\");\r\n switch (encodedString.length % 4) {\r\n case 0:\r\n break;\r\n case 2:\r\n encodedString += \"==\";\r\n break;\r\n case 3:\r\n encodedString += \"=\";\r\n break;\r\n default:\r\n throw new Error(\"Invalid base64 string\");\r\n }\r\n var inputUtf8Arr = this.base64DecToArr(encodedString);\r\n return BrowserStringUtils.utf8ArrToString(inputUtf8Arr);\r\n };\r\n /**\r\n * Decodes base64 into Uint8Array\r\n * @param base64String\r\n * @param nBlockSize\r\n */\r\n Base64Decode.prototype.base64DecToArr = function (base64String, nBlockSize) {\r\n var sB64Enc = base64String.replace(/[^A-Za-z0-9\\+\\/]/g, Constants.EMPTY_STRING);\r\n var nInLen = sB64Enc.length;\r\n var nOutLen = nBlockSize ? Math.ceil((nInLen * 3 + 1 >>> 2) / nBlockSize) * nBlockSize : nInLen * 3 + 1 >>> 2;\r\n var aBytes = new Uint8Array(nOutLen);\r\n for (var nMod3 = void 0, nMod4 = void 0, nUint24 = 0, nOutIdx = 0, nInIdx = 0; nInIdx < nInLen; nInIdx++) {\r\n nMod4 = nInIdx & 3;\r\n nUint24 |= this.b64ToUint6(sB64Enc.charCodeAt(nInIdx)) << 18 - 6 * nMod4;\r\n if (nMod4 === 3 || nInLen - nInIdx === 1) {\r\n for (nMod3 = 0; nMod3 < 3 && nOutIdx < nOutLen; nMod3++, nOutIdx++) {\r\n aBytes[nOutIdx] = nUint24 >>> (16 >>> nMod3 & 24) & 255;\r\n }\r\n nUint24 = 0;\r\n }\r\n }\r\n return aBytes;\r\n };\r\n /**\r\n * Base64 string to array decoding helper\r\n * @param charNum\r\n */\r\n Base64Decode.prototype.b64ToUint6 = function (charNum) {\r\n return charNum > 64 && charNum < 91 ?\r\n charNum - 65\r\n : charNum > 96 && charNum < 123 ?\r\n charNum - 71\r\n : charNum > 47 && charNum < 58 ?\r\n charNum + 4\r\n : charNum === 43 ?\r\n 62\r\n : charNum === 47 ?\r\n 63\r\n :\r\n 0;\r\n };\r\n return Base64Decode;\r\n}());\n\nexport { Base64Decode };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { Base64Encode } from '../encode/Base64Encode.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n// Constant byte array length\r\nvar RANDOM_BYTE_ARR_LENGTH = 32;\r\n/**\r\n * Class which exposes APIs to generate PKCE codes and code verifiers.\r\n */\r\nvar PkceGenerator = /** @class */ (function () {\r\n function PkceGenerator(cryptoObj) {\r\n this.base64Encode = new Base64Encode();\r\n this.cryptoObj = cryptoObj;\r\n }\r\n /**\r\n * Generates PKCE Codes. See the RFC for more information: https://tools.ietf.org/html/rfc7636\r\n */\r\n PkceGenerator.prototype.generateCodes = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var codeVerifier, codeChallenge;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n codeVerifier = this.generateCodeVerifier();\r\n return [4 /*yield*/, this.generateCodeChallengeFromVerifier(codeVerifier)];\r\n case 1:\r\n codeChallenge = _a.sent();\r\n return [2 /*return*/, {\r\n verifier: codeVerifier,\r\n challenge: codeChallenge\r\n }];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Generates a random 32 byte buffer and returns the base64\r\n * encoded string to be used as a PKCE Code Verifier\r\n */\r\n PkceGenerator.prototype.generateCodeVerifier = function () {\r\n try {\r\n // Generate random values as utf-8\r\n var buffer = new Uint8Array(RANDOM_BYTE_ARR_LENGTH);\r\n this.cryptoObj.getRandomValues(buffer);\r\n // encode verifier as base64\r\n var pkceCodeVerifierB64 = this.base64Encode.urlEncodeArr(buffer);\r\n return pkceCodeVerifierB64;\r\n }\r\n catch (e) {\r\n throw BrowserAuthError.createPkceNotGeneratedError(e);\r\n }\r\n };\r\n /**\r\n * Creates a base64 encoded PKCE Code Challenge string from the\r\n * hash created from the PKCE Code Verifier supplied\r\n */\r\n PkceGenerator.prototype.generateCodeChallengeFromVerifier = function (pkceCodeVerifier) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var pkceHashedCodeVerifier, e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n _a.trys.push([0, 2, , 3]);\r\n return [4 /*yield*/, this.cryptoObj.sha256Digest(pkceCodeVerifier)];\r\n case 1:\r\n pkceHashedCodeVerifier = _a.sent();\r\n // encode hash as base64\r\n return [2 /*return*/, this.base64Encode.urlEncodeArr(new Uint8Array(pkceHashedCodeVerifier))];\r\n case 2:\r\n e_1 = _a.sent();\r\n throw BrowserAuthError.createPkceNotGeneratedError(e_1);\r\n case 3: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n return PkceGenerator;\r\n}());\n\nexport { PkceGenerator };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { KEY_FORMAT_JWK } from '../utils/BrowserConstants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar ModernBrowserCrypto = /** @class */ (function () {\r\n function ModernBrowserCrypto() {\r\n }\r\n ModernBrowserCrypto.prototype.getRandomValues = function (dataBuffer) {\r\n return window.crypto.getRandomValues(dataBuffer);\r\n };\r\n ModernBrowserCrypto.prototype.generateKey = function (algorithm, extractable, keyUsages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.crypto.subtle.generateKey(algorithm, extractable, keyUsages)];\r\n });\r\n });\r\n };\r\n ModernBrowserCrypto.prototype.exportKey = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.crypto.subtle.exportKey(KEY_FORMAT_JWK, key)];\r\n });\r\n });\r\n };\r\n ModernBrowserCrypto.prototype.importKey = function (keyData, algorithm, extractable, keyUsages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.crypto.subtle.importKey(KEY_FORMAT_JWK, keyData, algorithm, extractable, keyUsages)];\r\n });\r\n });\r\n };\r\n ModernBrowserCrypto.prototype.sign = function (algorithm, key, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.crypto.subtle.sign(algorithm, key, data)];\r\n });\r\n });\r\n };\r\n ModernBrowserCrypto.prototype.digest = function (algorithm, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.crypto.subtle.digest(algorithm, data)];\r\n });\r\n });\r\n };\r\n return ModernBrowserCrypto;\r\n}());\n\nexport { ModernBrowserCrypto };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __spread, __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { KEY_FORMAT_JWK } from '../utils/BrowserConstants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar MsrBrowserCrypto = /** @class */ (function () {\r\n function MsrBrowserCrypto() {\r\n }\r\n MsrBrowserCrypto.prototype.initPrng = function (entropy) {\r\n // Turn into array, as initPrng seems to not always like Uint8Array (even though it should support both)\r\n return window.msrCrypto.initPrng(__spread(entropy));\r\n };\r\n MsrBrowserCrypto.prototype.getRandomValues = function (dataBuffer) {\r\n return window.msrCrypto.getRandomValues(dataBuffer);\r\n };\r\n MsrBrowserCrypto.prototype.generateKey = function (algorithm, extractable, keyUsages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.msrCrypto.subtle.generateKey(algorithm, extractable, keyUsages)];\r\n });\r\n });\r\n };\r\n MsrBrowserCrypto.prototype.exportKey = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.msrCrypto.subtle.exportKey(KEY_FORMAT_JWK, key)];\r\n });\r\n });\r\n };\r\n MsrBrowserCrypto.prototype.importKey = function (keyData, algorithm, extractable, keyUsages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.msrCrypto.subtle.importKey(KEY_FORMAT_JWK, keyData, algorithm, extractable, keyUsages)];\r\n });\r\n });\r\n };\r\n MsrBrowserCrypto.prototype.sign = function (algorithm, key, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.msrCrypto.subtle.sign(algorithm, key, data)];\r\n });\r\n });\r\n };\r\n MsrBrowserCrypto.prototype.digest = function (algorithm, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, window.msrCrypto.subtle.digest(algorithm, data)];\r\n });\r\n });\r\n };\r\n return MsrBrowserCrypto;\r\n}());\n\nexport { MsrBrowserCrypto };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { Constants } from '@azure/msal-common';\nimport { KEY_FORMAT_JWK } from '../utils/BrowserConstants.js';\nimport { BrowserStringUtils } from '../utils/BrowserStringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar MsBrowserCrypto = /** @class */ (function () {\r\n function MsBrowserCrypto() {\r\n }\r\n MsBrowserCrypto.prototype.getRandomValues = function (dataBuffer) {\r\n return window[\"msCrypto\"].getRandomValues(dataBuffer);\r\n };\r\n MsBrowserCrypto.prototype.generateKey = function (algorithm, extractable, keyUsages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var msGenerateKey = window[\"msCrypto\"].subtle.generateKey(algorithm, extractable, keyUsages);\r\n msGenerateKey.addEventListener(\"complete\", function (e) {\r\n resolve(e.target.result);\r\n });\r\n msGenerateKey.addEventListener(\"error\", function (error) {\r\n reject(error);\r\n });\r\n })];\r\n });\r\n });\r\n };\r\n MsBrowserCrypto.prototype.exportKey = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var msExportKey = window[\"msCrypto\"].subtle.exportKey(KEY_FORMAT_JWK, key);\r\n msExportKey.addEventListener(\"complete\", function (e) {\r\n var resultBuffer = e.target.result;\r\n var resultString = BrowserStringUtils.utf8ArrToString(new Uint8Array(resultBuffer))\r\n .replace(/\\r/g, Constants.EMPTY_STRING)\r\n .replace(/\\n/g, Constants.EMPTY_STRING)\r\n .replace(/\\t/g, Constants.EMPTY_STRING)\r\n .split(\" \").join(Constants.EMPTY_STRING)\r\n .replace(\"\\u0000\", Constants.EMPTY_STRING);\r\n try {\r\n resolve(JSON.parse(resultString));\r\n }\r\n catch (e) {\r\n reject(e);\r\n }\r\n });\r\n msExportKey.addEventListener(\"error\", function (error) {\r\n reject(error);\r\n });\r\n })];\r\n });\r\n });\r\n };\r\n MsBrowserCrypto.prototype.importKey = function (keyData, algorithm, extractable, keyUsages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var keyString, keyBuffer;\r\n return __generator(this, function (_a) {\r\n keyString = BrowserStringUtils.getSortedObjectString(keyData);\r\n keyBuffer = BrowserStringUtils.stringToArrayBuffer(keyString);\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var msImportKey = window[\"msCrypto\"].subtle.importKey(KEY_FORMAT_JWK, keyBuffer, algorithm, extractable, keyUsages);\r\n msImportKey.addEventListener(\"complete\", function (e) {\r\n resolve(e.target.result);\r\n });\r\n msImportKey.addEventListener(\"error\", function (error) {\r\n reject(error);\r\n });\r\n })];\r\n });\r\n });\r\n };\r\n MsBrowserCrypto.prototype.sign = function (algorithm, key, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var msSign = window[\"msCrypto\"].subtle.sign(algorithm, key, data);\r\n msSign.addEventListener(\"complete\", function (e) {\r\n resolve(e.target.result);\r\n });\r\n msSign.addEventListener(\"error\", function (error) {\r\n reject(error);\r\n });\r\n })];\r\n });\r\n });\r\n };\r\n MsBrowserCrypto.prototype.digest = function (algorithm, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var digestOperation = window[\"msCrypto\"].subtle.digest(algorithm, data.buffer);\r\n digestOperation.addEventListener(\"complete\", function (e) {\r\n resolve(e.target.result);\r\n });\r\n digestOperation.addEventListener(\"error\", function (error) {\r\n reject(error);\r\n });\r\n })];\r\n });\r\n });\r\n };\r\n return MsBrowserCrypto;\r\n}());\n\nexport { MsBrowserCrypto };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { BrowserStringUtils } from '../utils/BrowserStringUtils.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { ModernBrowserCrypto } from './ModernBrowserCrypto.js';\nimport { MsrBrowserCrypto } from './MsrBrowserCrypto.js';\nimport { MsBrowserCrypto } from './MsBrowserCrypto.js';\nimport { BrowserConfigurationAuthError } from '../error/BrowserConfigurationAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * See here for more info on RsaHashedKeyGenParams: https://developer.mozilla.org/en-US/docs/Web/API/RsaHashedKeyGenParams\r\n */\r\n// RSA KeyGen Algorithm\r\nvar PKCS1_V15_KEYGEN_ALG = \"RSASSA-PKCS1-v1_5\";\r\n// SHA-256 hashing algorithm\r\nvar S256_HASH_ALG = \"SHA-256\";\r\n// MOD length for PoP tokens\r\nvar MODULUS_LENGTH = 2048;\r\n// Public Exponent\r\nvar PUBLIC_EXPONENT = new Uint8Array([0x01, 0x00, 0x01]);\r\n/**\r\n * This class implements functions used by the browser library to perform cryptography operations such as\r\n * hashing and encoding. It also has helper functions to validate the availability of specific APIs.\r\n */\r\nvar BrowserCrypto = /** @class */ (function () {\r\n function BrowserCrypto(logger, cryptoOptions) {\r\n var _a, _b;\r\n this.logger = logger;\r\n this.cryptoOptions = cryptoOptions;\r\n if (this.hasBrowserCrypto()) {\r\n // Use standard modern web crypto if available\r\n this.logger.verbose(\"BrowserCrypto: modern crypto interface available\");\r\n this.subtleCrypto = new ModernBrowserCrypto();\r\n }\r\n else if (this.hasIECrypto()) {\r\n // For IE11, use msCrypto interface\r\n this.logger.verbose(\"BrowserCrypto: MS crypto interface available\");\r\n this.subtleCrypto = new MsBrowserCrypto();\r\n }\r\n else if (this.hasMsrCrypto() && ((_a = this.cryptoOptions) === null || _a === void 0 ? void 0 : _a.useMsrCrypto)) {\r\n // For other browsers, use MSR Crypto if found\r\n this.logger.verbose(\"BrowserCrypto: MSR crypto interface available\");\r\n this.subtleCrypto = new MsrBrowserCrypto();\r\n }\r\n else {\r\n if (this.hasMsrCrypto()) {\r\n this.logger.info(\"BrowserCrypto: MSR Crypto interface available but system.cryptoOptions.useMsrCrypto not enabled\");\r\n }\r\n this.logger.error(\"BrowserCrypto: No crypto interfaces available.\");\r\n throw BrowserAuthError.createCryptoNotAvailableError(\"Browser crypto, msCrypto, or msrCrypto interfaces not available.\");\r\n }\r\n // Mainly needed for MSR Crypto: https://github.com/microsoft/MSR-JavaScript-Crypto#random-number-generator-prng\r\n if (this.subtleCrypto.initPrng) {\r\n this.logger.verbose(\"BrowserCrypto: Interface requires entropy\");\r\n if (!((_b = this.cryptoOptions) === null || _b === void 0 ? void 0 : _b.entropy)) {\r\n this.logger.error(\"BrowserCrypto: Interface requires entropy but none provided.\");\r\n throw BrowserConfigurationAuthError.createEntropyNotProvided();\r\n }\r\n this.logger.verbose(\"BrowserCrypto: Entropy provided\");\r\n this.subtleCrypto.initPrng(this.cryptoOptions.entropy);\r\n }\r\n this.keygenAlgorithmOptions = {\r\n name: PKCS1_V15_KEYGEN_ALG,\r\n hash: S256_HASH_ALG,\r\n modulusLength: MODULUS_LENGTH,\r\n publicExponent: PUBLIC_EXPONENT\r\n };\r\n }\r\n /**\r\n * Check whether IE crypto or other browser cryptography is available.\r\n */\r\n BrowserCrypto.prototype.hasIECrypto = function () {\r\n return \"msCrypto\" in window;\r\n };\r\n /**\r\n * Check whether browser crypto is available.\r\n */\r\n BrowserCrypto.prototype.hasBrowserCrypto = function () {\r\n return \"crypto\" in window;\r\n };\r\n /**\r\n * Check whether MSR crypto polyfill is available\r\n */\r\n BrowserCrypto.prototype.hasMsrCrypto = function () {\r\n return \"msrCrypto\" in window;\r\n };\r\n /**\r\n * Returns a sha-256 hash of the given dataString as an ArrayBuffer.\r\n * @param dataString\r\n */\r\n BrowserCrypto.prototype.sha256Digest = function (dataString) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var data;\r\n return __generator(this, function (_a) {\r\n data = BrowserStringUtils.stringToUtf8Arr(dataString);\r\n // MSR Crypto wants object with name property, instead of string\r\n return [2 /*return*/, this.subtleCrypto.digest({ name: S256_HASH_ALG }, data)];\r\n });\r\n });\r\n };\r\n /**\r\n * Populates buffer with cryptographically random values.\r\n * @param dataBuffer\r\n */\r\n BrowserCrypto.prototype.getRandomValues = function (dataBuffer) {\r\n return this.subtleCrypto.getRandomValues(dataBuffer);\r\n };\r\n /**\r\n * Generates a keypair based on current keygen algorithm config.\r\n * @param extractable\r\n * @param usages\r\n */\r\n BrowserCrypto.prototype.generateKeyPair = function (extractable, usages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, this.subtleCrypto.generateKey(this.keygenAlgorithmOptions, extractable, usages)];\r\n });\r\n });\r\n };\r\n /**\r\n * Export key as Json Web Key (JWK)\r\n * @param key\r\n * @param format\r\n */\r\n BrowserCrypto.prototype.exportJwk = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, this.subtleCrypto.exportKey(key)];\r\n });\r\n });\r\n };\r\n /**\r\n * Imports key as Json Web Key (JWK), can set extractable and usages.\r\n * @param key\r\n * @param format\r\n * @param extractable\r\n * @param usages\r\n */\r\n BrowserCrypto.prototype.importJwk = function (key, extractable, usages) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, this.subtleCrypto.importKey(key, this.keygenAlgorithmOptions, extractable, usages)];\r\n });\r\n });\r\n };\r\n /**\r\n * Signs given data with given key\r\n * @param key\r\n * @param data\r\n */\r\n BrowserCrypto.prototype.sign = function (key, data) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, this.subtleCrypto.sign(this.keygenAlgorithmOptions, key, data)];\r\n });\r\n });\r\n };\r\n return BrowserCrypto;\r\n}());\n\nexport { BrowserCrypto };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { DB_NAME, DB_VERSION, DB_TABLE_NAME } from '../utils/BrowserConstants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Storage wrapper for IndexedDB storage in browsers: https://developer.mozilla.org/en-US/docs/Web/API/IndexedDB_API\r\n */\r\nvar DatabaseStorage = /** @class */ (function () {\r\n function DatabaseStorage() {\r\n this.dbName = DB_NAME;\r\n this.version = DB_VERSION;\r\n this.tableName = DB_TABLE_NAME;\r\n this.dbOpen = false;\r\n }\r\n /**\r\n * Opens IndexedDB instance.\r\n */\r\n DatabaseStorage.prototype.open = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var openDB = window.indexedDB.open(_this.dbName, _this.version);\r\n openDB.addEventListener(\"upgradeneeded\", function (e) {\r\n var event = e;\r\n event.target.result.createObjectStore(_this.tableName);\r\n });\r\n openDB.addEventListener(\"success\", function (e) {\r\n var event = e;\r\n _this.db = event.target.result;\r\n _this.dbOpen = true;\r\n resolve();\r\n });\r\n openDB.addEventListener(\"error\", function () { return reject(BrowserAuthError.createDatabaseUnavailableError()); });\r\n })];\r\n });\r\n });\r\n };\r\n /**\r\n * Closes the connection to IndexedDB database when all pending transactions\r\n * complete.\r\n */\r\n DatabaseStorage.prototype.closeConnection = function () {\r\n var db = this.db;\r\n if (db && this.dbOpen) {\r\n db.close();\r\n this.dbOpen = false;\r\n }\r\n };\r\n /**\r\n * Opens database if it's not already open\r\n */\r\n DatabaseStorage.prototype.validateDbIsOpen = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n if (!!this.dbOpen) return [3 /*break*/, 2];\r\n return [4 /*yield*/, this.open()];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n case 2: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Retrieves item from IndexedDB instance.\r\n * @param key\r\n */\r\n DatabaseStorage.prototype.getItem = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.validateDbIsOpen()];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n // TODO: Add timeouts?\r\n if (!_this.db) {\r\n return reject(BrowserAuthError.createDatabaseNotOpenError());\r\n }\r\n var transaction = _this.db.transaction([_this.tableName], \"readonly\");\r\n var objectStore = transaction.objectStore(_this.tableName);\r\n var dbGet = objectStore.get(key);\r\n dbGet.addEventListener(\"success\", function (e) {\r\n var event = e;\r\n _this.closeConnection();\r\n resolve(event.target.result);\r\n });\r\n dbGet.addEventListener(\"error\", function (e) {\r\n _this.closeConnection();\r\n reject(e);\r\n });\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Adds item to IndexedDB under given key\r\n * @param key\r\n * @param payload\r\n */\r\n DatabaseStorage.prototype.setItem = function (key, payload) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.validateDbIsOpen()];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n // TODO: Add timeouts?\r\n if (!_this.db) {\r\n return reject(BrowserAuthError.createDatabaseNotOpenError());\r\n }\r\n var transaction = _this.db.transaction([_this.tableName], \"readwrite\");\r\n var objectStore = transaction.objectStore(_this.tableName);\r\n var dbPut = objectStore.put(payload, key);\r\n dbPut.addEventListener(\"success\", function () {\r\n _this.closeConnection();\r\n resolve();\r\n });\r\n dbPut.addEventListener(\"error\", function (e) {\r\n _this.closeConnection();\r\n reject(e);\r\n });\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes item from IndexedDB under given key\r\n * @param key\r\n */\r\n DatabaseStorage.prototype.removeItem = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.validateDbIsOpen()];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n if (!_this.db) {\r\n return reject(BrowserAuthError.createDatabaseNotOpenError());\r\n }\r\n var transaction = _this.db.transaction([_this.tableName], \"readwrite\");\r\n var objectStore = transaction.objectStore(_this.tableName);\r\n var dbDelete = objectStore.delete(key);\r\n dbDelete.addEventListener(\"success\", function () {\r\n _this.closeConnection();\r\n resolve();\r\n });\r\n dbDelete.addEventListener(\"error\", function (e) {\r\n _this.closeConnection();\r\n reject(e);\r\n });\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Get all the keys from the storage object as an iterable array of strings.\r\n */\r\n DatabaseStorage.prototype.getKeys = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.validateDbIsOpen()];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n if (!_this.db) {\r\n return reject(BrowserAuthError.createDatabaseNotOpenError());\r\n }\r\n var transaction = _this.db.transaction([_this.tableName], \"readonly\");\r\n var objectStore = transaction.objectStore(_this.tableName);\r\n var dbGetKeys = objectStore.getAllKeys();\r\n dbGetKeys.addEventListener(\"success\", function (e) {\r\n var event = e;\r\n _this.closeConnection();\r\n resolve(event.target.result);\r\n });\r\n dbGetKeys.addEventListener(\"error\", function (e) {\r\n _this.closeConnection();\r\n reject(e);\r\n });\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n *\r\n * Checks whether there is an object under the search key in the object store\r\n */\r\n DatabaseStorage.prototype.containsKey = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.validateDbIsOpen()];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n if (!_this.db) {\r\n return reject(BrowserAuthError.createDatabaseNotOpenError());\r\n }\r\n var transaction = _this.db.transaction([_this.tableName], \"readonly\");\r\n var objectStore = transaction.objectStore(_this.tableName);\r\n var dbContainsKey = objectStore.count(key);\r\n dbContainsKey.addEventListener(\"success\", function (e) {\r\n var event = e;\r\n _this.closeConnection();\r\n resolve(event.target.result === 1);\r\n });\r\n dbContainsKey.addEventListener(\"error\", function (e) {\r\n _this.closeConnection();\r\n reject(e);\r\n });\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Deletes the MSAL database. The database is deleted rather than cleared to make it possible\r\n * for client applications to downgrade to a previous MSAL version without worrying about forward compatibility issues\r\n * with IndexedDB database versions.\r\n */\r\n DatabaseStorage.prototype.deleteDatabase = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n // Check if database being deleted exists\r\n if (this.db && this.dbOpen) {\r\n this.closeConnection();\r\n }\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n var deleteDbRequest = window.indexedDB.deleteDatabase(DB_NAME);\r\n deleteDbRequest.addEventListener(\"success\", function () { return resolve(true); });\r\n deleteDbRequest.addEventListener(\"blocked\", function () { return resolve(true); });\r\n deleteDbRequest.addEventListener(\"error\", function () { return reject(false); });\r\n })];\r\n });\r\n });\r\n };\r\n return DatabaseStorage;\r\n}());\n\nexport { DatabaseStorage };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar MemoryStorage = /** @class */ (function () {\r\n function MemoryStorage() {\r\n this.cache = new Map();\r\n }\r\n MemoryStorage.prototype.getItem = function (key) {\r\n return this.cache.get(key) || null;\r\n };\r\n MemoryStorage.prototype.setItem = function (key, value) {\r\n this.cache.set(key, value);\r\n };\r\n MemoryStorage.prototype.removeItem = function (key) {\r\n this.cache.delete(key);\r\n };\r\n MemoryStorage.prototype.getKeys = function () {\r\n var cacheKeys = [];\r\n this.cache.forEach(function (value, key) {\r\n cacheKeys.push(key);\r\n });\r\n return cacheKeys;\r\n };\r\n MemoryStorage.prototype.containsKey = function (key) {\r\n return this.cache.has(key);\r\n };\r\n MemoryStorage.prototype.clear = function () {\r\n this.cache.clear();\r\n };\r\n return MemoryStorage;\r\n}());\n\nexport { MemoryStorage };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { BrowserAuthError, BrowserAuthErrorMessage } from '../error/BrowserAuthError.js';\nimport { DatabaseStorage } from './DatabaseStorage.js';\nimport { MemoryStorage } from './MemoryStorage.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * This class allows MSAL to store artifacts asynchronously using the DatabaseStorage IndexedDB wrapper,\r\n * backed up with the more volatile MemoryStorage object for cases in which IndexedDB may be unavailable.\r\n */\r\nvar AsyncMemoryStorage = /** @class */ (function () {\r\n function AsyncMemoryStorage(logger, storeName) {\r\n this.inMemoryCache = new MemoryStorage();\r\n this.indexedDBCache = new DatabaseStorage();\r\n this.logger = logger;\r\n this.storeName = storeName;\r\n }\r\n AsyncMemoryStorage.prototype.handleDatabaseAccessError = function (error) {\r\n if (error instanceof BrowserAuthError && error.errorCode === BrowserAuthErrorMessage.databaseUnavailable.code) {\r\n this.logger.error(\"Could not access persistent storage. This may be caused by browser privacy features which block persistent storage in third-party contexts.\");\r\n }\r\n else {\r\n throw error;\r\n }\r\n };\r\n /**\r\n * Get the item matching the given key. Tries in-memory cache first, then in the asynchronous\r\n * storage object if item isn't found in-memory.\r\n * @param key\r\n */\r\n AsyncMemoryStorage.prototype.getItem = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var item, e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n item = this.inMemoryCache.getItem(key);\r\n if (!!item) return [3 /*break*/, 4];\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n this.logger.verbose(\"Queried item not found in in-memory cache, now querying persistent storage.\");\r\n return [4 /*yield*/, this.indexedDBCache.getItem(key)];\r\n case 2: return [2 /*return*/, _a.sent()];\r\n case 3:\r\n e_1 = _a.sent();\r\n this.handleDatabaseAccessError(e_1);\r\n return [3 /*break*/, 4];\r\n case 4: return [2 /*return*/, item];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Sets the item in the in-memory cache and then tries to set it in the asynchronous\r\n * storage object with the given key.\r\n * @param key\r\n * @param value\r\n */\r\n AsyncMemoryStorage.prototype.setItem = function (key, value) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var e_2;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.inMemoryCache.setItem(key, value);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.indexedDBCache.setItem(key, value)];\r\n case 2:\r\n _a.sent();\r\n return [3 /*break*/, 4];\r\n case 3:\r\n e_2 = _a.sent();\r\n this.handleDatabaseAccessError(e_2);\r\n return [3 /*break*/, 4];\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes the item matching the key from the in-memory cache, then tries to remove it from the asynchronous storage object.\r\n * @param key\r\n */\r\n AsyncMemoryStorage.prototype.removeItem = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var e_3;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.inMemoryCache.removeItem(key);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.indexedDBCache.removeItem(key)];\r\n case 2:\r\n _a.sent();\r\n return [3 /*break*/, 4];\r\n case 3:\r\n e_3 = _a.sent();\r\n this.handleDatabaseAccessError(e_3);\r\n return [3 /*break*/, 4];\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Get all the keys from the in-memory cache as an iterable array of strings. If no keys are found, query the keys in the\r\n * asynchronous storage object.\r\n */\r\n AsyncMemoryStorage.prototype.getKeys = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var cacheKeys, e_4;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n cacheKeys = this.inMemoryCache.getKeys();\r\n if (!(cacheKeys.length === 0)) return [3 /*break*/, 4];\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n this.logger.verbose(\"In-memory cache is empty, now querying persistent storage.\");\r\n return [4 /*yield*/, this.indexedDBCache.getKeys()];\r\n case 2: return [2 /*return*/, _a.sent()];\r\n case 3:\r\n e_4 = _a.sent();\r\n this.handleDatabaseAccessError(e_4);\r\n return [3 /*break*/, 4];\r\n case 4: return [2 /*return*/, cacheKeys];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Returns true or false if the given key is present in the cache.\r\n * @param key\r\n */\r\n AsyncMemoryStorage.prototype.containsKey = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var containsKey, e_5;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n containsKey = this.inMemoryCache.containsKey(key);\r\n if (!!containsKey) return [3 /*break*/, 4];\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n this.logger.verbose(\"Key not found in in-memory cache, now querying persistent storage.\");\r\n return [4 /*yield*/, this.indexedDBCache.containsKey(key)];\r\n case 2: return [2 /*return*/, _a.sent()];\r\n case 3:\r\n e_5 = _a.sent();\r\n this.handleDatabaseAccessError(e_5);\r\n return [3 /*break*/, 4];\r\n case 4: return [2 /*return*/, containsKey];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Clears in-memory Map\r\n */\r\n AsyncMemoryStorage.prototype.clearInMemory = function () {\r\n // InMemory cache is a Map instance, clear is straightforward\r\n this.logger.verbose(\"Deleting in-memory keystore \" + this.storeName);\r\n this.inMemoryCache.clear();\r\n this.logger.verbose(\"In-memory keystore \" + this.storeName + \" deleted\");\r\n };\r\n /**\r\n * Tries to delete the IndexedDB database\r\n * @returns\r\n */\r\n AsyncMemoryStorage.prototype.clearPersistent = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var dbDeleted, e_6;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n _a.trys.push([0, 2, , 3]);\r\n this.logger.verbose(\"Deleting persistent keystore\");\r\n return [4 /*yield*/, this.indexedDBCache.deleteDatabase()];\r\n case 1:\r\n dbDeleted = _a.sent();\r\n if (dbDeleted) {\r\n this.logger.verbose(\"Persistent keystore deleted\");\r\n }\r\n return [2 /*return*/, dbDeleted];\r\n case 2:\r\n e_6 = _a.sent();\r\n this.handleDatabaseAccessError(e_6);\r\n return [2 /*return*/, false];\r\n case 3: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n return AsyncMemoryStorage;\r\n}());\n\nexport { AsyncMemoryStorage };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { AsyncMemoryStorage } from './AsyncMemoryStorage.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar CryptoKeyStoreNames;\r\n(function (CryptoKeyStoreNames) {\r\n CryptoKeyStoreNames[\"asymmetricKeys\"] = \"asymmetricKeys\";\r\n CryptoKeyStoreNames[\"symmetricKeys\"] = \"symmetricKeys\";\r\n})(CryptoKeyStoreNames || (CryptoKeyStoreNames = {}));\r\n/**\r\n * MSAL CryptoKeyStore DB Version 2\r\n */\r\nvar CryptoKeyStore = /** @class */ (function () {\r\n function CryptoKeyStore(logger) {\r\n this.logger = logger;\r\n this.asymmetricKeys = new AsyncMemoryStorage(this.logger, CryptoKeyStoreNames.asymmetricKeys);\r\n this.symmetricKeys = new AsyncMemoryStorage(this.logger, CryptoKeyStoreNames.symmetricKeys);\r\n }\r\n CryptoKeyStore.prototype.clear = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n // Delete in-memory keystores\r\n this.asymmetricKeys.clearInMemory();\r\n this.symmetricKeys.clearInMemory();\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.asymmetricKeys.clearPersistent()];\r\n case 2:\r\n _a.sent();\r\n return [2 /*return*/, true];\r\n case 3:\r\n e_1 = _a.sent();\r\n if (e_1 instanceof Error) {\r\n this.logger.error(\"Clearing keystore failed with error: \" + e_1.message);\r\n }\r\n else {\r\n this.logger.error(\"Clearing keystore failed with unknown error\");\r\n }\r\n return [2 /*return*/, false];\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n return CryptoKeyStore;\r\n}());\n\nexport { CryptoKeyStore, CryptoKeyStoreNames };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { PerformanceEvents, JoseHeader } from '@azure/msal-common';\nimport { GuidGenerator } from './GuidGenerator.js';\nimport { Base64Encode } from '../encode/Base64Encode.js';\nimport { Base64Decode } from '../encode/Base64Decode.js';\nimport { PkceGenerator } from './PkceGenerator.js';\nimport { BrowserCrypto } from './BrowserCrypto.js';\nimport { BrowserStringUtils } from '../utils/BrowserStringUtils.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { CryptoKeyStore } from '../cache/CryptoKeyStore.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * This class implements MSAL's crypto interface, which allows it to perform base64 encoding and decoding, generating cryptographically random GUIDs and\r\n * implementing Proof Key for Code Exchange specs for the OAuth Authorization Code Flow using PKCE (rfc here: https://tools.ietf.org/html/rfc7636).\r\n */\r\nvar CryptoOps = /** @class */ (function () {\r\n function CryptoOps(logger, performanceClient, cryptoConfig) {\r\n this.logger = logger;\r\n // Browser crypto needs to be validated first before any other classes can be set.\r\n this.browserCrypto = new BrowserCrypto(this.logger, cryptoConfig);\r\n this.b64Encode = new Base64Encode();\r\n this.b64Decode = new Base64Decode();\r\n this.guidGenerator = new GuidGenerator(this.browserCrypto);\r\n this.pkceGenerator = new PkceGenerator(this.browserCrypto);\r\n this.cache = new CryptoKeyStore(this.logger);\r\n this.performanceClient = performanceClient;\r\n }\r\n /**\r\n * Creates a new random GUID - used to populate state and nonce.\r\n * @returns string (GUID)\r\n */\r\n CryptoOps.prototype.createNewGuid = function () {\r\n return this.guidGenerator.generateGuid();\r\n };\r\n /**\r\n * Encodes input string to base64.\r\n * @param input\r\n */\r\n CryptoOps.prototype.base64Encode = function (input) {\r\n return this.b64Encode.encode(input);\r\n };\r\n /**\r\n * Decodes input string from base64.\r\n * @param input\r\n */\r\n CryptoOps.prototype.base64Decode = function (input) {\r\n return this.b64Decode.decode(input);\r\n };\r\n /**\r\n * Generates PKCE codes used in Authorization Code Flow.\r\n */\r\n CryptoOps.prototype.generatePkceCodes = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, this.pkceGenerator.generateCodes()];\r\n });\r\n });\r\n };\r\n /**\r\n * Generates a keypair, stores it and returns a thumbprint\r\n * @param request\r\n */\r\n CryptoOps.prototype.getPublicKeyThumbprint = function (request) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var publicKeyThumbMeasurement, keyPair, publicKeyJwk, pubKeyThumprintObj, publicJwkString, publicJwkHash, privateKeyJwk, unextractablePrivateKey;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n publicKeyThumbMeasurement = (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.startMeasurement(PerformanceEvents.CryptoOptsGetPublicKeyThumbprint, request.correlationId);\r\n return [4 /*yield*/, this.browserCrypto.generateKeyPair(CryptoOps.EXTRACTABLE, CryptoOps.POP_KEY_USAGES)];\r\n case 1:\r\n keyPair = _b.sent();\r\n return [4 /*yield*/, this.browserCrypto.exportJwk(keyPair.publicKey)];\r\n case 2:\r\n publicKeyJwk = _b.sent();\r\n pubKeyThumprintObj = {\r\n e: publicKeyJwk.e,\r\n kty: publicKeyJwk.kty,\r\n n: publicKeyJwk.n\r\n };\r\n publicJwkString = BrowserStringUtils.getSortedObjectString(pubKeyThumprintObj);\r\n return [4 /*yield*/, this.hashString(publicJwkString)];\r\n case 3:\r\n publicJwkHash = _b.sent();\r\n return [4 /*yield*/, this.browserCrypto.exportJwk(keyPair.privateKey)];\r\n case 4:\r\n privateKeyJwk = _b.sent();\r\n return [4 /*yield*/, this.browserCrypto.importJwk(privateKeyJwk, false, [\"sign\"])];\r\n case 5:\r\n unextractablePrivateKey = _b.sent();\r\n // Store Keypair data in keystore\r\n return [4 /*yield*/, this.cache.asymmetricKeys.setItem(publicJwkHash, {\r\n privateKey: unextractablePrivateKey,\r\n publicKey: keyPair.publicKey,\r\n requestMethod: request.resourceRequestMethod,\r\n requestUri: request.resourceRequestUri\r\n })];\r\n case 6:\r\n // Store Keypair data in keystore\r\n _b.sent();\r\n if (publicKeyThumbMeasurement) {\r\n publicKeyThumbMeasurement.endMeasurement({\r\n success: true\r\n });\r\n }\r\n return [2 /*return*/, publicJwkHash];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes cryptographic keypair from key store matching the keyId passed in\r\n * @param kid\r\n */\r\n CryptoOps.prototype.removeTokenBindingKey = function (kid) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var keyFound;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.cache.asymmetricKeys.removeItem(kid)];\r\n case 1:\r\n _a.sent();\r\n return [4 /*yield*/, this.cache.asymmetricKeys.containsKey(kid)];\r\n case 2:\r\n keyFound = _a.sent();\r\n return [2 /*return*/, !keyFound];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes all cryptographic keys from IndexedDB storage\r\n */\r\n CryptoOps.prototype.clearKeystore = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.cache.clear()];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Signs the given object as a jwt payload with private key retrieved by given kid.\r\n * @param payload\r\n * @param kid\r\n */\r\n CryptoOps.prototype.signJwt = function (payload, kid, correlationId) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var signJwtMeasurement, cachedKeyPair, publicKeyJwk, publicKeyJwkString, encodedKeyIdThumbprint, shrHeader, encodedShrHeader, encodedPayload, tokenString, tokenBuffer, signatureBuffer, encodedSignature, signedJwt;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n signJwtMeasurement = (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.startMeasurement(PerformanceEvents.CryptoOptsSignJwt, correlationId);\r\n return [4 /*yield*/, this.cache.asymmetricKeys.getItem(kid)];\r\n case 1:\r\n cachedKeyPair = _b.sent();\r\n if (!cachedKeyPair) {\r\n throw BrowserAuthError.createSigningKeyNotFoundInStorageError(kid);\r\n }\r\n return [4 /*yield*/, this.browserCrypto.exportJwk(cachedKeyPair.publicKey)];\r\n case 2:\r\n publicKeyJwk = _b.sent();\r\n publicKeyJwkString = BrowserStringUtils.getSortedObjectString(publicKeyJwk);\r\n encodedKeyIdThumbprint = this.b64Encode.urlEncode(JSON.stringify({ kid: kid }));\r\n shrHeader = JoseHeader.getShrHeaderString({ kid: encodedKeyIdThumbprint, alg: publicKeyJwk.alg });\r\n encodedShrHeader = this.b64Encode.urlEncode(shrHeader);\r\n // Generate payload\r\n payload.cnf = {\r\n jwk: JSON.parse(publicKeyJwkString)\r\n };\r\n encodedPayload = this.b64Encode.urlEncode(JSON.stringify(payload));\r\n tokenString = encodedShrHeader + \".\" + encodedPayload;\r\n tokenBuffer = BrowserStringUtils.stringToArrayBuffer(tokenString);\r\n return [4 /*yield*/, this.browserCrypto.sign(cachedKeyPair.privateKey, tokenBuffer)];\r\n case 3:\r\n signatureBuffer = _b.sent();\r\n encodedSignature = this.b64Encode.urlEncodeArr(new Uint8Array(signatureBuffer));\r\n signedJwt = tokenString + \".\" + encodedSignature;\r\n if (signJwtMeasurement) {\r\n signJwtMeasurement.endMeasurement({\r\n success: true\r\n });\r\n }\r\n return [2 /*return*/, signedJwt];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Returns the SHA-256 hash of an input string\r\n * @param plainText\r\n */\r\n CryptoOps.prototype.hashString = function (plainText) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var hashBuffer, hashBytes;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.browserCrypto.sha256Digest(plainText)];\r\n case 1:\r\n hashBuffer = _a.sent();\r\n hashBytes = new Uint8Array(hashBuffer);\r\n return [2 /*return*/, this.b64Encode.urlEncodeArr(hashBytes)];\r\n }\r\n });\r\n });\r\n };\r\n CryptoOps.POP_KEY_USAGES = [\"sign\", \"verify\"];\r\n CryptoOps.EXTRACTABLE = true;\r\n return CryptoOps;\r\n}());\n\nexport { CryptoOps };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { Constants } from '../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Log message level.\r\n */\r\nvar LogLevel;\r\n(function (LogLevel) {\r\n LogLevel[LogLevel[\"Error\"] = 0] = \"Error\";\r\n LogLevel[LogLevel[\"Warning\"] = 1] = \"Warning\";\r\n LogLevel[LogLevel[\"Info\"] = 2] = \"Info\";\r\n LogLevel[LogLevel[\"Verbose\"] = 3] = \"Verbose\";\r\n LogLevel[LogLevel[\"Trace\"] = 4] = \"Trace\";\r\n})(LogLevel || (LogLevel = {}));\r\n/**\r\n * Class which facilitates logging of messages to a specific place.\r\n */\r\nvar Logger = /** @class */ (function () {\r\n function Logger(loggerOptions, packageName, packageVersion) {\r\n // Current log level, defaults to info.\r\n this.level = LogLevel.Info;\r\n var defaultLoggerCallback = function () {\r\n return;\r\n };\r\n var setLoggerOptions = loggerOptions || Logger.createDefaultLoggerOptions();\r\n this.localCallback = setLoggerOptions.loggerCallback || defaultLoggerCallback;\r\n this.piiLoggingEnabled = setLoggerOptions.piiLoggingEnabled || false;\r\n this.level = typeof (setLoggerOptions.logLevel) === \"number\" ? setLoggerOptions.logLevel : LogLevel.Info;\r\n this.correlationId = setLoggerOptions.correlationId || Constants.EMPTY_STRING;\r\n this.packageName = packageName || Constants.EMPTY_STRING;\r\n this.packageVersion = packageVersion || Constants.EMPTY_STRING;\r\n }\r\n Logger.createDefaultLoggerOptions = function () {\r\n return {\r\n loggerCallback: function () {\r\n // allow users to not set loggerCallback\r\n },\r\n piiLoggingEnabled: false,\r\n logLevel: LogLevel.Info\r\n };\r\n };\r\n /**\r\n * Create new Logger with existing configurations.\r\n */\r\n Logger.prototype.clone = function (packageName, packageVersion, correlationId) {\r\n return new Logger({ loggerCallback: this.localCallback, piiLoggingEnabled: this.piiLoggingEnabled, logLevel: this.level, correlationId: correlationId || this.correlationId }, packageName, packageVersion);\r\n };\r\n /**\r\n * Log message with required options.\r\n */\r\n Logger.prototype.logMessage = function (logMessage, options) {\r\n if ((options.logLevel > this.level) || (!this.piiLoggingEnabled && options.containsPii)) {\r\n return;\r\n }\r\n var timestamp = new Date().toUTCString();\r\n // Add correlationId to logs if set, correlationId provided on log messages take precedence\r\n var logHeader;\r\n if (!StringUtils.isEmpty(options.correlationId)) {\r\n logHeader = \"[\" + timestamp + \"] : [\" + options.correlationId + \"]\";\r\n }\r\n else if (!StringUtils.isEmpty(this.correlationId)) {\r\n logHeader = \"[\" + timestamp + \"] : [\" + this.correlationId + \"]\";\r\n }\r\n else {\r\n logHeader = \"[\" + timestamp + \"]\";\r\n }\r\n var log = logHeader + \" : \" + this.packageName + \"@\" + this.packageVersion + \" : \" + LogLevel[options.logLevel] + \" - \" + logMessage;\r\n // debug(`msal:${LogLevel[options.logLevel]}${options.containsPii ? \"-Pii\": Constants.EMPTY_STRING}${options.context ? `:${options.context}` : Constants.EMPTY_STRING}`)(logMessage);\r\n this.executeCallback(options.logLevel, log, options.containsPii || false);\r\n };\r\n /**\r\n * Execute callback with message.\r\n */\r\n Logger.prototype.executeCallback = function (level, message, containsPii) {\r\n if (this.localCallback) {\r\n this.localCallback(level, message, containsPii);\r\n }\r\n };\r\n /**\r\n * Logs error messages.\r\n */\r\n Logger.prototype.error = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Error,\r\n containsPii: false,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs error messages with PII.\r\n */\r\n Logger.prototype.errorPii = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Error,\r\n containsPii: true,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs warning messages.\r\n */\r\n Logger.prototype.warning = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Warning,\r\n containsPii: false,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs warning messages with PII.\r\n */\r\n Logger.prototype.warningPii = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Warning,\r\n containsPii: true,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs info messages.\r\n */\r\n Logger.prototype.info = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Info,\r\n containsPii: false,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs info messages with PII.\r\n */\r\n Logger.prototype.infoPii = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Info,\r\n containsPii: true,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs verbose messages.\r\n */\r\n Logger.prototype.verbose = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Verbose,\r\n containsPii: false,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs verbose messages with PII.\r\n */\r\n Logger.prototype.verbosePii = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Verbose,\r\n containsPii: true,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs trace messages.\r\n */\r\n Logger.prototype.trace = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Trace,\r\n containsPii: false,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Logs trace messages with PII.\r\n */\r\n Logger.prototype.tracePii = function (message, correlationId) {\r\n this.logMessage(message, {\r\n logLevel: LogLevel.Trace,\r\n containsPii: true,\r\n correlationId: correlationId || Constants.EMPTY_STRING\r\n });\r\n };\r\n /**\r\n * Returns whether PII Logging is enabled or not.\r\n */\r\n Logger.prototype.isPiiLoggingEnabled = function () {\r\n return this.piiLoggingEnabled || false;\r\n };\r\n return Logger;\r\n}());\n\nexport { LogLevel, Logger };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __assign } from '../../_virtual/_tslib.js';\nimport { IntFields, PerformanceEventStatus } from './PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar PerformanceClient = /** @class */ (function () {\r\n /**\r\n * Creates an instance of PerformanceClient,\r\n * an abstract class containing core performance telemetry logic.\r\n *\r\n * @constructor\r\n * @param {string} clientId Client ID of the application\r\n * @param {string} authority Authority used by the application\r\n * @param {Logger} logger Logger used by the application\r\n * @param {string} libraryName Name of the library\r\n * @param {string} libraryVersion Version of the library\r\n */\r\n function PerformanceClient(clientId, authority, logger, libraryName, libraryVersion, applicationTelemetry) {\r\n this.authority = authority;\r\n this.libraryName = libraryName;\r\n this.libraryVersion = libraryVersion;\r\n this.applicationTelemetry = applicationTelemetry;\r\n this.clientId = clientId;\r\n this.logger = logger;\r\n this.callbacks = new Map();\r\n this.eventsByCorrelationId = new Map();\r\n this.queueMeasurements = new Map();\r\n this.preQueueTimeByCorrelationId = new Map();\r\n }\r\n /**\r\n * Starts and returns an platform-specific implementation of IPerformanceMeasurement.\r\n * Note: this function can be changed to abstract at the next major version bump.\r\n *\r\n * @param {string} measureName\r\n * @param {string} correlationId\r\n * @returns {IPerformanceMeasurement}\r\n */\r\n /* eslint-disable-next-line @typescript-eslint/no-unused-vars */\r\n PerformanceClient.prototype.startPerformanceMeasurement = function (measureName, correlationId) {\r\n return {};\r\n };\r\n /**\r\n * Starts and returns an platform-specific implementation of IPerformanceMeasurement.\r\n * Note: this incorrectly-named function will be removed at the next major version bump.\r\n *\r\n * @param {string} measureName\r\n * @param {string} correlationId\r\n * @returns {IPerformanceMeasurement}\r\n */\r\n /* eslint-disable-next-line @typescript-eslint/no-unused-vars */\r\n PerformanceClient.prototype.startPerformanceMeasuremeant = function (measureName, correlationId) {\r\n return {};\r\n };\r\n /**\r\n * Get integral fields.\r\n * Override to change the set.\r\n */\r\n PerformanceClient.prototype.getIntFields = function () {\r\n return IntFields;\r\n };\r\n /**\r\n * Gets map of pre-queue times by correlation Id\r\n *\r\n * @param {PerformanceEvents} eventName\r\n * @param {string} correlationId\r\n * @returns {number}\r\n */\r\n PerformanceClient.prototype.getPreQueueTime = function (eventName, correlationId) {\r\n var preQueueEvent = this.preQueueTimeByCorrelationId.get(correlationId);\r\n if (!preQueueEvent) {\r\n this.logger.trace(\"PerformanceClient.getPreQueueTime: no pre-queue times found for correlationId: \" + correlationId + \", unable to add queue measurement\");\r\n return;\r\n }\r\n else if (preQueueEvent.name !== eventName) {\r\n this.logger.trace(\"PerformanceClient.getPreQueueTime: no pre-queue time found for \" + eventName + \", unable to add queue measurement\");\r\n return;\r\n }\r\n return preQueueEvent.time;\r\n };\r\n /**\r\n * Calculates the difference between current time and time when function was queued.\r\n * Note: It is possible to have 0 as the queue time if the current time and the queued time was the same.\r\n *\r\n * @param {number} preQueueTime\r\n * @param {number} currentTime\r\n * @returns {number}\r\n */\r\n PerformanceClient.prototype.calculateQueuedTime = function (preQueueTime, currentTime) {\r\n if (preQueueTime < 1) {\r\n this.logger.trace(\"PerformanceClient: preQueueTime should be a positive integer and not \" + preQueueTime);\r\n return 0;\r\n }\r\n if (currentTime < 1) {\r\n this.logger.trace(\"PerformanceClient: currentTime should be a positive integer and not \" + currentTime);\r\n return 0;\r\n }\r\n if (currentTime < preQueueTime) {\r\n this.logger.trace(\"PerformanceClient: currentTime is less than preQueueTime, check how time is being retrieved\");\r\n return 0;\r\n }\r\n return currentTime - preQueueTime;\r\n };\r\n /**\r\n * Adds queue measurement time to QueueMeasurements array for given correlation ID.\r\n *\r\n * @param {PerformanceEvents} eventName\r\n * @param {?string} correlationId\r\n * @param {?number} queueTime\r\n * @param {?boolean} manuallyCompleted - indicator for manually completed queue measurements\r\n * @returns\r\n */\r\n PerformanceClient.prototype.addQueueMeasurement = function (eventName, correlationId, queueTime, manuallyCompleted) {\r\n if (!correlationId) {\r\n this.logger.trace(\"PerformanceClient.addQueueMeasurement: correlationId not provided for \" + eventName + \", cannot add queue measurement\");\r\n return;\r\n }\r\n if (queueTime === 0) {\r\n // Possible for there to be no queue time after calculation\r\n this.logger.trace(\"PerformanceClient.addQueueMeasurement: queue time provided for \" + eventName + \" is \" + queueTime);\r\n }\r\n else if (!queueTime) {\r\n this.logger.trace(\"PerformanceClient.addQueueMeasurement: no queue time provided for \" + eventName);\r\n return;\r\n }\r\n var queueMeasurement = { eventName: eventName, queueTime: queueTime, manuallyCompleted: manuallyCompleted };\r\n // Adds to existing correlation Id if present in queueMeasurements\r\n var existingMeasurements = this.queueMeasurements.get(correlationId);\r\n if (existingMeasurements) {\r\n existingMeasurements.push(queueMeasurement);\r\n this.queueMeasurements.set(correlationId, existingMeasurements);\r\n }\r\n else {\r\n // Sets new correlation Id if not present in queueMeasurements\r\n this.logger.trace(\"PerformanceClient.addQueueMeasurement: adding correlationId \" + correlationId + \" to queue measurements\");\r\n var measurementArray = [queueMeasurement];\r\n this.queueMeasurements.set(correlationId, measurementArray);\r\n }\r\n // Delete processed pre-queue event.\r\n this.preQueueTimeByCorrelationId.delete(correlationId);\r\n };\r\n /**\r\n * Starts measuring performance for a given operation. Returns a function that should be used to end the measurement.\r\n *\r\n * @param {PerformanceEvents} measureName\r\n * @param {?string} [correlationId]\r\n * @returns {InProgressPerformanceEvent}\r\n */\r\n PerformanceClient.prototype.startMeasurement = function (measureName, correlationId) {\r\n var _this = this;\r\n var _a, _b;\r\n // Generate a placeholder correlation if the request does not provide one\r\n var eventCorrelationId = correlationId || this.generateId();\r\n if (!correlationId) {\r\n this.logger.info(\"PerformanceClient: No correlation id provided for \" + measureName + \", generating\", eventCorrelationId);\r\n }\r\n // Duplicate code to address spelling error will be removed at the next major version bump.\r\n this.logger.trace(\"PerformanceClient: Performance measurement started for \" + measureName, eventCorrelationId);\r\n var performanceMeasurement = this.startPerformanceMeasuremeant(measureName, eventCorrelationId);\r\n performanceMeasurement.startMeasurement();\r\n var inProgressEvent = {\r\n eventId: this.generateId(),\r\n status: PerformanceEventStatus.InProgress,\r\n authority: this.authority,\r\n libraryName: this.libraryName,\r\n libraryVersion: this.libraryVersion,\r\n clientId: this.clientId,\r\n name: measureName,\r\n startTimeMs: Date.now(),\r\n correlationId: eventCorrelationId,\r\n appName: (_a = this.applicationTelemetry) === null || _a === void 0 ? void 0 : _a.appName,\r\n appVersion: (_b = this.applicationTelemetry) === null || _b === void 0 ? void 0 : _b.appVersion,\r\n };\r\n // Store in progress events so they can be discarded if not ended properly\r\n this.cacheEventByCorrelationId(inProgressEvent);\r\n // Return the event and functions the caller can use to properly end/flush the measurement\r\n return {\r\n endMeasurement: function (event) {\r\n return _this.endMeasurement(__assign(__assign({}, inProgressEvent), event), performanceMeasurement);\r\n },\r\n discardMeasurement: function () {\r\n return _this.discardMeasurements(inProgressEvent.correlationId);\r\n },\r\n addStaticFields: function (fields) {\r\n return _this.addStaticFields(fields, inProgressEvent.correlationId);\r\n },\r\n increment: function (counters) {\r\n return _this.increment(counters, inProgressEvent.correlationId);\r\n },\r\n measurement: performanceMeasurement,\r\n event: inProgressEvent\r\n };\r\n };\r\n /**\r\n * Stops measuring the performance for an operation. Should only be called directly by PerformanceClient classes,\r\n * as consumers should instead use the function returned by startMeasurement.\r\n * Adds a new field named as \"[event name]DurationMs\" for sub-measurements, completes and emits an event\r\n * otherwise.\r\n *\r\n * @param {PerformanceEvent} event\r\n * @param {IPerformanceMeasurement} measurement\r\n * @returns {(PerformanceEvent | null)}\r\n */\r\n PerformanceClient.prototype.endMeasurement = function (event, measurement) {\r\n var _this = this;\r\n var _a, _b;\r\n var rootEvent = this.eventsByCorrelationId.get(event.correlationId);\r\n if (!rootEvent) {\r\n this.logger.trace(\"PerformanceClient: Measurement not found for \" + event.eventId, event.correlationId);\r\n return null;\r\n }\r\n var isRoot = event.eventId === rootEvent.eventId;\r\n var queueInfo = {\r\n totalQueueTime: 0,\r\n totalQueueCount: 0,\r\n manuallyCompletedCount: 0\r\n };\r\n if (isRoot) {\r\n queueInfo = this.getQueueInfo(event.correlationId);\r\n this.discardCache(rootEvent.correlationId);\r\n }\r\n else {\r\n (_a = rootEvent.incompleteSubMeasurements) === null || _a === void 0 ? void 0 : _a.delete(event.eventId);\r\n }\r\n measurement === null || measurement === void 0 ? void 0 : measurement.endMeasurement();\r\n var durationMs = measurement === null || measurement === void 0 ? void 0 : measurement.flushMeasurement();\r\n // null indicates no measurement was taken (e.g. needed performance APIs not present)\r\n if (!durationMs) {\r\n this.logger.trace(\"PerformanceClient: Performance measurement not taken\", rootEvent.correlationId);\r\n return null;\r\n }\r\n this.logger.trace(\"PerformanceClient: Performance measurement ended for \" + event.name + \": \" + durationMs + \" ms\", event.correlationId);\r\n // Add sub-measurement attribute to root event.\r\n if (!isRoot) {\r\n rootEvent[event.name + \"DurationMs\"] = Math.floor(durationMs);\r\n return __assign({}, rootEvent);\r\n }\r\n var finalEvent = __assign(__assign({}, rootEvent), event);\r\n var incompleteSubsCount = 0;\r\n // Incomplete sub-measurements are discarded. They are likely an instrumentation bug that should be fixed.\r\n (_b = finalEvent.incompleteSubMeasurements) === null || _b === void 0 ? void 0 : _b.forEach(function (subMeasurement) {\r\n _this.logger.trace(\"PerformanceClient: Incomplete submeasurement \" + subMeasurement.name + \" found for \" + event.name, finalEvent.correlationId);\r\n incompleteSubsCount++;\r\n });\r\n finalEvent.incompleteSubMeasurements = undefined;\r\n finalEvent = __assign(__assign({}, finalEvent), { durationMs: Math.round(durationMs), queuedTimeMs: queueInfo.totalQueueTime, queuedCount: queueInfo.totalQueueCount, queuedManuallyCompletedCount: queueInfo.manuallyCompletedCount, status: PerformanceEventStatus.Completed, incompleteSubsCount: incompleteSubsCount });\r\n this.truncateIntegralFields(finalEvent, this.getIntFields());\r\n this.emitEvents([finalEvent], event.correlationId);\r\n return finalEvent;\r\n };\r\n /**\r\n * Saves extra information to be emitted when the measurements are flushed\r\n * @param fields\r\n * @param correlationId\r\n */\r\n PerformanceClient.prototype.addStaticFields = function (fields, correlationId) {\r\n this.logger.trace(\"PerformanceClient: Updating static fields\");\r\n var event = this.eventsByCorrelationId.get(correlationId);\r\n if (event) {\r\n this.eventsByCorrelationId.set(correlationId, __assign(__assign({}, event), fields));\r\n }\r\n else {\r\n this.logger.trace(\"PerformanceClient: Event not found for\", correlationId);\r\n }\r\n };\r\n /**\r\n * Increment counters to be emitted when the measurements are flushed\r\n * @param counters {Counters}\r\n * @param correlationId {string} correlation identifier\r\n */\r\n PerformanceClient.prototype.increment = function (counters, correlationId) {\r\n this.logger.trace(\"PerformanceClient: Updating counters\");\r\n var event = this.eventsByCorrelationId.get(correlationId);\r\n if (event) {\r\n for (var counter in counters) {\r\n if (!event.hasOwnProperty(counter)) {\r\n event[counter] = 0;\r\n }\r\n event[counter] += counters[counter];\r\n }\r\n }\r\n else {\r\n this.logger.trace(\"PerformanceClient: Event not found for\", correlationId);\r\n }\r\n };\r\n /**\r\n * Upserts event into event cache.\r\n * First key is the correlation id, second key is the event id.\r\n * Allows for events to be grouped by correlation id,\r\n * and to easily allow for properties on them to be updated.\r\n *\r\n * @private\r\n * @param {PerformanceEvent} event\r\n */\r\n PerformanceClient.prototype.cacheEventByCorrelationId = function (event) {\r\n var rootEvent = this.eventsByCorrelationId.get(event.correlationId);\r\n if (rootEvent) {\r\n this.logger.trace(\"PerformanceClient: Performance measurement for \" + event.name + \" added/updated\", event.correlationId);\r\n rootEvent.incompleteSubMeasurements = rootEvent.incompleteSubMeasurements || new Map();\r\n rootEvent.incompleteSubMeasurements.set(event.eventId, { name: event.name, startTimeMs: event.startTimeMs });\r\n }\r\n else {\r\n this.logger.trace(\"PerformanceClient: Performance measurement for \" + event.name + \" started\", event.correlationId);\r\n this.eventsByCorrelationId.set(event.correlationId, __assign({}, event));\r\n }\r\n };\r\n PerformanceClient.prototype.getQueueInfo = function (correlationId) {\r\n var queueMeasurementForCorrelationId = this.queueMeasurements.get(correlationId);\r\n if (!queueMeasurementForCorrelationId) {\r\n this.logger.trace(\"PerformanceClient: no queue measurements found for for correlationId: \" + correlationId);\r\n }\r\n var totalQueueTime = 0;\r\n var totalQueueCount = 0;\r\n var manuallyCompletedCount = 0;\r\n queueMeasurementForCorrelationId === null || queueMeasurementForCorrelationId === void 0 ? void 0 : queueMeasurementForCorrelationId.forEach(function (measurement) {\r\n totalQueueTime += measurement.queueTime;\r\n totalQueueCount++;\r\n manuallyCompletedCount += measurement.manuallyCompleted ? 1 : 0;\r\n });\r\n return {\r\n totalQueueTime: totalQueueTime,\r\n totalQueueCount: totalQueueCount,\r\n manuallyCompletedCount: manuallyCompletedCount\r\n };\r\n };\r\n /**\r\n * Removes measurements for a given correlation id.\r\n *\r\n * @param {string} correlationId\r\n */\r\n PerformanceClient.prototype.discardMeasurements = function (correlationId) {\r\n this.logger.trace(\"PerformanceClient: Performance measurements discarded\", correlationId);\r\n this.eventsByCorrelationId.delete(correlationId);\r\n };\r\n /**\r\n * Removes cache for a given correlation id.\r\n *\r\n * @param {string} correlationId correlation identifier\r\n */\r\n PerformanceClient.prototype.discardCache = function (correlationId) {\r\n this.discardMeasurements(correlationId);\r\n this.logger.trace(\"PerformanceClient: QueueMeasurements discarded\", correlationId);\r\n this.queueMeasurements.delete(correlationId);\r\n this.logger.trace(\"PerformanceClient: Pre-queue times discarded\", correlationId);\r\n this.preQueueTimeByCorrelationId.delete(correlationId);\r\n };\r\n /**\r\n * Registers a callback function to receive performance events.\r\n *\r\n * @param {PerformanceCallbackFunction} callback\r\n * @returns {string}\r\n */\r\n PerformanceClient.prototype.addPerformanceCallback = function (callback) {\r\n var callbackId = this.generateId();\r\n this.callbacks.set(callbackId, callback);\r\n this.logger.verbose(\"PerformanceClient: Performance callback registered with id: \" + callbackId);\r\n return callbackId;\r\n };\r\n /**\r\n * Removes a callback registered with addPerformanceCallback.\r\n *\r\n * @param {string} callbackId\r\n * @returns {boolean}\r\n */\r\n PerformanceClient.prototype.removePerformanceCallback = function (callbackId) {\r\n var result = this.callbacks.delete(callbackId);\r\n if (result) {\r\n this.logger.verbose(\"PerformanceClient: Performance callback \" + callbackId + \" removed.\");\r\n }\r\n else {\r\n this.logger.verbose(\"PerformanceClient: Performance callback \" + callbackId + \" not removed.\");\r\n }\r\n return result;\r\n };\r\n /**\r\n * Emits events to all registered callbacks.\r\n *\r\n * @param {PerformanceEvent[]} events\r\n * @param {?string} [correlationId]\r\n */\r\n PerformanceClient.prototype.emitEvents = function (events, correlationId) {\r\n var _this = this;\r\n this.logger.verbose(\"PerformanceClient: Emitting performance events\", correlationId);\r\n this.callbacks.forEach(function (callback, callbackId) {\r\n _this.logger.trace(\"PerformanceClient: Emitting event to callback \" + callbackId, correlationId);\r\n callback.apply(null, [events]);\r\n });\r\n };\r\n /**\r\n * Enforce truncation of integral fields in performance event.\r\n * @param {PerformanceEvent} event performance event to update.\r\n * @param {Set} intFields integral fields.\r\n */\r\n PerformanceClient.prototype.truncateIntegralFields = function (event, intFields) {\r\n intFields.forEach(function (key) {\r\n if (key in event && typeof event[key] === \"number\") {\r\n event[key] = Math.floor(event[key]);\r\n }\r\n });\r\n };\r\n return PerformanceClient;\r\n}());\n\nexport { PerformanceClient };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../../_virtual/_tslib.js';\nimport { PerformanceClient } from './PerformanceClient.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar StubPerformanceMeasurement = /** @class */ (function () {\r\n function StubPerformanceMeasurement() {\r\n }\r\n /* eslint-disable-next-line @typescript-eslint/no-empty-function */\r\n StubPerformanceMeasurement.prototype.startMeasurement = function () { };\r\n /* eslint-disable-next-line @typescript-eslint/no-empty-function */\r\n StubPerformanceMeasurement.prototype.endMeasurement = function () { };\r\n StubPerformanceMeasurement.prototype.flushMeasurement = function () {\r\n return null;\r\n };\r\n return StubPerformanceMeasurement;\r\n}());\r\nvar StubPerformanceClient = /** @class */ (function (_super) {\r\n __extends(StubPerformanceClient, _super);\r\n function StubPerformanceClient() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n StubPerformanceClient.prototype.generateId = function () {\r\n return \"callback-id\";\r\n };\r\n StubPerformanceClient.prototype.startPerformanceMeasuremeant = function () {\r\n return new StubPerformanceMeasurement();\r\n };\r\n StubPerformanceClient.prototype.startPerformanceMeasurement = function () {\r\n return new StubPerformanceMeasurement();\r\n };\r\n /* eslint-disable-next-line @typescript-eslint/no-unused-vars */\r\n StubPerformanceClient.prototype.calculateQueuedTime = function (preQueueTime, currentTime) {\r\n return 0;\r\n };\r\n /* eslint-disable-next-line @typescript-eslint/no-unused-vars */\r\n StubPerformanceClient.prototype.addQueueMeasurement = function (eventName, correlationId, queueTime) {\r\n return;\r\n };\r\n /* eslint-disable-next-line @typescript-eslint/no-unused-vars */\r\n StubPerformanceClient.prototype.setPreQueueTime = function (eventName, correlationId) {\r\n return;\r\n };\r\n return StubPerformanceClient;\r\n}(PerformanceClient));\n\nexport { StubPerformanceClient, StubPerformanceMeasurement };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { AuthError } from '../error/AuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar DEFAULT_CRYPTO_IMPLEMENTATION = {\r\n createNewGuid: function () {\r\n var notImplErr = \"Crypto interface - createNewGuid() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n },\r\n base64Decode: function () {\r\n var notImplErr = \"Crypto interface - base64Decode() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n },\r\n base64Encode: function () {\r\n var notImplErr = \"Crypto interface - base64Encode() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n },\r\n generatePkceCodes: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Crypto interface - generatePkceCodes() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n },\r\n getPublicKeyThumbprint: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Crypto interface - getPublicKeyThumbprint() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n },\r\n removeTokenBindingKey: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Crypto interface - removeTokenBindingKey() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n },\r\n clearKeystore: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Crypto interface - clearKeystore() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n },\r\n signJwt: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Crypto interface - signJwt() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n },\r\n hashString: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Crypto interface - hashString() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n }\r\n};\n\nexport { DEFAULT_CRYPTO_IMPLEMENTATION };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { CredentialType, CacheType, Separators, Constants, AuthenticationScheme } from '../../utils/Constants.js';\nimport { ClientAuthError } from '../../error/ClientAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Base type for credentials to be stored in the cache: eg: ACCESS_TOKEN, ID_TOKEN etc\r\n *\r\n * Key:Value Schema:\r\n *\r\n * Key: -------\r\n *\r\n * Value Schema:\r\n * {\r\n * homeAccountId: home account identifier for the auth scheme,\r\n * environment: entity that issued the token, represented as a full host\r\n * credentialType: Type of credential as a string, can be one of the following: RefreshToken, AccessToken, IdToken, Password, Cookie, Certificate, Other\r\n * clientId: client ID of the application\r\n * secret: Actual credential as a string\r\n * familyId: Family ID identifier, usually only used for refresh tokens\r\n * realm: Full tenant or organizational identifier that the account belongs to\r\n * target: Permissions that are included in the token, or for refresh tokens, the resource identifier.\r\n * tokenType: Matches the authentication scheme for which the token was issued (i.e. Bearer or pop)\r\n * requestedClaimsHash: Matches the SHA 256 hash of the claims object included in the token request\r\n * userAssertionHash: Matches the SHA 256 hash of the obo_assertion for the OBO flow\r\n * }\r\n */\r\nvar CredentialEntity = /** @class */ (function () {\r\n function CredentialEntity() {\r\n }\r\n /**\r\n * Generate Account Id key component as per the schema: -\r\n */\r\n CredentialEntity.prototype.generateAccountId = function () {\r\n return CredentialEntity.generateAccountIdForCacheKey(this.homeAccountId, this.environment);\r\n };\r\n /**\r\n * Generate Credential Id key component as per the schema: --\r\n */\r\n CredentialEntity.prototype.generateCredentialId = function () {\r\n return CredentialEntity.generateCredentialIdForCacheKey(this.credentialType, this.clientId, this.realm, this.familyId);\r\n };\r\n /**\r\n * Generate target key component as per schema: \r\n */\r\n CredentialEntity.prototype.generateTarget = function () {\r\n return CredentialEntity.generateTargetForCacheKey(this.target);\r\n };\r\n /**\r\n * generates credential key\r\n */\r\n CredentialEntity.prototype.generateCredentialKey = function () {\r\n return CredentialEntity.generateCredentialCacheKey(this.homeAccountId, this.environment, this.credentialType, this.clientId, this.realm, this.target, this.familyId, this.tokenType, this.requestedClaimsHash);\r\n };\r\n /**\r\n * returns the type of the cache (in this case credential)\r\n */\r\n CredentialEntity.prototype.generateType = function () {\r\n switch (this.credentialType) {\r\n case CredentialType.ID_TOKEN:\r\n return CacheType.ID_TOKEN;\r\n case CredentialType.ACCESS_TOKEN:\r\n case CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME:\r\n return CacheType.ACCESS_TOKEN;\r\n case CredentialType.REFRESH_TOKEN:\r\n return CacheType.REFRESH_TOKEN;\r\n default: {\r\n throw ClientAuthError.createUnexpectedCredentialTypeError();\r\n }\r\n }\r\n };\r\n /**\r\n * generates credential key\r\n * -\\-----\r\n */\r\n CredentialEntity.generateCredentialCacheKey = function (homeAccountId, environment, credentialType, clientId, realm, target, familyId, tokenType, requestedClaimsHash) {\r\n var credentialKey = [\r\n this.generateAccountIdForCacheKey(homeAccountId, environment),\r\n this.generateCredentialIdForCacheKey(credentialType, clientId, realm, familyId),\r\n this.generateTargetForCacheKey(target),\r\n this.generateClaimsHashForCacheKey(requestedClaimsHash),\r\n this.generateSchemeForCacheKey(tokenType)\r\n ];\r\n return credentialKey.join(Separators.CACHE_KEY_SEPARATOR).toLowerCase();\r\n };\r\n /**\r\n * generates Account Id for keys\r\n * @param homeAccountId\r\n * @param environment\r\n */\r\n CredentialEntity.generateAccountIdForCacheKey = function (homeAccountId, environment) {\r\n var accountId = [homeAccountId, environment];\r\n return accountId.join(Separators.CACHE_KEY_SEPARATOR).toLowerCase();\r\n };\r\n /**\r\n * Generates Credential Id for keys\r\n * @param credentialType\r\n * @param realm\r\n * @param clientId\r\n * @param familyId\r\n */\r\n CredentialEntity.generateCredentialIdForCacheKey = function (credentialType, clientId, realm, familyId) {\r\n var clientOrFamilyId = credentialType === CredentialType.REFRESH_TOKEN\r\n ? familyId || clientId\r\n : clientId;\r\n var credentialId = [\r\n credentialType,\r\n clientOrFamilyId,\r\n realm || Constants.EMPTY_STRING,\r\n ];\r\n return credentialId.join(Separators.CACHE_KEY_SEPARATOR).toLowerCase();\r\n };\r\n /**\r\n * Generate target key component as per schema: \r\n */\r\n CredentialEntity.generateTargetForCacheKey = function (scopes) {\r\n return (scopes || Constants.EMPTY_STRING).toLowerCase();\r\n };\r\n /**\r\n * Generate requested claims key component as per schema: \r\n */\r\n CredentialEntity.generateClaimsHashForCacheKey = function (requestedClaimsHash) {\r\n return (requestedClaimsHash || Constants.EMPTY_STRING).toLowerCase();\r\n };\r\n /**\r\n * Generate scheme key componenet as per schema: \r\n */\r\n CredentialEntity.generateSchemeForCacheKey = function (tokenType) {\r\n /*\r\n * PoP Tokens and SSH certs include scheme in cache key\r\n * Cast to lowercase to handle \"bearer\" from ADFS\r\n */\r\n return (tokenType && tokenType.toLowerCase() !== AuthenticationScheme.BEARER.toLowerCase()) ? tokenType.toLowerCase() : Constants.EMPTY_STRING;\r\n };\r\n return CredentialEntity;\r\n}());\n\nexport { CredentialEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../../_virtual/_tslib.js';\nimport { CredentialEntity } from './CredentialEntity.js';\nimport { CredentialType } from '../../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * ID_TOKEN Cache\r\n *\r\n * Key:Value Schema:\r\n *\r\n * Key Example: uid.utid-login.microsoftonline.com-idtoken-clientId-contoso.com-\r\n *\r\n * Value Schema:\r\n * {\r\n * homeAccountId: home account identifier for the auth scheme,\r\n * environment: entity that issued the token, represented as a full host\r\n * credentialType: Type of credential as a string, can be one of the following: RefreshToken, AccessToken, IdToken, Password, Cookie, Certificate, Other\r\n * clientId: client ID of the application\r\n * secret: Actual credential as a string\r\n * realm: Full tenant or organizational identifier that the account belongs to\r\n * }\r\n */\r\nvar IdTokenEntity = /** @class */ (function (_super) {\r\n __extends(IdTokenEntity, _super);\r\n function IdTokenEntity() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n /**\r\n * Create IdTokenEntity\r\n * @param homeAccountId\r\n * @param authenticationResult\r\n * @param clientId\r\n * @param authority\r\n */\r\n IdTokenEntity.createIdTokenEntity = function (homeAccountId, environment, idToken, clientId, tenantId) {\r\n var idTokenEntity = new IdTokenEntity();\r\n idTokenEntity.credentialType = CredentialType.ID_TOKEN;\r\n idTokenEntity.homeAccountId = homeAccountId;\r\n idTokenEntity.environment = environment;\r\n idTokenEntity.clientId = clientId;\r\n idTokenEntity.secret = idToken;\r\n idTokenEntity.realm = tenantId;\r\n return idTokenEntity;\r\n };\r\n /**\r\n * Validates an entity: checks for all expected params\r\n * @param entity\r\n */\r\n IdTokenEntity.isIdTokenEntity = function (entity) {\r\n if (!entity) {\r\n return false;\r\n }\r\n return (entity.hasOwnProperty(\"homeAccountId\") &&\r\n entity.hasOwnProperty(\"environment\") &&\r\n entity.hasOwnProperty(\"credentialType\") &&\r\n entity.hasOwnProperty(\"realm\") &&\r\n entity.hasOwnProperty(\"clientId\") &&\r\n entity.hasOwnProperty(\"secret\") &&\r\n entity[\"credentialType\"] === CredentialType.ID_TOKEN);\r\n };\r\n return IdTokenEntity;\r\n}(CredentialEntity));\n\nexport { IdTokenEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __spreadArrays } from '../_virtual/_tslib.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { Constants, OIDC_SCOPES } from '../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * The ScopeSet class creates a set of scopes. Scopes are case-insensitive, unique values, so the Set object in JS makes\r\n * the most sense to implement for this class. All scopes are trimmed and converted to lower case strings in intersection and union functions\r\n * to ensure uniqueness of strings.\r\n */\r\nvar ScopeSet = /** @class */ (function () {\r\n function ScopeSet(inputScopes) {\r\n var _this = this;\r\n // Filter empty string and null/undefined array items\r\n var scopeArr = inputScopes ? StringUtils.trimArrayEntries(__spreadArrays(inputScopes)) : [];\r\n var filteredInput = scopeArr ? StringUtils.removeEmptyStringsFromArray(scopeArr) : [];\r\n // Validate and filter scopes (validate function throws if validation fails)\r\n this.validateInputScopes(filteredInput);\r\n this.scopes = new Set(); // Iterator in constructor not supported by IE11\r\n filteredInput.forEach(function (scope) { return _this.scopes.add(scope); });\r\n }\r\n /**\r\n * Factory method to create ScopeSet from space-delimited string\r\n * @param inputScopeString\r\n * @param appClientId\r\n * @param scopesRequired\r\n */\r\n ScopeSet.fromString = function (inputScopeString) {\r\n var scopeString = inputScopeString || Constants.EMPTY_STRING;\r\n var inputScopes = scopeString.split(\" \");\r\n return new ScopeSet(inputScopes);\r\n };\r\n /**\r\n * Creates the set of scopes to search for in cache lookups\r\n * @param inputScopeString\r\n * @returns\r\n */\r\n ScopeSet.createSearchScopes = function (inputScopeString) {\r\n var scopeSet = new ScopeSet(inputScopeString);\r\n if (!scopeSet.containsOnlyOIDCScopes()) {\r\n scopeSet.removeOIDCScopes();\r\n }\r\n else {\r\n scopeSet.removeScope(Constants.OFFLINE_ACCESS_SCOPE);\r\n }\r\n return scopeSet;\r\n };\r\n /**\r\n * Used to validate the scopes input parameter requested by the developer.\r\n * @param {Array} inputScopes - Developer requested permissions. Not all scopes are guaranteed to be included in the access token returned.\r\n * @param {boolean} scopesRequired - Boolean indicating whether the scopes array is required or not\r\n */\r\n ScopeSet.prototype.validateInputScopes = function (inputScopes) {\r\n // Check if scopes are required but not given or is an empty array\r\n if (!inputScopes || inputScopes.length < 1) {\r\n throw ClientConfigurationError.createEmptyScopesArrayError();\r\n }\r\n };\r\n /**\r\n * Check if a given scope is present in this set of scopes.\r\n * @param scope\r\n */\r\n ScopeSet.prototype.containsScope = function (scope) {\r\n var lowerCaseScopes = this.printScopesLowerCase().split(\" \");\r\n var lowerCaseScopesSet = new ScopeSet(lowerCaseScopes);\r\n // compare lowercase scopes\r\n return !StringUtils.isEmpty(scope) ? lowerCaseScopesSet.scopes.has(scope.toLowerCase()) : false;\r\n };\r\n /**\r\n * Check if a set of scopes is present in this set of scopes.\r\n * @param scopeSet\r\n */\r\n ScopeSet.prototype.containsScopeSet = function (scopeSet) {\r\n var _this = this;\r\n if (!scopeSet || scopeSet.scopes.size <= 0) {\r\n return false;\r\n }\r\n return (this.scopes.size >= scopeSet.scopes.size && scopeSet.asArray().every(function (scope) { return _this.containsScope(scope); }));\r\n };\r\n /**\r\n * Check if set of scopes contains only the defaults\r\n */\r\n ScopeSet.prototype.containsOnlyOIDCScopes = function () {\r\n var _this = this;\r\n var defaultScopeCount = 0;\r\n OIDC_SCOPES.forEach(function (defaultScope) {\r\n if (_this.containsScope(defaultScope)) {\r\n defaultScopeCount += 1;\r\n }\r\n });\r\n return this.scopes.size === defaultScopeCount;\r\n };\r\n /**\r\n * Appends single scope if passed\r\n * @param newScope\r\n */\r\n ScopeSet.prototype.appendScope = function (newScope) {\r\n if (!StringUtils.isEmpty(newScope)) {\r\n this.scopes.add(newScope.trim());\r\n }\r\n };\r\n /**\r\n * Appends multiple scopes if passed\r\n * @param newScopes\r\n */\r\n ScopeSet.prototype.appendScopes = function (newScopes) {\r\n var _this = this;\r\n try {\r\n newScopes.forEach(function (newScope) { return _this.appendScope(newScope); });\r\n }\r\n catch (e) {\r\n throw ClientAuthError.createAppendScopeSetError(e);\r\n }\r\n };\r\n /**\r\n * Removes element from set of scopes.\r\n * @param scope\r\n */\r\n ScopeSet.prototype.removeScope = function (scope) {\r\n if (StringUtils.isEmpty(scope)) {\r\n throw ClientAuthError.createRemoveEmptyScopeFromSetError(scope);\r\n }\r\n this.scopes.delete(scope.trim());\r\n };\r\n /**\r\n * Removes default scopes from set of scopes\r\n * Primarily used to prevent cache misses if the default scopes are not returned from the server\r\n */\r\n ScopeSet.prototype.removeOIDCScopes = function () {\r\n var _this = this;\r\n OIDC_SCOPES.forEach(function (defaultScope) {\r\n _this.scopes.delete(defaultScope);\r\n });\r\n };\r\n /**\r\n * Combines an array of scopes with the current set of scopes.\r\n * @param otherScopes\r\n */\r\n ScopeSet.prototype.unionScopeSets = function (otherScopes) {\r\n if (!otherScopes) {\r\n throw ClientAuthError.createEmptyInputScopeSetError();\r\n }\r\n var unionScopes = new Set(); // Iterator in constructor not supported in IE11\r\n otherScopes.scopes.forEach(function (scope) { return unionScopes.add(scope.toLowerCase()); });\r\n this.scopes.forEach(function (scope) { return unionScopes.add(scope.toLowerCase()); });\r\n return unionScopes;\r\n };\r\n /**\r\n * Check if scopes intersect between this set and another.\r\n * @param otherScopes\r\n */\r\n ScopeSet.prototype.intersectingScopeSets = function (otherScopes) {\r\n if (!otherScopes) {\r\n throw ClientAuthError.createEmptyInputScopeSetError();\r\n }\r\n // Do not allow OIDC scopes to be the only intersecting scopes\r\n if (!otherScopes.containsOnlyOIDCScopes()) {\r\n otherScopes.removeOIDCScopes();\r\n }\r\n var unionScopes = this.unionScopeSets(otherScopes);\r\n var sizeOtherScopes = otherScopes.getScopeCount();\r\n var sizeThisScopes = this.getScopeCount();\r\n var sizeUnionScopes = unionScopes.size;\r\n return sizeUnionScopes < (sizeThisScopes + sizeOtherScopes);\r\n };\r\n /**\r\n * Returns size of set of scopes.\r\n */\r\n ScopeSet.prototype.getScopeCount = function () {\r\n return this.scopes.size;\r\n };\r\n /**\r\n * Returns the scopes as an array of string values\r\n */\r\n ScopeSet.prototype.asArray = function () {\r\n var array = [];\r\n this.scopes.forEach(function (val) { return array.push(val); });\r\n return array;\r\n };\r\n /**\r\n * Prints scopes into a space-delimited string\r\n */\r\n ScopeSet.prototype.printScopes = function () {\r\n if (this.scopes) {\r\n var scopeArr = this.asArray();\r\n return scopeArr.join(\" \");\r\n }\r\n return Constants.EMPTY_STRING;\r\n };\r\n /**\r\n * Prints scopes into a space-delimited lower-case string (used for caching)\r\n */\r\n ScopeSet.prototype.printScopesLowerCase = function () {\r\n return this.printScopes().toLowerCase();\r\n };\r\n return ScopeSet;\r\n}());\n\nexport { ScopeSet };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { StringUtils } from '../utils/StringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * JWT Token representation class. Parses token string and generates claims object.\r\n */\r\nvar AuthToken = /** @class */ (function () {\r\n function AuthToken(rawToken, crypto) {\r\n if (StringUtils.isEmpty(rawToken)) {\r\n throw ClientAuthError.createTokenNullOrEmptyError(rawToken);\r\n }\r\n this.rawToken = rawToken;\r\n this.claims = AuthToken.extractTokenClaims(rawToken, crypto);\r\n }\r\n /**\r\n * Extract token by decoding the rawToken\r\n *\r\n * @param encodedToken\r\n */\r\n AuthToken.extractTokenClaims = function (encodedToken, crypto) {\r\n var decodedToken = StringUtils.decodeAuthToken(encodedToken);\r\n // token will be decoded to get the username\r\n try {\r\n var base64TokenPayload = decodedToken.JWSPayload;\r\n // base64Decode() should throw an error if there is an issue\r\n var base64Decoded = crypto.base64Decode(base64TokenPayload);\r\n return JSON.parse(base64Decoded);\r\n }\r\n catch (err) {\r\n throw ClientAuthError.createTokenParsingError(err);\r\n }\r\n };\r\n /**\r\n * Determine if the token's max_age has transpired\r\n */\r\n AuthToken.checkMaxAge = function (authTime, maxAge) {\r\n /*\r\n * per https://openid.net/specs/openid-connect-core-1_0.html#AuthRequest\r\n * To force an immediate re-authentication: If an app requires that a user re-authenticate prior to access,\r\n * provide a value of 0 for the max_age parameter and the AS will force a fresh login.\r\n */\r\n var fiveMinuteSkew = 300000; // five minutes in milliseconds\r\n if ((maxAge === 0) || ((Date.now() - fiveMinuteSkew) > (authTime + maxAge))) {\r\n throw ClientAuthError.createMaxAgeTranspiredError();\r\n }\r\n };\r\n return AuthToken;\r\n}());\n\nexport { AuthToken };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/* eslint-disable header/header */\r\nvar name = \"@azure/msal-common\";\r\nvar version = \"13.3.3\";\n\nexport { name, version };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __assign, __extends, __generator } from '../_virtual/_tslib.js';\nimport { Separators, CredentialType, AuthenticationScheme, THE_FAMILY_ID, APP_METADATA, AUTHORITY_METADATA_CONSTANTS } from '../utils/Constants.js';\nimport { ScopeSet } from '../request/ScopeSet.js';\nimport { AccountEntity } from './entities/AccountEntity.js';\nimport { AuthError } from '../error/AuthError.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { AuthToken } from '../account/AuthToken.js';\nimport { name, version } from '../packageMetadata.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Interface class which implement cache storage functions used by MSAL to perform validity checks, and store tokens.\r\n */\r\nvar CacheManager = /** @class */ (function () {\r\n function CacheManager(clientId, cryptoImpl, logger) {\r\n this.clientId = clientId;\r\n this.cryptoImpl = cryptoImpl;\r\n this.commonLogger = logger.clone(name, version);\r\n }\r\n /**\r\n * Returns all accounts in cache\r\n */\r\n CacheManager.prototype.getAllAccounts = function () {\r\n var _this = this;\r\n var allAccountKeys = this.getAccountKeys();\r\n if (allAccountKeys.length < 1) {\r\n return [];\r\n }\r\n var accountEntities = allAccountKeys.reduce(function (accounts, key) {\r\n var entity = _this.getAccount(key);\r\n if (!entity) {\r\n return accounts;\r\n }\r\n accounts.push(entity);\r\n return accounts;\r\n }, []);\r\n if (accountEntities.length < 1) {\r\n return [];\r\n }\r\n else {\r\n var allAccounts = accountEntities.map(function (accountEntity) {\r\n return _this.getAccountInfoFromEntity(accountEntity);\r\n });\r\n return allAccounts;\r\n }\r\n };\r\n /**\r\n * Gets accountInfo object based on provided filters\r\n */\r\n CacheManager.prototype.getAccountInfoFilteredBy = function (accountFilter) {\r\n var allAccounts = this.getAccountsFilteredBy(accountFilter);\r\n if (allAccounts.length > 0) {\r\n return this.getAccountInfoFromEntity(allAccounts[0]);\r\n }\r\n else {\r\n return null;\r\n }\r\n };\r\n CacheManager.prototype.getAccountInfoFromEntity = function (accountEntity) {\r\n var accountInfo = accountEntity.getAccountInfo();\r\n var idToken = this.getIdToken(accountInfo);\r\n if (idToken) {\r\n accountInfo.idToken = idToken.secret;\r\n accountInfo.idTokenClaims = new AuthToken(idToken.secret, this.cryptoImpl).claims;\r\n }\r\n return accountInfo;\r\n };\r\n /**\r\n * saves a cache record\r\n * @param cacheRecord\r\n */\r\n CacheManager.prototype.saveCacheRecord = function (cacheRecord) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n if (!cacheRecord) {\r\n throw ClientAuthError.createNullOrUndefinedCacheRecord();\r\n }\r\n if (!!cacheRecord.account) {\r\n this.setAccount(cacheRecord.account);\r\n }\r\n if (!!cacheRecord.idToken) {\r\n this.setIdTokenCredential(cacheRecord.idToken);\r\n }\r\n if (!!!cacheRecord.accessToken) return [3 /*break*/, 2];\r\n return [4 /*yield*/, this.saveAccessToken(cacheRecord.accessToken)];\r\n case 1:\r\n _a.sent();\r\n _a.label = 2;\r\n case 2:\r\n if (!!cacheRecord.refreshToken) {\r\n this.setRefreshTokenCredential(cacheRecord.refreshToken);\r\n }\r\n if (!!cacheRecord.appMetadata) {\r\n this.setAppMetadata(cacheRecord.appMetadata);\r\n }\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * saves access token credential\r\n * @param credential\r\n */\r\n CacheManager.prototype.saveAccessToken = function (credential) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var accessTokenFilter, tokenKeys, currentScopes, removedAccessTokens;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n accessTokenFilter = {\r\n clientId: credential.clientId,\r\n credentialType: credential.credentialType,\r\n environment: credential.environment,\r\n homeAccountId: credential.homeAccountId,\r\n realm: credential.realm,\r\n tokenType: credential.tokenType,\r\n requestedClaimsHash: credential.requestedClaimsHash\r\n };\r\n tokenKeys = this.getTokenKeys();\r\n currentScopes = ScopeSet.fromString(credential.target);\r\n removedAccessTokens = [];\r\n tokenKeys.accessToken.forEach(function (key) {\r\n if (!_this.accessTokenKeyMatchesFilter(key, accessTokenFilter, false)) {\r\n return;\r\n }\r\n var tokenEntity = _this.getAccessTokenCredential(key);\r\n if (tokenEntity && _this.credentialMatchesFilter(tokenEntity, accessTokenFilter)) {\r\n var tokenScopeSet = ScopeSet.fromString(tokenEntity.target);\r\n if (tokenScopeSet.intersectingScopeSets(currentScopes)) {\r\n removedAccessTokens.push(_this.removeAccessToken(key));\r\n }\r\n }\r\n });\r\n return [4 /*yield*/, Promise.all(removedAccessTokens)];\r\n case 1:\r\n _a.sent();\r\n this.setAccessTokenCredential(credential);\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * retrieve accounts matching all provided filters; if no filter is set, get all accounts\r\n * not checking for casing as keys are all generated in lower case, remember to convert to lower case if object properties are compared\r\n * @param homeAccountId\r\n * @param environment\r\n * @param realm\r\n */\r\n CacheManager.prototype.getAccountsFilteredBy = function (accountFilter) {\r\n var _this = this;\r\n var allAccountKeys = this.getAccountKeys();\r\n var matchingAccounts = [];\r\n allAccountKeys.forEach(function (cacheKey) {\r\n if (!_this.isAccountKey(cacheKey, accountFilter.homeAccountId, accountFilter.realm)) {\r\n // Don't parse value if the key doesn't match the account filters\r\n return;\r\n }\r\n var entity = _this.getAccount(cacheKey);\r\n if (!entity) {\r\n return;\r\n }\r\n if (!!accountFilter.homeAccountId && !_this.matchHomeAccountId(entity, accountFilter.homeAccountId)) {\r\n return;\r\n }\r\n if (!!accountFilter.localAccountId && !_this.matchLocalAccountId(entity, accountFilter.localAccountId)) {\r\n return;\r\n }\r\n if (!!accountFilter.username && !_this.matchUsername(entity, accountFilter.username)) {\r\n return;\r\n }\r\n if (!!accountFilter.environment && !_this.matchEnvironment(entity, accountFilter.environment)) {\r\n return;\r\n }\r\n if (!!accountFilter.realm && !_this.matchRealm(entity, accountFilter.realm)) {\r\n return;\r\n }\r\n if (!!accountFilter.nativeAccountId && !_this.matchNativeAccountId(entity, accountFilter.nativeAccountId)) {\r\n return;\r\n }\r\n matchingAccounts.push(entity);\r\n });\r\n return matchingAccounts;\r\n };\r\n /**\r\n * Returns true if the given key matches our account key schema. Also matches homeAccountId and/or tenantId if provided\r\n * @param key\r\n * @param homeAccountId\r\n * @param tenantId\r\n * @returns\r\n */\r\n CacheManager.prototype.isAccountKey = function (key, homeAccountId, tenantId) {\r\n if (key.split(Separators.CACHE_KEY_SEPARATOR).length < 3) {\r\n // Account cache keys contain 3 items separated by '-' (each item may also contain '-')\r\n return false;\r\n }\r\n if (homeAccountId && !key.toLowerCase().includes(homeAccountId.toLowerCase())) {\r\n return false;\r\n }\r\n if (tenantId && !key.toLowerCase().includes(tenantId.toLowerCase())) {\r\n return false;\r\n }\r\n // Do not check environment as aliasing can cause false negatives\r\n return true;\r\n };\r\n /**\r\n * Returns true if the given key matches our credential key schema.\r\n * @param key\r\n */\r\n CacheManager.prototype.isCredentialKey = function (key) {\r\n if (key.split(Separators.CACHE_KEY_SEPARATOR).length < 6) {\r\n // Credential cache keys contain 6 items separated by '-' (each item may also contain '-')\r\n return false;\r\n }\r\n var lowerCaseKey = key.toLowerCase();\r\n // Credential keys must indicate what credential type they represent\r\n if (lowerCaseKey.indexOf(CredentialType.ID_TOKEN.toLowerCase()) === -1 &&\r\n lowerCaseKey.indexOf(CredentialType.ACCESS_TOKEN.toLowerCase()) === -1 &&\r\n lowerCaseKey.indexOf(CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME.toLowerCase()) === -1 &&\r\n lowerCaseKey.indexOf(CredentialType.REFRESH_TOKEN.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (lowerCaseKey.indexOf(CredentialType.REFRESH_TOKEN.toLowerCase()) > -1) {\r\n // Refresh tokens must contain the client id or family id\r\n var clientIdValidation = \"\" + CredentialType.REFRESH_TOKEN + Separators.CACHE_KEY_SEPARATOR + this.clientId + Separators.CACHE_KEY_SEPARATOR;\r\n var familyIdValidation = \"\" + CredentialType.REFRESH_TOKEN + Separators.CACHE_KEY_SEPARATOR + THE_FAMILY_ID + Separators.CACHE_KEY_SEPARATOR;\r\n if (lowerCaseKey.indexOf(clientIdValidation.toLowerCase()) === -1 && lowerCaseKey.indexOf(familyIdValidation.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n }\r\n else if (lowerCaseKey.indexOf(this.clientId.toLowerCase()) === -1) {\r\n // Tokens must contain the clientId\r\n return false;\r\n }\r\n return true;\r\n };\r\n /**\r\n * Returns whether or not the given credential entity matches the filter\r\n * @param entity\r\n * @param filter\r\n * @returns\r\n */\r\n CacheManager.prototype.credentialMatchesFilter = function (entity, filter) {\r\n if (!!filter.clientId && !this.matchClientId(entity, filter.clientId)) {\r\n return false;\r\n }\r\n if (!!filter.userAssertionHash && !this.matchUserAssertionHash(entity, filter.userAssertionHash)) {\r\n return false;\r\n }\r\n /*\r\n * homeAccountId can be undefined, and we want to filter out cached items that have a homeAccountId of \"\"\r\n * because we don't want a client_credential request to return a cached token that has a homeAccountId\r\n */\r\n if ((typeof filter.homeAccountId === \"string\") && !this.matchHomeAccountId(entity, filter.homeAccountId)) {\r\n return false;\r\n }\r\n if (!!filter.environment && !this.matchEnvironment(entity, filter.environment)) {\r\n return false;\r\n }\r\n if (!!filter.realm && !this.matchRealm(entity, filter.realm)) {\r\n return false;\r\n }\r\n if (!!filter.credentialType && !this.matchCredentialType(entity, filter.credentialType)) {\r\n return false;\r\n }\r\n if (!!filter.familyId && !this.matchFamilyId(entity, filter.familyId)) {\r\n return false;\r\n }\r\n /*\r\n * idTokens do not have \"target\", target specific refreshTokens do exist for some types of authentication\r\n * Resource specific refresh tokens case will be added when the support is deemed necessary\r\n */\r\n if (!!filter.target && !this.matchTarget(entity, filter.target)) {\r\n return false;\r\n }\r\n // If request OR cached entity has requested Claims Hash, check if they match\r\n if (filter.requestedClaimsHash || entity.requestedClaimsHash) {\r\n // Don't match if either is undefined or they are different\r\n if (entity.requestedClaimsHash !== filter.requestedClaimsHash) {\r\n return false;\r\n }\r\n }\r\n // Access Token with Auth Scheme specific matching\r\n if (entity.credentialType === CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME) {\r\n if (!!filter.tokenType && !this.matchTokenType(entity, filter.tokenType)) {\r\n return false;\r\n }\r\n // KeyId (sshKid) in request must match cached SSH certificate keyId because SSH cert is bound to a specific key\r\n if (filter.tokenType === AuthenticationScheme.SSH) {\r\n if (filter.keyId && !this.matchKeyId(entity, filter.keyId)) {\r\n return false;\r\n }\r\n }\r\n }\r\n return true;\r\n };\r\n /**\r\n * retrieve appMetadata matching all provided filters; if no filter is set, get all appMetadata\r\n * @param filter\r\n */\r\n CacheManager.prototype.getAppMetadataFilteredBy = function (filter) {\r\n return this.getAppMetadataFilteredByInternal(filter.environment, filter.clientId);\r\n };\r\n /**\r\n * Support function to help match appMetadata\r\n * @param environment\r\n * @param clientId\r\n */\r\n CacheManager.prototype.getAppMetadataFilteredByInternal = function (environment, clientId) {\r\n var _this = this;\r\n var allCacheKeys = this.getKeys();\r\n var matchingAppMetadata = {};\r\n allCacheKeys.forEach(function (cacheKey) {\r\n // don't parse any non-appMetadata type cache entities\r\n if (!_this.isAppMetadata(cacheKey)) {\r\n return;\r\n }\r\n // Attempt retrieval\r\n var entity = _this.getAppMetadata(cacheKey);\r\n if (!entity) {\r\n return;\r\n }\r\n if (!!environment && !_this.matchEnvironment(entity, environment)) {\r\n return;\r\n }\r\n if (!!clientId && !_this.matchClientId(entity, clientId)) {\r\n return;\r\n }\r\n matchingAppMetadata[cacheKey] = entity;\r\n });\r\n return matchingAppMetadata;\r\n };\r\n /**\r\n * retrieve authorityMetadata that contains a matching alias\r\n * @param filter\r\n */\r\n CacheManager.prototype.getAuthorityMetadataByAlias = function (host) {\r\n var _this = this;\r\n var allCacheKeys = this.getAuthorityMetadataKeys();\r\n var matchedEntity = null;\r\n allCacheKeys.forEach(function (cacheKey) {\r\n // don't parse any non-authorityMetadata type cache entities\r\n if (!_this.isAuthorityMetadata(cacheKey) || cacheKey.indexOf(_this.clientId) === -1) {\r\n return;\r\n }\r\n // Attempt retrieval\r\n var entity = _this.getAuthorityMetadata(cacheKey);\r\n if (!entity) {\r\n return;\r\n }\r\n if (entity.aliases.indexOf(host) === -1) {\r\n return;\r\n }\r\n matchedEntity = entity;\r\n });\r\n return matchedEntity;\r\n };\r\n /**\r\n * Removes all accounts and related tokens from cache.\r\n */\r\n CacheManager.prototype.removeAllAccounts = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var allAccountKeys, removedAccounts;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n allAccountKeys = this.getAccountKeys();\r\n removedAccounts = [];\r\n allAccountKeys.forEach(function (cacheKey) {\r\n removedAccounts.push(_this.removeAccount(cacheKey));\r\n });\r\n return [4 /*yield*/, Promise.all(removedAccounts)];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes the account and related tokens for a given account key\r\n * @param account\r\n */\r\n CacheManager.prototype.removeAccount = function (accountKey) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var account;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n account = this.getAccount(accountKey);\r\n if (!account) {\r\n throw ClientAuthError.createNoAccountFoundError();\r\n }\r\n return [4 /*yield*/, this.removeAccountContext(account)];\r\n case 1:\r\n _a.sent();\r\n this.removeItem(accountKey);\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes credentials associated with the provided account\r\n * @param account\r\n */\r\n CacheManager.prototype.removeAccountContext = function (account) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var allTokenKeys, accountId, removedCredentials;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n allTokenKeys = this.getTokenKeys();\r\n accountId = account.generateAccountId();\r\n removedCredentials = [];\r\n allTokenKeys.idToken.forEach(function (key) {\r\n if (key.indexOf(accountId) === 0) {\r\n _this.removeIdToken(key);\r\n }\r\n });\r\n allTokenKeys.accessToken.forEach(function (key) {\r\n if (key.indexOf(accountId) === 0) {\r\n removedCredentials.push(_this.removeAccessToken(key));\r\n }\r\n });\r\n allTokenKeys.refreshToken.forEach(function (key) {\r\n if (key.indexOf(accountId) === 0) {\r\n _this.removeRefreshToken(key);\r\n }\r\n });\r\n return [4 /*yield*/, Promise.all(removedCredentials)];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * returns a boolean if the given credential is removed\r\n * @param credential\r\n */\r\n CacheManager.prototype.removeAccessToken = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var credential, accessTokenWithAuthSchemeEntity, kid;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n credential = this.getAccessTokenCredential(key);\r\n if (!credential) {\r\n return [2 /*return*/];\r\n }\r\n if (!(credential.credentialType.toLowerCase() === CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME.toLowerCase())) return [3 /*break*/, 4];\r\n if (!(credential.tokenType === AuthenticationScheme.POP)) return [3 /*break*/, 4];\r\n accessTokenWithAuthSchemeEntity = credential;\r\n kid = accessTokenWithAuthSchemeEntity.keyId;\r\n if (!kid) return [3 /*break*/, 4];\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.cryptoImpl.removeTokenBindingKey(kid)];\r\n case 2:\r\n _a.sent();\r\n return [3 /*break*/, 4];\r\n case 3:\r\n _a.sent();\r\n throw ClientAuthError.createBindingKeyNotRemovedError();\r\n case 4: return [2 /*return*/, this.removeItem(key)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Removes all app metadata objects from cache.\r\n */\r\n CacheManager.prototype.removeAppMetadata = function () {\r\n var _this = this;\r\n var allCacheKeys = this.getKeys();\r\n allCacheKeys.forEach(function (cacheKey) {\r\n if (_this.isAppMetadata(cacheKey)) {\r\n _this.removeItem(cacheKey);\r\n }\r\n });\r\n return true;\r\n };\r\n /**\r\n * Retrieve the cached credentials into a cacherecord\r\n * @param account\r\n * @param clientId\r\n * @param scopes\r\n * @param environment\r\n * @param authScheme\r\n */\r\n CacheManager.prototype.readCacheRecord = function (account, request, environment) {\r\n var tokenKeys = this.getTokenKeys();\r\n var cachedAccount = this.readAccountFromCache(account);\r\n var cachedIdToken = this.getIdToken(account, tokenKeys);\r\n var cachedAccessToken = this.getAccessToken(account, request, tokenKeys);\r\n var cachedRefreshToken = this.getRefreshToken(account, false, tokenKeys);\r\n var cachedAppMetadata = this.readAppMetadataFromCache(environment);\r\n if (cachedAccount && cachedIdToken) {\r\n cachedAccount.idTokenClaims = new AuthToken(cachedIdToken.secret, this.cryptoImpl).claims;\r\n }\r\n return {\r\n account: cachedAccount,\r\n idToken: cachedIdToken,\r\n accessToken: cachedAccessToken,\r\n refreshToken: cachedRefreshToken,\r\n appMetadata: cachedAppMetadata,\r\n };\r\n };\r\n /**\r\n * Retrieve AccountEntity from cache\r\n * @param account\r\n */\r\n CacheManager.prototype.readAccountFromCache = function (account) {\r\n var accountKey = AccountEntity.generateAccountCacheKey(account);\r\n return this.getAccount(accountKey);\r\n };\r\n /**\r\n * Retrieve IdTokenEntity from cache\r\n * @param clientId\r\n * @param account\r\n * @param inputRealm\r\n */\r\n CacheManager.prototype.getIdToken = function (account, tokenKeys) {\r\n var _this = this;\r\n this.commonLogger.trace(\"CacheManager - getIdToken called\");\r\n var idTokenFilter = {\r\n homeAccountId: account.homeAccountId,\r\n environment: account.environment,\r\n credentialType: CredentialType.ID_TOKEN,\r\n clientId: this.clientId,\r\n realm: account.tenantId,\r\n };\r\n var idTokens = this.getIdTokensByFilter(idTokenFilter, tokenKeys);\r\n var numIdTokens = idTokens.length;\r\n if (numIdTokens < 1) {\r\n this.commonLogger.info(\"CacheManager:getIdToken - No token found\");\r\n return null;\r\n }\r\n else if (numIdTokens > 1) {\r\n this.commonLogger.info(\"CacheManager:getIdToken - Multiple id tokens found, clearing them\");\r\n idTokens.forEach(function (idToken) {\r\n _this.removeIdToken(idToken.generateCredentialKey());\r\n });\r\n return null;\r\n }\r\n this.commonLogger.info(\"CacheManager:getIdToken - Returning id token\");\r\n return idTokens[0];\r\n };\r\n /**\r\n * Gets all idTokens matching the given filter\r\n * @param filter\r\n * @returns\r\n */\r\n CacheManager.prototype.getIdTokensByFilter = function (filter, tokenKeys) {\r\n var _this = this;\r\n var idTokenKeys = tokenKeys && tokenKeys.idToken || this.getTokenKeys().idToken;\r\n var idTokens = [];\r\n idTokenKeys.forEach(function (key) {\r\n if (!_this.idTokenKeyMatchesFilter(key, __assign({ clientId: _this.clientId }, filter))) {\r\n return;\r\n }\r\n var idToken = _this.getIdTokenCredential(key);\r\n if (idToken && _this.credentialMatchesFilter(idToken, filter)) {\r\n idTokens.push(idToken);\r\n }\r\n });\r\n return idTokens;\r\n };\r\n /**\r\n * Validate the cache key against filter before retrieving and parsing cache value\r\n * @param key\r\n * @param filter\r\n * @returns\r\n */\r\n CacheManager.prototype.idTokenKeyMatchesFilter = function (inputKey, filter) {\r\n var key = inputKey.toLowerCase();\r\n if (filter.clientId && key.indexOf(filter.clientId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (filter.homeAccountId && key.indexOf(filter.homeAccountId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n return true;\r\n };\r\n /**\r\n * Removes idToken from the cache\r\n * @param key\r\n */\r\n CacheManager.prototype.removeIdToken = function (key) {\r\n this.removeItem(key);\r\n };\r\n /**\r\n * Removes refresh token from the cache\r\n * @param key\r\n */\r\n CacheManager.prototype.removeRefreshToken = function (key) {\r\n this.removeItem(key);\r\n };\r\n /**\r\n * Retrieve AccessTokenEntity from cache\r\n * @param clientId\r\n * @param account\r\n * @param scopes\r\n * @param authScheme\r\n */\r\n CacheManager.prototype.getAccessToken = function (account, request, tokenKeys) {\r\n var _this = this;\r\n this.commonLogger.trace(\"CacheManager - getAccessToken called\");\r\n var scopes = ScopeSet.createSearchScopes(request.scopes);\r\n var authScheme = request.authenticationScheme || AuthenticationScheme.BEARER;\r\n /*\r\n * Distinguish between Bearer and PoP/SSH token cache types\r\n * Cast to lowercase to handle \"bearer\" from ADFS\r\n */\r\n var credentialType = (authScheme && authScheme.toLowerCase() !== AuthenticationScheme.BEARER.toLowerCase()) ? CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME : CredentialType.ACCESS_TOKEN;\r\n var accessTokenFilter = {\r\n homeAccountId: account.homeAccountId,\r\n environment: account.environment,\r\n credentialType: credentialType,\r\n clientId: this.clientId,\r\n realm: account.tenantId,\r\n target: scopes,\r\n tokenType: authScheme,\r\n keyId: request.sshKid,\r\n requestedClaimsHash: request.requestedClaimsHash,\r\n };\r\n var accessTokenKeys = tokenKeys && tokenKeys.accessToken || this.getTokenKeys().accessToken;\r\n var accessTokens = [];\r\n accessTokenKeys.forEach(function (key) {\r\n // Validate key\r\n if (_this.accessTokenKeyMatchesFilter(key, accessTokenFilter, true)) {\r\n var accessToken = _this.getAccessTokenCredential(key);\r\n // Validate value\r\n if (accessToken && _this.credentialMatchesFilter(accessToken, accessTokenFilter)) {\r\n accessTokens.push(accessToken);\r\n }\r\n }\r\n });\r\n var numAccessTokens = accessTokens.length;\r\n if (numAccessTokens < 1) {\r\n this.commonLogger.info(\"CacheManager:getAccessToken - No token found\");\r\n return null;\r\n }\r\n else if (numAccessTokens > 1) {\r\n this.commonLogger.info(\"CacheManager:getAccessToken - Multiple access tokens found, clearing them\");\r\n accessTokens.forEach(function (accessToken) {\r\n _this.removeAccessToken(accessToken.generateCredentialKey());\r\n });\r\n return null;\r\n }\r\n this.commonLogger.info(\"CacheManager:getAccessToken - Returning access token\");\r\n return accessTokens[0];\r\n };\r\n /**\r\n * Validate the cache key against filter before retrieving and parsing cache value\r\n * @param key\r\n * @param filter\r\n * @param keyMustContainAllScopes\r\n * @returns\r\n */\r\n CacheManager.prototype.accessTokenKeyMatchesFilter = function (inputKey, filter, keyMustContainAllScopes) {\r\n var key = inputKey.toLowerCase();\r\n if (filter.clientId && key.indexOf(filter.clientId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (filter.homeAccountId && key.indexOf(filter.homeAccountId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (filter.realm && key.indexOf(filter.realm.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (filter.requestedClaimsHash && key.indexOf(filter.requestedClaimsHash.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (filter.target) {\r\n var scopes = filter.target.asArray();\r\n for (var i = 0; i < scopes.length; i++) {\r\n if (keyMustContainAllScopes && !key.includes(scopes[i].toLowerCase())) {\r\n // When performing a cache lookup a missing scope would be a cache miss\r\n return false;\r\n }\r\n else if (!keyMustContainAllScopes && key.includes(scopes[i].toLowerCase())) {\r\n // When performing a cache write, any token with a subset of requested scopes should be replaced\r\n return true;\r\n }\r\n }\r\n }\r\n return true;\r\n };\r\n /**\r\n * Gets all access tokens matching the filter\r\n * @param filter\r\n * @returns\r\n */\r\n CacheManager.prototype.getAccessTokensByFilter = function (filter) {\r\n var _this = this;\r\n var tokenKeys = this.getTokenKeys();\r\n var accessTokens = [];\r\n tokenKeys.accessToken.forEach(function (key) {\r\n if (!_this.accessTokenKeyMatchesFilter(key, filter, true)) {\r\n return;\r\n }\r\n var accessToken = _this.getAccessTokenCredential(key);\r\n if (accessToken && _this.credentialMatchesFilter(accessToken, filter)) {\r\n accessTokens.push(accessToken);\r\n }\r\n });\r\n return accessTokens;\r\n };\r\n /**\r\n * Helper to retrieve the appropriate refresh token from cache\r\n * @param clientId\r\n * @param account\r\n * @param familyRT\r\n */\r\n CacheManager.prototype.getRefreshToken = function (account, familyRT, tokenKeys) {\r\n var _this = this;\r\n this.commonLogger.trace(\"CacheManager - getRefreshToken called\");\r\n var id = familyRT ? THE_FAMILY_ID : undefined;\r\n var refreshTokenFilter = {\r\n homeAccountId: account.homeAccountId,\r\n environment: account.environment,\r\n credentialType: CredentialType.REFRESH_TOKEN,\r\n clientId: this.clientId,\r\n familyId: id,\r\n };\r\n var refreshTokenKeys = tokenKeys && tokenKeys.refreshToken || this.getTokenKeys().refreshToken;\r\n var refreshTokens = [];\r\n refreshTokenKeys.forEach(function (key) {\r\n // Validate key\r\n if (_this.refreshTokenKeyMatchesFilter(key, refreshTokenFilter)) {\r\n var refreshToken = _this.getRefreshTokenCredential(key);\r\n // Validate value\r\n if (refreshToken && _this.credentialMatchesFilter(refreshToken, refreshTokenFilter)) {\r\n refreshTokens.push(refreshToken);\r\n }\r\n }\r\n });\r\n var numRefreshTokens = refreshTokens.length;\r\n if (numRefreshTokens < 1) {\r\n this.commonLogger.info(\"CacheManager:getRefreshToken - No refresh token found.\");\r\n return null;\r\n }\r\n // address the else case after remove functions address environment aliases\r\n this.commonLogger.info(\"CacheManager:getRefreshToken - returning refresh token\");\r\n return refreshTokens[0];\r\n };\r\n /**\r\n * Validate the cache key against filter before retrieving and parsing cache value\r\n * @param key\r\n * @param filter\r\n */\r\n CacheManager.prototype.refreshTokenKeyMatchesFilter = function (inputKey, filter) {\r\n var key = inputKey.toLowerCase();\r\n if (filter.familyId && key.indexOf(filter.familyId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n // If familyId is used, clientId is not in the key\r\n if (!filter.familyId && filter.clientId && key.indexOf(filter.clientId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n if (filter.homeAccountId && key.indexOf(filter.homeAccountId.toLowerCase()) === -1) {\r\n return false;\r\n }\r\n return true;\r\n };\r\n /**\r\n * Retrieve AppMetadataEntity from cache\r\n */\r\n CacheManager.prototype.readAppMetadataFromCache = function (environment) {\r\n var appMetadataFilter = {\r\n environment: environment,\r\n clientId: this.clientId,\r\n };\r\n var appMetadata = this.getAppMetadataFilteredBy(appMetadataFilter);\r\n var appMetadataEntries = Object.keys(appMetadata).map(function (key) { return appMetadata[key]; });\r\n var numAppMetadata = appMetadataEntries.length;\r\n if (numAppMetadata < 1) {\r\n return null;\r\n }\r\n else if (numAppMetadata > 1) {\r\n throw ClientAuthError.createMultipleMatchingAppMetadataInCacheError();\r\n }\r\n return appMetadataEntries[0];\r\n };\r\n /**\r\n * Return the family_id value associated with FOCI\r\n * @param environment\r\n * @param clientId\r\n */\r\n CacheManager.prototype.isAppMetadataFOCI = function (environment) {\r\n var appMetadata = this.readAppMetadataFromCache(environment);\r\n return !!(appMetadata && appMetadata.familyId === THE_FAMILY_ID);\r\n };\r\n /**\r\n * helper to match account ids\r\n * @param value\r\n * @param homeAccountId\r\n */\r\n CacheManager.prototype.matchHomeAccountId = function (entity, homeAccountId) {\r\n return !!((typeof entity.homeAccountId === \"string\") && (homeAccountId === entity.homeAccountId));\r\n };\r\n /**\r\n * helper to match account ids\r\n * @param entity\r\n * @param localAccountId\r\n * @returns\r\n */\r\n CacheManager.prototype.matchLocalAccountId = function (entity, localAccountId) {\r\n return !!((typeof entity.localAccountId === \"string\") && (localAccountId === entity.localAccountId));\r\n };\r\n /**\r\n * helper to match usernames\r\n * @param entity\r\n * @param username\r\n * @returns\r\n */\r\n CacheManager.prototype.matchUsername = function (entity, username) {\r\n return !!((typeof entity.username === \"string\") && (username.toLowerCase() === entity.username.toLowerCase()));\r\n };\r\n /**\r\n * helper to match assertion\r\n * @param value\r\n * @param oboAssertion\r\n */\r\n CacheManager.prototype.matchUserAssertionHash = function (entity, userAssertionHash) {\r\n return !!(entity.userAssertionHash && userAssertionHash === entity.userAssertionHash);\r\n };\r\n /**\r\n * helper to match environment\r\n * @param value\r\n * @param environment\r\n */\r\n CacheManager.prototype.matchEnvironment = function (entity, environment) {\r\n var cloudMetadata = this.getAuthorityMetadataByAlias(environment);\r\n if (cloudMetadata && cloudMetadata.aliases.indexOf(entity.environment) > -1) {\r\n return true;\r\n }\r\n return false;\r\n };\r\n /**\r\n * helper to match credential type\r\n * @param entity\r\n * @param credentialType\r\n */\r\n CacheManager.prototype.matchCredentialType = function (entity, credentialType) {\r\n return (entity.credentialType && credentialType.toLowerCase() === entity.credentialType.toLowerCase());\r\n };\r\n /**\r\n * helper to match client ids\r\n * @param entity\r\n * @param clientId\r\n */\r\n CacheManager.prototype.matchClientId = function (entity, clientId) {\r\n return !!(entity.clientId && clientId === entity.clientId);\r\n };\r\n /**\r\n * helper to match family ids\r\n * @param entity\r\n * @param familyId\r\n */\r\n CacheManager.prototype.matchFamilyId = function (entity, familyId) {\r\n return !!(entity.familyId && familyId === entity.familyId);\r\n };\r\n /**\r\n * helper to match realm\r\n * @param entity\r\n * @param realm\r\n */\r\n CacheManager.prototype.matchRealm = function (entity, realm) {\r\n return !!(entity.realm && realm === entity.realm);\r\n };\r\n /**\r\n * helper to match nativeAccountId\r\n * @param entity\r\n * @param nativeAccountId\r\n * @returns boolean indicating the match result\r\n */\r\n CacheManager.prototype.matchNativeAccountId = function (entity, nativeAccountId) {\r\n return !!(entity.nativeAccountId && nativeAccountId === entity.nativeAccountId);\r\n };\r\n /**\r\n * Returns true if the target scopes are a subset of the current entity's scopes, false otherwise.\r\n * @param entity\r\n * @param target\r\n */\r\n CacheManager.prototype.matchTarget = function (entity, target) {\r\n var isNotAccessTokenCredential = (entity.credentialType !== CredentialType.ACCESS_TOKEN && entity.credentialType !== CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME);\r\n if (isNotAccessTokenCredential || !entity.target) {\r\n return false;\r\n }\r\n var entityScopeSet = ScopeSet.fromString(entity.target);\r\n return entityScopeSet.containsScopeSet(target);\r\n };\r\n /**\r\n * Returns true if the credential's tokenType or Authentication Scheme matches the one in the request, false otherwise\r\n * @param entity\r\n * @param tokenType\r\n */\r\n CacheManager.prototype.matchTokenType = function (entity, tokenType) {\r\n return !!(entity.tokenType && entity.tokenType === tokenType);\r\n };\r\n /**\r\n * Returns true if the credential's keyId matches the one in the request, false otherwise\r\n * @param entity\r\n * @param tokenType\r\n */\r\n CacheManager.prototype.matchKeyId = function (entity, keyId) {\r\n return !!(entity.keyId && entity.keyId === keyId);\r\n };\r\n /**\r\n * returns if a given cache entity is of the type appmetadata\r\n * @param key\r\n */\r\n CacheManager.prototype.isAppMetadata = function (key) {\r\n return key.indexOf(APP_METADATA) !== -1;\r\n };\r\n /**\r\n * returns if a given cache entity is of the type authoritymetadata\r\n * @param key\r\n */\r\n CacheManager.prototype.isAuthorityMetadata = function (key) {\r\n return key.indexOf(AUTHORITY_METADATA_CONSTANTS.CACHE_KEY) !== -1;\r\n };\r\n /**\r\n * returns cache key used for cloud instance metadata\r\n */\r\n CacheManager.prototype.generateAuthorityMetadataCacheKey = function (authority) {\r\n return AUTHORITY_METADATA_CONSTANTS.CACHE_KEY + \"-\" + this.clientId + \"-\" + authority;\r\n };\r\n /**\r\n * Helper to convert serialized data to object\r\n * @param obj\r\n * @param json\r\n */\r\n CacheManager.toObject = function (obj, json) {\r\n for (var propertyName in json) {\r\n obj[propertyName] = json[propertyName];\r\n }\r\n return obj;\r\n };\r\n return CacheManager;\r\n}());\r\nvar DefaultStorageClass = /** @class */ (function (_super) {\r\n __extends(DefaultStorageClass, _super);\r\n function DefaultStorageClass() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n DefaultStorageClass.prototype.setAccount = function () {\r\n var notImplErr = \"Storage interface - setAccount() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getAccount = function () {\r\n var notImplErr = \"Storage interface - getAccount() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setIdTokenCredential = function () {\r\n var notImplErr = \"Storage interface - setIdTokenCredential() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getIdTokenCredential = function () {\r\n var notImplErr = \"Storage interface - getIdTokenCredential() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setAccessTokenCredential = function () {\r\n var notImplErr = \"Storage interface - setAccessTokenCredential() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getAccessTokenCredential = function () {\r\n var notImplErr = \"Storage interface - getAccessTokenCredential() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setRefreshTokenCredential = function () {\r\n var notImplErr = \"Storage interface - setRefreshTokenCredential() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getRefreshTokenCredential = function () {\r\n var notImplErr = \"Storage interface - getRefreshTokenCredential() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setAppMetadata = function () {\r\n var notImplErr = \"Storage interface - setAppMetadata() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getAppMetadata = function () {\r\n var notImplErr = \"Storage interface - getAppMetadata() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setServerTelemetry = function () {\r\n var notImplErr = \"Storage interface - setServerTelemetry() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getServerTelemetry = function () {\r\n var notImplErr = \"Storage interface - getServerTelemetry() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setAuthorityMetadata = function () {\r\n var notImplErr = \"Storage interface - setAuthorityMetadata() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getAuthorityMetadata = function () {\r\n var notImplErr = \"Storage interface - getAuthorityMetadata() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getAuthorityMetadataKeys = function () {\r\n var notImplErr = \"Storage interface - getAuthorityMetadataKeys() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.setThrottlingCache = function () {\r\n var notImplErr = \"Storage interface - setThrottlingCache() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getThrottlingCache = function () {\r\n var notImplErr = \"Storage interface - getThrottlingCache() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.removeItem = function () {\r\n var notImplErr = \"Storage interface - removeItem() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.containsKey = function () {\r\n var notImplErr = \"Storage interface - containsKey() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getKeys = function () {\r\n var notImplErr = \"Storage interface - getKeys() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getAccountKeys = function () {\r\n var notImplErr = \"Storage interface - getAccountKeys() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.getTokenKeys = function () {\r\n var notImplErr = \"Storage interface - getTokenKeys() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n DefaultStorageClass.prototype.clear = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Storage interface - clear() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n };\r\n DefaultStorageClass.prototype.updateCredentialCacheKey = function () {\r\n var notImplErr = \"Storage interface - updateCredentialCacheKey() has not been implemented for the cacheStorage interface.\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n };\r\n return DefaultStorageClass;\r\n}(CacheManager));\n\nexport { CacheManager, DefaultStorageClass };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Utility class which exposes functions for managing date and time operations.\r\n */\r\nvar TimeUtils = /** @class */ (function () {\r\n function TimeUtils() {\r\n }\r\n /**\r\n * return the current time in Unix time (seconds).\r\n */\r\n TimeUtils.nowSeconds = function () {\r\n // Date.getTime() returns in milliseconds.\r\n return Math.round(new Date().getTime() / 1000.0);\r\n };\r\n /**\r\n * check if a token is expired based on given UTC time in seconds.\r\n * @param expiresOn\r\n */\r\n TimeUtils.isTokenExpired = function (expiresOn, offset) {\r\n // check for access token expiry\r\n var expirationSec = Number(expiresOn) || 0;\r\n var offsetCurrentTimeSec = TimeUtils.nowSeconds() + offset;\r\n // If current time + offset is greater than token expiration time, then token is expired.\r\n return (offsetCurrentTimeSec > expirationSec);\r\n };\r\n /**\r\n * If the current time is earlier than the time that a token was cached at, we must discard the token\r\n * i.e. The system clock was turned back after acquiring the cached token\r\n * @param cachedAt\r\n * @param offset\r\n */\r\n TimeUtils.wasClockTurnedBack = function (cachedAt) {\r\n var cachedAtSec = Number(cachedAt);\r\n return cachedAtSec > TimeUtils.nowSeconds();\r\n };\r\n /**\r\n * Waits for t number of milliseconds\r\n * @param t number\r\n * @param value T\r\n */\r\n TimeUtils.delay = function (t, value) {\r\n return new Promise(function (resolve) { return setTimeout(function () { return resolve(value); }, t); });\r\n };\r\n return TimeUtils;\r\n}());\n\nexport { TimeUtils };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../../_virtual/_tslib.js';\nimport { CredentialEntity } from './CredentialEntity.js';\nimport { CredentialType, AuthenticationScheme } from '../../utils/Constants.js';\nimport { TimeUtils } from '../../utils/TimeUtils.js';\nimport { StringUtils } from '../../utils/StringUtils.js';\nimport { AuthToken } from '../../account/AuthToken.js';\nimport { ClientAuthError } from '../../error/ClientAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * ACCESS_TOKEN Credential Type\r\n *\r\n * Key:Value Schema:\r\n *\r\n * Key Example: uid.utid-login.microsoftonline.com-accesstoken-clientId-contoso.com-user.read\r\n *\r\n * Value Schema:\r\n * {\r\n * homeAccountId: home account identifier for the auth scheme,\r\n * environment: entity that issued the token, represented as a full host\r\n * credentialType: Type of credential as a string, can be one of the following: RefreshToken, AccessToken, IdToken, Password, Cookie, Certificate, Other\r\n * clientId: client ID of the application\r\n * secret: Actual credential as a string\r\n * familyId: Family ID identifier, usually only used for refresh tokens\r\n * realm: Full tenant or organizational identifier that the account belongs to\r\n * target: Permissions that are included in the token, or for refresh tokens, the resource identifier.\r\n * cachedAt: Absolute device time when entry was created in the cache.\r\n * expiresOn: Token expiry time, calculated based on current UTC time in seconds. Represented as a string.\r\n * extendedExpiresOn: Additional extended expiry time until when token is valid in case of server-side outage. Represented as string in UTC seconds.\r\n * keyId: used for POP and SSH tokenTypes\r\n * tokenType: Type of the token issued. Usually \"Bearer\"\r\n * }\r\n */\r\nvar AccessTokenEntity = /** @class */ (function (_super) {\r\n __extends(AccessTokenEntity, _super);\r\n function AccessTokenEntity() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n /**\r\n * Create AccessTokenEntity\r\n * @param homeAccountId\r\n * @param environment\r\n * @param accessToken\r\n * @param clientId\r\n * @param tenantId\r\n * @param scopes\r\n * @param expiresOn\r\n * @param extExpiresOn\r\n */\r\n AccessTokenEntity.createAccessTokenEntity = function (homeAccountId, environment, accessToken, clientId, tenantId, scopes, expiresOn, extExpiresOn, cryptoUtils, refreshOn, tokenType, userAssertionHash, keyId, requestedClaims, requestedClaimsHash) {\r\n var _a, _b;\r\n var atEntity = new AccessTokenEntity();\r\n atEntity.homeAccountId = homeAccountId;\r\n atEntity.credentialType = CredentialType.ACCESS_TOKEN;\r\n atEntity.secret = accessToken;\r\n var currentTime = TimeUtils.nowSeconds();\r\n atEntity.cachedAt = currentTime.toString();\r\n /*\r\n * Token expiry time.\r\n * This value should be calculated based on the current UTC time measured locally and the value expires_in Represented as a string in JSON.\r\n */\r\n atEntity.expiresOn = expiresOn.toString();\r\n atEntity.extendedExpiresOn = extExpiresOn.toString();\r\n if (refreshOn) {\r\n atEntity.refreshOn = refreshOn.toString();\r\n }\r\n atEntity.environment = environment;\r\n atEntity.clientId = clientId;\r\n atEntity.realm = tenantId;\r\n atEntity.target = scopes;\r\n atEntity.userAssertionHash = userAssertionHash;\r\n atEntity.tokenType = StringUtils.isEmpty(tokenType) ? AuthenticationScheme.BEARER : tokenType;\r\n if (requestedClaims) {\r\n atEntity.requestedClaims = requestedClaims;\r\n atEntity.requestedClaimsHash = requestedClaimsHash;\r\n }\r\n /*\r\n * Create Access Token With Auth Scheme instead of regular access token\r\n * Cast to lower to handle \"bearer\" from ADFS\r\n */\r\n if (((_a = atEntity.tokenType) === null || _a === void 0 ? void 0 : _a.toLowerCase()) !== AuthenticationScheme.BEARER.toLowerCase()) {\r\n atEntity.credentialType = CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME;\r\n switch (atEntity.tokenType) {\r\n case AuthenticationScheme.POP:\r\n // Make sure keyId is present and add it to credential\r\n var tokenClaims = AuthToken.extractTokenClaims(accessToken, cryptoUtils);\r\n if (!((_b = tokenClaims === null || tokenClaims === void 0 ? void 0 : tokenClaims.cnf) === null || _b === void 0 ? void 0 : _b.kid)) {\r\n throw ClientAuthError.createTokenClaimsRequiredError();\r\n }\r\n atEntity.keyId = tokenClaims.cnf.kid;\r\n break;\r\n case AuthenticationScheme.SSH:\r\n atEntity.keyId = keyId;\r\n }\r\n }\r\n return atEntity;\r\n };\r\n /**\r\n * Validates an entity: checks for all expected params\r\n * @param entity\r\n */\r\n AccessTokenEntity.isAccessTokenEntity = function (entity) {\r\n if (!entity) {\r\n return false;\r\n }\r\n return (entity.hasOwnProperty(\"homeAccountId\") &&\r\n entity.hasOwnProperty(\"environment\") &&\r\n entity.hasOwnProperty(\"credentialType\") &&\r\n entity.hasOwnProperty(\"realm\") &&\r\n entity.hasOwnProperty(\"clientId\") &&\r\n entity.hasOwnProperty(\"secret\") &&\r\n entity.hasOwnProperty(\"target\") &&\r\n (entity[\"credentialType\"] === CredentialType.ACCESS_TOKEN || entity[\"credentialType\"] === CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME));\r\n };\r\n return AccessTokenEntity;\r\n}(CredentialEntity));\n\nexport { AccessTokenEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends } from '../../_virtual/_tslib.js';\nimport { CredentialEntity } from './CredentialEntity.js';\nimport { CredentialType } from '../../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * REFRESH_TOKEN Cache\r\n *\r\n * Key:Value Schema:\r\n *\r\n * Key Example: uid.utid-login.microsoftonline.com-refreshtoken-clientId--\r\n *\r\n * Value:\r\n * {\r\n * homeAccountId: home account identifier for the auth scheme,\r\n * environment: entity that issued the token, represented as a full host\r\n * credentialType: Type of credential as a string, can be one of the following: RefreshToken, AccessToken, IdToken, Password, Cookie, Certificate, Other\r\n * clientId: client ID of the application\r\n * secret: Actual credential as a string\r\n * familyId: Family ID identifier, '1' represents Microsoft Family\r\n * realm: Full tenant or organizational identifier that the account belongs to\r\n * target: Permissions that are included in the token, or for refresh tokens, the resource identifier.\r\n * }\r\n */\r\nvar RefreshTokenEntity = /** @class */ (function (_super) {\r\n __extends(RefreshTokenEntity, _super);\r\n function RefreshTokenEntity() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n /**\r\n * Create RefreshTokenEntity\r\n * @param homeAccountId\r\n * @param authenticationResult\r\n * @param clientId\r\n * @param authority\r\n */\r\n RefreshTokenEntity.createRefreshTokenEntity = function (homeAccountId, environment, refreshToken, clientId, familyId, userAssertionHash) {\r\n var rtEntity = new RefreshTokenEntity();\r\n rtEntity.clientId = clientId;\r\n rtEntity.credentialType = CredentialType.REFRESH_TOKEN;\r\n rtEntity.environment = environment;\r\n rtEntity.homeAccountId = homeAccountId;\r\n rtEntity.secret = refreshToken;\r\n rtEntity.userAssertionHash = userAssertionHash;\r\n if (familyId)\r\n rtEntity.familyId = familyId;\r\n return rtEntity;\r\n };\r\n /**\r\n * Validates an entity: checks for all expected params\r\n * @param entity\r\n */\r\n RefreshTokenEntity.isRefreshTokenEntity = function (entity) {\r\n if (!entity) {\r\n return false;\r\n }\r\n return (entity.hasOwnProperty(\"homeAccountId\") &&\r\n entity.hasOwnProperty(\"environment\") &&\r\n entity.hasOwnProperty(\"credentialType\") &&\r\n entity.hasOwnProperty(\"clientId\") &&\r\n entity.hasOwnProperty(\"secret\") &&\r\n entity[\"credentialType\"] === CredentialType.REFRESH_TOKEN);\r\n };\r\n return RefreshTokenEntity;\r\n}(CredentialEntity));\n\nexport { RefreshTokenEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { Separators, APP_METADATA } from '../../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * APP_METADATA Cache\r\n *\r\n * Key:Value Schema:\r\n *\r\n * Key: appmetadata--\r\n *\r\n * Value:\r\n * {\r\n * clientId: client ID of the application\r\n * environment: entity that issued the token, represented as a full host\r\n * familyId: Family ID identifier, '1' represents Microsoft Family\r\n * }\r\n */\r\nvar AppMetadataEntity = /** @class */ (function () {\r\n function AppMetadataEntity() {\r\n }\r\n /**\r\n * Generate AppMetadata Cache Key as per the schema: appmetadata--\r\n */\r\n AppMetadataEntity.prototype.generateAppMetadataKey = function () {\r\n return AppMetadataEntity.generateAppMetadataCacheKey(this.environment, this.clientId);\r\n };\r\n /**\r\n * Generate AppMetadata Cache Key\r\n */\r\n AppMetadataEntity.generateAppMetadataCacheKey = function (environment, clientId) {\r\n var appMetaDataKeyArray = [\r\n APP_METADATA,\r\n environment,\r\n clientId,\r\n ];\r\n return appMetaDataKeyArray.join(Separators.CACHE_KEY_SEPARATOR).toLowerCase();\r\n };\r\n /**\r\n * Creates AppMetadataEntity\r\n * @param clientId\r\n * @param environment\r\n * @param familyId\r\n */\r\n AppMetadataEntity.createAppMetadataEntity = function (clientId, environment, familyId) {\r\n var appMetadata = new AppMetadataEntity();\r\n appMetadata.clientId = clientId;\r\n appMetadata.environment = environment;\r\n if (familyId) {\r\n appMetadata.familyId = familyId;\r\n }\r\n return appMetadata;\r\n };\r\n /**\r\n * Validates an entity: checks for all expected params\r\n * @param entity\r\n */\r\n AppMetadataEntity.isAppMetadataEntity = function (key, entity) {\r\n if (!entity) {\r\n return false;\r\n }\r\n return (key.indexOf(APP_METADATA) === 0 &&\r\n entity.hasOwnProperty(\"clientId\") &&\r\n entity.hasOwnProperty(\"environment\"));\r\n };\r\n return AppMetadataEntity;\r\n}());\n\nexport { AppMetadataEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { SERVER_TELEM_CONSTANTS } from '../../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar ServerTelemetryEntity = /** @class */ (function () {\r\n function ServerTelemetryEntity() {\r\n this.failedRequests = [];\r\n this.errors = [];\r\n this.cacheHits = 0;\r\n }\r\n /**\r\n * validates if a given cache entry is \"Telemetry\", parses \r\n * @param key\r\n * @param entity\r\n */\r\n ServerTelemetryEntity.isServerTelemetryEntity = function (key, entity) {\r\n var validateKey = key.indexOf(SERVER_TELEM_CONSTANTS.CACHE_KEY) === 0;\r\n var validateEntity = true;\r\n if (entity) {\r\n validateEntity =\r\n entity.hasOwnProperty(\"failedRequests\") &&\r\n entity.hasOwnProperty(\"errors\") &&\r\n entity.hasOwnProperty(\"cacheHits\");\r\n }\r\n return validateKey && validateEntity;\r\n };\r\n return ServerTelemetryEntity;\r\n}());\n\nexport { ServerTelemetryEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { AUTHORITY_METADATA_CONSTANTS } from '../../utils/Constants.js';\nimport { TimeUtils } from '../../utils/TimeUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar AuthorityMetadataEntity = /** @class */ (function () {\r\n function AuthorityMetadataEntity() {\r\n this.expiresAt = TimeUtils.nowSeconds() + AUTHORITY_METADATA_CONSTANTS.REFRESH_TIME_SECONDS;\r\n }\r\n /**\r\n * Update the entity with new aliases, preferred_cache and preferred_network values\r\n * @param metadata\r\n * @param fromNetwork\r\n */\r\n AuthorityMetadataEntity.prototype.updateCloudDiscoveryMetadata = function (metadata, fromNetwork) {\r\n this.aliases = metadata.aliases;\r\n this.preferred_cache = metadata.preferred_cache;\r\n this.preferred_network = metadata.preferred_network;\r\n this.aliasesFromNetwork = fromNetwork;\r\n };\r\n /**\r\n * Update the entity with new endpoints\r\n * @param metadata\r\n * @param fromNetwork\r\n */\r\n AuthorityMetadataEntity.prototype.updateEndpointMetadata = function (metadata, fromNetwork) {\r\n this.authorization_endpoint = metadata.authorization_endpoint;\r\n this.token_endpoint = metadata.token_endpoint;\r\n this.end_session_endpoint = metadata.end_session_endpoint;\r\n this.issuer = metadata.issuer;\r\n this.endpointsFromNetwork = fromNetwork;\r\n this.jwks_uri = metadata.jwks_uri;\r\n };\r\n /**\r\n * Save the authority that was used to create this cache entry\r\n * @param authority\r\n */\r\n AuthorityMetadataEntity.prototype.updateCanonicalAuthority = function (authority) {\r\n this.canonical_authority = authority;\r\n };\r\n /**\r\n * Reset the exiresAt value\r\n */\r\n AuthorityMetadataEntity.prototype.resetExpiresAt = function () {\r\n this.expiresAt = TimeUtils.nowSeconds() + AUTHORITY_METADATA_CONSTANTS.REFRESH_TIME_SECONDS;\r\n };\r\n /**\r\n * Returns whether or not the data needs to be refreshed\r\n */\r\n AuthorityMetadataEntity.prototype.isExpired = function () {\r\n return this.expiresAt <= TimeUtils.nowSeconds();\r\n };\r\n /**\r\n * Validates an entity: checks for all expected params\r\n * @param entity\r\n */\r\n AuthorityMetadataEntity.isAuthorityMetadataEntity = function (key, entity) {\r\n if (!entity) {\r\n return false;\r\n }\r\n return (key.indexOf(AUTHORITY_METADATA_CONSTANTS.CACHE_KEY) === 0 &&\r\n entity.hasOwnProperty(\"aliases\") &&\r\n entity.hasOwnProperty(\"preferred_cache\") &&\r\n entity.hasOwnProperty(\"preferred_network\") &&\r\n entity.hasOwnProperty(\"canonical_authority\") &&\r\n entity.hasOwnProperty(\"authorization_endpoint\") &&\r\n entity.hasOwnProperty(\"token_endpoint\") &&\r\n entity.hasOwnProperty(\"issuer\") &&\r\n entity.hasOwnProperty(\"aliasesFromNetwork\") &&\r\n entity.hasOwnProperty(\"endpointsFromNetwork\") &&\r\n entity.hasOwnProperty(\"expiresAt\") &&\r\n entity.hasOwnProperty(\"jwks_uri\"));\r\n };\r\n return AuthorityMetadataEntity;\r\n}());\n\nexport { AuthorityMetadataEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { ThrottlingConstants } from '../../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar ThrottlingEntity = /** @class */ (function () {\r\n function ThrottlingEntity() {\r\n }\r\n /**\r\n * validates if a given cache entry is \"Throttling\", parses \r\n * @param key\r\n * @param entity\r\n */\r\n ThrottlingEntity.isThrottlingEntity = function (key, entity) {\r\n var validateKey = false;\r\n if (key) {\r\n validateKey = key.indexOf(ThrottlingConstants.THROTTLING_PREFIX) === 0;\r\n }\r\n var validateEntity = true;\r\n if (entity) {\r\n validateEntity = entity.hasOwnProperty(\"throttleTime\");\r\n }\r\n return validateKey && validateEntity;\r\n };\r\n return ThrottlingEntity;\r\n}());\n\nexport { ThrottlingEntity };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { StringUtils } from './StringUtils.js';\nimport { Constants } from './Constants.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Class which provides helpers for OAuth 2.0 protocol specific values\r\n */\r\nvar ProtocolUtils = /** @class */ (function () {\r\n function ProtocolUtils() {\r\n }\r\n /**\r\n * Appends user state with random guid, or returns random guid.\r\n * @param userState\r\n * @param randomGuid\r\n */\r\n ProtocolUtils.setRequestState = function (cryptoObj, userState, meta) {\r\n var libraryState = ProtocolUtils.generateLibraryState(cryptoObj, meta);\r\n return !StringUtils.isEmpty(userState) ? \"\" + libraryState + Constants.RESOURCE_DELIM + userState : libraryState;\r\n };\r\n /**\r\n * Generates the state value used by the common library.\r\n * @param randomGuid\r\n * @param cryptoObj\r\n */\r\n ProtocolUtils.generateLibraryState = function (cryptoObj, meta) {\r\n if (!cryptoObj) {\r\n throw ClientAuthError.createNoCryptoObjectError(\"generateLibraryState\");\r\n }\r\n // Create a state object containing a unique id and the timestamp of the request creation\r\n var stateObj = {\r\n id: cryptoObj.createNewGuid()\r\n };\r\n if (meta) {\r\n stateObj.meta = meta;\r\n }\r\n var stateString = JSON.stringify(stateObj);\r\n return cryptoObj.base64Encode(stateString);\r\n };\r\n /**\r\n * Parses the state into the RequestStateObject, which contains the LibraryState info and the state passed by the user.\r\n * @param state\r\n * @param cryptoObj\r\n */\r\n ProtocolUtils.parseRequestState = function (cryptoObj, state) {\r\n if (!cryptoObj) {\r\n throw ClientAuthError.createNoCryptoObjectError(\"parseRequestState\");\r\n }\r\n if (StringUtils.isEmpty(state)) {\r\n throw ClientAuthError.createInvalidStateError(state, \"Null, undefined or empty state\");\r\n }\r\n try {\r\n // Split the state between library state and user passed state and decode them separately\r\n var splitState = state.split(Constants.RESOURCE_DELIM);\r\n var libraryState = splitState[0];\r\n var userState = splitState.length > 1 ? splitState.slice(1).join(Constants.RESOURCE_DELIM) : Constants.EMPTY_STRING;\r\n var libraryStateString = cryptoObj.base64Decode(libraryState);\r\n var libraryStateObj = JSON.parse(libraryStateString);\r\n return {\r\n userRequestState: !StringUtils.isEmpty(userState) ? userState : Constants.EMPTY_STRING,\r\n libraryState: libraryStateObj\r\n };\r\n }\r\n catch (e) {\r\n throw ClientAuthError.createInvalidStateError(state, e);\r\n }\r\n };\r\n return ProtocolUtils;\r\n}());\n\nexport { ProtocolUtils };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar CcsCredentialType;\r\n(function (CcsCredentialType) {\r\n CcsCredentialType[\"HOME_ACCOUNT_ID\"] = \"home_account_id\";\r\n CcsCredentialType[\"UPN\"] = \"UPN\";\r\n})(CcsCredentialType || (CcsCredentialType = {}));\n\nexport { CcsCredentialType };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar CacheRecord = /** @class */ (function () {\r\n function CacheRecord(accountEntity, idTokenEntity, accessTokenEntity, refreshTokenEntity, appMetadataEntity) {\r\n this.account = accountEntity || null;\r\n this.idToken = idTokenEntity || null;\r\n this.accessToken = accessTokenEntity || null;\r\n this.refreshToken = refreshTokenEntity || null;\r\n this.appMetadata = appMetadataEntity || null;\r\n }\r\n return CacheRecord;\r\n}());\n\nexport { CacheRecord };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { BrowserConfigurationAuthError } from '../error/BrowserConfigurationAuthError.js';\nimport { BrowserCacheLocation } from '../utils/BrowserConstants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar BrowserStorage = /** @class */ (function () {\r\n function BrowserStorage(cacheLocation) {\r\n this.validateWindowStorage(cacheLocation);\r\n this.windowStorage = window[cacheLocation];\r\n }\r\n BrowserStorage.prototype.validateWindowStorage = function (cacheLocation) {\r\n if (cacheLocation !== BrowserCacheLocation.LocalStorage && cacheLocation !== BrowserCacheLocation.SessionStorage) {\r\n throw BrowserConfigurationAuthError.createStorageNotSupportedError(cacheLocation);\r\n }\r\n var storageSupported = !!window[cacheLocation];\r\n if (!storageSupported) {\r\n throw BrowserConfigurationAuthError.createStorageNotSupportedError(cacheLocation);\r\n }\r\n };\r\n BrowserStorage.prototype.getItem = function (key) {\r\n return this.windowStorage.getItem(key);\r\n };\r\n BrowserStorage.prototype.setItem = function (key, value) {\r\n this.windowStorage.setItem(key, value);\r\n };\r\n BrowserStorage.prototype.removeItem = function (key) {\r\n this.windowStorage.removeItem(key);\r\n };\r\n BrowserStorage.prototype.getKeys = function () {\r\n return Object.keys(this.windowStorage);\r\n };\r\n BrowserStorage.prototype.containsKey = function (key) {\r\n return this.windowStorage.hasOwnProperty(key);\r\n };\r\n return BrowserStorage;\r\n}());\n\nexport { BrowserStorage };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { StringUtils, ProtocolUtils, ClientAuthError, UrlString } from '@azure/msal-common';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar BrowserProtocolUtils = /** @class */ (function () {\r\n function BrowserProtocolUtils() {\r\n }\r\n /**\r\n * Extracts the BrowserStateObject from the state string.\r\n * @param browserCrypto\r\n * @param state\r\n */\r\n BrowserProtocolUtils.extractBrowserRequestState = function (browserCrypto, state) {\r\n if (StringUtils.isEmpty(state)) {\r\n return null;\r\n }\r\n try {\r\n var requestStateObj = ProtocolUtils.parseRequestState(browserCrypto, state);\r\n return requestStateObj.libraryState.meta;\r\n }\r\n catch (e) {\r\n throw ClientAuthError.createInvalidStateError(state, e);\r\n }\r\n };\r\n /**\r\n * Parses properties of server response from url hash\r\n * @param locationHash Hash from url\r\n */\r\n BrowserProtocolUtils.parseServerResponseFromHash = function (locationHash) {\r\n if (!locationHash) {\r\n return {};\r\n }\r\n var hashUrlString = new UrlString(locationHash);\r\n return UrlString.getDeserializedHash(hashUrlString.getHash());\r\n };\r\n return BrowserProtocolUtils;\r\n}());\n\nexport { BrowserProtocolUtils };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __spread, __generator } from '../_virtual/_tslib.js';\nimport { CredentialType, RefreshTokenEntity, CacheManager, AccessTokenEntity, IdTokenEntity, AccountEntity, ClientAuthError, AppMetadataEntity, ServerTelemetryEntity, AuthorityMetadataEntity, Constants, PersistentCacheKeys, ThrottlingEntity, StringUtils, ProtocolUtils, CcsCredentialType, IdToken, CacheRecord, DEFAULT_CRYPTO_IMPLEMENTATION } from '@azure/msal-common';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { BrowserCacheLocation, StaticCacheKeys, InMemoryCacheKeys, TemporaryCacheKeys } from '../utils/BrowserConstants.js';\nimport { BrowserStorage } from './BrowserStorage.js';\nimport { MemoryStorage } from './MemoryStorage.js';\nimport { BrowserProtocolUtils } from '../utils/BrowserProtocolUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * This class implements the cache storage interface for MSAL through browser local or session storage.\r\n * Cookies are only used if storeAuthStateInCookie is true, and are only used for\r\n * parameters such as state and nonce, generally.\r\n */\r\nvar BrowserCacheManager = /** @class */ (function (_super) {\r\n __extends(BrowserCacheManager, _super);\r\n function BrowserCacheManager(clientId, cacheConfig, cryptoImpl, logger) {\r\n var _this = _super.call(this, clientId, cryptoImpl, logger) || this;\r\n // Cookie life calculation (hours * minutes * seconds * ms)\r\n _this.COOKIE_LIFE_MULTIPLIER = 24 * 60 * 60 * 1000;\r\n _this.cacheConfig = cacheConfig;\r\n _this.logger = logger;\r\n _this.internalStorage = new MemoryStorage();\r\n _this.browserStorage = _this.setupBrowserStorage(_this.cacheConfig.cacheLocation);\r\n _this.temporaryCacheStorage = _this.setupTemporaryCacheStorage(_this.cacheConfig.temporaryCacheLocation, _this.cacheConfig.cacheLocation);\r\n // Migrate cache entries from older versions of MSAL.\r\n if (cacheConfig.cacheMigrationEnabled) {\r\n _this.migrateCacheEntries();\r\n _this.createKeyMaps();\r\n }\r\n return _this;\r\n }\r\n /**\r\n * Returns a window storage class implementing the IWindowStorage interface that corresponds to the configured cacheLocation.\r\n * @param cacheLocation\r\n */\r\n BrowserCacheManager.prototype.setupBrowserStorage = function (cacheLocation) {\r\n switch (cacheLocation) {\r\n case BrowserCacheLocation.LocalStorage:\r\n case BrowserCacheLocation.SessionStorage:\r\n try {\r\n return new BrowserStorage(cacheLocation);\r\n }\r\n catch (e) {\r\n this.logger.verbose(e);\r\n break;\r\n }\r\n }\r\n this.cacheConfig.cacheLocation = BrowserCacheLocation.MemoryStorage;\r\n return new MemoryStorage();\r\n };\r\n /**\r\n * Returns a window storage class implementing the IWindowStorage interface that corresponds to the configured temporaryCacheLocation.\r\n * @param temporaryCacheLocation\r\n * @param cacheLocation\r\n */\r\n BrowserCacheManager.prototype.setupTemporaryCacheStorage = function (temporaryCacheLocation, cacheLocation) {\r\n switch (cacheLocation) {\r\n case BrowserCacheLocation.LocalStorage:\r\n case BrowserCacheLocation.SessionStorage:\r\n try {\r\n /*\r\n * When users do not explicitly choose their own temporaryCacheLocation,\r\n * temporary cache items will always be stored in session storage to mitigate problems caused by multiple tabs\r\n */\r\n return new BrowserStorage(temporaryCacheLocation || BrowserCacheLocation.SessionStorage);\r\n }\r\n catch (e) {\r\n this.logger.verbose(e);\r\n return this.internalStorage;\r\n }\r\n case BrowserCacheLocation.MemoryStorage:\r\n default:\r\n return this.internalStorage;\r\n }\r\n };\r\n /**\r\n * Migrate all old cache entries to new schema. No rollback supported.\r\n * @param storeAuthStateInCookie\r\n */\r\n BrowserCacheManager.prototype.migrateCacheEntries = function () {\r\n var _this = this;\r\n var idTokenKey = Constants.CACHE_PREFIX + \".\" + PersistentCacheKeys.ID_TOKEN;\r\n var clientInfoKey = Constants.CACHE_PREFIX + \".\" + PersistentCacheKeys.CLIENT_INFO;\r\n var errorKey = Constants.CACHE_PREFIX + \".\" + PersistentCacheKeys.ERROR;\r\n var errorDescKey = Constants.CACHE_PREFIX + \".\" + PersistentCacheKeys.ERROR_DESC;\r\n var idTokenValue = this.browserStorage.getItem(idTokenKey);\r\n var clientInfoValue = this.browserStorage.getItem(clientInfoKey);\r\n var errorValue = this.browserStorage.getItem(errorKey);\r\n var errorDescValue = this.browserStorage.getItem(errorDescKey);\r\n var values = [idTokenValue, clientInfoValue, errorValue, errorDescValue];\r\n var keysToMigrate = [PersistentCacheKeys.ID_TOKEN, PersistentCacheKeys.CLIENT_INFO, PersistentCacheKeys.ERROR, PersistentCacheKeys.ERROR_DESC];\r\n keysToMigrate.forEach(function (cacheKey, index) { return _this.migrateCacheEntry(cacheKey, values[index]); });\r\n };\r\n /**\r\n * Utility function to help with migration.\r\n * @param newKey\r\n * @param value\r\n * @param storeAuthStateInCookie\r\n */\r\n BrowserCacheManager.prototype.migrateCacheEntry = function (newKey, value) {\r\n if (value) {\r\n this.setTemporaryCache(newKey, value, true);\r\n }\r\n };\r\n /**\r\n * Searches all cache entries for MSAL accounts and creates the account key map\r\n * This is used to migrate users from older versions of MSAL which did not create the map.\r\n * @returns\r\n */\r\n BrowserCacheManager.prototype.createKeyMaps = function () {\r\n var _this = this;\r\n this.logger.trace(\"BrowserCacheManager - createKeyMaps called.\");\r\n var accountKeys = this.getItem(StaticCacheKeys.ACCOUNT_KEYS);\r\n var tokenKeys = this.getItem(StaticCacheKeys.TOKEN_KEYS + \".\" + this.clientId);\r\n if (accountKeys && tokenKeys) {\r\n this.logger.verbose(\"BrowserCacheManager:createKeyMaps - account and token key maps already exist, skipping migration.\");\r\n // Key maps already exist, no need to iterate through cache\r\n return;\r\n }\r\n var allKeys = this.browserStorage.getKeys();\r\n allKeys.forEach(function (key) {\r\n if (_this.isCredentialKey(key)) {\r\n // Get item, parse, validate and write key to map\r\n var value = _this.getItem(key);\r\n if (value) {\r\n var credObj = _this.validateAndParseJson(value);\r\n if (credObj && credObj.hasOwnProperty(\"credentialType\")) {\r\n switch (credObj[\"credentialType\"]) {\r\n case CredentialType.ID_TOKEN:\r\n if (IdTokenEntity.isIdTokenEntity(credObj)) {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - idToken found, saving key to token key map\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - idToken with key: \" + key + \" found, saving key to token key map\");\r\n var idTokenEntity = CacheManager.toObject(new IdTokenEntity(), credObj);\r\n var newKey = _this.updateCredentialCacheKey(key, idTokenEntity);\r\n _this.addTokenKey(newKey, CredentialType.ID_TOKEN);\r\n return;\r\n }\r\n else {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - key found matching idToken schema with value containing idToken credentialType field but value failed IdTokenEntity validation, skipping.\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - failed idToken validation on key: \" + key);\r\n }\r\n break;\r\n case CredentialType.ACCESS_TOKEN:\r\n case CredentialType.ACCESS_TOKEN_WITH_AUTH_SCHEME:\r\n if (AccessTokenEntity.isAccessTokenEntity(credObj)) {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - accessToken found, saving key to token key map\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - accessToken with key: \" + key + \" found, saving key to token key map\");\r\n var accessTokenEntity = CacheManager.toObject(new AccessTokenEntity(), credObj);\r\n var newKey = _this.updateCredentialCacheKey(key, accessTokenEntity);\r\n _this.addTokenKey(newKey, CredentialType.ACCESS_TOKEN);\r\n return;\r\n }\r\n else {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - key found matching accessToken schema with value containing accessToken credentialType field but value failed AccessTokenEntity validation, skipping.\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - failed accessToken validation on key: \" + key);\r\n }\r\n break;\r\n case CredentialType.REFRESH_TOKEN:\r\n if (RefreshTokenEntity.isRefreshTokenEntity(credObj)) {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - refreshToken found, saving key to token key map\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - refreshToken with key: \" + key + \" found, saving key to token key map\");\r\n var refreshTokenEntity = CacheManager.toObject(new RefreshTokenEntity(), credObj);\r\n var newKey = _this.updateCredentialCacheKey(key, refreshTokenEntity);\r\n _this.addTokenKey(newKey, CredentialType.REFRESH_TOKEN);\r\n return;\r\n }\r\n else {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - key found matching refreshToken schema with value containing refreshToken credentialType field but value failed RefreshTokenEntity validation, skipping.\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - failed refreshToken validation on key: \" + key);\r\n }\r\n break;\r\n // If credentialType isn't one of our predefined ones, it may not be an MSAL cache value. Ignore.\r\n }\r\n }\r\n }\r\n }\r\n if (_this.isAccountKey(key)) {\r\n var value = _this.getItem(key);\r\n if (value) {\r\n var accountObj = _this.validateAndParseJson(value);\r\n if (accountObj && AccountEntity.isAccountEntity(accountObj)) {\r\n _this.logger.trace(\"BrowserCacheManager:createKeyMaps - account found, saving key to account key map\");\r\n _this.logger.tracePii(\"BrowserCacheManager:createKeyMaps - account with key: \" + key + \" found, saving key to account key map\");\r\n _this.addAccountKeyToMap(key);\r\n }\r\n }\r\n }\r\n });\r\n };\r\n /**\r\n * Parses passed value as JSON object, JSON.parse() will throw an error.\r\n * @param input\r\n */\r\n BrowserCacheManager.prototype.validateAndParseJson = function (jsonValue) {\r\n try {\r\n var parsedJson = JSON.parse(jsonValue);\r\n /**\r\n * There are edge cases in which JSON.parse will successfully parse a non-valid JSON object\r\n * (e.g. JSON.parse will parse an escaped string into an unescaped string), so adding a type check\r\n * of the parsed value is necessary in order to be certain that the string represents a valid JSON object.\r\n *\r\n */\r\n return (parsedJson && typeof parsedJson === \"object\") ? parsedJson : null;\r\n }\r\n catch (error) {\r\n return null;\r\n }\r\n };\r\n /**\r\n * fetches the entry from the browser storage based off the key\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.getItem = function (key) {\r\n return this.browserStorage.getItem(key);\r\n };\r\n /**\r\n * sets the entry in the browser storage\r\n * @param key\r\n * @param value\r\n */\r\n BrowserCacheManager.prototype.setItem = function (key, value) {\r\n this.browserStorage.setItem(key, value);\r\n };\r\n /**\r\n * fetch the account entity from the platform cache\r\n * @param accountKey\r\n */\r\n BrowserCacheManager.prototype.getAccount = function (accountKey) {\r\n this.logger.trace(\"BrowserCacheManager.getAccount called\");\r\n var account = this.getItem(accountKey);\r\n if (!account) {\r\n this.removeAccountKeyFromMap(accountKey);\r\n return null;\r\n }\r\n var parsedAccount = this.validateAndParseJson(account);\r\n if (!parsedAccount || !AccountEntity.isAccountEntity(parsedAccount)) {\r\n this.removeAccountKeyFromMap(accountKey);\r\n return null;\r\n }\r\n return CacheManager.toObject(new AccountEntity(), parsedAccount);\r\n };\r\n /**\r\n * set account entity in the platform cache\r\n * @param key\r\n * @param value\r\n */\r\n BrowserCacheManager.prototype.setAccount = function (account) {\r\n this.logger.trace(\"BrowserCacheManager.setAccount called\");\r\n var key = account.generateAccountKey();\r\n this.setItem(key, JSON.stringify(account));\r\n this.addAccountKeyToMap(key);\r\n };\r\n /**\r\n * Returns the array of account keys currently cached\r\n * @returns\r\n */\r\n BrowserCacheManager.prototype.getAccountKeys = function () {\r\n this.logger.trace(\"BrowserCacheManager.getAccountKeys called\");\r\n var accountKeys = this.getItem(StaticCacheKeys.ACCOUNT_KEYS);\r\n if (accountKeys) {\r\n return JSON.parse(accountKeys);\r\n }\r\n this.logger.verbose(\"BrowserCacheManager.getAccountKeys - No account keys found\");\r\n return [];\r\n };\r\n /**\r\n * Add a new account to the key map\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.addAccountKeyToMap = function (key) {\r\n this.logger.trace(\"BrowserCacheManager.addAccountKeyToMap called\");\r\n this.logger.tracePii(\"BrowserCacheManager.addAccountKeyToMap called with key: \" + key);\r\n var accountKeys = this.getAccountKeys();\r\n if (accountKeys.indexOf(key) === -1) {\r\n // Only add key if it does not already exist in the map\r\n accountKeys.push(key);\r\n this.setItem(StaticCacheKeys.ACCOUNT_KEYS, JSON.stringify(accountKeys));\r\n this.logger.verbose(\"BrowserCacheManager.addAccountKeyToMap account key added\");\r\n }\r\n else {\r\n this.logger.verbose(\"BrowserCacheManager.addAccountKeyToMap account key already exists in map\");\r\n }\r\n };\r\n /**\r\n * Remove an account from the key map\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.removeAccountKeyFromMap = function (key) {\r\n this.logger.trace(\"BrowserCacheManager.removeAccountKeyFromMap called\");\r\n this.logger.tracePii(\"BrowserCacheManager.removeAccountKeyFromMap called with key: \" + key);\r\n var accountKeys = this.getAccountKeys();\r\n var removalIndex = accountKeys.indexOf(key);\r\n if (removalIndex > -1) {\r\n accountKeys.splice(removalIndex, 1);\r\n this.setItem(StaticCacheKeys.ACCOUNT_KEYS, JSON.stringify(accountKeys));\r\n this.logger.trace(\"BrowserCacheManager.removeAccountKeyFromMap account key removed\");\r\n }\r\n else {\r\n this.logger.trace(\"BrowserCacheManager.removeAccountKeyFromMap key not found in existing map\");\r\n }\r\n };\r\n /**\r\n * Extends inherited removeAccount function to include removal of the account key from the map\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.removeAccount = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n _super.prototype.removeAccount.call(this, key);\r\n this.removeAccountKeyFromMap(key);\r\n return [2 /*return*/];\r\n });\r\n });\r\n };\r\n /**\r\n * Removes given idToken from the cache and from the key map\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.removeIdToken = function (key) {\r\n _super.prototype.removeIdToken.call(this, key);\r\n this.removeTokenKey(key, CredentialType.ID_TOKEN);\r\n };\r\n /**\r\n * Removes given accessToken from the cache and from the key map\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.removeAccessToken = function (key) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n _super.prototype.removeAccessToken.call(this, key);\r\n this.removeTokenKey(key, CredentialType.ACCESS_TOKEN);\r\n return [2 /*return*/];\r\n });\r\n });\r\n };\r\n /**\r\n * Removes given refreshToken from the cache and from the key map\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.removeRefreshToken = function (key) {\r\n _super.prototype.removeRefreshToken.call(this, key);\r\n this.removeTokenKey(key, CredentialType.REFRESH_TOKEN);\r\n };\r\n /**\r\n * Gets the keys for the cached tokens associated with this clientId\r\n * @returns\r\n */\r\n BrowserCacheManager.prototype.getTokenKeys = function () {\r\n this.logger.trace(\"BrowserCacheManager.getTokenKeys called\");\r\n var item = this.getItem(StaticCacheKeys.TOKEN_KEYS + \".\" + this.clientId);\r\n if (item) {\r\n var tokenKeys = this.validateAndParseJson(item);\r\n if (tokenKeys &&\r\n tokenKeys.hasOwnProperty(\"idToken\") &&\r\n tokenKeys.hasOwnProperty(\"accessToken\") &&\r\n tokenKeys.hasOwnProperty(\"refreshToken\")) {\r\n return tokenKeys;\r\n }\r\n else {\r\n this.logger.error(\"BrowserCacheManager.getTokenKeys - Token keys found but in an unknown format. Returning empty key map.\");\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"BrowserCacheManager.getTokenKeys - No token keys found\");\r\n }\r\n return {\r\n idToken: [],\r\n accessToken: [],\r\n refreshToken: []\r\n };\r\n };\r\n /**\r\n * Adds the given key to the token key map\r\n * @param key\r\n * @param type\r\n */\r\n BrowserCacheManager.prototype.addTokenKey = function (key, type) {\r\n this.logger.trace(\"BrowserCacheManager addTokenKey called\");\r\n var tokenKeys = this.getTokenKeys();\r\n switch (type) {\r\n case CredentialType.ID_TOKEN:\r\n if (tokenKeys.idToken.indexOf(key) === -1) {\r\n this.logger.info(\"BrowserCacheManager: addTokenKey - idToken added to map\");\r\n tokenKeys.idToken.push(key);\r\n }\r\n break;\r\n case CredentialType.ACCESS_TOKEN:\r\n if (tokenKeys.accessToken.indexOf(key) === -1) {\r\n this.logger.info(\"BrowserCacheManager: addTokenKey - accessToken added to map\");\r\n tokenKeys.accessToken.push(key);\r\n }\r\n break;\r\n case CredentialType.REFRESH_TOKEN:\r\n if (tokenKeys.refreshToken.indexOf(key) === -1) {\r\n this.logger.info(\"BrowserCacheManager: addTokenKey - refreshToken added to map\");\r\n tokenKeys.refreshToken.push(key);\r\n }\r\n break;\r\n default:\r\n this.logger.error(\"BrowserCacheManager:addTokenKey - CredentialType provided invalid. CredentialType: \" + type);\r\n ClientAuthError.createUnexpectedCredentialTypeError();\r\n }\r\n this.setItem(StaticCacheKeys.TOKEN_KEYS + \".\" + this.clientId, JSON.stringify(tokenKeys));\r\n };\r\n /**\r\n * Removes the given key from the token key map\r\n * @param key\r\n * @param type\r\n */\r\n BrowserCacheManager.prototype.removeTokenKey = function (key, type) {\r\n this.logger.trace(\"BrowserCacheManager removeTokenKey called\");\r\n var tokenKeys = this.getTokenKeys();\r\n switch (type) {\r\n case CredentialType.ID_TOKEN:\r\n this.logger.infoPii(\"BrowserCacheManager: removeTokenKey - attempting to remove idToken with key: \" + key + \" from map\");\r\n var idRemoval = tokenKeys.idToken.indexOf(key);\r\n if (idRemoval > -1) {\r\n this.logger.info(\"BrowserCacheManager: removeTokenKey - idToken removed from map\");\r\n tokenKeys.idToken.splice(idRemoval, 1);\r\n }\r\n else {\r\n this.logger.info(\"BrowserCacheManager: removeTokenKey - idToken does not exist in map. Either it was previously removed or it was never added.\");\r\n }\r\n break;\r\n case CredentialType.ACCESS_TOKEN:\r\n this.logger.infoPii(\"BrowserCacheManager: removeTokenKey - attempting to remove accessToken with key: \" + key + \" from map\");\r\n var accessRemoval = tokenKeys.accessToken.indexOf(key);\r\n if (accessRemoval > -1) {\r\n this.logger.info(\"BrowserCacheManager: removeTokenKey - accessToken removed from map\");\r\n tokenKeys.accessToken.splice(accessRemoval, 1);\r\n }\r\n else {\r\n this.logger.info(\"BrowserCacheManager: removeTokenKey - accessToken does not exist in map. Either it was previously removed or it was never added.\");\r\n }\r\n break;\r\n case CredentialType.REFRESH_TOKEN:\r\n this.logger.infoPii(\"BrowserCacheManager: removeTokenKey - attempting to remove refreshToken with key: \" + key + \" from map\");\r\n var refreshRemoval = tokenKeys.refreshToken.indexOf(key);\r\n if (refreshRemoval > -1) {\r\n this.logger.info(\"BrowserCacheManager: removeTokenKey - refreshToken removed from map\");\r\n tokenKeys.refreshToken.splice(refreshRemoval, 1);\r\n }\r\n else {\r\n this.logger.info(\"BrowserCacheManager: removeTokenKey - refreshToken does not exist in map. Either it was previously removed or it was never added.\");\r\n }\r\n break;\r\n default:\r\n this.logger.error(\"BrowserCacheManager:removeTokenKey - CredentialType provided invalid. CredentialType: \" + type);\r\n ClientAuthError.createUnexpectedCredentialTypeError();\r\n }\r\n this.setItem(StaticCacheKeys.TOKEN_KEYS + \".\" + this.clientId, JSON.stringify(tokenKeys));\r\n };\r\n /**\r\n * generates idToken entity from a string\r\n * @param idTokenKey\r\n */\r\n BrowserCacheManager.prototype.getIdTokenCredential = function (idTokenKey) {\r\n var value = this.getItem(idTokenKey);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getIdTokenCredential: called, no cache hit\");\r\n this.removeTokenKey(idTokenKey, CredentialType.ID_TOKEN);\r\n return null;\r\n }\r\n var parsedIdToken = this.validateAndParseJson(value);\r\n if (!parsedIdToken || !IdTokenEntity.isIdTokenEntity(parsedIdToken)) {\r\n this.logger.trace(\"BrowserCacheManager.getIdTokenCredential: called, no cache hit\");\r\n this.removeTokenKey(idTokenKey, CredentialType.ID_TOKEN);\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getIdTokenCredential: cache hit\");\r\n return CacheManager.toObject(new IdTokenEntity(), parsedIdToken);\r\n };\r\n /**\r\n * set IdToken credential to the platform cache\r\n * @param idToken\r\n */\r\n BrowserCacheManager.prototype.setIdTokenCredential = function (idToken) {\r\n this.logger.trace(\"BrowserCacheManager.setIdTokenCredential called\");\r\n var idTokenKey = idToken.generateCredentialKey();\r\n this.setItem(idTokenKey, JSON.stringify(idToken));\r\n this.addTokenKey(idTokenKey, CredentialType.ID_TOKEN);\r\n };\r\n /**\r\n * generates accessToken entity from a string\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.getAccessTokenCredential = function (accessTokenKey) {\r\n var value = this.getItem(accessTokenKey);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getAccessTokenCredential: called, no cache hit\");\r\n this.removeTokenKey(accessTokenKey, CredentialType.ACCESS_TOKEN);\r\n return null;\r\n }\r\n var parsedAccessToken = this.validateAndParseJson(value);\r\n if (!parsedAccessToken || !AccessTokenEntity.isAccessTokenEntity(parsedAccessToken)) {\r\n this.logger.trace(\"BrowserCacheManager.getAccessTokenCredential: called, no cache hit\");\r\n this.removeTokenKey(accessTokenKey, CredentialType.ACCESS_TOKEN);\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getAccessTokenCredential: cache hit\");\r\n return CacheManager.toObject(new AccessTokenEntity(), parsedAccessToken);\r\n };\r\n /**\r\n * set accessToken credential to the platform cache\r\n * @param accessToken\r\n */\r\n BrowserCacheManager.prototype.setAccessTokenCredential = function (accessToken) {\r\n this.logger.trace(\"BrowserCacheManager.setAccessTokenCredential called\");\r\n var accessTokenKey = accessToken.generateCredentialKey();\r\n this.setItem(accessTokenKey, JSON.stringify(accessToken));\r\n this.addTokenKey(accessTokenKey, CredentialType.ACCESS_TOKEN);\r\n };\r\n /**\r\n * generates refreshToken entity from a string\r\n * @param refreshTokenKey\r\n */\r\n BrowserCacheManager.prototype.getRefreshTokenCredential = function (refreshTokenKey) {\r\n var value = this.getItem(refreshTokenKey);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getRefreshTokenCredential: called, no cache hit\");\r\n this.removeTokenKey(refreshTokenKey, CredentialType.REFRESH_TOKEN);\r\n return null;\r\n }\r\n var parsedRefreshToken = this.validateAndParseJson(value);\r\n if (!parsedRefreshToken || !RefreshTokenEntity.isRefreshTokenEntity(parsedRefreshToken)) {\r\n this.logger.trace(\"BrowserCacheManager.getRefreshTokenCredential: called, no cache hit\");\r\n this.removeTokenKey(refreshTokenKey, CredentialType.REFRESH_TOKEN);\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getRefreshTokenCredential: cache hit\");\r\n return CacheManager.toObject(new RefreshTokenEntity(), parsedRefreshToken);\r\n };\r\n /**\r\n * set refreshToken credential to the platform cache\r\n * @param refreshToken\r\n */\r\n BrowserCacheManager.prototype.setRefreshTokenCredential = function (refreshToken) {\r\n this.logger.trace(\"BrowserCacheManager.setRefreshTokenCredential called\");\r\n var refreshTokenKey = refreshToken.generateCredentialKey();\r\n this.setItem(refreshTokenKey, JSON.stringify(refreshToken));\r\n this.addTokenKey(refreshTokenKey, CredentialType.REFRESH_TOKEN);\r\n };\r\n /**\r\n * fetch appMetadata entity from the platform cache\r\n * @param appMetadataKey\r\n */\r\n BrowserCacheManager.prototype.getAppMetadata = function (appMetadataKey) {\r\n var value = this.getItem(appMetadataKey);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getAppMetadata: called, no cache hit\");\r\n return null;\r\n }\r\n var parsedMetadata = this.validateAndParseJson(value);\r\n if (!parsedMetadata || !AppMetadataEntity.isAppMetadataEntity(appMetadataKey, parsedMetadata)) {\r\n this.logger.trace(\"BrowserCacheManager.getAppMetadata: called, no cache hit\");\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getAppMetadata: cache hit\");\r\n return CacheManager.toObject(new AppMetadataEntity(), parsedMetadata);\r\n };\r\n /**\r\n * set appMetadata entity to the platform cache\r\n * @param appMetadata\r\n */\r\n BrowserCacheManager.prototype.setAppMetadata = function (appMetadata) {\r\n this.logger.trace(\"BrowserCacheManager.setAppMetadata called\");\r\n var appMetadataKey = appMetadata.generateAppMetadataKey();\r\n this.setItem(appMetadataKey, JSON.stringify(appMetadata));\r\n };\r\n /**\r\n * fetch server telemetry entity from the platform cache\r\n * @param serverTelemetryKey\r\n */\r\n BrowserCacheManager.prototype.getServerTelemetry = function (serverTelemetryKey) {\r\n var value = this.getItem(serverTelemetryKey);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getServerTelemetry: called, no cache hit\");\r\n return null;\r\n }\r\n var parsedMetadata = this.validateAndParseJson(value);\r\n if (!parsedMetadata || !ServerTelemetryEntity.isServerTelemetryEntity(serverTelemetryKey, parsedMetadata)) {\r\n this.logger.trace(\"BrowserCacheManager.getServerTelemetry: called, no cache hit\");\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getServerTelemetry: cache hit\");\r\n return CacheManager.toObject(new ServerTelemetryEntity(), parsedMetadata);\r\n };\r\n /**\r\n * set server telemetry entity to the platform cache\r\n * @param serverTelemetryKey\r\n * @param serverTelemetry\r\n */\r\n BrowserCacheManager.prototype.setServerTelemetry = function (serverTelemetryKey, serverTelemetry) {\r\n this.logger.trace(\"BrowserCacheManager.setServerTelemetry called\");\r\n this.setItem(serverTelemetryKey, JSON.stringify(serverTelemetry));\r\n };\r\n /**\r\n *\r\n */\r\n BrowserCacheManager.prototype.getAuthorityMetadata = function (key) {\r\n var value = this.internalStorage.getItem(key);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getAuthorityMetadata: called, no cache hit\");\r\n return null;\r\n }\r\n var parsedMetadata = this.validateAndParseJson(value);\r\n if (parsedMetadata && AuthorityMetadataEntity.isAuthorityMetadataEntity(key, parsedMetadata)) {\r\n this.logger.trace(\"BrowserCacheManager.getAuthorityMetadata: cache hit\");\r\n return CacheManager.toObject(new AuthorityMetadataEntity(), parsedMetadata);\r\n }\r\n return null;\r\n };\r\n /**\r\n *\r\n */\r\n BrowserCacheManager.prototype.getAuthorityMetadataKeys = function () {\r\n var _this = this;\r\n var allKeys = this.internalStorage.getKeys();\r\n return allKeys.filter(function (key) {\r\n return _this.isAuthorityMetadata(key);\r\n });\r\n };\r\n /**\r\n * Sets wrapper metadata in memory\r\n * @param wrapperSKU\r\n * @param wrapperVersion\r\n */\r\n BrowserCacheManager.prototype.setWrapperMetadata = function (wrapperSKU, wrapperVersion) {\r\n this.internalStorage.setItem(InMemoryCacheKeys.WRAPPER_SKU, wrapperSKU);\r\n this.internalStorage.setItem(InMemoryCacheKeys.WRAPPER_VER, wrapperVersion);\r\n };\r\n /**\r\n * Returns wrapper metadata from in-memory storage\r\n */\r\n BrowserCacheManager.prototype.getWrapperMetadata = function () {\r\n var sku = this.internalStorage.getItem(InMemoryCacheKeys.WRAPPER_SKU) || Constants.EMPTY_STRING;\r\n var version = this.internalStorage.getItem(InMemoryCacheKeys.WRAPPER_VER) || Constants.EMPTY_STRING;\r\n return [sku, version];\r\n };\r\n /**\r\n *\r\n * @param entity\r\n */\r\n BrowserCacheManager.prototype.setAuthorityMetadata = function (key, entity) {\r\n this.logger.trace(\"BrowserCacheManager.setAuthorityMetadata called\");\r\n this.internalStorage.setItem(key, JSON.stringify(entity));\r\n };\r\n /**\r\n * Gets the active account\r\n */\r\n BrowserCacheManager.prototype.getActiveAccount = function () {\r\n var activeAccountKeyFilters = this.generateCacheKey(PersistentCacheKeys.ACTIVE_ACCOUNT_FILTERS);\r\n var activeAccountValueFilters = this.getItem(activeAccountKeyFilters);\r\n if (!activeAccountValueFilters) {\r\n // if new active account cache type isn't found, it's an old version, so look for that instead\r\n this.logger.trace(\"BrowserCacheManager.getActiveAccount: No active account filters cache schema found, looking for legacy schema\");\r\n var activeAccountKeyLocal = this.generateCacheKey(PersistentCacheKeys.ACTIVE_ACCOUNT);\r\n var activeAccountValueLocal = this.getItem(activeAccountKeyLocal);\r\n if (!activeAccountValueLocal) {\r\n this.logger.trace(\"BrowserCacheManager.getActiveAccount: No active account found\");\r\n return null;\r\n }\r\n var activeAccount = this.getAccountInfoByFilter({ localAccountId: activeAccountValueLocal })[0] || null;\r\n if (activeAccount) {\r\n this.logger.trace(\"BrowserCacheManager.getActiveAccount: Legacy active account cache schema found\");\r\n this.logger.trace(\"BrowserCacheManager.getActiveAccount: Adding active account filters cache schema\");\r\n this.setActiveAccount(activeAccount);\r\n return activeAccount;\r\n }\r\n return null;\r\n }\r\n var activeAccountValueObj = this.validateAndParseJson(activeAccountValueFilters);\r\n if (activeAccountValueObj) {\r\n this.logger.trace(\"BrowserCacheManager.getActiveAccount: Active account filters schema found\");\r\n return this.getAccountInfoByFilter({\r\n homeAccountId: activeAccountValueObj.homeAccountId,\r\n localAccountId: activeAccountValueObj.localAccountId\r\n })[0] || null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getActiveAccount: No active account found\");\r\n return null;\r\n };\r\n /**\r\n * Sets the active account's localAccountId in cache\r\n * @param account\r\n */\r\n BrowserCacheManager.prototype.setActiveAccount = function (account) {\r\n var activeAccountKey = this.generateCacheKey(PersistentCacheKeys.ACTIVE_ACCOUNT_FILTERS);\r\n var activeAccountKeyLocal = this.generateCacheKey(PersistentCacheKeys.ACTIVE_ACCOUNT);\r\n if (account) {\r\n this.logger.verbose(\"setActiveAccount: Active account set\");\r\n var activeAccountValue = {\r\n homeAccountId: account.homeAccountId,\r\n localAccountId: account.localAccountId\r\n };\r\n this.browserStorage.setItem(activeAccountKey, JSON.stringify(activeAccountValue));\r\n this.browserStorage.setItem(activeAccountKeyLocal, account.localAccountId);\r\n }\r\n else {\r\n this.logger.verbose(\"setActiveAccount: No account passed, active account not set\");\r\n this.browserStorage.removeItem(activeAccountKey);\r\n this.browserStorage.removeItem(activeAccountKeyLocal);\r\n }\r\n };\r\n /**\r\n * Gets a list of accounts that match all of the filters provided\r\n * @param account\r\n */\r\n BrowserCacheManager.prototype.getAccountInfoByFilter = function (accountFilter) {\r\n var allAccounts = this.getAllAccounts();\r\n this.logger.trace(\"BrowserCacheManager.getAccountInfoByFilter: total \" + allAccounts.length + \" accounts found\");\r\n return allAccounts.filter(function (accountObj) {\r\n if (accountFilter.username && accountFilter.username.toLowerCase() !== accountObj.username.toLowerCase()) {\r\n return false;\r\n }\r\n if (accountFilter.homeAccountId && accountFilter.homeAccountId !== accountObj.homeAccountId) {\r\n return false;\r\n }\r\n if (accountFilter.localAccountId && accountFilter.localAccountId !== accountObj.localAccountId) {\r\n return false;\r\n }\r\n if (accountFilter.tenantId && accountFilter.tenantId !== accountObj.tenantId) {\r\n return false;\r\n }\r\n if (accountFilter.environment && accountFilter.environment !== accountObj.environment) {\r\n return false;\r\n }\r\n return true;\r\n });\r\n };\r\n /**\r\n * Checks the cache for accounts matching loginHint or SID\r\n * @param loginHint\r\n * @param sid\r\n */\r\n BrowserCacheManager.prototype.getAccountInfoByHints = function (loginHint, sid) {\r\n var matchingAccounts = this.getAllAccounts().filter(function (accountInfo) {\r\n if (sid) {\r\n var accountSid = accountInfo.idTokenClaims && accountInfo.idTokenClaims[\"sid\"];\r\n return sid === accountSid;\r\n }\r\n if (loginHint) {\r\n return loginHint === accountInfo.username;\r\n }\r\n return false;\r\n });\r\n if (matchingAccounts.length === 1) {\r\n return matchingAccounts[0];\r\n }\r\n else if (matchingAccounts.length > 1) {\r\n throw ClientAuthError.createMultipleMatchingAccountsInCacheError();\r\n }\r\n return null;\r\n };\r\n /**\r\n * fetch throttling entity from the platform cache\r\n * @param throttlingCacheKey\r\n */\r\n BrowserCacheManager.prototype.getThrottlingCache = function (throttlingCacheKey) {\r\n var value = this.getItem(throttlingCacheKey);\r\n if (!value) {\r\n this.logger.trace(\"BrowserCacheManager.getThrottlingCache: called, no cache hit\");\r\n return null;\r\n }\r\n var parsedThrottlingCache = this.validateAndParseJson(value);\r\n if (!parsedThrottlingCache || !ThrottlingEntity.isThrottlingEntity(throttlingCacheKey, parsedThrottlingCache)) {\r\n this.logger.trace(\"BrowserCacheManager.getThrottlingCache: called, no cache hit\");\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getThrottlingCache: cache hit\");\r\n return CacheManager.toObject(new ThrottlingEntity(), parsedThrottlingCache);\r\n };\r\n /**\r\n * set throttling entity to the platform cache\r\n * @param throttlingCacheKey\r\n * @param throttlingCache\r\n */\r\n BrowserCacheManager.prototype.setThrottlingCache = function (throttlingCacheKey, throttlingCache) {\r\n this.logger.trace(\"BrowserCacheManager.setThrottlingCache called\");\r\n this.setItem(throttlingCacheKey, JSON.stringify(throttlingCache));\r\n };\r\n /**\r\n * Gets cache item with given key.\r\n * Will retrieve from cookies if storeAuthStateInCookie is set to true.\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.getTemporaryCache = function (cacheKey, generateKey) {\r\n var key = generateKey ? this.generateCacheKey(cacheKey) : cacheKey;\r\n if (this.cacheConfig.storeAuthStateInCookie) {\r\n var itemCookie = this.getItemCookie(key);\r\n if (itemCookie) {\r\n this.logger.trace(\"BrowserCacheManager.getTemporaryCache: storeAuthStateInCookies set to true, retrieving from cookies\");\r\n return itemCookie;\r\n }\r\n }\r\n var value = this.temporaryCacheStorage.getItem(key);\r\n if (!value) {\r\n // If temp cache item not found in session/memory, check local storage for items set by old versions\r\n if (this.cacheConfig.cacheLocation === BrowserCacheLocation.LocalStorage) {\r\n var item = this.browserStorage.getItem(key);\r\n if (item) {\r\n this.logger.trace(\"BrowserCacheManager.getTemporaryCache: Temporary cache item found in local storage\");\r\n return item;\r\n }\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getTemporaryCache: No cache item found in local storage\");\r\n return null;\r\n }\r\n this.logger.trace(\"BrowserCacheManager.getTemporaryCache: Temporary cache item returned\");\r\n return value;\r\n };\r\n /**\r\n * Sets the cache item with the key and value given.\r\n * Stores in cookie if storeAuthStateInCookie is set to true.\r\n * This can cause cookie overflow if used incorrectly.\r\n * @param key\r\n * @param value\r\n */\r\n BrowserCacheManager.prototype.setTemporaryCache = function (cacheKey, value, generateKey) {\r\n var key = generateKey ? this.generateCacheKey(cacheKey) : cacheKey;\r\n this.temporaryCacheStorage.setItem(key, value);\r\n if (this.cacheConfig.storeAuthStateInCookie) {\r\n this.logger.trace(\"BrowserCacheManager.setTemporaryCache: storeAuthStateInCookie set to true, setting item cookie\");\r\n this.setItemCookie(key, value);\r\n }\r\n };\r\n /**\r\n * Removes the cache item with the given key.\r\n * Will also clear the cookie item if storeAuthStateInCookie is set to true.\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.removeItem = function (key) {\r\n this.browserStorage.removeItem(key);\r\n this.temporaryCacheStorage.removeItem(key);\r\n if (this.cacheConfig.storeAuthStateInCookie) {\r\n this.logger.trace(\"BrowserCacheManager.removeItem: storeAuthStateInCookie is true, clearing item cookie\");\r\n this.clearItemCookie(key);\r\n }\r\n };\r\n /**\r\n * Checks whether key is in cache.\r\n * @param key\r\n */\r\n BrowserCacheManager.prototype.containsKey = function (key) {\r\n return this.browserStorage.containsKey(key) || this.temporaryCacheStorage.containsKey(key);\r\n };\r\n /**\r\n * Gets all keys in window.\r\n */\r\n BrowserCacheManager.prototype.getKeys = function () {\r\n return __spread(this.browserStorage.getKeys(), this.temporaryCacheStorage.getKeys());\r\n };\r\n /**\r\n * Clears all cache entries created by MSAL.\r\n */\r\n BrowserCacheManager.prototype.clear = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: \r\n // Removes all accounts and their credentials\r\n return [4 /*yield*/, this.removeAllAccounts()];\r\n case 1:\r\n // Removes all accounts and their credentials\r\n _a.sent();\r\n this.removeAppMetadata();\r\n // Removes all remaining MSAL cache items\r\n this.getKeys().forEach(function (cacheKey) {\r\n // Check if key contains msal prefix; For now, we are clearing all the cache items created by MSAL.js\r\n if ((_this.browserStorage.containsKey(cacheKey) || _this.temporaryCacheStorage.containsKey(cacheKey)) && ((cacheKey.indexOf(Constants.CACHE_PREFIX) !== -1) || (cacheKey.indexOf(_this.clientId) !== -1))) {\r\n _this.removeItem(cacheKey);\r\n }\r\n });\r\n this.internalStorage.clear();\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Clears all access tokes that have claims prior to saving the current one\r\n * @param credential\r\n * @returns\r\n */\r\n BrowserCacheManager.prototype.clearTokensAndKeysWithClaims = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var tokenKeys, removedAccessTokens;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"BrowserCacheManager.clearTokensAndKeysWithClaims called\");\r\n tokenKeys = this.getTokenKeys();\r\n removedAccessTokens = [];\r\n tokenKeys.accessToken.forEach(function (key) {\r\n // if the access token has claims in its key, remove the token key and the token\r\n var credential = _this.getAccessTokenCredential(key);\r\n if ((credential === null || credential === void 0 ? void 0 : credential.requestedClaimsHash) && key.includes(credential.requestedClaimsHash.toLowerCase())) {\r\n removedAccessTokens.push(_this.removeAccessToken(key));\r\n }\r\n });\r\n return [4 /*yield*/, Promise.all(removedAccessTokens)];\r\n case 1:\r\n _a.sent();\r\n // warn if any access tokens are removed\r\n if (removedAccessTokens.length > 0) {\r\n this.logger.warning(removedAccessTokens.length + \" access tokens with claims in the cache keys have been removed from the cache.\");\r\n }\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Add value to cookies\r\n * @param cookieName\r\n * @param cookieValue\r\n * @param expires\r\n */\r\n BrowserCacheManager.prototype.setItemCookie = function (cookieName, cookieValue, expires) {\r\n var cookieStr = encodeURIComponent(cookieName) + \"=\" + encodeURIComponent(cookieValue) + \";path=/;SameSite=Lax;\";\r\n if (expires) {\r\n var expireTime = this.getCookieExpirationTime(expires);\r\n cookieStr += \"expires=\" + expireTime + \";\";\r\n }\r\n if (this.cacheConfig.secureCookies) {\r\n cookieStr += \"Secure;\";\r\n }\r\n document.cookie = cookieStr;\r\n };\r\n /**\r\n * Get one item by key from cookies\r\n * @param cookieName\r\n */\r\n BrowserCacheManager.prototype.getItemCookie = function (cookieName) {\r\n var name = encodeURIComponent(cookieName) + \"=\";\r\n var cookieList = document.cookie.split(\";\");\r\n for (var i = 0; i < cookieList.length; i++) {\r\n var cookie = cookieList[i];\r\n while (cookie.charAt(0) === \" \") {\r\n cookie = cookie.substring(1);\r\n }\r\n if (cookie.indexOf(name) === 0) {\r\n return decodeURIComponent(cookie.substring(name.length, cookie.length));\r\n }\r\n }\r\n return Constants.EMPTY_STRING;\r\n };\r\n /**\r\n * Clear all msal-related cookies currently set in the browser. Should only be used to clear temporary cache items.\r\n */\r\n BrowserCacheManager.prototype.clearMsalCookies = function () {\r\n var _this = this;\r\n var cookiePrefix = Constants.CACHE_PREFIX + \".\" + this.clientId;\r\n var cookieList = document.cookie.split(\";\");\r\n cookieList.forEach(function (cookie) {\r\n while (cookie.charAt(0) === \" \") {\r\n // eslint-disable-next-line no-param-reassign\r\n cookie = cookie.substring(1);\r\n }\r\n if (cookie.indexOf(cookiePrefix) === 0) {\r\n var cookieKey = cookie.split(\"=\")[0];\r\n _this.clearItemCookie(cookieKey);\r\n }\r\n });\r\n };\r\n /**\r\n * Clear an item in the cookies by key\r\n * @param cookieName\r\n */\r\n BrowserCacheManager.prototype.clearItemCookie = function (cookieName) {\r\n this.setItemCookie(cookieName, Constants.EMPTY_STRING, -1);\r\n };\r\n /**\r\n * Get cookie expiration time\r\n * @param cookieLifeDays\r\n */\r\n BrowserCacheManager.prototype.getCookieExpirationTime = function (cookieLifeDays) {\r\n var today = new Date();\r\n var expr = new Date(today.getTime() + cookieLifeDays * this.COOKIE_LIFE_MULTIPLIER);\r\n return expr.toUTCString();\r\n };\r\n /**\r\n * Gets the cache object referenced by the browser\r\n */\r\n BrowserCacheManager.prototype.getCache = function () {\r\n return this.browserStorage;\r\n };\r\n /**\r\n * interface compat, we cannot overwrite browser cache; Functionality is supported by individual entities in browser\r\n */\r\n BrowserCacheManager.prototype.setCache = function () {\r\n // sets nothing\r\n };\r\n /**\r\n * Prepend msal. to each key; Skip for any JSON object as Key (defined schemas do not need the key appended: AccessToken Keys or the upcoming schema)\r\n * @param key\r\n * @param addInstanceId\r\n */\r\n BrowserCacheManager.prototype.generateCacheKey = function (key) {\r\n var generatedKey = this.validateAndParseJson(key);\r\n if (!generatedKey) {\r\n if (StringUtils.startsWith(key, Constants.CACHE_PREFIX) || StringUtils.startsWith(key, PersistentCacheKeys.ADAL_ID_TOKEN)) {\r\n return key;\r\n }\r\n return Constants.CACHE_PREFIX + \".\" + this.clientId + \".\" + key;\r\n }\r\n return JSON.stringify(key);\r\n };\r\n /**\r\n * Create authorityKey to cache authority\r\n * @param state\r\n */\r\n BrowserCacheManager.prototype.generateAuthorityKey = function (stateString) {\r\n var stateId = ProtocolUtils.parseRequestState(this.cryptoImpl, stateString).libraryState.id;\r\n return this.generateCacheKey(TemporaryCacheKeys.AUTHORITY + \".\" + stateId);\r\n };\r\n /**\r\n * Create Nonce key to cache nonce\r\n * @param state\r\n */\r\n BrowserCacheManager.prototype.generateNonceKey = function (stateString) {\r\n var stateId = ProtocolUtils.parseRequestState(this.cryptoImpl, stateString).libraryState.id;\r\n return this.generateCacheKey(TemporaryCacheKeys.NONCE_IDTOKEN + \".\" + stateId);\r\n };\r\n /**\r\n * Creates full cache key for the request state\r\n * @param stateString State string for the request\r\n */\r\n BrowserCacheManager.prototype.generateStateKey = function (stateString) {\r\n // Use the library state id to key temp storage for uniqueness for multiple concurrent requests\r\n var stateId = ProtocolUtils.parseRequestState(this.cryptoImpl, stateString).libraryState.id;\r\n return this.generateCacheKey(TemporaryCacheKeys.REQUEST_STATE + \".\" + stateId);\r\n };\r\n /**\r\n * Gets the cached authority based on the cached state. Returns empty if no cached state found.\r\n */\r\n BrowserCacheManager.prototype.getCachedAuthority = function (cachedState) {\r\n var stateCacheKey = this.generateStateKey(cachedState);\r\n var state = this.getTemporaryCache(stateCacheKey);\r\n if (!state) {\r\n return null;\r\n }\r\n var authorityCacheKey = this.generateAuthorityKey(state);\r\n return this.getTemporaryCache(authorityCacheKey);\r\n };\r\n /**\r\n * Updates account, authority, and state in cache\r\n * @param serverAuthenticationRequest\r\n * @param account\r\n */\r\n BrowserCacheManager.prototype.updateCacheEntries = function (state, nonce, authorityInstance, loginHint, account) {\r\n this.logger.trace(\"BrowserCacheManager.updateCacheEntries called\");\r\n // Cache the request state\r\n var stateCacheKey = this.generateStateKey(state);\r\n this.setTemporaryCache(stateCacheKey, state, false);\r\n // Cache the nonce\r\n var nonceCacheKey = this.generateNonceKey(state);\r\n this.setTemporaryCache(nonceCacheKey, nonce, false);\r\n // Cache authorityKey\r\n var authorityCacheKey = this.generateAuthorityKey(state);\r\n this.setTemporaryCache(authorityCacheKey, authorityInstance, false);\r\n if (account) {\r\n var ccsCredential = {\r\n credential: account.homeAccountId,\r\n type: CcsCredentialType.HOME_ACCOUNT_ID\r\n };\r\n this.setTemporaryCache(TemporaryCacheKeys.CCS_CREDENTIAL, JSON.stringify(ccsCredential), true);\r\n }\r\n else if (!StringUtils.isEmpty(loginHint)) {\r\n var ccsCredential = {\r\n credential: loginHint,\r\n type: CcsCredentialType.UPN\r\n };\r\n this.setTemporaryCache(TemporaryCacheKeys.CCS_CREDENTIAL, JSON.stringify(ccsCredential), true);\r\n }\r\n };\r\n /**\r\n * Reset all temporary cache items\r\n * @param state\r\n */\r\n BrowserCacheManager.prototype.resetRequestCache = function (state) {\r\n var _this = this;\r\n this.logger.trace(\"BrowserCacheManager.resetRequestCache called\");\r\n // check state and remove associated cache items\r\n if (!StringUtils.isEmpty(state)) {\r\n this.getKeys().forEach(function (key) {\r\n if (key.indexOf(state) !== -1) {\r\n _this.removeItem(key);\r\n }\r\n });\r\n }\r\n // delete generic interactive request parameters\r\n if (state) {\r\n this.removeItem(this.generateStateKey(state));\r\n this.removeItem(this.generateNonceKey(state));\r\n this.removeItem(this.generateAuthorityKey(state));\r\n }\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.REQUEST_PARAMS));\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.ORIGIN_URI));\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.URL_HASH));\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.CORRELATION_ID));\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.CCS_CREDENTIAL));\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.NATIVE_REQUEST));\r\n this.setInteractionInProgress(false);\r\n };\r\n /**\r\n * Removes temporary cache for the provided state\r\n * @param stateString\r\n */\r\n BrowserCacheManager.prototype.cleanRequestByState = function (stateString) {\r\n this.logger.trace(\"BrowserCacheManager.cleanRequestByState called\");\r\n // Interaction is completed - remove interaction status.\r\n if (stateString) {\r\n var stateKey = this.generateStateKey(stateString);\r\n var cachedState = this.temporaryCacheStorage.getItem(stateKey);\r\n this.logger.infoPii(\"BrowserCacheManager.cleanRequestByState: Removing temporary cache items for state: \" + cachedState);\r\n this.resetRequestCache(cachedState || Constants.EMPTY_STRING);\r\n }\r\n this.clearMsalCookies();\r\n };\r\n /**\r\n * Looks in temporary cache for any state values with the provided interactionType and removes all temporary cache items for that state\r\n * Used in scenarios where temp cache needs to be cleaned but state is not known, such as clicking browser back button.\r\n * @param interactionType\r\n */\r\n BrowserCacheManager.prototype.cleanRequestByInteractionType = function (interactionType) {\r\n var _this = this;\r\n this.logger.trace(\"BrowserCacheManager.cleanRequestByInteractionType called\");\r\n // Loop through all keys to find state key\r\n this.getKeys().forEach(function (key) {\r\n // If this key is not the state key, move on\r\n if (key.indexOf(TemporaryCacheKeys.REQUEST_STATE) === -1) {\r\n return;\r\n }\r\n // Retrieve state value, return if not a valid value\r\n var stateValue = _this.temporaryCacheStorage.getItem(key);\r\n if (!stateValue) {\r\n return;\r\n }\r\n // Extract state and ensure it matches given InteractionType, then clean request cache\r\n var parsedState = BrowserProtocolUtils.extractBrowserRequestState(_this.cryptoImpl, stateValue);\r\n if (parsedState && parsedState.interactionType === interactionType) {\r\n _this.logger.infoPii(\"BrowserCacheManager.cleanRequestByInteractionType: Removing temporary cache items for state: \" + stateValue);\r\n _this.resetRequestCache(stateValue);\r\n }\r\n });\r\n this.clearMsalCookies();\r\n this.setInteractionInProgress(false);\r\n };\r\n BrowserCacheManager.prototype.cacheCodeRequest = function (authCodeRequest, browserCrypto) {\r\n this.logger.trace(\"BrowserCacheManager.cacheCodeRequest called\");\r\n var encodedValue = browserCrypto.base64Encode(JSON.stringify(authCodeRequest));\r\n this.setTemporaryCache(TemporaryCacheKeys.REQUEST_PARAMS, encodedValue, true);\r\n };\r\n /**\r\n * Gets the token exchange parameters from the cache. Throws an error if nothing is found.\r\n */\r\n BrowserCacheManager.prototype.getCachedRequest = function (state, browserCrypto) {\r\n this.logger.trace(\"BrowserCacheManager.getCachedRequest called\");\r\n // Get token request from cache and parse as TokenExchangeParameters.\r\n var encodedTokenRequest = this.getTemporaryCache(TemporaryCacheKeys.REQUEST_PARAMS, true);\r\n if (!encodedTokenRequest) {\r\n throw BrowserAuthError.createNoTokenRequestCacheError();\r\n }\r\n var parsedRequest = this.validateAndParseJson(browserCrypto.base64Decode(encodedTokenRequest));\r\n if (!parsedRequest) {\r\n throw BrowserAuthError.createUnableToParseTokenRequestCacheError();\r\n }\r\n this.removeItem(this.generateCacheKey(TemporaryCacheKeys.REQUEST_PARAMS));\r\n // Get cached authority and use if no authority is cached with request.\r\n if (StringUtils.isEmpty(parsedRequest.authority)) {\r\n var authorityCacheKey = this.generateAuthorityKey(state);\r\n var cachedAuthority = this.getTemporaryCache(authorityCacheKey);\r\n if (!cachedAuthority) {\r\n throw BrowserAuthError.createNoCachedAuthorityError();\r\n }\r\n parsedRequest.authority = cachedAuthority;\r\n }\r\n return parsedRequest;\r\n };\r\n /**\r\n * Gets cached native request for redirect flows\r\n */\r\n BrowserCacheManager.prototype.getCachedNativeRequest = function () {\r\n this.logger.trace(\"BrowserCacheManager.getCachedNativeRequest called\");\r\n var cachedRequest = this.getTemporaryCache(TemporaryCacheKeys.NATIVE_REQUEST, true);\r\n if (!cachedRequest) {\r\n this.logger.trace(\"BrowserCacheManager.getCachedNativeRequest: No cached native request found\");\r\n return null;\r\n }\r\n var parsedRequest = this.validateAndParseJson(cachedRequest);\r\n if (!parsedRequest) {\r\n this.logger.error(\"BrowserCacheManager.getCachedNativeRequest: Unable to parse native request\");\r\n return null;\r\n }\r\n return parsedRequest;\r\n };\r\n BrowserCacheManager.prototype.isInteractionInProgress = function (matchClientId) {\r\n var clientId = this.getInteractionInProgress();\r\n if (matchClientId) {\r\n return clientId === this.clientId;\r\n }\r\n else {\r\n return !!clientId;\r\n }\r\n };\r\n BrowserCacheManager.prototype.getInteractionInProgress = function () {\r\n var key = Constants.CACHE_PREFIX + \".\" + TemporaryCacheKeys.INTERACTION_STATUS_KEY;\r\n return this.getTemporaryCache(key, false);\r\n };\r\n BrowserCacheManager.prototype.setInteractionInProgress = function (inProgress) {\r\n // Ensure we don't overwrite interaction in progress for a different clientId\r\n var key = Constants.CACHE_PREFIX + \".\" + TemporaryCacheKeys.INTERACTION_STATUS_KEY;\r\n if (inProgress) {\r\n if (this.getInteractionInProgress()) {\r\n throw BrowserAuthError.createInteractionInProgressError();\r\n }\r\n else {\r\n // No interaction is in progress\r\n this.setTemporaryCache(key, this.clientId, false);\r\n }\r\n }\r\n else if (!inProgress && this.getInteractionInProgress() === this.clientId) {\r\n this.removeItem(key);\r\n }\r\n };\r\n /**\r\n * Returns username retrieved from ADAL or MSAL v1 idToken\r\n */\r\n BrowserCacheManager.prototype.getLegacyLoginHint = function () {\r\n // Only check for adal/msal token if no SSO params are being used\r\n var adalIdTokenString = this.getTemporaryCache(PersistentCacheKeys.ADAL_ID_TOKEN);\r\n if (adalIdTokenString) {\r\n this.browserStorage.removeItem(PersistentCacheKeys.ADAL_ID_TOKEN);\r\n this.logger.verbose(\"Cached ADAL id token retrieved.\");\r\n }\r\n // Check for cached MSAL v1 id token\r\n var msalIdTokenString = this.getTemporaryCache(PersistentCacheKeys.ID_TOKEN, true);\r\n if (msalIdTokenString) {\r\n this.removeItem(this.generateCacheKey(PersistentCacheKeys.ID_TOKEN));\r\n this.logger.verbose(\"Cached MSAL.js v1 id token retrieved\");\r\n }\r\n var cachedIdTokenString = msalIdTokenString || adalIdTokenString;\r\n if (cachedIdTokenString) {\r\n var cachedIdToken = new IdToken(cachedIdTokenString, this.cryptoImpl);\r\n if (cachedIdToken.claims && cachedIdToken.claims.preferred_username) {\r\n this.logger.verbose(\"No SSO params used and ADAL/MSAL v1 token retrieved, setting ADAL/MSAL v1 preferred_username as loginHint\");\r\n return cachedIdToken.claims.preferred_username;\r\n }\r\n else if (cachedIdToken.claims && cachedIdToken.claims.upn) {\r\n this.logger.verbose(\"No SSO params used and ADAL/MSAL v1 token retrieved, setting ADAL/MSAL v1 upn as loginHint\");\r\n return cachedIdToken.claims.upn;\r\n }\r\n else {\r\n this.logger.verbose(\"No SSO params used and ADAL/MSAL v1 token retrieved, however, no account hint claim found. Enable preferred_username or upn id token claim to get SSO.\");\r\n }\r\n }\r\n return null;\r\n };\r\n /**\r\n * Updates a credential's cache key if the current cache key is outdated\r\n */\r\n BrowserCacheManager.prototype.updateCredentialCacheKey = function (currentCacheKey, credential) {\r\n var updatedCacheKey = credential.generateCredentialKey();\r\n if (currentCacheKey !== updatedCacheKey) {\r\n var cacheItem = this.getItem(currentCacheKey);\r\n if (cacheItem) {\r\n this.removeItem(currentCacheKey);\r\n this.setItem(updatedCacheKey, cacheItem);\r\n this.logger.verbose(\"Updated an outdated \" + credential.credentialType + \" cache key\");\r\n return updatedCacheKey;\r\n }\r\n else {\r\n this.logger.error(\"Attempted to update an outdated \" + credential.credentialType + \" cache key but no item matching the outdated key was found in storage\");\r\n }\r\n }\r\n return currentCacheKey;\r\n };\r\n /**\r\n * Returns application id as redirect context during AcquireTokenRedirect flow.\r\n */\r\n BrowserCacheManager.prototype.getRedirectRequestContext = function () {\r\n return this.getTemporaryCache(TemporaryCacheKeys.REDIRECT_CONTEXT, true);\r\n };\r\n /**\r\n * Sets application id as the redirect context during AcquireTokenRedirect flow.\r\n * @param value\r\n */\r\n BrowserCacheManager.prototype.setRedirectRequestContext = function (value) {\r\n this.setTemporaryCache(TemporaryCacheKeys.REDIRECT_CONTEXT, value, true);\r\n };\r\n /**\r\n * Builds credential entities from AuthenticationResult object and saves the resulting credentials to the cache\r\n * @param result\r\n * @param request\r\n */\r\n BrowserCacheManager.prototype.hydrateCache = function (result, request) {\r\n var _a, _b, _c, _d, _e, _f;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var idTokenEntity, claimsHash, accessTokenEntity, cacheRecord;\r\n return __generator(this, function (_g) {\r\n switch (_g.label) {\r\n case 0:\r\n idTokenEntity = IdTokenEntity.createIdTokenEntity(((_a = result.account) === null || _a === void 0 ? void 0 : _a.homeAccountId) || \"\", ((_b = result.account) === null || _b === void 0 ? void 0 : _b.environment) || \"\", result.idToken, this.clientId, result.tenantId);\r\n if (!request.claims) return [3 /*break*/, 2];\r\n return [4 /*yield*/, this.cryptoImpl.hashString(request.claims)];\r\n case 1:\r\n claimsHash = _g.sent();\r\n _g.label = 2;\r\n case 2:\r\n accessTokenEntity = AccessTokenEntity.createAccessTokenEntity(((_c = result.account) === null || _c === void 0 ? void 0 : _c.homeAccountId) || \"\", ((_d = result.account) === null || _d === void 0 ? void 0 : _d.environment) || \"\", result.accessToken, this.clientId, result.tenantId, result.scopes.join(\" \"), ((_e = result.expiresOn) === null || _e === void 0 ? void 0 : _e.getTime()) || 0, ((_f = result.extExpiresOn) === null || _f === void 0 ? void 0 : _f.getTime()) || 0, this.cryptoImpl, undefined, // refreshOn\r\n result.tokenType, undefined, // userAssertionHash\r\n request.sshKid, request.claims, claimsHash);\r\n cacheRecord = new CacheRecord(undefined, idTokenEntity, accessTokenEntity);\r\n return [2 /*return*/, this.saveCacheRecord(cacheRecord)];\r\n }\r\n });\r\n });\r\n };\r\n return BrowserCacheManager;\r\n}(CacheManager));\r\nvar DEFAULT_BROWSER_CACHE_MANAGER = function (clientId, logger) {\r\n var cacheOptions = {\r\n cacheLocation: BrowserCacheLocation.MemoryStorage,\r\n temporaryCacheLocation: BrowserCacheLocation.MemoryStorage,\r\n storeAuthStateInCookie: false,\r\n secureCookies: false,\r\n cacheMigrationEnabled: false,\r\n claimsBasedCachingEnabled: true\r\n };\r\n return new BrowserCacheManager(clientId, cacheOptions, DEFAULT_CRYPTO_IMPLEMENTATION, logger);\r\n};\n\nexport { BrowserCacheManager, DEFAULT_BROWSER_CACHE_MANAGER };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar AzureCloudInstance;\r\n(function (AzureCloudInstance) {\r\n // AzureCloudInstance is not specified.\r\n AzureCloudInstance[AzureCloudInstance[\"None\"] = 0] = \"None\";\r\n // Microsoft Azure public cloud\r\n AzureCloudInstance[\"AzurePublic\"] = \"https://login.microsoftonline.com\";\r\n // Microsoft PPE\r\n AzureCloudInstance[\"AzurePpe\"] = \"https://login.windows-ppe.net\";\r\n // Microsoft Chinese national cloud\r\n AzureCloudInstance[\"AzureChina\"] = \"https://login.chinacloudapi.cn\";\r\n // Microsoft German national cloud (\"Black Forest\")\r\n AzureCloudInstance[\"AzureGermany\"] = \"https://login.microsoftonline.de\";\r\n // US Government cloud\r\n AzureCloudInstance[\"AzureUsGovernment\"] = \"https://login.microsoftonline.us\";\r\n})(AzureCloudInstance || (AzureCloudInstance = {}));\n\nexport { AzureCloudInstance };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __assign, __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { DEFAULT_CRYPTO_IMPLEMENTATION } from '../crypto/ICrypto.js';\nimport { AuthError } from '../error/AuthError.js';\nimport { Logger, LogLevel } from '../logger/Logger.js';\nimport { Constants } from '../utils/Constants.js';\nimport { version } from '../packageMetadata.js';\nimport { AzureCloudInstance } from '../authority/AuthorityOptions.js';\nimport { DefaultStorageClass } from '../cache/CacheManager.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n// Token renewal offset default in seconds\r\nvar DEFAULT_TOKEN_RENEWAL_OFFSET_SEC = 300;\r\nvar DEFAULT_SYSTEM_OPTIONS = {\r\n tokenRenewalOffsetSeconds: DEFAULT_TOKEN_RENEWAL_OFFSET_SEC,\r\n preventCorsPreflight: false\r\n};\r\nvar DEFAULT_LOGGER_IMPLEMENTATION = {\r\n loggerCallback: function () {\r\n // allow users to not set loggerCallback\r\n },\r\n piiLoggingEnabled: false,\r\n logLevel: LogLevel.Info,\r\n correlationId: Constants.EMPTY_STRING\r\n};\r\nvar DEFAULT_CACHE_OPTIONS = {\r\n claimsBasedCachingEnabled: true\r\n};\r\nvar DEFAULT_NETWORK_IMPLEMENTATION = {\r\n sendGetRequestAsync: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Network interface - sendGetRequestAsync() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n },\r\n sendPostRequestAsync: function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var notImplErr;\r\n return __generator(this, function (_a) {\r\n notImplErr = \"Network interface - sendPostRequestAsync() has not been implemented\";\r\n throw AuthError.createUnexpectedError(notImplErr);\r\n });\r\n });\r\n }\r\n};\r\nvar DEFAULT_LIBRARY_INFO = {\r\n sku: Constants.SKU,\r\n version: version,\r\n cpu: Constants.EMPTY_STRING,\r\n os: Constants.EMPTY_STRING\r\n};\r\nvar DEFAULT_CLIENT_CREDENTIALS = {\r\n clientSecret: Constants.EMPTY_STRING,\r\n clientAssertion: undefined\r\n};\r\nvar DEFAULT_AZURE_CLOUD_OPTIONS = {\r\n azureCloudInstance: AzureCloudInstance.None,\r\n tenant: \"\" + Constants.DEFAULT_COMMON_TENANT\r\n};\r\nvar DEFAULT_TELEMETRY_OPTIONS = {\r\n application: {\r\n appName: \"\",\r\n appVersion: \"\"\r\n }\r\n};\r\n/**\r\n * Function that sets the default options when not explicitly configured from app developer\r\n *\r\n * @param Configuration\r\n *\r\n * @returns Configuration\r\n */\r\nfunction buildClientConfiguration(_a) {\r\n var userAuthOptions = _a.authOptions, userSystemOptions = _a.systemOptions, userLoggerOption = _a.loggerOptions, userCacheOptions = _a.cacheOptions, storageImplementation = _a.storageInterface, networkImplementation = _a.networkInterface, cryptoImplementation = _a.cryptoInterface, clientCredentials = _a.clientCredentials, libraryInfo = _a.libraryInfo, telemetry = _a.telemetry, serverTelemetryManager = _a.serverTelemetryManager, persistencePlugin = _a.persistencePlugin, serializableCache = _a.serializableCache;\r\n var loggerOptions = __assign(__assign({}, DEFAULT_LOGGER_IMPLEMENTATION), userLoggerOption);\r\n return {\r\n authOptions: buildAuthOptions(userAuthOptions),\r\n systemOptions: __assign(__assign({}, DEFAULT_SYSTEM_OPTIONS), userSystemOptions),\r\n loggerOptions: loggerOptions,\r\n cacheOptions: __assign(__assign({}, DEFAULT_CACHE_OPTIONS), userCacheOptions),\r\n storageInterface: storageImplementation || new DefaultStorageClass(userAuthOptions.clientId, DEFAULT_CRYPTO_IMPLEMENTATION, new Logger(loggerOptions)),\r\n networkInterface: networkImplementation || DEFAULT_NETWORK_IMPLEMENTATION,\r\n cryptoInterface: cryptoImplementation || DEFAULT_CRYPTO_IMPLEMENTATION,\r\n clientCredentials: clientCredentials || DEFAULT_CLIENT_CREDENTIALS,\r\n libraryInfo: __assign(__assign({}, DEFAULT_LIBRARY_INFO), libraryInfo),\r\n telemetry: __assign(__assign({}, DEFAULT_TELEMETRY_OPTIONS), telemetry),\r\n serverTelemetryManager: serverTelemetryManager || null,\r\n persistencePlugin: persistencePlugin || null,\r\n serializableCache: serializableCache || null,\r\n };\r\n}\r\n/**\r\n * Construct authoptions from the client and platform passed values\r\n * @param authOptions\r\n */\r\nfunction buildAuthOptions(authOptions) {\r\n return __assign({ clientCapabilities: [], azureCloudOptions: DEFAULT_AZURE_CLOUD_OPTIONS, skipAuthorityMetadataCache: false }, authOptions);\r\n}\n\nexport { DEFAULT_SYSTEM_OPTIONS, buildClientConfiguration };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { AuthError } from '../error/AuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar StubbedNetworkModule = {\r\n sendGetRequestAsync: function () {\r\n var notImplErr = \"Network interface - sendGetRequestAsync() has not been implemented for the Network interface.\";\r\n return Promise.reject(AuthError.createUnexpectedError(notImplErr));\r\n },\r\n sendPostRequestAsync: function () {\r\n var notImplErr = \"Network interface - sendPostRequestAsync() has not been implemented for the Network interface.\";\r\n return Promise.reject(AuthError.createUnexpectedError(notImplErr));\r\n }\r\n};\n\nexport { StubbedNetworkModule };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar NavigationClient = /** @class */ (function () {\r\n function NavigationClient() {\r\n }\r\n /**\r\n * Navigates to other pages within the same web application\r\n * @param url\r\n * @param options\r\n */\r\n NavigationClient.prototype.navigateInternal = function (url, options) {\r\n return NavigationClient.defaultNavigateWindow(url, options);\r\n };\r\n /**\r\n * Navigates to other pages outside the web application i.e. the Identity Provider\r\n * @param url\r\n * @param options\r\n */\r\n NavigationClient.prototype.navigateExternal = function (url, options) {\r\n return NavigationClient.defaultNavigateWindow(url, options);\r\n };\r\n /**\r\n * Default navigation implementation invoked by the internal and external functions\r\n * @param url\r\n * @param options\r\n */\r\n NavigationClient.defaultNavigateWindow = function (url, options) {\r\n if (options.noHistory) {\r\n window.location.replace(url);\r\n }\r\n else {\r\n window.location.assign(url);\r\n }\r\n return new Promise(function (resolve) {\r\n setTimeout(function () {\r\n resolve(true);\r\n }, options.timeout);\r\n });\r\n };\r\n return NavigationClient;\r\n}());\n\nexport { NavigationClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __assign } from '../_virtual/_tslib.js';\nimport { DEFAULT_SYSTEM_OPTIONS, StubbedNetworkModule, Constants, ProtocolMode, AzureCloudInstance, LogLevel } from '@azure/msal-common';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\nimport { BrowserConstants, BrowserCacheLocation } from '../utils/BrowserConstants.js';\nimport { NavigationClient } from '../navigation/NavigationClient.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n// Default timeout for popup windows and iframes in milliseconds\r\nvar DEFAULT_POPUP_TIMEOUT_MS = 60000;\r\nvar DEFAULT_IFRAME_TIMEOUT_MS = 6000;\r\nvar DEFAULT_REDIRECT_TIMEOUT_MS = 30000;\r\nvar DEFAULT_NATIVE_BROKER_HANDSHAKE_TIMEOUT_MS = 2000;\r\n/**\r\n * MSAL function that sets the default options when not explicitly configured from app developer\r\n *\r\n * @param auth\r\n * @param cache\r\n * @param system\r\n *\r\n * @returns Configuration object\r\n */\r\nfunction buildConfiguration(_a, isBrowserEnvironment) {\r\n var userInputAuth = _a.auth, userInputCache = _a.cache, userInputSystem = _a.system, userInputTelemetry = _a.telemetry;\r\n // Default auth options for browser\r\n var DEFAULT_AUTH_OPTIONS = {\r\n clientId: Constants.EMPTY_STRING,\r\n authority: \"\" + Constants.DEFAULT_AUTHORITY,\r\n knownAuthorities: [],\r\n cloudDiscoveryMetadata: Constants.EMPTY_STRING,\r\n authorityMetadata: Constants.EMPTY_STRING,\r\n redirectUri: Constants.EMPTY_STRING,\r\n postLogoutRedirectUri: Constants.EMPTY_STRING,\r\n navigateToLoginRequestUrl: true,\r\n clientCapabilities: [],\r\n protocolMode: ProtocolMode.AAD,\r\n azureCloudOptions: {\r\n azureCloudInstance: AzureCloudInstance.None,\r\n tenant: Constants.EMPTY_STRING\r\n },\r\n skipAuthorityMetadataCache: false,\r\n };\r\n // Default cache options for browser\r\n var DEFAULT_CACHE_OPTIONS = {\r\n cacheLocation: BrowserCacheLocation.SessionStorage,\r\n temporaryCacheLocation: BrowserCacheLocation.SessionStorage,\r\n storeAuthStateInCookie: false,\r\n secureCookies: false,\r\n // Default cache migration to true if cache location is localStorage since entries are preserved across tabs/windows. Migration has little to no benefit in sessionStorage and memoryStorage\r\n cacheMigrationEnabled: userInputCache && userInputCache.cacheLocation === BrowserCacheLocation.LocalStorage ? true : false,\r\n claimsBasedCachingEnabled: true\r\n };\r\n // Default logger options for browser\r\n var DEFAULT_LOGGER_OPTIONS = {\r\n // eslint-disable-next-line @typescript-eslint/no-empty-function\r\n loggerCallback: function () {\r\n // allow users to not set logger call back \r\n },\r\n logLevel: LogLevel.Info,\r\n piiLoggingEnabled: false\r\n };\r\n // Default system options for browser\r\n var DEFAULT_BROWSER_SYSTEM_OPTIONS = __assign(__assign({}, DEFAULT_SYSTEM_OPTIONS), { loggerOptions: DEFAULT_LOGGER_OPTIONS, networkClient: isBrowserEnvironment ? BrowserUtils.getBrowserNetworkClient() : StubbedNetworkModule, navigationClient: new NavigationClient(), loadFrameTimeout: 0, \r\n // If loadFrameTimeout is provided, use that as default.\r\n windowHashTimeout: (userInputSystem === null || userInputSystem === void 0 ? void 0 : userInputSystem.loadFrameTimeout) || DEFAULT_POPUP_TIMEOUT_MS, iframeHashTimeout: (userInputSystem === null || userInputSystem === void 0 ? void 0 : userInputSystem.loadFrameTimeout) || DEFAULT_IFRAME_TIMEOUT_MS, navigateFrameWait: isBrowserEnvironment && BrowserUtils.detectIEOrEdge() ? 500 : 0, redirectNavigationTimeout: DEFAULT_REDIRECT_TIMEOUT_MS, asyncPopups: false, allowRedirectInIframe: false, allowNativeBroker: false, nativeBrokerHandshakeTimeout: (userInputSystem === null || userInputSystem === void 0 ? void 0 : userInputSystem.nativeBrokerHandshakeTimeout) || DEFAULT_NATIVE_BROKER_HANDSHAKE_TIMEOUT_MS, pollIntervalMilliseconds: BrowserConstants.DEFAULT_POLL_INTERVAL_MS, cryptoOptions: {\r\n useMsrCrypto: false,\r\n entropy: undefined\r\n } });\r\n var providedSystemOptions = __assign(__assign({}, userInputSystem), { loggerOptions: (userInputSystem === null || userInputSystem === void 0 ? void 0 : userInputSystem.loggerOptions) || DEFAULT_LOGGER_OPTIONS });\r\n var DEFAULT_TELEMETRY_OPTIONS = {\r\n application: {\r\n appName: Constants.EMPTY_STRING,\r\n appVersion: Constants.EMPTY_STRING\r\n }\r\n };\r\n var overlayedConfig = {\r\n auth: __assign(__assign({}, DEFAULT_AUTH_OPTIONS), userInputAuth),\r\n cache: __assign(__assign({}, DEFAULT_CACHE_OPTIONS), userInputCache),\r\n system: __assign(__assign({}, DEFAULT_BROWSER_SYSTEM_OPTIONS), providedSystemOptions),\r\n telemetry: __assign(__assign({}, DEFAULT_TELEMETRY_OPTIONS), userInputTelemetry)\r\n };\r\n return overlayedConfig;\r\n}\n\nexport { DEFAULT_IFRAME_TIMEOUT_MS, DEFAULT_NATIVE_BROKER_HANDSHAKE_TIMEOUT_MS, DEFAULT_POPUP_TIMEOUT_MS, DEFAULT_REDIRECT_TIMEOUT_MS, buildConfiguration };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\n/* eslint-disable header/header */\r\nvar name = \"@azure/msal-browser\";\r\nvar version = \"2.39.0\";\n\nexport { name, version };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { AccountEntity, CacheManager } from '@azure/msal-common';\nimport { EventType } from './EventType.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar EventHandler = /** @class */ (function () {\r\n function EventHandler(logger, browserCrypto) {\r\n this.eventCallbacks = new Map();\r\n this.logger = logger;\r\n this.browserCrypto = browserCrypto;\r\n this.listeningToStorageEvents = false;\r\n this.handleAccountCacheChange = this.handleAccountCacheChange.bind(this);\r\n }\r\n /**\r\n * Adds event callbacks to array\r\n * @param callback\r\n */\r\n EventHandler.prototype.addEventCallback = function (callback) {\r\n if (typeof window !== \"undefined\") {\r\n var callbackId = this.browserCrypto.createNewGuid();\r\n this.eventCallbacks.set(callbackId, callback);\r\n this.logger.verbose(\"Event callback registered with id: \" + callbackId);\r\n return callbackId;\r\n }\r\n return null;\r\n };\r\n /**\r\n * Removes callback with provided id from callback array\r\n * @param callbackId\r\n */\r\n EventHandler.prototype.removeEventCallback = function (callbackId) {\r\n this.eventCallbacks.delete(callbackId);\r\n this.logger.verbose(\"Event callback \" + callbackId + \" removed.\");\r\n };\r\n /**\r\n * Adds event listener that emits an event when a user account is added or removed from localstorage in a different browser tab or window\r\n */\r\n EventHandler.prototype.enableAccountStorageEvents = function () {\r\n if (typeof window === \"undefined\") {\r\n return;\r\n }\r\n if (!this.listeningToStorageEvents) {\r\n this.logger.verbose(\"Adding account storage listener.\");\r\n this.listeningToStorageEvents = true;\r\n window.addEventListener(\"storage\", this.handleAccountCacheChange);\r\n }\r\n else {\r\n this.logger.verbose(\"Account storage listener already registered.\");\r\n }\r\n };\r\n /**\r\n * Removes event listener that emits an event when a user account is added or removed from localstorage in a different browser tab or window\r\n */\r\n EventHandler.prototype.disableAccountStorageEvents = function () {\r\n if (typeof window === \"undefined\") {\r\n return;\r\n }\r\n if (this.listeningToStorageEvents) {\r\n this.logger.verbose(\"Removing account storage listener.\");\r\n window.removeEventListener(\"storage\", this.handleAccountCacheChange);\r\n this.listeningToStorageEvents = false;\r\n }\r\n else {\r\n this.logger.verbose(\"No account storage listener registered.\");\r\n }\r\n };\r\n /**\r\n * Emits events by calling callback with event message\r\n * @param eventType\r\n * @param interactionType\r\n * @param payload\r\n * @param error\r\n */\r\n EventHandler.prototype.emitEvent = function (eventType, interactionType, payload, error) {\r\n var _this = this;\r\n if (typeof window !== \"undefined\") {\r\n var message_1 = {\r\n eventType: eventType,\r\n interactionType: interactionType || null,\r\n payload: payload || null,\r\n error: error || null,\r\n timestamp: Date.now()\r\n };\r\n this.logger.info(\"Emitting event: \" + eventType);\r\n this.eventCallbacks.forEach(function (callback, callbackId) {\r\n _this.logger.verbose(\"Emitting event to callback \" + callbackId + \": \" + eventType);\r\n callback.apply(null, [message_1]);\r\n });\r\n }\r\n };\r\n /**\r\n * Emit account added/removed events when cached accounts are changed in a different tab or frame\r\n */\r\n EventHandler.prototype.handleAccountCacheChange = function (e) {\r\n try {\r\n var cacheValue = e.newValue || e.oldValue;\r\n if (!cacheValue) {\r\n return;\r\n }\r\n var parsedValue = JSON.parse(cacheValue);\r\n if (typeof parsedValue !== \"object\" || !AccountEntity.isAccountEntity(parsedValue)) {\r\n return;\r\n }\r\n var accountEntity = CacheManager.toObject(new AccountEntity(), parsedValue);\r\n var accountInfo = accountEntity.getAccountInfo();\r\n if (!e.oldValue && e.newValue) {\r\n this.logger.info(\"Account was added to cache in a different window\");\r\n this.emitEvent(EventType.ACCOUNT_ADDED, undefined, accountInfo);\r\n }\r\n else if (!e.newValue && e.oldValue) {\r\n this.logger.info(\"Account was removed from cache in a different window\");\r\n this.emitEvent(EventType.ACCOUNT_REMOVED, undefined, accountInfo);\r\n }\r\n }\r\n catch (e) {\r\n return;\r\n }\r\n };\r\n return EventHandler;\r\n}());\n\nexport { EventHandler };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { ThrottlingConstants, Constants, HeaderNames } from '../utils/Constants.js';\nimport { ServerError } from '../error/ServerError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar ThrottlingUtils = /** @class */ (function () {\r\n function ThrottlingUtils() {\r\n }\r\n /**\r\n * Prepares a RequestThumbprint to be stored as a key.\r\n * @param thumbprint\r\n */\r\n ThrottlingUtils.generateThrottlingStorageKey = function (thumbprint) {\r\n return ThrottlingConstants.THROTTLING_PREFIX + \".\" + JSON.stringify(thumbprint);\r\n };\r\n /**\r\n * Performs necessary throttling checks before a network request.\r\n * @param cacheManager\r\n * @param thumbprint\r\n */\r\n ThrottlingUtils.preProcess = function (cacheManager, thumbprint) {\r\n var _a;\r\n var key = ThrottlingUtils.generateThrottlingStorageKey(thumbprint);\r\n var value = cacheManager.getThrottlingCache(key);\r\n if (value) {\r\n if (value.throttleTime < Date.now()) {\r\n cacheManager.removeItem(key);\r\n return;\r\n }\r\n throw new ServerError(((_a = value.errorCodes) === null || _a === void 0 ? void 0 : _a.join(\" \")) || Constants.EMPTY_STRING, value.errorMessage, value.subError);\r\n }\r\n };\r\n /**\r\n * Performs necessary throttling checks after a network request.\r\n * @param cacheManager\r\n * @param thumbprint\r\n * @param response\r\n */\r\n ThrottlingUtils.postProcess = function (cacheManager, thumbprint, response) {\r\n if (ThrottlingUtils.checkResponseStatus(response) || ThrottlingUtils.checkResponseForRetryAfter(response)) {\r\n var thumbprintValue = {\r\n throttleTime: ThrottlingUtils.calculateThrottleTime(parseInt(response.headers[HeaderNames.RETRY_AFTER])),\r\n error: response.body.error,\r\n errorCodes: response.body.error_codes,\r\n errorMessage: response.body.error_description,\r\n subError: response.body.suberror\r\n };\r\n cacheManager.setThrottlingCache(ThrottlingUtils.generateThrottlingStorageKey(thumbprint), thumbprintValue);\r\n }\r\n };\r\n /**\r\n * Checks a NetworkResponse object's status codes against 429 or 5xx\r\n * @param response\r\n */\r\n ThrottlingUtils.checkResponseStatus = function (response) {\r\n return response.status === 429 || response.status >= 500 && response.status < 600;\r\n };\r\n /**\r\n * Checks a NetworkResponse object's RetryAfter header\r\n * @param response\r\n */\r\n ThrottlingUtils.checkResponseForRetryAfter = function (response) {\r\n if (response.headers) {\r\n return response.headers.hasOwnProperty(HeaderNames.RETRY_AFTER) && (response.status < 200 || response.status >= 300);\r\n }\r\n return false;\r\n };\r\n /**\r\n * Calculates the Unix-time value for a throttle to expire given throttleTime in seconds.\r\n * @param throttleTime\r\n */\r\n ThrottlingUtils.calculateThrottleTime = function (throttleTime) {\r\n var time = throttleTime <= 0 ? 0 : throttleTime;\r\n var currentSeconds = Date.now() / 1000;\r\n return Math.floor(Math.min(currentSeconds + (time || ThrottlingConstants.DEFAULT_THROTTLE_TIME_SECONDS), currentSeconds + ThrottlingConstants.DEFAULT_MAX_THROTTLE_TIME_SECONDS) * 1000);\r\n };\r\n ThrottlingUtils.removeThrottle = function (cacheManager, clientId, request, homeAccountIdentifier) {\r\n var thumbprint = {\r\n clientId: clientId,\r\n authority: request.authority,\r\n scopes: request.scopes,\r\n homeAccountIdentifier: homeAccountIdentifier,\r\n claims: request.claims,\r\n authenticationScheme: request.authenticationScheme,\r\n resourceRequestMethod: request.resourceRequestMethod,\r\n resourceRequestUri: request.resourceRequestUri,\r\n shrClaims: request.shrClaims,\r\n sshKid: request.sshKid\r\n };\r\n var key = this.generateThrottlingStorageKey(thumbprint);\r\n cacheManager.removeItem(key);\r\n };\r\n return ThrottlingUtils;\r\n}());\n\nexport { ThrottlingUtils };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { ThrottlingUtils } from './ThrottlingUtils.js';\nimport { AuthError } from '../error/AuthError.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar NetworkManager = /** @class */ (function () {\r\n function NetworkManager(networkClient, cacheManager) {\r\n this.networkClient = networkClient;\r\n this.cacheManager = cacheManager;\r\n }\r\n /**\r\n * Wraps sendPostRequestAsync with necessary preflight and postflight logic\r\n * @param thumbprint\r\n * @param tokenEndpoint\r\n * @param options\r\n */\r\n NetworkManager.prototype.sendPostRequest = function (thumbprint, tokenEndpoint, options) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var response, e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n ThrottlingUtils.preProcess(this.cacheManager, thumbprint);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.networkClient.sendPostRequestAsync(tokenEndpoint, options)];\r\n case 2:\r\n response = _a.sent();\r\n return [3 /*break*/, 4];\r\n case 3:\r\n e_1 = _a.sent();\r\n if (e_1 instanceof AuthError) {\r\n throw e_1;\r\n }\r\n else {\r\n throw ClientAuthError.createNetworkError(tokenEndpoint, e_1);\r\n }\r\n case 4:\r\n ThrottlingUtils.postProcess(this.cacheManager, thumbprint, response);\r\n return [2 /*return*/, response];\r\n }\r\n });\r\n });\r\n };\r\n return NetworkManager;\r\n}());\n\nexport { NetworkManager };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { CodeChallengeMethodValues, PromptValue } from '../utils/Constants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Validates server consumable params from the \"request\" objects\r\n */\r\nvar RequestValidator = /** @class */ (function () {\r\n function RequestValidator() {\r\n }\r\n /**\r\n * Utility to check if the `redirectUri` in the request is a non-null value\r\n * @param redirectUri\r\n */\r\n RequestValidator.validateRedirectUri = function (redirectUri) {\r\n if (StringUtils.isEmpty(redirectUri)) {\r\n throw ClientConfigurationError.createRedirectUriEmptyError();\r\n }\r\n };\r\n /**\r\n * Utility to validate prompt sent by the user in the request\r\n * @param prompt\r\n */\r\n RequestValidator.validatePrompt = function (prompt) {\r\n var promptValues = [];\r\n for (var value in PromptValue) {\r\n promptValues.push(PromptValue[value]);\r\n }\r\n if (promptValues.indexOf(prompt) < 0) {\r\n throw ClientConfigurationError.createInvalidPromptError(prompt);\r\n }\r\n };\r\n RequestValidator.validateClaims = function (claims) {\r\n try {\r\n JSON.parse(claims);\r\n }\r\n catch (e) {\r\n throw ClientConfigurationError.createInvalidClaimsRequestError();\r\n }\r\n };\r\n /**\r\n * Utility to validate code_challenge and code_challenge_method\r\n * @param codeChallenge\r\n * @param codeChallengeMethod\r\n */\r\n RequestValidator.validateCodeChallengeParams = function (codeChallenge, codeChallengeMethod) {\r\n if (StringUtils.isEmpty(codeChallenge) || StringUtils.isEmpty(codeChallengeMethod)) {\r\n throw ClientConfigurationError.createInvalidCodeChallengeParamsError();\r\n }\r\n else {\r\n this.validateCodeChallengeMethod(codeChallengeMethod);\r\n }\r\n };\r\n /**\r\n * Utility to validate code_challenge_method\r\n * @param codeChallengeMethod\r\n */\r\n RequestValidator.validateCodeChallengeMethod = function (codeChallengeMethod) {\r\n if ([\r\n CodeChallengeMethodValues.PLAIN,\r\n CodeChallengeMethodValues.S256\r\n ].indexOf(codeChallengeMethod) < 0) {\r\n throw ClientConfigurationError.createInvalidCodeChallengeMethodError();\r\n }\r\n };\r\n /**\r\n * Removes unnecessary, duplicate, and empty string query parameters from extraQueryParameters\r\n * @param request\r\n */\r\n RequestValidator.sanitizeEQParams = function (eQParams, queryParams) {\r\n if (!eQParams) {\r\n return {};\r\n }\r\n // Remove any query parameters already included in SSO params\r\n queryParams.forEach(function (value, key) {\r\n if (eQParams[key]) {\r\n delete eQParams[key];\r\n }\r\n });\r\n // remove empty string parameters\r\n // eslint-disable-next-line @typescript-eslint/no-unused-vars\r\n return Object.fromEntries(Object.entries(eQParams).filter(function (_a) {\r\n var value = _a[1];\r\n return value !== \"\";\r\n }));\r\n };\r\n return RequestValidator;\r\n}());\n\nexport { RequestValidator };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __spreadArrays } from '../_virtual/_tslib.js';\nimport { AADServerParamKeys, Constants, ResponseMode, OIDC_DEFAULT_SCOPES, SSOTypes, HeaderNames, CLIENT_INFO, ClaimsRequestKeys, PasswordGrantConstants, AuthenticationScheme, ThrottlingConstants } from '../utils/Constants.js';\nimport { ScopeSet } from './ScopeSet.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { RequestValidator } from './RequestValidator.js';\nimport { StringUtils } from '../utils/StringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar RequestParameterBuilder = /** @class */ (function () {\r\n function RequestParameterBuilder() {\r\n this.parameters = new Map();\r\n }\r\n /**\r\n * add response_type = code\r\n */\r\n RequestParameterBuilder.prototype.addResponseTypeCode = function () {\r\n this.parameters.set(AADServerParamKeys.RESPONSE_TYPE, encodeURIComponent(Constants.CODE_RESPONSE_TYPE));\r\n };\r\n /**\r\n * add response_type = token id_token\r\n */\r\n RequestParameterBuilder.prototype.addResponseTypeForTokenAndIdToken = function () {\r\n this.parameters.set(AADServerParamKeys.RESPONSE_TYPE, encodeURIComponent(Constants.TOKEN_RESPONSE_TYPE + \" \" + Constants.ID_TOKEN_RESPONSE_TYPE));\r\n };\r\n /**\r\n * add response_mode. defaults to query.\r\n * @param responseMode\r\n */\r\n RequestParameterBuilder.prototype.addResponseMode = function (responseMode) {\r\n this.parameters.set(AADServerParamKeys.RESPONSE_MODE, encodeURIComponent((responseMode) ? responseMode : ResponseMode.QUERY));\r\n };\r\n /**\r\n * Add flag to indicate STS should attempt to use WAM if available\r\n */\r\n RequestParameterBuilder.prototype.addNativeBroker = function () {\r\n this.parameters.set(AADServerParamKeys.NATIVE_BROKER, encodeURIComponent(\"1\"));\r\n };\r\n /**\r\n * add scopes. set addOidcScopes to false to prevent default scopes in non-user scenarios\r\n * @param scopeSet\r\n * @param addOidcScopes\r\n */\r\n RequestParameterBuilder.prototype.addScopes = function (scopes, addOidcScopes) {\r\n if (addOidcScopes === void 0) { addOidcScopes = true; }\r\n var requestScopes = addOidcScopes ? __spreadArrays(scopes || [], OIDC_DEFAULT_SCOPES) : scopes || [];\r\n var scopeSet = new ScopeSet(requestScopes);\r\n this.parameters.set(AADServerParamKeys.SCOPE, encodeURIComponent(scopeSet.printScopes()));\r\n };\r\n /**\r\n * add clientId\r\n * @param clientId\r\n */\r\n RequestParameterBuilder.prototype.addClientId = function (clientId) {\r\n this.parameters.set(AADServerParamKeys.CLIENT_ID, encodeURIComponent(clientId));\r\n };\r\n /**\r\n * add redirect_uri\r\n * @param redirectUri\r\n */\r\n RequestParameterBuilder.prototype.addRedirectUri = function (redirectUri) {\r\n RequestValidator.validateRedirectUri(redirectUri);\r\n this.parameters.set(AADServerParamKeys.REDIRECT_URI, encodeURIComponent(redirectUri));\r\n };\r\n /**\r\n * add post logout redirectUri\r\n * @param redirectUri\r\n */\r\n RequestParameterBuilder.prototype.addPostLogoutRedirectUri = function (redirectUri) {\r\n RequestValidator.validateRedirectUri(redirectUri);\r\n this.parameters.set(AADServerParamKeys.POST_LOGOUT_URI, encodeURIComponent(redirectUri));\r\n };\r\n /**\r\n * add id_token_hint to logout request\r\n * @param idTokenHint\r\n */\r\n RequestParameterBuilder.prototype.addIdTokenHint = function (idTokenHint) {\r\n this.parameters.set(AADServerParamKeys.ID_TOKEN_HINT, encodeURIComponent(idTokenHint));\r\n };\r\n /**\r\n * add domain_hint\r\n * @param domainHint\r\n */\r\n RequestParameterBuilder.prototype.addDomainHint = function (domainHint) {\r\n this.parameters.set(SSOTypes.DOMAIN_HINT, encodeURIComponent(domainHint));\r\n };\r\n /**\r\n * add login_hint\r\n * @param loginHint\r\n */\r\n RequestParameterBuilder.prototype.addLoginHint = function (loginHint) {\r\n this.parameters.set(SSOTypes.LOGIN_HINT, encodeURIComponent(loginHint));\r\n };\r\n /**\r\n * Adds the CCS (Cache Credential Service) query parameter for login_hint\r\n * @param loginHint\r\n */\r\n RequestParameterBuilder.prototype.addCcsUpn = function (loginHint) {\r\n this.parameters.set(HeaderNames.CCS_HEADER, encodeURIComponent(\"UPN:\" + loginHint));\r\n };\r\n /**\r\n * Adds the CCS (Cache Credential Service) query parameter for account object\r\n * @param loginHint\r\n */\r\n RequestParameterBuilder.prototype.addCcsOid = function (clientInfo) {\r\n this.parameters.set(HeaderNames.CCS_HEADER, encodeURIComponent(\"Oid:\" + clientInfo.uid + \"@\" + clientInfo.utid));\r\n };\r\n /**\r\n * add sid\r\n * @param sid\r\n */\r\n RequestParameterBuilder.prototype.addSid = function (sid) {\r\n this.parameters.set(SSOTypes.SID, encodeURIComponent(sid));\r\n };\r\n /**\r\n * add claims\r\n * @param claims\r\n */\r\n RequestParameterBuilder.prototype.addClaims = function (claims, clientCapabilities) {\r\n var mergedClaims = this.addClientCapabilitiesToClaims(claims, clientCapabilities);\r\n RequestValidator.validateClaims(mergedClaims);\r\n this.parameters.set(AADServerParamKeys.CLAIMS, encodeURIComponent(mergedClaims));\r\n };\r\n /**\r\n * add correlationId\r\n * @param correlationId\r\n */\r\n RequestParameterBuilder.prototype.addCorrelationId = function (correlationId) {\r\n this.parameters.set(AADServerParamKeys.CLIENT_REQUEST_ID, encodeURIComponent(correlationId));\r\n };\r\n /**\r\n * add library info query params\r\n * @param libraryInfo\r\n */\r\n RequestParameterBuilder.prototype.addLibraryInfo = function (libraryInfo) {\r\n // Telemetry Info\r\n this.parameters.set(AADServerParamKeys.X_CLIENT_SKU, libraryInfo.sku);\r\n this.parameters.set(AADServerParamKeys.X_CLIENT_VER, libraryInfo.version);\r\n if (libraryInfo.os) {\r\n this.parameters.set(AADServerParamKeys.X_CLIENT_OS, libraryInfo.os);\r\n }\r\n if (libraryInfo.cpu) {\r\n this.parameters.set(AADServerParamKeys.X_CLIENT_CPU, libraryInfo.cpu);\r\n }\r\n };\r\n /**\r\n * Add client telemetry parameters\r\n * @param appTelemetry\r\n */\r\n RequestParameterBuilder.prototype.addApplicationTelemetry = function (appTelemetry) {\r\n if (appTelemetry === null || appTelemetry === void 0 ? void 0 : appTelemetry.appName) {\r\n this.parameters.set(AADServerParamKeys.X_APP_NAME, appTelemetry.appName);\r\n }\r\n if (appTelemetry === null || appTelemetry === void 0 ? void 0 : appTelemetry.appVersion) {\r\n this.parameters.set(AADServerParamKeys.X_APP_VER, appTelemetry.appVersion);\r\n }\r\n };\r\n /**\r\n * add prompt\r\n * @param prompt\r\n */\r\n RequestParameterBuilder.prototype.addPrompt = function (prompt) {\r\n RequestValidator.validatePrompt(prompt);\r\n this.parameters.set(\"\" + AADServerParamKeys.PROMPT, encodeURIComponent(prompt));\r\n };\r\n /**\r\n * add state\r\n * @param state\r\n */\r\n RequestParameterBuilder.prototype.addState = function (state) {\r\n if (!StringUtils.isEmpty(state)) {\r\n this.parameters.set(AADServerParamKeys.STATE, encodeURIComponent(state));\r\n }\r\n };\r\n /**\r\n * add nonce\r\n * @param nonce\r\n */\r\n RequestParameterBuilder.prototype.addNonce = function (nonce) {\r\n this.parameters.set(AADServerParamKeys.NONCE, encodeURIComponent(nonce));\r\n };\r\n /**\r\n * add code_challenge and code_challenge_method\r\n * - throw if either of them are not passed\r\n * @param codeChallenge\r\n * @param codeChallengeMethod\r\n */\r\n RequestParameterBuilder.prototype.addCodeChallengeParams = function (codeChallenge, codeChallengeMethod) {\r\n RequestValidator.validateCodeChallengeParams(codeChallenge, codeChallengeMethod);\r\n if (codeChallenge && codeChallengeMethod) {\r\n this.parameters.set(AADServerParamKeys.CODE_CHALLENGE, encodeURIComponent(codeChallenge));\r\n this.parameters.set(AADServerParamKeys.CODE_CHALLENGE_METHOD, encodeURIComponent(codeChallengeMethod));\r\n }\r\n else {\r\n throw ClientConfigurationError.createInvalidCodeChallengeParamsError();\r\n }\r\n };\r\n /**\r\n * add the `authorization_code` passed by the user to exchange for a token\r\n * @param code\r\n */\r\n RequestParameterBuilder.prototype.addAuthorizationCode = function (code) {\r\n this.parameters.set(AADServerParamKeys.CODE, encodeURIComponent(code));\r\n };\r\n /**\r\n * add the `authorization_code` passed by the user to exchange for a token\r\n * @param code\r\n */\r\n RequestParameterBuilder.prototype.addDeviceCode = function (code) {\r\n this.parameters.set(AADServerParamKeys.DEVICE_CODE, encodeURIComponent(code));\r\n };\r\n /**\r\n * add the `refreshToken` passed by the user\r\n * @param refreshToken\r\n */\r\n RequestParameterBuilder.prototype.addRefreshToken = function (refreshToken) {\r\n this.parameters.set(AADServerParamKeys.REFRESH_TOKEN, encodeURIComponent(refreshToken));\r\n };\r\n /**\r\n * add the `code_verifier` passed by the user to exchange for a token\r\n * @param codeVerifier\r\n */\r\n RequestParameterBuilder.prototype.addCodeVerifier = function (codeVerifier) {\r\n this.parameters.set(AADServerParamKeys.CODE_VERIFIER, encodeURIComponent(codeVerifier));\r\n };\r\n /**\r\n * add client_secret\r\n * @param clientSecret\r\n */\r\n RequestParameterBuilder.prototype.addClientSecret = function (clientSecret) {\r\n this.parameters.set(AADServerParamKeys.CLIENT_SECRET, encodeURIComponent(clientSecret));\r\n };\r\n /**\r\n * add clientAssertion for confidential client flows\r\n * @param clientAssertion\r\n */\r\n RequestParameterBuilder.prototype.addClientAssertion = function (clientAssertion) {\r\n if (!StringUtils.isEmpty(clientAssertion)) {\r\n this.parameters.set(AADServerParamKeys.CLIENT_ASSERTION, encodeURIComponent(clientAssertion));\r\n }\r\n };\r\n /**\r\n * add clientAssertionType for confidential client flows\r\n * @param clientAssertionType\r\n */\r\n RequestParameterBuilder.prototype.addClientAssertionType = function (clientAssertionType) {\r\n if (!StringUtils.isEmpty(clientAssertionType)) {\r\n this.parameters.set(AADServerParamKeys.CLIENT_ASSERTION_TYPE, encodeURIComponent(clientAssertionType));\r\n }\r\n };\r\n /**\r\n * add OBO assertion for confidential client flows\r\n * @param clientAssertion\r\n */\r\n RequestParameterBuilder.prototype.addOboAssertion = function (oboAssertion) {\r\n this.parameters.set(AADServerParamKeys.OBO_ASSERTION, encodeURIComponent(oboAssertion));\r\n };\r\n /**\r\n * add grant type\r\n * @param grantType\r\n */\r\n RequestParameterBuilder.prototype.addRequestTokenUse = function (tokenUse) {\r\n this.parameters.set(AADServerParamKeys.REQUESTED_TOKEN_USE, encodeURIComponent(tokenUse));\r\n };\r\n /**\r\n * add grant type\r\n * @param grantType\r\n */\r\n RequestParameterBuilder.prototype.addGrantType = function (grantType) {\r\n this.parameters.set(AADServerParamKeys.GRANT_TYPE, encodeURIComponent(grantType));\r\n };\r\n /**\r\n * add client info\r\n *\r\n */\r\n RequestParameterBuilder.prototype.addClientInfo = function () {\r\n this.parameters.set(CLIENT_INFO, \"1\");\r\n };\r\n /**\r\n * add extraQueryParams\r\n * @param eQParams\r\n */\r\n RequestParameterBuilder.prototype.addExtraQueryParameters = function (eQParams) {\r\n var _this = this;\r\n var sanitizedEQParams = RequestValidator.sanitizeEQParams(eQParams, this.parameters);\r\n Object.keys(sanitizedEQParams).forEach(function (key) {\r\n _this.parameters.set(key, eQParams[key]);\r\n });\r\n };\r\n RequestParameterBuilder.prototype.addClientCapabilitiesToClaims = function (claims, clientCapabilities) {\r\n var mergedClaims;\r\n // Parse provided claims into JSON object or initialize empty object\r\n if (!claims) {\r\n mergedClaims = {};\r\n }\r\n else {\r\n try {\r\n mergedClaims = JSON.parse(claims);\r\n }\r\n catch (e) {\r\n throw ClientConfigurationError.createInvalidClaimsRequestError();\r\n }\r\n }\r\n if (clientCapabilities && clientCapabilities.length > 0) {\r\n if (!mergedClaims.hasOwnProperty(ClaimsRequestKeys.ACCESS_TOKEN)) {\r\n // Add access_token key to claims object\r\n mergedClaims[ClaimsRequestKeys.ACCESS_TOKEN] = {};\r\n }\r\n // Add xms_cc claim with provided clientCapabilities to access_token key\r\n mergedClaims[ClaimsRequestKeys.ACCESS_TOKEN][ClaimsRequestKeys.XMS_CC] = {\r\n values: clientCapabilities\r\n };\r\n }\r\n return JSON.stringify(mergedClaims);\r\n };\r\n /**\r\n * adds `username` for Password Grant flow\r\n * @param username\r\n */\r\n RequestParameterBuilder.prototype.addUsername = function (username) {\r\n this.parameters.set(PasswordGrantConstants.username, encodeURIComponent(username));\r\n };\r\n /**\r\n * adds `password` for Password Grant flow\r\n * @param password\r\n */\r\n RequestParameterBuilder.prototype.addPassword = function (password) {\r\n this.parameters.set(PasswordGrantConstants.password, encodeURIComponent(password));\r\n };\r\n /**\r\n * add pop_jwk to query params\r\n * @param cnfString\r\n */\r\n RequestParameterBuilder.prototype.addPopToken = function (cnfString) {\r\n if (!StringUtils.isEmpty(cnfString)) {\r\n this.parameters.set(AADServerParamKeys.TOKEN_TYPE, AuthenticationScheme.POP);\r\n this.parameters.set(AADServerParamKeys.REQ_CNF, encodeURIComponent(cnfString));\r\n }\r\n };\r\n /**\r\n * add SSH JWK and key ID to query params\r\n */\r\n RequestParameterBuilder.prototype.addSshJwk = function (sshJwkString) {\r\n if (!StringUtils.isEmpty(sshJwkString)) {\r\n this.parameters.set(AADServerParamKeys.TOKEN_TYPE, AuthenticationScheme.SSH);\r\n this.parameters.set(AADServerParamKeys.REQ_CNF, encodeURIComponent(sshJwkString));\r\n }\r\n };\r\n /**\r\n * add server telemetry fields\r\n * @param serverTelemetryManager\r\n */\r\n RequestParameterBuilder.prototype.addServerTelemetry = function (serverTelemetryManager) {\r\n this.parameters.set(AADServerParamKeys.X_CLIENT_CURR_TELEM, serverTelemetryManager.generateCurrentRequestHeaderValue());\r\n this.parameters.set(AADServerParamKeys.X_CLIENT_LAST_TELEM, serverTelemetryManager.generateLastRequestHeaderValue());\r\n };\r\n /**\r\n * Adds parameter that indicates to the server that throttling is supported\r\n */\r\n RequestParameterBuilder.prototype.addThrottling = function () {\r\n this.parameters.set(AADServerParamKeys.X_MS_LIB_CAPABILITY, ThrottlingConstants.X_MS_LIB_CAPABILITY_VALUE);\r\n };\r\n /**\r\n * Adds logout_hint parameter for \"silent\" logout which prevent server account picker\r\n */\r\n RequestParameterBuilder.prototype.addLogoutHint = function (logoutHint) {\r\n this.parameters.set(AADServerParamKeys.LOGOUT_HINT, encodeURIComponent(logoutHint));\r\n };\r\n /**\r\n * Utility to create a URL from the params map\r\n */\r\n RequestParameterBuilder.prototype.createQueryString = function () {\r\n var queryParameterArray = new Array();\r\n this.parameters.forEach(function (value, key) {\r\n queryParameterArray.push(key + \"=\" + value);\r\n });\r\n return queryParameterArray.join(\"&\");\r\n };\r\n return RequestParameterBuilder;\r\n}());\n\nexport { RequestParameterBuilder };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { buildClientConfiguration } from '../config/ClientConfiguration.js';\nimport { NetworkManager } from '../network/NetworkManager.js';\nimport { Logger } from '../logger/Logger.js';\nimport { HeaderNames, Constants } from '../utils/Constants.js';\nimport { name, version } from '../packageMetadata.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { CcsCredentialType } from '../account/CcsCredential.js';\nimport { buildClientInfoFromHomeAccountId } from '../account/ClientInfo.js';\nimport { RequestParameterBuilder } from '../request/RequestParameterBuilder.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Base application class which will construct requests to send to and handle responses from the Microsoft STS using the authorization code flow.\r\n */\r\nvar BaseClient = /** @class */ (function () {\r\n function BaseClient(configuration, performanceClient) {\r\n // Set the configuration\r\n this.config = buildClientConfiguration(configuration);\r\n // Initialize the logger\r\n this.logger = new Logger(this.config.loggerOptions, name, version);\r\n // Initialize crypto\r\n this.cryptoUtils = this.config.cryptoInterface;\r\n // Initialize storage interface\r\n this.cacheManager = this.config.storageInterface;\r\n // Set the network interface\r\n this.networkClient = this.config.networkInterface;\r\n // Set the NetworkManager\r\n this.networkManager = new NetworkManager(this.networkClient, this.cacheManager);\r\n // Set TelemetryManager\r\n this.serverTelemetryManager = this.config.serverTelemetryManager;\r\n // set Authority\r\n this.authority = this.config.authOptions.authority;\r\n // set performance telemetry client\r\n this.performanceClient = performanceClient;\r\n }\r\n /**\r\n * Creates default headers for requests to token endpoint\r\n */\r\n BaseClient.prototype.createTokenRequestHeaders = function (ccsCred) {\r\n var headers = {};\r\n headers[HeaderNames.CONTENT_TYPE] = Constants.URL_FORM_CONTENT_TYPE;\r\n if (!this.config.systemOptions.preventCorsPreflight && ccsCred) {\r\n switch (ccsCred.type) {\r\n case CcsCredentialType.HOME_ACCOUNT_ID:\r\n try {\r\n var clientInfo = buildClientInfoFromHomeAccountId(ccsCred.credential);\r\n headers[HeaderNames.CCS_HEADER] = \"Oid:\" + clientInfo.uid + \"@\" + clientInfo.utid;\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"Could not parse home account ID for CCS Header: \" + e);\r\n }\r\n break;\r\n case CcsCredentialType.UPN:\r\n headers[HeaderNames.CCS_HEADER] = \"UPN: \" + ccsCred.credential;\r\n break;\r\n }\r\n }\r\n return headers;\r\n };\r\n /**\r\n * Http post to token endpoint\r\n * @param tokenEndpoint\r\n * @param queryString\r\n * @param headers\r\n * @param thumbprint\r\n */\r\n BaseClient.prototype.executePostToTokenEndpoint = function (tokenEndpoint, queryString, headers, thumbprint) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var response;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.networkManager.sendPostRequest(thumbprint, tokenEndpoint, { body: queryString, headers: headers })];\r\n case 1:\r\n response = _a.sent();\r\n if (this.config.serverTelemetryManager && response.status < 500 && response.status !== 429) {\r\n // Telemetry data successfully logged by server, clear Telemetry cache\r\n this.config.serverTelemetryManager.clearTelemetryCache();\r\n }\r\n return [2 /*return*/, response];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Updates the authority object of the client. Endpoint discovery must be completed.\r\n * @param updatedAuthority\r\n */\r\n BaseClient.prototype.updateAuthority = function (updatedAuthority) {\r\n if (!updatedAuthority.discoveryComplete()) {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Updated authority has not completed endpoint discovery.\");\r\n }\r\n this.authority = updatedAuthority;\r\n };\r\n /**\r\n * Creates query string for the /token request\r\n * @param request\r\n */\r\n BaseClient.prototype.createTokenQueryParameters = function (request) {\r\n var parameterBuilder = new RequestParameterBuilder();\r\n if (request.tokenQueryParameters) {\r\n parameterBuilder.addExtraQueryParameters(request.tokenQueryParameters);\r\n }\r\n return parameterBuilder.createQueryString();\r\n };\r\n return BaseClient;\r\n}());\n\nexport { BaseClient };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { TimeUtils } from '../utils/TimeUtils.js';\nimport { UrlString } from '../url/UrlString.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar KeyLocation;\r\n(function (KeyLocation) {\r\n KeyLocation[\"SW\"] = \"sw\";\r\n KeyLocation[\"UHW\"] = \"uhw\";\r\n})(KeyLocation || (KeyLocation = {}));\r\nvar PopTokenGenerator = /** @class */ (function () {\r\n function PopTokenGenerator(cryptoUtils, performanceClient) {\r\n this.cryptoUtils = cryptoUtils;\r\n this.performanceClient = performanceClient;\r\n }\r\n /**\r\n * Generates the req_cnf validated at the RP in the POP protocol for SHR parameters\r\n * and returns an object containing the keyid, the full req_cnf string and the req_cnf string hash\r\n * @param request\r\n * @returns\r\n */\r\n PopTokenGenerator.prototype.generateCnf = function (request) {\r\n var _a, _b;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var reqCnf, reqCnfString, _c;\r\n return __generator(this, function (_d) {\r\n switch (_d.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.PopTokenGenerateCnf, request.correlationId);\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.PopTokenGenerateKid, request.correlationId);\r\n return [4 /*yield*/, this.generateKid(request)];\r\n case 1:\r\n reqCnf = _d.sent();\r\n reqCnfString = this.cryptoUtils.base64Encode(JSON.stringify(reqCnf));\r\n _c = {\r\n kid: reqCnf.kid,\r\n reqCnfString: reqCnfString\r\n };\r\n return [4 /*yield*/, this.cryptoUtils.hashString(reqCnfString)];\r\n case 2: return [2 /*return*/, (_c.reqCnfHash = _d.sent(),\r\n _c)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Generates key_id for a SHR token request\r\n * @param request\r\n * @returns\r\n */\r\n PopTokenGenerator.prototype.generateKid = function (request) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var kidThumbprint;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.PopTokenGenerateKid, request.correlationId);\r\n return [4 /*yield*/, this.cryptoUtils.getPublicKeyThumbprint(request)];\r\n case 1:\r\n kidThumbprint = _b.sent();\r\n return [2 /*return*/, {\r\n kid: kidThumbprint,\r\n xms_ksl: KeyLocation.SW\r\n }];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Signs the POP access_token with the local generated key-pair\r\n * @param accessToken\r\n * @param request\r\n * @returns\r\n */\r\n PopTokenGenerator.prototype.signPopToken = function (accessToken, keyId, request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n return [2 /*return*/, this.signPayload(accessToken, keyId, request)];\r\n });\r\n });\r\n };\r\n /**\r\n * Utility function to generate the signed JWT for an access_token\r\n * @param payload\r\n * @param kid\r\n * @param request\r\n * @param claims\r\n * @returns\r\n */\r\n PopTokenGenerator.prototype.signPayload = function (payload, keyId, request, claims) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var resourceRequestMethod, resourceRequestUri, shrClaims, shrNonce, resourceUrlString, resourceUrlComponents;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n resourceRequestMethod = request.resourceRequestMethod, resourceRequestUri = request.resourceRequestUri, shrClaims = request.shrClaims, shrNonce = request.shrNonce;\r\n resourceUrlString = (resourceRequestUri) ? new UrlString(resourceRequestUri) : undefined;\r\n resourceUrlComponents = resourceUrlString === null || resourceUrlString === void 0 ? void 0 : resourceUrlString.getUrlComponents();\r\n return [4 /*yield*/, this.cryptoUtils.signJwt(__assign({ at: payload, ts: TimeUtils.nowSeconds(), m: resourceRequestMethod === null || resourceRequestMethod === void 0 ? void 0 : resourceRequestMethod.toUpperCase(), u: resourceUrlComponents === null || resourceUrlComponents === void 0 ? void 0 : resourceUrlComponents.HostNameAndPort, nonce: shrNonce || this.cryptoUtils.createNewGuid(), p: resourceUrlComponents === null || resourceUrlComponents === void 0 ? void 0 : resourceUrlComponents.AbsolutePath, q: (resourceUrlComponents === null || resourceUrlComponents === void 0 ? void 0 : resourceUrlComponents.QueryString) ? [[], resourceUrlComponents.QueryString] : undefined, client_claims: shrClaims || undefined }, claims), keyId, request.correlationId)];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n }\r\n });\r\n });\r\n };\r\n return PopTokenGenerator;\r\n}());\n\nexport { PopTokenGenerator };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * This class instance helps track the memory changes facilitating\r\n * decisions to read from and write to the persistent cache\r\n */ var TokenCacheContext = /** @class */ (function () {\r\n function TokenCacheContext(tokenCache, hasChanged) {\r\n this.cache = tokenCache;\r\n this.hasChanged = hasChanged;\r\n }\r\n Object.defineProperty(TokenCacheContext.prototype, \"cacheHasChanged\", {\r\n /**\r\n * boolean which indicates the changes in cache\r\n */\r\n get: function () {\r\n return this.hasChanged;\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(TokenCacheContext.prototype, \"tokenCache\", {\r\n /**\r\n * function to retrieve the token cache\r\n */\r\n get: function () {\r\n return this.cache;\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n return TokenCacheContext;\r\n}());\n\nexport { TokenCacheContext };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { buildClientInfo } from '../account/ClientInfo.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { ServerError } from '../error/ServerError.js';\nimport { AuthToken } from '../account/AuthToken.js';\nimport { ScopeSet } from '../request/ScopeSet.js';\nimport { AccountEntity } from '../cache/entities/AccountEntity.js';\nimport { IdTokenEntity } from '../cache/entities/IdTokenEntity.js';\nimport { AccessTokenEntity } from '../cache/entities/AccessTokenEntity.js';\nimport { RefreshTokenEntity } from '../cache/entities/RefreshTokenEntity.js';\nimport { InteractionRequiredAuthError } from '../error/InteractionRequiredAuthError.js';\nimport { CacheRecord } from '../cache/entities/CacheRecord.js';\nimport { ProtocolUtils } from '../utils/ProtocolUtils.js';\nimport { Constants, AuthenticationScheme, THE_FAMILY_ID } from '../utils/Constants.js';\nimport { PopTokenGenerator } from '../crypto/PopTokenGenerator.js';\nimport { AppMetadataEntity } from '../cache/entities/AppMetadataEntity.js';\nimport { TokenCacheContext } from '../cache/persistence/TokenCacheContext.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Class that handles response parsing.\r\n */\r\nvar ResponseHandler = /** @class */ (function () {\r\n function ResponseHandler(clientId, cacheStorage, cryptoObj, logger, serializableCache, persistencePlugin, performanceClient) {\r\n this.clientId = clientId;\r\n this.cacheStorage = cacheStorage;\r\n this.cryptoObj = cryptoObj;\r\n this.logger = logger;\r\n this.serializableCache = serializableCache;\r\n this.persistencePlugin = persistencePlugin;\r\n this.performanceClient = performanceClient;\r\n }\r\n /**\r\n * Function which validates server authorization code response.\r\n * @param serverResponseHash\r\n * @param cachedState\r\n * @param cryptoObj\r\n */\r\n ResponseHandler.prototype.validateServerAuthorizationCodeResponse = function (serverResponseHash, cachedState, cryptoObj) {\r\n if (!serverResponseHash.state || !cachedState) {\r\n throw !serverResponseHash.state ? ClientAuthError.createStateNotFoundError(\"Server State\") : ClientAuthError.createStateNotFoundError(\"Cached State\");\r\n }\r\n if (decodeURIComponent(serverResponseHash.state) !== decodeURIComponent(cachedState)) {\r\n throw ClientAuthError.createStateMismatchError();\r\n }\r\n // Check for error\r\n if (serverResponseHash.error || serverResponseHash.error_description || serverResponseHash.suberror) {\r\n if (InteractionRequiredAuthError.isInteractionRequiredError(serverResponseHash.error, serverResponseHash.error_description, serverResponseHash.suberror)) {\r\n throw new InteractionRequiredAuthError(serverResponseHash.error || Constants.EMPTY_STRING, serverResponseHash.error_description, serverResponseHash.suberror, serverResponseHash.timestamp || Constants.EMPTY_STRING, serverResponseHash.trace_id || Constants.EMPTY_STRING, serverResponseHash.correlation_id || Constants.EMPTY_STRING, serverResponseHash.claims || Constants.EMPTY_STRING);\r\n }\r\n throw new ServerError(serverResponseHash.error || Constants.EMPTY_STRING, serverResponseHash.error_description, serverResponseHash.suberror);\r\n }\r\n if (serverResponseHash.client_info) {\r\n buildClientInfo(serverResponseHash.client_info, cryptoObj);\r\n }\r\n };\r\n /**\r\n * Function which validates server authorization token response.\r\n * @param serverResponse\r\n */\r\n ResponseHandler.prototype.validateTokenResponse = function (serverResponse) {\r\n // Check for error\r\n if (serverResponse.error || serverResponse.error_description || serverResponse.suberror) {\r\n if (InteractionRequiredAuthError.isInteractionRequiredError(serverResponse.error, serverResponse.error_description, serverResponse.suberror)) {\r\n throw new InteractionRequiredAuthError(serverResponse.error, serverResponse.error_description, serverResponse.suberror, serverResponse.timestamp || Constants.EMPTY_STRING, serverResponse.trace_id || Constants.EMPTY_STRING, serverResponse.correlation_id || Constants.EMPTY_STRING, serverResponse.claims || Constants.EMPTY_STRING);\r\n }\r\n var errString = serverResponse.error_codes + \" - [\" + serverResponse.timestamp + \"]: \" + serverResponse.error_description + \" - Correlation ID: \" + serverResponse.correlation_id + \" - Trace ID: \" + serverResponse.trace_id;\r\n throw new ServerError(serverResponse.error, errString, serverResponse.suberror);\r\n }\r\n };\r\n /**\r\n * Returns a constructed token response based on given string. Also manages the cache updates and cleanups.\r\n * @param serverTokenResponse\r\n * @param authority\r\n */\r\n ResponseHandler.prototype.handleServerTokenResponse = function (serverTokenResponse, authority, reqTimestamp, request, authCodePayload, userAssertionHash, handlingRefreshTokenResponse, forceCacheRefreshTokenResponse, serverRequestId) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var idTokenObj, authTime, requestStateObj, cacheRecord, cacheContext, key, account;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.HandleServerTokenResponse, serverTokenResponse.correlation_id);\r\n if (serverTokenResponse.id_token) {\r\n idTokenObj = new AuthToken(serverTokenResponse.id_token || Constants.EMPTY_STRING, this.cryptoObj);\r\n // token nonce check (TODO: Add a warning if no nonce is given?)\r\n if (authCodePayload && !StringUtils.isEmpty(authCodePayload.nonce)) {\r\n if (idTokenObj.claims.nonce !== authCodePayload.nonce) {\r\n throw ClientAuthError.createNonceMismatchError();\r\n }\r\n }\r\n // token max_age check\r\n if (request.maxAge || (request.maxAge === 0)) {\r\n authTime = idTokenObj.claims.auth_time;\r\n if (!authTime) {\r\n throw ClientAuthError.createAuthTimeNotFoundError();\r\n }\r\n AuthToken.checkMaxAge(authTime, request.maxAge);\r\n }\r\n }\r\n // generate homeAccountId\r\n this.homeAccountIdentifier = AccountEntity.generateHomeAccountId(serverTokenResponse.client_info || Constants.EMPTY_STRING, authority.authorityType, this.logger, this.cryptoObj, idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims);\r\n if (!!authCodePayload && !!authCodePayload.state) {\r\n requestStateObj = ProtocolUtils.parseRequestState(this.cryptoObj, authCodePayload.state);\r\n }\r\n // Add keyId from request to serverTokenResponse if defined\r\n serverTokenResponse.key_id = serverTokenResponse.key_id || request.sshKid || undefined;\r\n cacheRecord = this.generateCacheRecord(serverTokenResponse, authority, reqTimestamp, request, idTokenObj, userAssertionHash, authCodePayload);\r\n _b.label = 1;\r\n case 1:\r\n _b.trys.push([1, , 5, 8]);\r\n if (!(this.persistencePlugin && this.serializableCache)) return [3 /*break*/, 3];\r\n this.logger.verbose(\"Persistence enabled, calling beforeCacheAccess\");\r\n cacheContext = new TokenCacheContext(this.serializableCache, true);\r\n return [4 /*yield*/, this.persistencePlugin.beforeCacheAccess(cacheContext)];\r\n case 2:\r\n _b.sent();\r\n _b.label = 3;\r\n case 3:\r\n /*\r\n * When saving a refreshed tokens to the cache, it is expected that the account that was used is present in the cache.\r\n * If not present, we should return null, as it's the case that another application called removeAccount in between\r\n * the calls to getAllAccounts and acquireTokenSilent. We should not overwrite that removal, unless explicitly flagged by\r\n * the developer, as in the case of refresh token flow used in ADAL Node to MSAL Node migration.\r\n */\r\n if (handlingRefreshTokenResponse && !forceCacheRefreshTokenResponse && cacheRecord.account) {\r\n key = cacheRecord.account.generateAccountKey();\r\n account = this.cacheStorage.getAccount(key);\r\n if (!account) {\r\n this.logger.warning(\"Account used to refresh tokens not in persistence, refreshed tokens will not be stored in the cache\");\r\n return [2 /*return*/, ResponseHandler.generateAuthenticationResult(this.cryptoObj, authority, cacheRecord, false, request, idTokenObj, requestStateObj, undefined, serverRequestId)];\r\n }\r\n }\r\n return [4 /*yield*/, this.cacheStorage.saveCacheRecord(cacheRecord)];\r\n case 4:\r\n _b.sent();\r\n return [3 /*break*/, 8];\r\n case 5:\r\n if (!(this.persistencePlugin && this.serializableCache && cacheContext)) return [3 /*break*/, 7];\r\n this.logger.verbose(\"Persistence enabled, calling afterCacheAccess\");\r\n return [4 /*yield*/, this.persistencePlugin.afterCacheAccess(cacheContext)];\r\n case 6:\r\n _b.sent();\r\n _b.label = 7;\r\n case 7: return [7 /*endfinally*/];\r\n case 8: return [2 /*return*/, ResponseHandler.generateAuthenticationResult(this.cryptoObj, authority, cacheRecord, false, request, idTokenObj, requestStateObj, serverTokenResponse, serverRequestId)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Generates CacheRecord\r\n * @param serverTokenResponse\r\n * @param idTokenObj\r\n * @param authority\r\n */\r\n ResponseHandler.prototype.generateCacheRecord = function (serverTokenResponse, authority, reqTimestamp, request, idTokenObj, userAssertionHash, authCodePayload) {\r\n var env = authority.getPreferredCache();\r\n if (StringUtils.isEmpty(env)) {\r\n throw ClientAuthError.createInvalidCacheEnvironmentError();\r\n }\r\n // IdToken: non AAD scenarios can have empty realm\r\n var cachedIdToken;\r\n var cachedAccount;\r\n if (!StringUtils.isEmpty(serverTokenResponse.id_token) && !!idTokenObj) {\r\n cachedIdToken = IdTokenEntity.createIdTokenEntity(this.homeAccountIdentifier, env, serverTokenResponse.id_token || Constants.EMPTY_STRING, this.clientId, idTokenObj.claims.tid || Constants.EMPTY_STRING);\r\n cachedAccount = AccountEntity.createAccount({\r\n homeAccountId: this.homeAccountIdentifier,\r\n idTokenClaims: idTokenObj.claims,\r\n clientInfo: serverTokenResponse.client_info || Constants.EMPTY_STRING,\r\n cloudGraphHostName: authCodePayload === null || authCodePayload === void 0 ? void 0 : authCodePayload.cloud_graph_host_name,\r\n msGraphHost: authCodePayload === null || authCodePayload === void 0 ? void 0 : authCodePayload.msgraph_host,\r\n }, authority);\r\n }\r\n // AccessToken\r\n var cachedAccessToken = null;\r\n if (!StringUtils.isEmpty(serverTokenResponse.access_token)) {\r\n // If scopes not returned in server response, use request scopes\r\n var responseScopes = serverTokenResponse.scope ? ScopeSet.fromString(serverTokenResponse.scope) : new ScopeSet(request.scopes || []);\r\n /*\r\n * Use timestamp calculated before request\r\n * Server may return timestamps as strings, parse to numbers if so.\r\n */\r\n var expiresIn = (typeof serverTokenResponse.expires_in === \"string\" ? parseInt(serverTokenResponse.expires_in, 10) : serverTokenResponse.expires_in) || 0;\r\n var extExpiresIn = (typeof serverTokenResponse.ext_expires_in === \"string\" ? parseInt(serverTokenResponse.ext_expires_in, 10) : serverTokenResponse.ext_expires_in) || 0;\r\n var refreshIn = (typeof serverTokenResponse.refresh_in === \"string\" ? parseInt(serverTokenResponse.refresh_in, 10) : serverTokenResponse.refresh_in) || undefined;\r\n var tokenExpirationSeconds = reqTimestamp + expiresIn;\r\n var extendedTokenExpirationSeconds = tokenExpirationSeconds + extExpiresIn;\r\n var refreshOnSeconds = refreshIn && refreshIn > 0 ? reqTimestamp + refreshIn : undefined;\r\n // non AAD scenarios can have empty realm\r\n cachedAccessToken = AccessTokenEntity.createAccessTokenEntity(this.homeAccountIdentifier, env, serverTokenResponse.access_token || Constants.EMPTY_STRING, this.clientId, idTokenObj ? idTokenObj.claims.tid || Constants.EMPTY_STRING : authority.tenant, responseScopes.printScopes(), tokenExpirationSeconds, extendedTokenExpirationSeconds, this.cryptoObj, refreshOnSeconds, serverTokenResponse.token_type, userAssertionHash, serverTokenResponse.key_id, request.claims, request.requestedClaimsHash);\r\n }\r\n // refreshToken\r\n var cachedRefreshToken = null;\r\n if (!StringUtils.isEmpty(serverTokenResponse.refresh_token)) {\r\n cachedRefreshToken = RefreshTokenEntity.createRefreshTokenEntity(this.homeAccountIdentifier, env, serverTokenResponse.refresh_token || Constants.EMPTY_STRING, this.clientId, serverTokenResponse.foci, userAssertionHash);\r\n }\r\n // appMetadata\r\n var cachedAppMetadata = null;\r\n if (!StringUtils.isEmpty(serverTokenResponse.foci)) {\r\n cachedAppMetadata = AppMetadataEntity.createAppMetadataEntity(this.clientId, env, serverTokenResponse.foci);\r\n }\r\n return new CacheRecord(cachedAccount, cachedIdToken, cachedAccessToken, cachedRefreshToken, cachedAppMetadata);\r\n };\r\n /**\r\n * Creates an @AuthenticationResult from @CacheRecord , @IdToken , and a boolean that states whether or not the result is from cache.\r\n *\r\n * Optionally takes a state string that is set as-is in the response.\r\n *\r\n * @param cacheRecord\r\n * @param idTokenObj\r\n * @param fromTokenCache\r\n * @param stateString\r\n */\r\n ResponseHandler.generateAuthenticationResult = function (cryptoObj, authority, cacheRecord, fromTokenCache, request, idTokenObj, requestState, serverTokenResponse, requestId) {\r\n var _a, _b, _c;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var accessToken, responseScopes, expiresOn, extExpiresOn, familyId, popTokenGenerator, _d, secret, keyId, uid, tid;\r\n return __generator(this, function (_e) {\r\n switch (_e.label) {\r\n case 0:\r\n accessToken = Constants.EMPTY_STRING;\r\n responseScopes = [];\r\n expiresOn = null;\r\n familyId = Constants.EMPTY_STRING;\r\n if (!cacheRecord.accessToken) return [3 /*break*/, 4];\r\n if (!(cacheRecord.accessToken.tokenType === AuthenticationScheme.POP)) return [3 /*break*/, 2];\r\n popTokenGenerator = new PopTokenGenerator(cryptoObj);\r\n _d = cacheRecord.accessToken, secret = _d.secret, keyId = _d.keyId;\r\n if (!keyId) {\r\n throw ClientAuthError.createKeyIdMissingError();\r\n }\r\n return [4 /*yield*/, popTokenGenerator.signPopToken(secret, keyId, request)];\r\n case 1:\r\n accessToken = _e.sent();\r\n return [3 /*break*/, 3];\r\n case 2:\r\n accessToken = cacheRecord.accessToken.secret;\r\n _e.label = 3;\r\n case 3:\r\n responseScopes = ScopeSet.fromString(cacheRecord.accessToken.target).asArray();\r\n expiresOn = new Date(Number(cacheRecord.accessToken.expiresOn) * 1000);\r\n extExpiresOn = new Date(Number(cacheRecord.accessToken.extendedExpiresOn) * 1000);\r\n _e.label = 4;\r\n case 4:\r\n if (cacheRecord.appMetadata) {\r\n familyId = cacheRecord.appMetadata.familyId === THE_FAMILY_ID ? THE_FAMILY_ID : Constants.EMPTY_STRING;\r\n }\r\n uid = (idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.oid) || (idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.sub) || Constants.EMPTY_STRING;\r\n tid = (idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.tid) || Constants.EMPTY_STRING;\r\n // for hybrid + native bridge enablement, send back the native account Id\r\n if ((serverTokenResponse === null || serverTokenResponse === void 0 ? void 0 : serverTokenResponse.spa_accountid) && !!cacheRecord.account) {\r\n cacheRecord.account.nativeAccountId = serverTokenResponse === null || serverTokenResponse === void 0 ? void 0 : serverTokenResponse.spa_accountid;\r\n }\r\n return [2 /*return*/, {\r\n authority: authority.canonicalAuthority,\r\n uniqueId: uid,\r\n tenantId: tid,\r\n scopes: responseScopes,\r\n account: cacheRecord.account ? cacheRecord.account.getAccountInfo() : null,\r\n idToken: idTokenObj ? idTokenObj.rawToken : Constants.EMPTY_STRING,\r\n idTokenClaims: idTokenObj ? idTokenObj.claims : {},\r\n accessToken: accessToken,\r\n fromCache: fromTokenCache,\r\n expiresOn: expiresOn,\r\n correlationId: request.correlationId,\r\n requestId: requestId || Constants.EMPTY_STRING,\r\n extExpiresOn: extExpiresOn,\r\n familyId: familyId,\r\n tokenType: ((_a = cacheRecord.accessToken) === null || _a === void 0 ? void 0 : _a.tokenType) || Constants.EMPTY_STRING,\r\n state: requestState ? requestState.userRequestState : Constants.EMPTY_STRING,\r\n cloudGraphHostName: ((_b = cacheRecord.account) === null || _b === void 0 ? void 0 : _b.cloudGraphHostName) || Constants.EMPTY_STRING,\r\n msGraphHost: ((_c = cacheRecord.account) === null || _c === void 0 ? void 0 : _c.msGraphHost) || Constants.EMPTY_STRING,\r\n code: serverTokenResponse === null || serverTokenResponse === void 0 ? void 0 : serverTokenResponse.spa_code,\r\n fromNativeBroker: false,\r\n }];\r\n }\r\n });\r\n });\r\n };\r\n return ResponseHandler;\r\n}());\n\nexport { ResponseHandler };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __assign, __generator, __spreadArrays } from '../_virtual/_tslib.js';\nimport { BaseClient } from './BaseClient.js';\nimport { RequestParameterBuilder } from '../request/RequestParameterBuilder.js';\nimport { Separators, AADServerParamKeys, AuthenticationScheme, GrantType, PromptValue, HeaderNames } from '../utils/Constants.js';\nimport { ResponseHandler } from '../response/ResponseHandler.js';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { UrlString } from '../url/UrlString.js';\nimport { PopTokenGenerator } from '../crypto/PopTokenGenerator.js';\nimport { TimeUtils } from '../utils/TimeUtils.js';\nimport { buildClientInfo, buildClientInfoFromHomeAccountId } from '../account/ClientInfo.js';\nimport { CcsCredentialType } from '../account/CcsCredential.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { RequestValidator } from '../request/RequestValidator.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Oauth2.0 Authorization Code client\r\n */\r\nvar AuthorizationCodeClient = /** @class */ (function (_super) {\r\n __extends(AuthorizationCodeClient, _super);\r\n function AuthorizationCodeClient(configuration, performanceClient) {\r\n var _this = _super.call(this, configuration, performanceClient) || this;\r\n // Flag to indicate if client is for hybrid spa auth code redemption\r\n _this.includeRedirectUri = true;\r\n return _this;\r\n }\r\n /**\r\n * Creates the URL of the authorization request letting the user input credentials and consent to the\r\n * application. The URL target the /authorize endpoint of the authority configured in the\r\n * application object.\r\n *\r\n * Once the user inputs their credentials and consents, the authority will send a response to the redirect URI\r\n * sent in the request and should contain an authorization code, which can then be used to acquire tokens via\r\n * acquireToken(AuthorizationCodeRequest)\r\n * @param request\r\n */\r\n AuthorizationCodeClient.prototype.getAuthCodeUrl = function (request) {\r\n var _a, _b;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var queryString;\r\n return __generator(this, function (_c) {\r\n switch (_c.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.GetAuthCodeUrl, request.correlationId);\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.AuthClientCreateQueryString, request.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeUrlQueryString(request)];\r\n case 1:\r\n queryString = _c.sent();\r\n return [2 /*return*/, UrlString.appendQueryString(this.authority.authorizationEndpoint, queryString)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * API to acquire a token in exchange of 'authorization_code` acquired by the user in the first leg of the\r\n * authorization_code_grant\r\n * @param request\r\n */\r\n AuthorizationCodeClient.prototype.acquireToken = function (request, authCodePayload) {\r\n var _a, _b, _c, _d, _e, _f;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var atsMeasurement, reqTimestamp, response, requestId, httpVerAuthority, responseHandler;\r\n var _this = this;\r\n return __generator(this, function (_g) {\r\n switch (_g.label) {\r\n case 0:\r\n if (!request || !request.code) {\r\n throw ClientAuthError.createTokenRequestCannotBeMadeError();\r\n }\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthClientAcquireToken, request.correlationId);\r\n atsMeasurement = (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.startMeasurement(\"AuthCodeClientAcquireToken\", request.correlationId);\r\n this.logger.info(\"in acquireToken call in auth-code client\");\r\n reqTimestamp = TimeUtils.nowSeconds();\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.AuthClientExecuteTokenRequest, request.correlationId);\r\n return [4 /*yield*/, this.executeTokenRequest(this.authority, request)];\r\n case 1:\r\n response = _g.sent();\r\n requestId = (_d = response.headers) === null || _d === void 0 ? void 0 : _d[HeaderNames.X_MS_REQUEST_ID];\r\n httpVerAuthority = (_e = response.headers) === null || _e === void 0 ? void 0 : _e[HeaderNames.X_MS_HTTP_VERSION];\r\n if (httpVerAuthority) {\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.addStaticFields({\r\n httpVerAuthority: httpVerAuthority\r\n });\r\n }\r\n responseHandler = new ResponseHandler(this.config.authOptions.clientId, this.cacheManager, this.cryptoUtils, this.logger, this.config.serializableCache, this.config.persistencePlugin, this.performanceClient);\r\n // Validate response. This function throws a server error if an error is returned by the server.\r\n responseHandler.validateTokenResponse(response.body);\r\n (_f = this.performanceClient) === null || _f === void 0 ? void 0 : _f.setPreQueueTime(PerformanceEvents.HandleServerTokenResponse, request.correlationId);\r\n return [2 /*return*/, responseHandler.handleServerTokenResponse(response.body, this.authority, reqTimestamp, request, authCodePayload, undefined, undefined, undefined, requestId).then(function (result) {\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.endMeasurement({\r\n success: true\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n _this.logger.verbose(\"Error in fetching token in ACC\", request.correlationId);\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.endMeasurement({\r\n errorCode: error.errorCode,\r\n subErrorCode: error.subError,\r\n success: false\r\n });\r\n throw error;\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Handles the hash fragment response from public client code request. Returns a code response used by\r\n * the client to exchange for a token in acquireToken.\r\n * @param hashFragment\r\n */\r\n AuthorizationCodeClient.prototype.handleFragmentResponse = function (hashFragment, cachedState) {\r\n // Handle responses.\r\n var responseHandler = new ResponseHandler(this.config.authOptions.clientId, this.cacheManager, this.cryptoUtils, this.logger, null, null);\r\n // Deserialize hash fragment response parameters.\r\n var hashUrlString = new UrlString(hashFragment);\r\n // Deserialize hash fragment response parameters.\r\n var serverParams = UrlString.getDeserializedHash(hashUrlString.getHash());\r\n // Get code response\r\n responseHandler.validateServerAuthorizationCodeResponse(serverParams, cachedState, this.cryptoUtils);\r\n // throw when there is no auth code in the response\r\n if (!serverParams.code) {\r\n throw ClientAuthError.createNoAuthCodeInServerResponseError();\r\n }\r\n return __assign(__assign({}, serverParams), { \r\n // Code param is optional in ServerAuthorizationCodeResponse but required in AuthorizationCodePaylod\r\n code: serverParams.code });\r\n };\r\n /**\r\n * Used to log out the current user, and redirect the user to the postLogoutRedirectUri.\r\n * Default behaviour is to redirect the user to `window.location.href`.\r\n * @param authorityUri\r\n */\r\n AuthorizationCodeClient.prototype.getLogoutUri = function (logoutRequest) {\r\n // Throw error if logoutRequest is null/undefined\r\n if (!logoutRequest) {\r\n throw ClientConfigurationError.createEmptyLogoutRequestError();\r\n }\r\n var queryString = this.createLogoutUrlQueryString(logoutRequest);\r\n // Construct logout URI\r\n return UrlString.appendQueryString(this.authority.endSessionEndpoint, queryString);\r\n };\r\n /**\r\n * Executes POST request to token endpoint\r\n * @param authority\r\n * @param request\r\n */\r\n AuthorizationCodeClient.prototype.executeTokenRequest = function (authority, request) {\r\n var _a, _b;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var queryParametersString, endpoint, requestBody, ccsCredential, clientInfo, headers, thumbprint;\r\n return __generator(this, function (_c) {\r\n switch (_c.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthClientExecuteTokenRequest, request.correlationId);\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.AuthClientCreateTokenRequestBody, request.correlationId);\r\n queryParametersString = this.createTokenQueryParameters(request);\r\n endpoint = UrlString.appendQueryString(authority.tokenEndpoint, queryParametersString);\r\n return [4 /*yield*/, this.createTokenRequestBody(request)];\r\n case 1:\r\n requestBody = _c.sent();\r\n ccsCredential = undefined;\r\n if (request.clientInfo) {\r\n try {\r\n clientInfo = buildClientInfo(request.clientInfo, this.cryptoUtils);\r\n ccsCredential = {\r\n credential: \"\" + clientInfo.uid + Separators.CLIENT_INFO_SEPARATOR + clientInfo.utid,\r\n type: CcsCredentialType.HOME_ACCOUNT_ID\r\n };\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"Could not parse client info for CCS Header: \" + e);\r\n }\r\n }\r\n headers = this.createTokenRequestHeaders(ccsCredential || request.ccsCredential);\r\n thumbprint = {\r\n clientId: this.config.authOptions.clientId,\r\n authority: authority.canonicalAuthority,\r\n scopes: request.scopes,\r\n claims: request.claims,\r\n authenticationScheme: request.authenticationScheme,\r\n resourceRequestMethod: request.resourceRequestMethod,\r\n resourceRequestUri: request.resourceRequestUri,\r\n shrClaims: request.shrClaims,\r\n sshKid: request.sshKid\r\n };\r\n return [2 /*return*/, this.executePostToTokenEndpoint(endpoint, requestBody, headers, thumbprint)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Generates a map for all the params to be sent to the service\r\n * @param request\r\n */\r\n AuthorizationCodeClient.prototype.createTokenRequestBody = function (request) {\r\n var _a, _b;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var parameterBuilder, clientAssertion, popTokenGenerator, reqCnfData, correlationId, ccsCred, clientInfo, clientInfo;\r\n var _c;\r\n return __generator(this, function (_d) {\r\n switch (_d.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthClientCreateTokenRequestBody, request.correlationId);\r\n parameterBuilder = new RequestParameterBuilder();\r\n parameterBuilder.addClientId(this.config.authOptions.clientId);\r\n /*\r\n * For hybrid spa flow, there will be a code but no verifier\r\n * In this scenario, don't include redirect uri as auth code will not be bound to redirect URI\r\n */\r\n if (!this.includeRedirectUri) {\r\n // Just validate\r\n RequestValidator.validateRedirectUri(request.redirectUri);\r\n }\r\n else {\r\n // Validate and include redirect uri\r\n parameterBuilder.addRedirectUri(request.redirectUri);\r\n }\r\n // Add scope array, parameter builder will add default scopes and dedupe\r\n parameterBuilder.addScopes(request.scopes);\r\n // add code: user set, not validated\r\n parameterBuilder.addAuthorizationCode(request.code);\r\n // Add library metadata\r\n parameterBuilder.addLibraryInfo(this.config.libraryInfo);\r\n parameterBuilder.addApplicationTelemetry(this.config.telemetry.application);\r\n parameterBuilder.addThrottling();\r\n if (this.serverTelemetryManager) {\r\n parameterBuilder.addServerTelemetry(this.serverTelemetryManager);\r\n }\r\n // add code_verifier if passed\r\n if (request.codeVerifier) {\r\n parameterBuilder.addCodeVerifier(request.codeVerifier);\r\n }\r\n if (this.config.clientCredentials.clientSecret) {\r\n parameterBuilder.addClientSecret(this.config.clientCredentials.clientSecret);\r\n }\r\n if (this.config.clientCredentials.clientAssertion) {\r\n clientAssertion = this.config.clientCredentials.clientAssertion;\r\n parameterBuilder.addClientAssertion(clientAssertion.assertion);\r\n parameterBuilder.addClientAssertionType(clientAssertion.assertionType);\r\n }\r\n parameterBuilder.addGrantType(GrantType.AUTHORIZATION_CODE_GRANT);\r\n parameterBuilder.addClientInfo();\r\n if (!(request.authenticationScheme === AuthenticationScheme.POP)) return [3 /*break*/, 2];\r\n popTokenGenerator = new PopTokenGenerator(this.cryptoUtils, this.performanceClient);\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.PopTokenGenerateCnf, request.correlationId);\r\n return [4 /*yield*/, popTokenGenerator.generateCnf(request)];\r\n case 1:\r\n reqCnfData = _d.sent();\r\n // SPA PoP requires full Base64Url encoded req_cnf string (unhashed)\r\n parameterBuilder.addPopToken(reqCnfData.reqCnfString);\r\n return [3 /*break*/, 3];\r\n case 2:\r\n if (request.authenticationScheme === AuthenticationScheme.SSH) {\r\n if (request.sshJwk) {\r\n parameterBuilder.addSshJwk(request.sshJwk);\r\n }\r\n else {\r\n throw ClientConfigurationError.createMissingSshJwkError();\r\n }\r\n }\r\n _d.label = 3;\r\n case 3:\r\n correlationId = request.correlationId || this.config.cryptoInterface.createNewGuid();\r\n parameterBuilder.addCorrelationId(correlationId);\r\n if (!StringUtils.isEmptyObj(request.claims) || this.config.authOptions.clientCapabilities && this.config.authOptions.clientCapabilities.length > 0) {\r\n parameterBuilder.addClaims(request.claims, this.config.authOptions.clientCapabilities);\r\n }\r\n ccsCred = undefined;\r\n if (request.clientInfo) {\r\n try {\r\n clientInfo = buildClientInfo(request.clientInfo, this.cryptoUtils);\r\n ccsCred = {\r\n credential: \"\" + clientInfo.uid + Separators.CLIENT_INFO_SEPARATOR + clientInfo.utid,\r\n type: CcsCredentialType.HOME_ACCOUNT_ID\r\n };\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"Could not parse client info for CCS Header: \" + e);\r\n }\r\n }\r\n else {\r\n ccsCred = request.ccsCredential;\r\n }\r\n // Adds these as parameters in the request instead of headers to prevent CORS preflight request\r\n if (this.config.systemOptions.preventCorsPreflight && ccsCred) {\r\n switch (ccsCred.type) {\r\n case CcsCredentialType.HOME_ACCOUNT_ID:\r\n try {\r\n clientInfo = buildClientInfoFromHomeAccountId(ccsCred.credential);\r\n parameterBuilder.addCcsOid(clientInfo);\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"Could not parse home account ID for CCS Header: \" + e);\r\n }\r\n break;\r\n case CcsCredentialType.UPN:\r\n parameterBuilder.addCcsUpn(ccsCred.credential);\r\n break;\r\n }\r\n }\r\n if (request.tokenBodyParameters) {\r\n parameterBuilder.addExtraQueryParameters(request.tokenBodyParameters);\r\n }\r\n // Add hybrid spa parameters if not already provided\r\n if (request.enableSpaAuthorizationCode && (!request.tokenBodyParameters || !request.tokenBodyParameters[AADServerParamKeys.RETURN_SPA_CODE])) {\r\n parameterBuilder.addExtraQueryParameters((_c = {},\r\n _c[AADServerParamKeys.RETURN_SPA_CODE] = \"1\",\r\n _c));\r\n }\r\n return [2 /*return*/, parameterBuilder.createQueryString()];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * This API validates the `AuthorizationCodeUrlRequest` and creates a URL\r\n * @param request\r\n */\r\n AuthorizationCodeClient.prototype.createAuthCodeUrlQueryString = function (request) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var parameterBuilder, requestScopes, correlationId, accountSid, accountLoginHintClaim, clientInfo, clientInfo, clientInfo, popTokenGenerator, reqCnfData;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthClientCreateQueryString, request.correlationId);\r\n parameterBuilder = new RequestParameterBuilder();\r\n parameterBuilder.addClientId(this.config.authOptions.clientId);\r\n requestScopes = __spreadArrays(request.scopes || [], request.extraScopesToConsent || []);\r\n parameterBuilder.addScopes(requestScopes);\r\n // validate the redirectUri (to be a non null value)\r\n parameterBuilder.addRedirectUri(request.redirectUri);\r\n correlationId = request.correlationId || this.config.cryptoInterface.createNewGuid();\r\n parameterBuilder.addCorrelationId(correlationId);\r\n // add response_mode. If not passed in it defaults to query.\r\n parameterBuilder.addResponseMode(request.responseMode);\r\n // add response_type = code\r\n parameterBuilder.addResponseTypeCode();\r\n // add library info parameters\r\n parameterBuilder.addLibraryInfo(this.config.libraryInfo);\r\n parameterBuilder.addApplicationTelemetry(this.config.telemetry.application);\r\n // add client_info=1\r\n parameterBuilder.addClientInfo();\r\n if (request.codeChallenge && request.codeChallengeMethod) {\r\n parameterBuilder.addCodeChallengeParams(request.codeChallenge, request.codeChallengeMethod);\r\n }\r\n if (request.prompt) {\r\n parameterBuilder.addPrompt(request.prompt);\r\n }\r\n if (request.domainHint) {\r\n parameterBuilder.addDomainHint(request.domainHint);\r\n }\r\n // Add sid or loginHint with preference for login_hint claim (in request) -> sid -> loginHint (upn/email) -> username of AccountInfo object\r\n if (request.prompt !== PromptValue.SELECT_ACCOUNT) {\r\n // AAD will throw if prompt=select_account is passed with an account hint\r\n if (request.sid && request.prompt === PromptValue.NONE) {\r\n // SessionID is only used in silent calls\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Prompt is none, adding sid from request\");\r\n parameterBuilder.addSid(request.sid);\r\n }\r\n else if (request.account) {\r\n accountSid = this.extractAccountSid(request.account);\r\n accountLoginHintClaim = this.extractLoginHint(request.account);\r\n // If login_hint claim is present, use it over sid/username\r\n if (accountLoginHintClaim) {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: login_hint claim present on account\");\r\n parameterBuilder.addLoginHint(accountLoginHintClaim);\r\n try {\r\n clientInfo = buildClientInfoFromHomeAccountId(request.account.homeAccountId);\r\n parameterBuilder.addCcsOid(clientInfo);\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Could not parse home account ID for CCS Header\");\r\n }\r\n }\r\n else if (accountSid && request.prompt === PromptValue.NONE) {\r\n /*\r\n * If account and loginHint are provided, we will check account first for sid before adding loginHint\r\n * SessionId is only used in silent calls\r\n */\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Prompt is none, adding sid from account\");\r\n parameterBuilder.addSid(accountSid);\r\n try {\r\n clientInfo = buildClientInfoFromHomeAccountId(request.account.homeAccountId);\r\n parameterBuilder.addCcsOid(clientInfo);\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Could not parse home account ID for CCS Header\");\r\n }\r\n }\r\n else if (request.loginHint) {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Adding login_hint from request\");\r\n parameterBuilder.addLoginHint(request.loginHint);\r\n parameterBuilder.addCcsUpn(request.loginHint);\r\n }\r\n else if (request.account.username) {\r\n // Fallback to account username if provided\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Adding login_hint from account\");\r\n parameterBuilder.addLoginHint(request.account.username);\r\n try {\r\n clientInfo = buildClientInfoFromHomeAccountId(request.account.homeAccountId);\r\n parameterBuilder.addCcsOid(clientInfo);\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Could not parse home account ID for CCS Header\");\r\n }\r\n }\r\n }\r\n else if (request.loginHint) {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: No account, adding login_hint from request\");\r\n parameterBuilder.addLoginHint(request.loginHint);\r\n parameterBuilder.addCcsUpn(request.loginHint);\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"createAuthCodeUrlQueryString: Prompt is select_account, ignoring account hints\");\r\n }\r\n if (request.nonce) {\r\n parameterBuilder.addNonce(request.nonce);\r\n }\r\n if (request.state) {\r\n parameterBuilder.addState(request.state);\r\n }\r\n if (!StringUtils.isEmpty(request.claims) || this.config.authOptions.clientCapabilities && this.config.authOptions.clientCapabilities.length > 0) {\r\n parameterBuilder.addClaims(request.claims, this.config.authOptions.clientCapabilities);\r\n }\r\n if (request.extraQueryParameters) {\r\n parameterBuilder.addExtraQueryParameters(request.extraQueryParameters);\r\n }\r\n if (!request.nativeBroker) return [3 /*break*/, 2];\r\n // signal ests that this is a WAM call\r\n parameterBuilder.addNativeBroker();\r\n if (!(request.authenticationScheme === AuthenticationScheme.POP)) return [3 /*break*/, 2];\r\n popTokenGenerator = new PopTokenGenerator(this.cryptoUtils);\r\n return [4 /*yield*/, popTokenGenerator.generateCnf(request)];\r\n case 1:\r\n reqCnfData = _b.sent();\r\n parameterBuilder.addPopToken(reqCnfData.reqCnfString);\r\n _b.label = 2;\r\n case 2: return [2 /*return*/, parameterBuilder.createQueryString()];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * This API validates the `EndSessionRequest` and creates a URL\r\n * @param request\r\n */\r\n AuthorizationCodeClient.prototype.createLogoutUrlQueryString = function (request) {\r\n var parameterBuilder = new RequestParameterBuilder();\r\n if (request.postLogoutRedirectUri) {\r\n parameterBuilder.addPostLogoutRedirectUri(request.postLogoutRedirectUri);\r\n }\r\n if (request.correlationId) {\r\n parameterBuilder.addCorrelationId(request.correlationId);\r\n }\r\n if (request.idTokenHint) {\r\n parameterBuilder.addIdTokenHint(request.idTokenHint);\r\n }\r\n if (request.state) {\r\n parameterBuilder.addState(request.state);\r\n }\r\n if (request.logoutHint) {\r\n parameterBuilder.addLogoutHint(request.logoutHint);\r\n }\r\n if (request.extraQueryParameters) {\r\n parameterBuilder.addExtraQueryParameters(request.extraQueryParameters);\r\n }\r\n return parameterBuilder.createQueryString();\r\n };\r\n /**\r\n * Helper to get sid from account. Returns null if idTokenClaims are not present or sid is not present.\r\n * @param account\r\n */\r\n AuthorizationCodeClient.prototype.extractAccountSid = function (account) {\r\n var _a;\r\n return ((_a = account.idTokenClaims) === null || _a === void 0 ? void 0 : _a.sid) || null;\r\n };\r\n AuthorizationCodeClient.prototype.extractLoginHint = function (account) {\r\n var _a;\r\n return ((_a = account.idTokenClaims) === null || _a === void 0 ? void 0 : _a.login_hint) || null;\r\n };\r\n return AuthorizationCodeClient;\r\n}(BaseClient));\n\nexport { AuthorizationCodeClient };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nfunction isOpenIdConfigResponse(response) {\r\n return (response.hasOwnProperty(\"authorization_endpoint\") &&\r\n response.hasOwnProperty(\"token_endpoint\") &&\r\n response.hasOwnProperty(\"issuer\") &&\r\n response.hasOwnProperty(\"jwks_uri\"));\r\n}\n\nexport { isOpenIdConfigResponse };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar rawMetdataJSON = { \"endpointMetadata\": { \"https://login.microsoftonline.com/common/\": { \"token_endpoint\": \"https://login.microsoftonline.com/common/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.microsoftonline.com/common/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.microsoftonline.com/{tenantid}/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://graph.microsoft.com/oidc/userinfo\", \"authorization_endpoint\": \"https://login.microsoftonline.com/common/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.microsoftonline.com/common/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.microsoftonline.com/common/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.microsoftonline.com/common/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"microsoftonline.com\", \"cloud_graph_host_name\": \"graph.windows.net\", \"msgraph_host\": \"graph.microsoft.com\", \"rbac_url\": \"https://pas.windows.net\" }, \"https://login.chinacloudapi.cn/common/\": { \"token_endpoint\": \"https://login.chinacloudapi.cn/common/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.chinacloudapi.cn/common/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.partner.microsoftonline.cn/{tenantid}/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://microsoftgraph.chinacloudapi.cn/oidc/userinfo\", \"authorization_endpoint\": \"https://login.chinacloudapi.cn/common/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.chinacloudapi.cn/common/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.chinacloudapi.cn/common/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.chinacloudapi.cn/common/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"partner.microsoftonline.cn\", \"cloud_graph_host_name\": \"graph.chinacloudapi.cn\", \"msgraph_host\": \"microsoftgraph.chinacloudapi.cn\", \"rbac_url\": \"https://pas.chinacloudapi.cn\" }, \"https://login.microsoftonline.us/common/\": { \"token_endpoint\": \"https://login.microsoftonline.us/common/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.microsoftonline.us/common/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.microsoftonline.us/{tenantid}/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://graph.microsoft.com/oidc/userinfo\", \"authorization_endpoint\": \"https://login.microsoftonline.us/common/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.microsoftonline.us/common/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.microsoftonline.us/common/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.microsoftonline.us/common/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"microsoftonline.us\", \"cloud_graph_host_name\": \"graph.windows.net\", \"msgraph_host\": \"graph.microsoft.com\", \"rbac_url\": \"https://pasff.usgovcloudapi.net\" }, \"https://login.microsoftonline.com/consumers/\": { \"token_endpoint\": \"https://login.microsoftonline.com/consumers/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.microsoftonline.com/consumers/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.microsoftonline.com/9188040d-6c67-4c5b-b112-36a304b66dad/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://graph.microsoft.com/oidc/userinfo\", \"authorization_endpoint\": \"https://login.microsoftonline.com/consumers/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.microsoftonline.com/consumers/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.microsoftonline.com/consumers/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.microsoftonline.com/consumers/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"microsoftonline.com\", \"cloud_graph_host_name\": \"graph.windows.net\", \"msgraph_host\": \"graph.microsoft.com\", \"rbac_url\": \"https://pas.windows.net\" }, \"https://login.chinacloudapi.cn/consumers/\": { \"token_endpoint\": \"https://login.chinacloudapi.cn/consumers/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.chinacloudapi.cn/consumers/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.partner.microsoftonline.cn/9188040d-6c67-4c5b-b112-36a304b66dad/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://microsoftgraph.chinacloudapi.cn/oidc/userinfo\", \"authorization_endpoint\": \"https://login.chinacloudapi.cn/consumers/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.chinacloudapi.cn/consumers/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.chinacloudapi.cn/consumers/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.chinacloudapi.cn/consumers/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"partner.microsoftonline.cn\", \"cloud_graph_host_name\": \"graph.chinacloudapi.cn\", \"msgraph_host\": \"microsoftgraph.chinacloudapi.cn\", \"rbac_url\": \"https://pas.chinacloudapi.cn\" }, \"https://login.microsoftonline.us/consumers/\": { \"token_endpoint\": \"https://login.microsoftonline.us/consumers/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.microsoftonline.us/consumers/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.microsoftonline.us/9188040d-6c67-4c5b-b112-36a304b66dad/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://graph.microsoft.com/oidc/userinfo\", \"authorization_endpoint\": \"https://login.microsoftonline.us/consumers/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.microsoftonline.us/consumers/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.microsoftonline.us/consumers/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.microsoftonline.us/consumers/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"microsoftonline.us\", \"cloud_graph_host_name\": \"graph.windows.net\", \"msgraph_host\": \"graph.microsoft.com\", \"rbac_url\": \"https://pasff.usgovcloudapi.net\" }, \"https://login.microsoftonline.com/organizations/\": { \"token_endpoint\": \"https://login.microsoftonline.com/organizations/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.microsoftonline.com/organizations/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.microsoftonline.com/{tenantid}/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://graph.microsoft.com/oidc/userinfo\", \"authorization_endpoint\": \"https://login.microsoftonline.com/organizations/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.microsoftonline.com/organizations/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.microsoftonline.com/organizations/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.microsoftonline.com/organizations/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"microsoftonline.com\", \"cloud_graph_host_name\": \"graph.windows.net\", \"msgraph_host\": \"graph.microsoft.com\", \"rbac_url\": \"https://pas.windows.net\" }, \"https://login.chinacloudapi.cn/organizations/\": { \"token_endpoint\": \"https://login.chinacloudapi.cn/organizations/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.chinacloudapi.cn/organizations/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.partner.microsoftonline.cn/{tenantid}/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://microsoftgraph.chinacloudapi.cn/oidc/userinfo\", \"authorization_endpoint\": \"https://login.chinacloudapi.cn/organizations/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.chinacloudapi.cn/organizations/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.chinacloudapi.cn/organizations/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.chinacloudapi.cn/organizations/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"partner.microsoftonline.cn\", \"cloud_graph_host_name\": \"graph.chinacloudapi.cn\", \"msgraph_host\": \"microsoftgraph.chinacloudapi.cn\", \"rbac_url\": \"https://pas.chinacloudapi.cn\" }, \"https://login.microsoftonline.us/organizations/\": { \"token_endpoint\": \"https://login.microsoftonline.us/organizations/oauth2/v2.0/token\", \"token_endpoint_auth_methods_supported\": [\"client_secret_post\", \"private_key_jwt\", \"client_secret_basic\"], \"jwks_uri\": \"https://login.microsoftonline.us/organizations/discovery/v2.0/keys\", \"response_modes_supported\": [\"query\", \"fragment\", \"form_post\"], \"subject_types_supported\": [\"pairwise\"], \"id_token_signing_alg_values_supported\": [\"RS256\"], \"response_types_supported\": [\"code\", \"id_token\", \"code id_token\", \"id_token token\"], \"scopes_supported\": [\"openid\", \"profile\", \"email\", \"offline_access\"], \"issuer\": \"https://login.microsoftonline.us/{tenantid}/v2.0\", \"request_uri_parameter_supported\": false, \"userinfo_endpoint\": \"https://graph.microsoft.com/oidc/userinfo\", \"authorization_endpoint\": \"https://login.microsoftonline.us/organizations/oauth2/v2.0/authorize\", \"device_authorization_endpoint\": \"https://login.microsoftonline.us/organizations/oauth2/v2.0/devicecode\", \"http_logout_supported\": true, \"frontchannel_logout_supported\": true, \"end_session_endpoint\": \"https://login.microsoftonline.us/organizations/oauth2/v2.0/logout\", \"claims_supported\": [\"sub\", \"iss\", \"cloud_instance_name\", \"cloud_instance_host_name\", \"cloud_graph_host_name\", \"msgraph_host\", \"aud\", \"exp\", \"iat\", \"auth_time\", \"acr\", \"nonce\", \"preferred_username\", \"name\", \"tid\", \"ver\", \"at_hash\", \"c_hash\", \"email\"], \"kerberos_endpoint\": \"https://login.microsoftonline.us/organizations/kerberos\", \"tenant_region_scope\": null, \"cloud_instance_name\": \"microsoftonline.us\", \"cloud_graph_host_name\": \"graph.windows.net\", \"msgraph_host\": \"graph.microsoft.com\", \"rbac_url\": \"https://pasff.usgovcloudapi.net\" } }, \"instanceDiscoveryMetadata\": { \"https://login.microsoftonline.com/common/\": { \"tenant_discovery_endpoint\": \"https://login.microsoftonline.com/common/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.chinacloudapi.cn/common/\": { \"tenant_discovery_endpoint\": \"https://login.chinacloudapi.cn/common/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.microsoftonline.us/common/\": { \"tenant_discovery_endpoint\": \"https://login.microsoftonline.us/common/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.microsoftonline.com/consumers/\": { \"tenant_discovery_endpoint\": \"https://login.microsoftonline.com/consumers/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.chinacloudapi.cn/consumers/\": { \"tenant_discovery_endpoint\": \"https://login.chinacloudapi.cn/consumers/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.microsoftonline.us/consumers/\": { \"tenant_discovery_endpoint\": \"https://login.microsoftonline.us/consumers/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.microsoftonline.com/organizations/\": { \"tenant_discovery_endpoint\": \"https://login.microsoftonline.com/organizations/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.chinacloudapi.cn/organizations/\": { \"tenant_discovery_endpoint\": \"https://login.chinacloudapi.cn/organizations/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] }, \"https://login.microsoftonline.us/organizations/\": { \"tenant_discovery_endpoint\": \"https://login.microsoftonline.us/organizations/v2.0/.well-known/openid-configuration\", \"api-version\": \"1.1\", \"metadata\": [{ \"preferred_network\": \"login.microsoftonline.com\", \"preferred_cache\": \"login.windows.net\", \"aliases\": [\"login.microsoftonline.com\", \"login.windows.net\", \"login.microsoft.com\", \"sts.windows.net\"] }, { \"preferred_network\": \"login.partner.microsoftonline.cn\", \"preferred_cache\": \"login.partner.microsoftonline.cn\", \"aliases\": [\"login.partner.microsoftonline.cn\", \"login.chinacloudapi.cn\"] }, { \"preferred_network\": \"login.microsoftonline.de\", \"preferred_cache\": \"login.microsoftonline.de\", \"aliases\": [\"login.microsoftonline.de\"] }, { \"preferred_network\": \"login.microsoftonline.us\", \"preferred_cache\": \"login.microsoftonline.us\", \"aliases\": [\"login.microsoftonline.us\", \"login.usgovcloudapi.net\"] }, { \"preferred_network\": \"login-us.microsoftonline.com\", \"preferred_cache\": \"login-us.microsoftonline.com\", \"aliases\": [\"login-us.microsoftonline.com\"] }] } } };\r\nvar EndpointMetadata = rawMetdataJSON.endpointMetadata;\r\nvar InstanceDiscoveryMetadata = rawMetdataJSON.instanceDiscoveryMetadata;\n\nexport { EndpointMetadata, InstanceDiscoveryMetadata, rawMetdataJSON };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { RegionDiscoverySources, ResponseCodes, Constants } from '../utils/Constants.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar RegionDiscovery = /** @class */ (function () {\r\n function RegionDiscovery(networkInterface, performanceClient, correlationId) {\r\n this.networkInterface = networkInterface;\r\n this.performanceClient = performanceClient;\r\n this.correlationId = correlationId;\r\n }\r\n /**\r\n * Detect the region from the application's environment.\r\n *\r\n * @returns Promise\r\n */\r\n RegionDiscovery.prototype.detectRegion = function (environmentRegion, regionDiscoveryMetadata) {\r\n var _a, _b, _c, _d;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var autodetectedRegionName, options, localIMDSVersionResponse, currentIMDSVersion, currentIMDSVersionResponse;\r\n return __generator(this, function (_e) {\r\n switch (_e.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RegionDiscoveryDetectRegion, this.correlationId);\r\n autodetectedRegionName = environmentRegion;\r\n if (!!autodetectedRegionName) return [3 /*break*/, 8];\r\n options = RegionDiscovery.IMDS_OPTIONS;\r\n _e.label = 1;\r\n case 1:\r\n _e.trys.push([1, 6, , 7]);\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.RegionDiscoveryGetRegionFromIMDS, this.correlationId);\r\n return [4 /*yield*/, this.getRegionFromIMDS(Constants.IMDS_VERSION, options)];\r\n case 2:\r\n localIMDSVersionResponse = _e.sent();\r\n if (localIMDSVersionResponse.status === ResponseCodes.httpSuccess) {\r\n autodetectedRegionName = localIMDSVersionResponse.body;\r\n regionDiscoveryMetadata.region_source = RegionDiscoverySources.IMDS;\r\n }\r\n if (!(localIMDSVersionResponse.status === ResponseCodes.httpBadRequest)) return [3 /*break*/, 5];\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.RegionDiscoveryGetCurrentVersion, this.correlationId);\r\n return [4 /*yield*/, this.getCurrentVersion(options)];\r\n case 3:\r\n currentIMDSVersion = _e.sent();\r\n if (!currentIMDSVersion) {\r\n regionDiscoveryMetadata.region_source = RegionDiscoverySources.FAILED_AUTO_DETECTION;\r\n return [2 /*return*/, null];\r\n }\r\n (_d = this.performanceClient) === null || _d === void 0 ? void 0 : _d.setPreQueueTime(PerformanceEvents.RegionDiscoveryGetRegionFromIMDS, this.correlationId);\r\n return [4 /*yield*/, this.getRegionFromIMDS(currentIMDSVersion, options)];\r\n case 4:\r\n currentIMDSVersionResponse = _e.sent();\r\n if (currentIMDSVersionResponse.status === ResponseCodes.httpSuccess) {\r\n autodetectedRegionName = currentIMDSVersionResponse.body;\r\n regionDiscoveryMetadata.region_source = RegionDiscoverySources.IMDS;\r\n }\r\n _e.label = 5;\r\n case 5: return [3 /*break*/, 7];\r\n case 6:\r\n _e.sent();\r\n regionDiscoveryMetadata.region_source = RegionDiscoverySources.FAILED_AUTO_DETECTION;\r\n return [2 /*return*/, null];\r\n case 7: return [3 /*break*/, 9];\r\n case 8:\r\n regionDiscoveryMetadata.region_source = RegionDiscoverySources.ENVIRONMENT_VARIABLE;\r\n _e.label = 9;\r\n case 9:\r\n // If no region was auto detected from the environment or from the IMDS endpoint, mark the attempt as a FAILED_AUTO_DETECTION\r\n if (!autodetectedRegionName) {\r\n regionDiscoveryMetadata.region_source = RegionDiscoverySources.FAILED_AUTO_DETECTION;\r\n }\r\n return [2 /*return*/, autodetectedRegionName || null];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Make the call to the IMDS endpoint\r\n *\r\n * @param imdsEndpointUrl\r\n * @returns Promise>\r\n */\r\n RegionDiscovery.prototype.getRegionFromIMDS = function (version, options) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_b) {\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RegionDiscoveryGetRegionFromIMDS, this.correlationId);\r\n return [2 /*return*/, this.networkInterface.sendGetRequestAsync(Constants.IMDS_ENDPOINT + \"?api-version=\" + version + \"&format=text\", options, Constants.IMDS_TIMEOUT)];\r\n });\r\n });\r\n };\r\n /**\r\n * Get the most recent version of the IMDS endpoint available\r\n *\r\n * @returns Promise\r\n */\r\n RegionDiscovery.prototype.getCurrentVersion = function (options) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var response;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RegionDiscoveryGetCurrentVersion, this.correlationId);\r\n _b.label = 1;\r\n case 1:\r\n _b.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.networkInterface.sendGetRequestAsync(Constants.IMDS_ENDPOINT + \"?format=json\", options)];\r\n case 2:\r\n response = _b.sent();\r\n // When IMDS endpoint is called without the api version query param, bad request response comes back with latest version.\r\n if (response.status === ResponseCodes.httpBadRequest && response.body && response.body[\"newest-versions\"] && response.body[\"newest-versions\"].length > 0) {\r\n return [2 /*return*/, response.body[\"newest-versions\"][0]];\r\n }\r\n return [2 /*return*/, null];\r\n case 3:\r\n _b.sent();\r\n return [2 /*return*/, null];\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n // Options for the IMDS endpoint request\r\n RegionDiscovery.IMDS_OPTIONS = {\r\n headers: {\r\n Metadata: \"true\",\r\n },\r\n };\r\n return RegionDiscovery;\r\n}());\n\nexport { RegionDiscovery };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __assign, __generator } from '../_virtual/_tslib.js';\nimport { AuthorityType } from './AuthorityType.js';\nimport { isOpenIdConfigResponse } from './OpenIdConfigResponse.js';\nimport { UrlString } from '../url/UrlString.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { Constants, AADAuthorityConstants, AuthorityMetadataSource, RegionDiscoveryOutcomes } from '../utils/Constants.js';\nimport { EndpointMetadata, InstanceDiscoveryMetadata } from './AuthorityMetadata.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { ProtocolMode } from './ProtocolMode.js';\nimport { AuthorityMetadataEntity } from '../cache/entities/AuthorityMetadataEntity.js';\nimport { AzureCloudInstance } from './AuthorityOptions.js';\nimport { isCloudInstanceDiscoveryResponse } from './CloudInstanceDiscoveryResponse.js';\nimport { isCloudInstanceDiscoveryErrorResponse } from './CloudInstanceDiscoveryErrorResponse.js';\nimport { RegionDiscovery } from './RegionDiscovery.js';\nimport { AuthError } from '../error/AuthError.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * The authority class validates the authority URIs used by the user, and retrieves the OpenID Configuration Data from the\r\n * endpoint. It will store the pertinent config data in this object for use during token calls.\r\n */\r\nvar Authority = /** @class */ (function () {\r\n function Authority(authority, networkInterface, cacheManager, authorityOptions, logger, performanceClient, correlationId) {\r\n this.canonicalAuthority = authority;\r\n this._canonicalAuthority.validateAsUri();\r\n this.networkInterface = networkInterface;\r\n this.cacheManager = cacheManager;\r\n this.authorityOptions = authorityOptions;\r\n this.regionDiscoveryMetadata = { region_used: undefined, region_source: undefined, region_outcome: undefined };\r\n this.logger = logger;\r\n this.performanceClient = performanceClient;\r\n this.correlationId = correlationId;\r\n this.regionDiscovery = new RegionDiscovery(networkInterface, this.performanceClient, this.correlationId);\r\n }\r\n /**\r\n * Get {@link AuthorityType}\r\n * @param authorityUri {@link IUri}\r\n * @private\r\n */\r\n Authority.prototype.getAuthorityType = function (authorityUri) {\r\n // CIAM auth url pattern is being standardized as: .ciamlogin.com\r\n if (authorityUri.HostNameAndPort.endsWith(Constants.CIAM_AUTH_URL)) {\r\n return AuthorityType.Ciam;\r\n }\r\n var pathSegments = authorityUri.PathSegments;\r\n if (pathSegments.length) {\r\n switch (pathSegments[0].toLowerCase()) {\r\n case Constants.ADFS:\r\n return AuthorityType.Adfs;\r\n case Constants.DSTS:\r\n return AuthorityType.Dsts;\r\n }\r\n }\r\n return AuthorityType.Default;\r\n };\r\n Object.defineProperty(Authority.prototype, \"authorityType\", {\r\n // See above for AuthorityType\r\n get: function () {\r\n return this.getAuthorityType(this.canonicalAuthorityUrlComponents);\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"protocolMode\", {\r\n /**\r\n * ProtocolMode enum representing the way endpoints are constructed.\r\n */\r\n get: function () {\r\n return this.authorityOptions.protocolMode;\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"options\", {\r\n /**\r\n * Returns authorityOptions which can be used to reinstantiate a new authority instance\r\n */\r\n get: function () {\r\n return this.authorityOptions;\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"canonicalAuthority\", {\r\n /**\r\n * A URL that is the authority set by the developer\r\n */\r\n get: function () {\r\n return this._canonicalAuthority.urlString;\r\n },\r\n /**\r\n * Sets canonical authority.\r\n */\r\n set: function (url) {\r\n this._canonicalAuthority = new UrlString(url);\r\n this._canonicalAuthority.validateAsUri();\r\n this._canonicalAuthorityUrlComponents = null;\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"canonicalAuthorityUrlComponents\", {\r\n /**\r\n * Get authority components.\r\n */\r\n get: function () {\r\n if (!this._canonicalAuthorityUrlComponents) {\r\n this._canonicalAuthorityUrlComponents = this._canonicalAuthority.getUrlComponents();\r\n }\r\n return this._canonicalAuthorityUrlComponents;\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"hostnameAndPort\", {\r\n /**\r\n * Get hostname and port i.e. login.microsoftonline.com\r\n */\r\n get: function () {\r\n return this.canonicalAuthorityUrlComponents.HostNameAndPort.toLowerCase();\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"tenant\", {\r\n /**\r\n * Get tenant for authority.\r\n */\r\n get: function () {\r\n return this.canonicalAuthorityUrlComponents.PathSegments[0];\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"authorizationEndpoint\", {\r\n /**\r\n * OAuth /authorize endpoint for requests\r\n */\r\n get: function () {\r\n if (this.discoveryComplete()) {\r\n return this.replacePath(this.metadata.authorization_endpoint);\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"tokenEndpoint\", {\r\n /**\r\n * OAuth /token endpoint for requests\r\n */\r\n get: function () {\r\n if (this.discoveryComplete()) {\r\n return this.replacePath(this.metadata.token_endpoint);\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"deviceCodeEndpoint\", {\r\n get: function () {\r\n if (this.discoveryComplete()) {\r\n return this.replacePath(this.metadata.token_endpoint.replace(\"/token\", \"/devicecode\"));\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"endSessionEndpoint\", {\r\n /**\r\n * OAuth logout endpoint for requests\r\n */\r\n get: function () {\r\n if (this.discoveryComplete()) {\r\n // ROPC policies may not have end_session_endpoint set\r\n if (!this.metadata.end_session_endpoint) {\r\n throw ClientAuthError.createLogoutNotSupportedError();\r\n }\r\n return this.replacePath(this.metadata.end_session_endpoint);\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"selfSignedJwtAudience\", {\r\n /**\r\n * OAuth issuer for requests\r\n */\r\n get: function () {\r\n if (this.discoveryComplete()) {\r\n return this.replacePath(this.metadata.issuer);\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n Object.defineProperty(Authority.prototype, \"jwksUri\", {\r\n /**\r\n * Jwks_uri for token signing keys\r\n */\r\n get: function () {\r\n if (this.discoveryComplete()) {\r\n return this.replacePath(this.metadata.jwks_uri);\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n /**\r\n * Returns a flag indicating that tenant name can be replaced in authority {@link IUri}\r\n * @param authorityUri {@link IUri}\r\n * @private\r\n */\r\n Authority.prototype.canReplaceTenant = function (authorityUri) {\r\n return authorityUri.PathSegments.length === 1\r\n && !Authority.reservedTenantDomains.has(authorityUri.PathSegments[0])\r\n && this.getAuthorityType(authorityUri) === AuthorityType.Default\r\n && this.protocolMode === ProtocolMode.AAD;\r\n };\r\n /**\r\n * Replaces tenant in url path with current tenant. Defaults to common.\r\n * @param urlString\r\n */\r\n Authority.prototype.replaceTenant = function (urlString) {\r\n return urlString.replace(/{tenant}|{tenantid}/g, this.tenant);\r\n };\r\n /**\r\n * Replaces path such as tenant or policy with the current tenant or policy.\r\n * @param urlString\r\n */\r\n Authority.prototype.replacePath = function (urlString) {\r\n var _this = this;\r\n var endpoint = urlString;\r\n var cachedAuthorityUrl = new UrlString(this.metadata.canonical_authority);\r\n var cachedAuthorityUrlComponents = cachedAuthorityUrl.getUrlComponents();\r\n var cachedAuthorityParts = cachedAuthorityUrlComponents.PathSegments;\r\n var currentAuthorityParts = this.canonicalAuthorityUrlComponents.PathSegments;\r\n currentAuthorityParts.forEach(function (currentPart, index) {\r\n var cachedPart = cachedAuthorityParts[index];\r\n if (index === 0 && _this.canReplaceTenant(cachedAuthorityUrlComponents)) {\r\n var tenantId = (new UrlString(_this.metadata.authorization_endpoint)).getUrlComponents().PathSegments[0];\r\n /**\r\n * Check if AAD canonical authority contains tenant domain name, for example \"testdomain.onmicrosoft.com\",\r\n * by comparing its first path segment to the corresponding authorization endpoint path segment, which is\r\n * always resolved with tenant id by OIDC.\r\n */\r\n if (cachedPart !== tenantId) {\r\n _this.logger.verbose(\"Replacing tenant domain name \" + cachedPart + \" with id \" + tenantId);\r\n cachedPart = tenantId;\r\n }\r\n }\r\n if (currentPart !== cachedPart) {\r\n endpoint = endpoint.replace(\"/\" + cachedPart + \"/\", \"/\" + currentPart + \"/\");\r\n }\r\n });\r\n return this.replaceTenant(endpoint);\r\n };\r\n Object.defineProperty(Authority.prototype, \"defaultOpenIdConfigurationEndpoint\", {\r\n /**\r\n * The default open id configuration endpoint for any canonical authority.\r\n */\r\n get: function () {\r\n if (this.authorityType === AuthorityType.Adfs ||\r\n this.authorityType === AuthorityType.Dsts ||\r\n this.protocolMode === ProtocolMode.OIDC) {\r\n return this.canonicalAuthority + \".well-known/openid-configuration\";\r\n }\r\n return this.canonicalAuthority + \"v2.0/.well-known/openid-configuration\";\r\n },\r\n enumerable: false,\r\n configurable: true\r\n });\r\n /**\r\n * Boolean that returns whethr or not tenant discovery has been completed.\r\n */\r\n Authority.prototype.discoveryComplete = function () {\r\n return !!this.metadata;\r\n };\r\n /**\r\n * Perform endpoint discovery to discover aliases, preferred_cache, preferred_network\r\n * and the /authorize, /token and logout endpoints.\r\n */\r\n Authority.prototype.resolveEndpointsAsync = function () {\r\n var _a, _b, _c;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var metadataEntity, cloudDiscoverySource, endpointSource, cacheKey;\r\n return __generator(this, function (_d) {\r\n switch (_d.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthorityResolveEndpointsAsync, this.correlationId);\r\n metadataEntity = this.cacheManager.getAuthorityMetadataByAlias(this.hostnameAndPort);\r\n if (!metadataEntity) {\r\n metadataEntity = new AuthorityMetadataEntity();\r\n metadataEntity.updateCanonicalAuthority(this.canonicalAuthority);\r\n }\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.AuthorityUpdateCloudDiscoveryMetadata, this.correlationId);\r\n return [4 /*yield*/, this.updateCloudDiscoveryMetadata(metadataEntity)];\r\n case 1:\r\n cloudDiscoverySource = _d.sent();\r\n this.canonicalAuthority = this.canonicalAuthority.replace(this.hostnameAndPort, metadataEntity.preferred_network);\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.AuthorityUpdateEndpointMetadata, this.correlationId);\r\n return [4 /*yield*/, this.updateEndpointMetadata(metadataEntity)];\r\n case 2:\r\n endpointSource = _d.sent();\r\n if (cloudDiscoverySource !== AuthorityMetadataSource.CACHE && endpointSource !== AuthorityMetadataSource.CACHE) {\r\n // Reset the expiration time unless both values came from a successful cache lookup\r\n metadataEntity.resetExpiresAt();\r\n metadataEntity.updateCanonicalAuthority(this.canonicalAuthority);\r\n }\r\n cacheKey = this.cacheManager.generateAuthorityMetadataCacheKey(metadataEntity.preferred_cache);\r\n this.cacheManager.setAuthorityMetadata(cacheKey, metadataEntity);\r\n this.metadata = metadataEntity;\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Update AuthorityMetadataEntity with new endpoints and return where the information came from\r\n * @param metadataEntity\r\n */\r\n Authority.prototype.updateEndpointMetadata = function (metadataEntity) {\r\n var _a, _b, _c, _d, _e, _f;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var metadata, harcodedMetadata;\r\n return __generator(this, function (_g) {\r\n switch (_g.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthorityUpdateEndpointMetadata, this.correlationId);\r\n metadata = this.getEndpointMetadataFromConfig();\r\n if (metadata) {\r\n metadataEntity.updateEndpointMetadata(metadata, false);\r\n return [2 /*return*/, AuthorityMetadataSource.CONFIG];\r\n }\r\n if (this.isAuthoritySameType(metadataEntity) && metadataEntity.endpointsFromNetwork && !metadataEntity.isExpired()) {\r\n // No need to update\r\n return [2 /*return*/, AuthorityMetadataSource.CACHE];\r\n }\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.AuthorityGetEndpointMetadataFromNetwork, this.correlationId);\r\n return [4 /*yield*/, this.getEndpointMetadataFromNetwork()];\r\n case 1:\r\n metadata = _g.sent();\r\n if (!metadata) return [3 /*break*/, 4];\r\n if (!((_c = this.authorityOptions.azureRegionConfiguration) === null || _c === void 0 ? void 0 : _c.azureRegion)) return [3 /*break*/, 3];\r\n (_d = this.performanceClient) === null || _d === void 0 ? void 0 : _d.setPreQueueTime(PerformanceEvents.AuthorityUpdateMetadataWithRegionalInformation, this.correlationId);\r\n return [4 /*yield*/, this.updateMetadataWithRegionalInformation(metadata)];\r\n case 2:\r\n metadata = _g.sent();\r\n _g.label = 3;\r\n case 3:\r\n metadataEntity.updateEndpointMetadata(metadata, true);\r\n return [2 /*return*/, AuthorityMetadataSource.NETWORK];\r\n case 4:\r\n harcodedMetadata = this.getEndpointMetadataFromHardcodedValues();\r\n if (!(harcodedMetadata && !this.authorityOptions.skipAuthorityMetadataCache)) return [3 /*break*/, 7];\r\n if (!((_e = this.authorityOptions.azureRegionConfiguration) === null || _e === void 0 ? void 0 : _e.azureRegion)) return [3 /*break*/, 6];\r\n (_f = this.performanceClient) === null || _f === void 0 ? void 0 : _f.setPreQueueTime(PerformanceEvents.AuthorityUpdateMetadataWithRegionalInformation, this.correlationId);\r\n return [4 /*yield*/, this.updateMetadataWithRegionalInformation(harcodedMetadata)];\r\n case 5:\r\n harcodedMetadata = _g.sent();\r\n _g.label = 6;\r\n case 6:\r\n metadataEntity.updateEndpointMetadata(harcodedMetadata, false);\r\n return [2 /*return*/, AuthorityMetadataSource.HARDCODED_VALUES];\r\n case 7: throw ClientAuthError.createUnableToGetOpenidConfigError(this.defaultOpenIdConfigurationEndpoint);\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Compares the number of url components after the domain to determine if the cached\r\n * authority metadata can be used for the requested authority. Protects against same domain different\r\n * authority such as login.microsoftonline.com/tenant and login.microsoftonline.com/tfp/tenant/policy\r\n * @param metadataEntity\r\n */\r\n Authority.prototype.isAuthoritySameType = function (metadataEntity) {\r\n var cachedAuthorityUrl = new UrlString(metadataEntity.canonical_authority);\r\n var cachedParts = cachedAuthorityUrl.getUrlComponents().PathSegments;\r\n return cachedParts.length === this.canonicalAuthorityUrlComponents.PathSegments.length;\r\n };\r\n /**\r\n * Parse authorityMetadata config option\r\n */\r\n Authority.prototype.getEndpointMetadataFromConfig = function () {\r\n if (this.authorityOptions.authorityMetadata) {\r\n try {\r\n return JSON.parse(this.authorityOptions.authorityMetadata);\r\n }\r\n catch (e) {\r\n throw ClientConfigurationError.createInvalidAuthorityMetadataError();\r\n }\r\n }\r\n return null;\r\n };\r\n /**\r\n * Gets OAuth endpoints from the given OpenID configuration endpoint.\r\n *\r\n * @param hasHardcodedMetadata boolean\r\n */\r\n Authority.prototype.getEndpointMetadataFromNetwork = function () {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var options, response;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthorityGetEndpointMetadataFromNetwork, this.correlationId);\r\n options = {};\r\n _b.label = 1;\r\n case 1:\r\n _b.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.networkInterface.\r\n sendGetRequestAsync(this.defaultOpenIdConfigurationEndpoint, options)];\r\n case 2:\r\n response = _b.sent();\r\n return [2 /*return*/, isOpenIdConfigResponse(response.body) ? response.body : null];\r\n case 3:\r\n _b.sent();\r\n return [2 /*return*/, null];\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Get OAuth endpoints for common authorities.\r\n */\r\n Authority.prototype.getEndpointMetadataFromHardcodedValues = function () {\r\n if (this.canonicalAuthority in EndpointMetadata) {\r\n return EndpointMetadata[this.canonicalAuthority];\r\n }\r\n return null;\r\n };\r\n /**\r\n * Update the retrieved metadata with regional information.\r\n * User selected Azure region will be used if configured.\r\n */\r\n Authority.prototype.updateMetadataWithRegionalInformation = function (metadata) {\r\n var _a, _b, _c, _d;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var userConfiguredAzureRegion, autodetectedRegionName;\r\n return __generator(this, function (_e) {\r\n switch (_e.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthorityUpdateMetadataWithRegionalInformation, this.correlationId);\r\n userConfiguredAzureRegion = (_b = this.authorityOptions.azureRegionConfiguration) === null || _b === void 0 ? void 0 : _b.azureRegion;\r\n if (!userConfiguredAzureRegion) return [3 /*break*/, 2];\r\n if (userConfiguredAzureRegion !== Constants.AZURE_REGION_AUTO_DISCOVER_FLAG) {\r\n this.regionDiscoveryMetadata.region_outcome = RegionDiscoveryOutcomes.CONFIGURED_NO_AUTO_DETECTION;\r\n this.regionDiscoveryMetadata.region_used = userConfiguredAzureRegion;\r\n return [2 /*return*/, Authority.replaceWithRegionalInformation(metadata, userConfiguredAzureRegion)];\r\n }\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.RegionDiscoveryDetectRegion, this.correlationId);\r\n return [4 /*yield*/, this.regionDiscovery.detectRegion((_d = this.authorityOptions.azureRegionConfiguration) === null || _d === void 0 ? void 0 : _d.environmentRegion, this.regionDiscoveryMetadata)];\r\n case 1:\r\n autodetectedRegionName = _e.sent();\r\n if (autodetectedRegionName) {\r\n this.regionDiscoveryMetadata.region_outcome = RegionDiscoveryOutcomes.AUTO_DETECTION_REQUESTED_SUCCESSFUL;\r\n this.regionDiscoveryMetadata.region_used = autodetectedRegionName;\r\n return [2 /*return*/, Authority.replaceWithRegionalInformation(metadata, autodetectedRegionName)];\r\n }\r\n this.regionDiscoveryMetadata.region_outcome = RegionDiscoveryOutcomes.AUTO_DETECTION_REQUESTED_FAILED;\r\n _e.label = 2;\r\n case 2: return [2 /*return*/, metadata];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Updates the AuthorityMetadataEntity with new aliases, preferred_network and preferred_cache\r\n * and returns where the information was retrieved from\r\n * @param metadataEntity\r\n * @returns AuthorityMetadataSource\r\n */\r\n Authority.prototype.updateCloudDiscoveryMetadata = function (metadataEntity) {\r\n var _a, _b;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var metadata, metadataEntityExpired, harcodedMetadata;\r\n return __generator(this, function (_c) {\r\n switch (_c.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthorityUpdateCloudDiscoveryMetadata, this.correlationId);\r\n // attempt to read metadata from the config\r\n this.logger.verbose(\"Attempting to get cloud discovery metadata in the config\");\r\n this.logger.verbosePii(\"Known Authorities: \" + (this.authorityOptions.knownAuthorities || Constants.NOT_APPLICABLE));\r\n this.logger.verbosePii(\"Authority Metadata: \" + (this.authorityOptions.authorityMetadata || Constants.NOT_APPLICABLE));\r\n this.logger.verbosePii(\"Canonical Authority: \" + (metadataEntity.canonical_authority || Constants.NOT_APPLICABLE));\r\n metadata = this.getCloudDiscoveryMetadataFromConfig();\r\n if (metadata) {\r\n this.logger.verbose(\"Found cloud discovery metadata in the config.\");\r\n metadataEntity.updateCloudDiscoveryMetadata(metadata, false);\r\n return [2 /*return*/, AuthorityMetadataSource.CONFIG];\r\n }\r\n // If the cached metadata came from config but that config was not passed to this instance, we must go to the network\r\n this.logger.verbose(\"Did not find cloud discovery metadata in the config... Attempting to get cloud discovery metadata from the cache.\");\r\n metadataEntityExpired = metadataEntity.isExpired();\r\n if (this.isAuthoritySameType(metadataEntity) && metadataEntity.aliasesFromNetwork && !metadataEntityExpired) {\r\n this.logger.verbose(\"Found metadata in the cache.\");\r\n // No need to update\r\n return [2 /*return*/, AuthorityMetadataSource.CACHE];\r\n }\r\n else if (metadataEntityExpired) {\r\n this.logger.verbose(\"The metadata entity is expired.\");\r\n }\r\n this.logger.verbose(\"Did not find cloud discovery metadata in the cache... Attempting to get cloud discovery metadata from the network.\");\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.AuthorityGetCloudDiscoveryMetadataFromNetwork, this.correlationId);\r\n return [4 /*yield*/, this.getCloudDiscoveryMetadataFromNetwork()];\r\n case 1:\r\n metadata = _c.sent();\r\n if (metadata) {\r\n this.logger.verbose(\"cloud discovery metadata was successfully returned from getCloudDiscoveryMetadataFromNetwork()\");\r\n metadataEntity.updateCloudDiscoveryMetadata(metadata, true);\r\n return [2 /*return*/, AuthorityMetadataSource.NETWORK];\r\n }\r\n this.logger.verbose(\"Did not find cloud discovery metadata from the network... Attempting to get cloud discovery metadata from hardcoded values.\");\r\n harcodedMetadata = this.getCloudDiscoveryMetadataFromHarcodedValues();\r\n if (harcodedMetadata && !this.options.skipAuthorityMetadataCache) {\r\n this.logger.verbose(\"Found cloud discovery metadata from hardcoded values.\");\r\n metadataEntity.updateCloudDiscoveryMetadata(harcodedMetadata, false);\r\n return [2 /*return*/, AuthorityMetadataSource.HARDCODED_VALUES];\r\n }\r\n // Metadata could not be obtained from the config, cache, network or hardcoded values\r\n this.logger.error(\"Did not find cloud discovery metadata from hardcoded values... Metadata could not be obtained from config, cache, network or hardcoded values. Throwing Untrusted Authority Error.\");\r\n throw ClientConfigurationError.createUntrustedAuthorityError();\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Parse cloudDiscoveryMetadata config or check knownAuthorities\r\n */\r\n Authority.prototype.getCloudDiscoveryMetadataFromConfig = function () {\r\n // CIAM does not support cloud discovery metadata\r\n if (this.authorityType === AuthorityType.Ciam) {\r\n this.logger.verbose(\"CIAM authorities do not support cloud discovery metadata, generate the aliases from authority host.\");\r\n return Authority.createCloudDiscoveryMetadataFromHost(this.hostnameAndPort);\r\n }\r\n // Check if network response was provided in config\r\n if (this.authorityOptions.cloudDiscoveryMetadata) {\r\n this.logger.verbose(\"The cloud discovery metadata has been provided as a network response, in the config.\");\r\n try {\r\n this.logger.verbose(\"Attempting to parse the cloud discovery metadata.\");\r\n var parsedResponse = JSON.parse(this.authorityOptions.cloudDiscoveryMetadata);\r\n var metadata = Authority.getCloudDiscoveryMetadataFromNetworkResponse(parsedResponse.metadata, this.hostnameAndPort);\r\n this.logger.verbose(\"Parsed the cloud discovery metadata.\");\r\n if (metadata) {\r\n this.logger.verbose(\"There is returnable metadata attached to the parsed cloud discovery metadata.\");\r\n return metadata;\r\n }\r\n else {\r\n this.logger.verbose(\"There is no metadata attached to the parsed cloud discovery metadata.\");\r\n }\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"Unable to parse the cloud discovery metadata. Throwing Invalid Cloud Discovery Metadata Error.\");\r\n throw ClientConfigurationError.createInvalidCloudDiscoveryMetadataError();\r\n }\r\n }\r\n // If cloudDiscoveryMetadata is empty or does not contain the host, check knownAuthorities\r\n if (this.isInKnownAuthorities()) {\r\n this.logger.verbose(\"The host is included in knownAuthorities. Creating new cloud discovery metadata from the host.\");\r\n return Authority.createCloudDiscoveryMetadataFromHost(this.hostnameAndPort);\r\n }\r\n return null;\r\n };\r\n /**\r\n * Called to get metadata from network if CloudDiscoveryMetadata was not populated by config\r\n *\r\n * @param hasHardcodedMetadata boolean\r\n */\r\n Authority.prototype.getCloudDiscoveryMetadataFromNetwork = function () {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var instanceDiscoveryEndpoint, options, match, response, typedResponseBody, metadata, error_1, typedError;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.AuthorityGetCloudDiscoveryMetadataFromNetwork, this.correlationId);\r\n instanceDiscoveryEndpoint = \"\" + Constants.AAD_INSTANCE_DISCOVERY_ENDPT + this.canonicalAuthority + \"oauth2/v2.0/authorize\";\r\n options = {};\r\n match = null;\r\n _b.label = 1;\r\n case 1:\r\n _b.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.networkInterface.sendGetRequestAsync(instanceDiscoveryEndpoint, options)];\r\n case 2:\r\n response = _b.sent();\r\n typedResponseBody = void 0;\r\n metadata = void 0;\r\n if (isCloudInstanceDiscoveryResponse(response.body)) {\r\n typedResponseBody = response.body;\r\n metadata = typedResponseBody.metadata;\r\n this.logger.verbosePii(\"tenant_discovery_endpoint is: \" + typedResponseBody.tenant_discovery_endpoint);\r\n }\r\n else if (isCloudInstanceDiscoveryErrorResponse(response.body)) {\r\n this.logger.warning(\"A CloudInstanceDiscoveryErrorResponse was returned. The cloud instance discovery network request's status code is: \" + response.status);\r\n typedResponseBody = response.body;\r\n if (typedResponseBody.error === Constants.INVALID_INSTANCE) {\r\n this.logger.error(\"The CloudInstanceDiscoveryErrorResponse error is invalid_instance.\");\r\n return [2 /*return*/, null];\r\n }\r\n this.logger.warning(\"The CloudInstanceDiscoveryErrorResponse error is \" + typedResponseBody.error);\r\n this.logger.warning(\"The CloudInstanceDiscoveryErrorResponse error description is \" + typedResponseBody.error_description);\r\n this.logger.warning(\"Setting the value of the CloudInstanceDiscoveryMetadata (returned from the network) to []\");\r\n metadata = [];\r\n }\r\n else {\r\n this.logger.error(\"AAD did not return a CloudInstanceDiscoveryResponse or CloudInstanceDiscoveryErrorResponse\");\r\n return [2 /*return*/, null];\r\n }\r\n this.logger.verbose(\"Attempting to find a match between the developer's authority and the CloudInstanceDiscoveryMetadata returned from the network request.\");\r\n match = Authority.getCloudDiscoveryMetadataFromNetworkResponse(metadata, this.hostnameAndPort);\r\n return [3 /*break*/, 4];\r\n case 3:\r\n error_1 = _b.sent();\r\n if (error_1 instanceof AuthError) {\r\n this.logger.error(\"There was a network error while attempting to get the cloud discovery instance metadata.\\nError: \" + error_1.errorCode + \"\\nError Description: \" + error_1.errorMessage);\r\n }\r\n else {\r\n typedError = error_1;\r\n this.logger.error(\"A non-MSALJS error was thrown while attempting to get the cloud instance discovery metadata.\\nError: \" + typedError.name + \"\\nError Description: \" + typedError.message);\r\n }\r\n return [2 /*return*/, null];\r\n case 4:\r\n // Custom Domain scenario, host is trusted because Instance Discovery call succeeded\r\n if (!match) {\r\n this.logger.warning(\"The developer's authority was not found within the CloudInstanceDiscoveryMetadata returned from the network request.\");\r\n this.logger.verbose(\"Creating custom Authority for custom domain scenario.\");\r\n match = Authority.createCloudDiscoveryMetadataFromHost(this.hostnameAndPort);\r\n }\r\n return [2 /*return*/, match];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Get cloud discovery metadata for common authorities\r\n */\r\n Authority.prototype.getCloudDiscoveryMetadataFromHarcodedValues = function () {\r\n if (this.canonicalAuthority in InstanceDiscoveryMetadata) {\r\n return InstanceDiscoveryMetadata[this.canonicalAuthority];\r\n }\r\n return null;\r\n };\r\n /**\r\n * Helper function to determine if this host is included in the knownAuthorities config option\r\n */\r\n Authority.prototype.isInKnownAuthorities = function () {\r\n var _this = this;\r\n var matches = this.authorityOptions.knownAuthorities.filter(function (authority) {\r\n return UrlString.getDomainFromUrl(authority).toLowerCase() === _this.hostnameAndPort;\r\n });\r\n return matches.length > 0;\r\n };\r\n /**\r\n * helper function to populate the authority based on azureCloudOptions\r\n * @param authorityString\r\n * @param azureCloudOptions\r\n */\r\n Authority.generateAuthority = function (authorityString, azureCloudOptions) {\r\n var authorityAzureCloudInstance;\r\n if (azureCloudOptions && azureCloudOptions.azureCloudInstance !== AzureCloudInstance.None) {\r\n var tenant = azureCloudOptions.tenant ? azureCloudOptions.tenant : Constants.DEFAULT_COMMON_TENANT;\r\n authorityAzureCloudInstance = azureCloudOptions.azureCloudInstance + \"/\" + tenant + \"/\";\r\n }\r\n return authorityAzureCloudInstance ? authorityAzureCloudInstance : authorityString;\r\n };\r\n /**\r\n * Creates cloud discovery metadata object from a given host\r\n * @param host\r\n */\r\n Authority.createCloudDiscoveryMetadataFromHost = function (host) {\r\n return {\r\n preferred_network: host,\r\n preferred_cache: host,\r\n aliases: [host]\r\n };\r\n };\r\n /**\r\n * Searches instance discovery network response for the entry that contains the host in the aliases list\r\n * @param response\r\n * @param authority\r\n */\r\n Authority.getCloudDiscoveryMetadataFromNetworkResponse = function (response, authority) {\r\n for (var i = 0; i < response.length; i++) {\r\n var metadata = response[i];\r\n if (metadata.aliases.indexOf(authority) > -1) {\r\n return metadata;\r\n }\r\n }\r\n return null;\r\n };\r\n /**\r\n * helper function to generate environment from authority object\r\n */\r\n Authority.prototype.getPreferredCache = function () {\r\n if (this.discoveryComplete()) {\r\n return this.metadata.preferred_cache;\r\n }\r\n else {\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(\"Discovery incomplete.\");\r\n }\r\n };\r\n /**\r\n * Returns whether or not the provided host is an alias of this authority instance\r\n * @param host\r\n */\r\n Authority.prototype.isAlias = function (host) {\r\n return this.metadata.aliases.indexOf(host) > -1;\r\n };\r\n /**\r\n * Checks whether the provided host is that of a public cloud authority\r\n *\r\n * @param authority string\r\n * @returns bool\r\n */\r\n Authority.isPublicCloudAuthority = function (host) {\r\n return Constants.KNOWN_PUBLIC_CLOUDS.indexOf(host) >= 0;\r\n };\r\n /**\r\n * Rebuild the authority string with the region\r\n *\r\n * @param host string\r\n * @param region string\r\n */\r\n Authority.buildRegionalAuthorityString = function (host, region, queryString) {\r\n // Create and validate a Url string object with the initial authority string\r\n var authorityUrlInstance = new UrlString(host);\r\n authorityUrlInstance.validateAsUri();\r\n var authorityUrlParts = authorityUrlInstance.getUrlComponents();\r\n var hostNameAndPort = region + \".\" + authorityUrlParts.HostNameAndPort;\r\n if (this.isPublicCloudAuthority(authorityUrlParts.HostNameAndPort)) {\r\n hostNameAndPort = region + \".\" + Constants.REGIONAL_AUTH_PUBLIC_CLOUD_SUFFIX;\r\n }\r\n // Include the query string portion of the url\r\n var url = UrlString.constructAuthorityUriFromObject(__assign(__assign({}, authorityUrlInstance.getUrlComponents()), { HostNameAndPort: hostNameAndPort })).urlString;\r\n // Add the query string if a query string was provided\r\n if (queryString)\r\n return url + \"?\" + queryString;\r\n return url;\r\n };\r\n /**\r\n * Replace the endpoints in the metadata object with their regional equivalents.\r\n *\r\n * @param metadata OpenIdConfigResponse\r\n * @param azureRegion string\r\n */\r\n Authority.replaceWithRegionalInformation = function (metadata, azureRegion) {\r\n metadata.authorization_endpoint = Authority.buildRegionalAuthorityString(metadata.authorization_endpoint, azureRegion);\r\n // TODO: Enquire on whether we should leave the query string or remove it before releasing the feature\r\n metadata.token_endpoint = Authority.buildRegionalAuthorityString(metadata.token_endpoint, azureRegion, Constants.REGIONAL_AUTH_NON_MSI_QUERY_STRING);\r\n if (metadata.end_session_endpoint) {\r\n metadata.end_session_endpoint = Authority.buildRegionalAuthorityString(metadata.end_session_endpoint, azureRegion);\r\n }\r\n return metadata;\r\n };\r\n /**\r\n * Transform CIAM_AUTHORIY as per the below rules:\r\n * If no path segments found and it is a CIAM authority (hostname ends with .ciamlogin.com), then transform it\r\n *\r\n * NOTE: The transformation path should go away once STS supports CIAM with the format: `tenantIdorDomain.ciamlogin.com`\r\n * `ciamlogin.com` can also change in the future and we should accommodate the same\r\n *\r\n * @param authority\r\n */\r\n Authority.transformCIAMAuthority = function (authority) {\r\n var ciamAuthority = authority.endsWith(Constants.FORWARD_SLASH) ? authority : \"\" + authority + Constants.FORWARD_SLASH;\r\n var authorityUrl = new UrlString(authority);\r\n var authorityUrlComponents = authorityUrl.getUrlComponents();\r\n // check if transformation is needed\r\n if (authorityUrlComponents.PathSegments.length === 0 && (authorityUrlComponents.HostNameAndPort.endsWith(Constants.CIAM_AUTH_URL))) {\r\n var tenantIdOrDomain = authorityUrlComponents.HostNameAndPort.split(\".\")[0];\r\n ciamAuthority = \"\" + ciamAuthority + tenantIdOrDomain + Constants.AAD_TENANT_DOMAIN_SUFFIX;\r\n }\r\n return ciamAuthority;\r\n };\r\n // Reserved tenant domain names that will not be replaced with tenant id\r\n Authority.reservedTenantDomains = (new Set([\r\n \"{tenant}\",\r\n \"{tenantid}\",\r\n AADAuthorityConstants.COMMON,\r\n AADAuthorityConstants.CONSUMERS,\r\n AADAuthorityConstants.ORGANIZATIONS\r\n ]));\r\n return Authority;\r\n}());\n\nexport { Authority };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nfunction isCloudInstanceDiscoveryResponse(response) {\r\n return (response.hasOwnProperty(\"tenant_discovery_endpoint\") &&\r\n response.hasOwnProperty(\"metadata\"));\r\n}\n\nexport { isCloudInstanceDiscoveryResponse };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nfunction isCloudInstanceDiscoveryErrorResponse(response) {\r\n return (response.hasOwnProperty(\"error\") &&\r\n response.hasOwnProperty(\"error_description\"));\r\n}\n\nexport { isCloudInstanceDiscoveryErrorResponse };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { Authority } from './Authority.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar AuthorityFactory = /** @class */ (function () {\r\n function AuthorityFactory() {\r\n }\r\n /**\r\n * Create an authority object of the correct type based on the url\r\n * Performs basic authority validation - checks to see if the authority is of a valid type (i.e. aad, b2c, adfs)\r\n *\r\n * Also performs endpoint discovery.\r\n *\r\n * @param authorityUri\r\n * @param networkClient\r\n * @param protocolMode\r\n */\r\n AuthorityFactory.createDiscoveredInstance = function (authorityUri, networkClient, cacheManager, authorityOptions, logger, performanceClient, correlationId) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var authorityUriFinal, acquireTokenAuthority, e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n performanceClient === null || performanceClient === void 0 ? void 0 : performanceClient.addQueueMeasurement(PerformanceEvents.AuthorityFactoryCreateDiscoveredInstance, correlationId);\r\n authorityUriFinal = Authority.transformCIAMAuthority(authorityUri);\r\n acquireTokenAuthority = AuthorityFactory.createInstance(authorityUriFinal, networkClient, cacheManager, authorityOptions, logger, performanceClient, correlationId);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n performanceClient === null || performanceClient === void 0 ? void 0 : performanceClient.setPreQueueTime(PerformanceEvents.AuthorityResolveEndpointsAsync, correlationId);\r\n return [4 /*yield*/, acquireTokenAuthority.resolveEndpointsAsync()];\r\n case 2:\r\n _a.sent();\r\n return [2 /*return*/, acquireTokenAuthority];\r\n case 3:\r\n e_1 = _a.sent();\r\n throw ClientAuthError.createEndpointDiscoveryIncompleteError(e_1);\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Create an authority object of the correct type based on the url\r\n * Performs basic authority validation - checks to see if the authority is of a valid type (i.e. aad, b2c, adfs)\r\n *\r\n * Does not perform endpoint discovery.\r\n *\r\n * @param authorityUrl\r\n * @param networkInterface\r\n * @param protocolMode\r\n */\r\n AuthorityFactory.createInstance = function (authorityUrl, networkInterface, cacheManager, authorityOptions, logger, performanceClient, correlationId) {\r\n // Throw error if authority url is empty\r\n if (StringUtils.isEmpty(authorityUrl)) {\r\n throw ClientConfigurationError.createUrlEmptyError();\r\n }\r\n return new Authority(authorityUrl, networkInterface, cacheManager, authorityOptions, logger, performanceClient, correlationId);\r\n };\r\n return AuthorityFactory;\r\n}());\n\nexport { AuthorityFactory };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { SERVER_TELEM_CONSTANTS, CacheOutcome, Constants, Separators } from '../../utils/Constants.js';\nimport { ServerTelemetryEntity } from '../../cache/entities/ServerTelemetryEntity.js';\nimport { StringUtils } from '../../utils/StringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar ServerTelemetryManager = /** @class */ (function () {\r\n function ServerTelemetryManager(telemetryRequest, cacheManager) {\r\n this.cacheOutcome = CacheOutcome.NO_CACHE_HIT;\r\n this.cacheManager = cacheManager;\r\n this.apiId = telemetryRequest.apiId;\r\n this.correlationId = telemetryRequest.correlationId;\r\n this.wrapperSKU = telemetryRequest.wrapperSKU || Constants.EMPTY_STRING;\r\n this.wrapperVer = telemetryRequest.wrapperVer || Constants.EMPTY_STRING;\r\n this.telemetryCacheKey = SERVER_TELEM_CONSTANTS.CACHE_KEY + Separators.CACHE_KEY_SEPARATOR + telemetryRequest.clientId;\r\n }\r\n /**\r\n * API to add MSER Telemetry to request\r\n */\r\n ServerTelemetryManager.prototype.generateCurrentRequestHeaderValue = function () {\r\n var request = \"\" + this.apiId + SERVER_TELEM_CONSTANTS.VALUE_SEPARATOR + this.cacheOutcome;\r\n var platformFields = [this.wrapperSKU, this.wrapperVer].join(SERVER_TELEM_CONSTANTS.VALUE_SEPARATOR);\r\n var regionDiscoveryFields = this.getRegionDiscoveryFields();\r\n var requestWithRegionDiscoveryFields = [request, regionDiscoveryFields].join(SERVER_TELEM_CONSTANTS.VALUE_SEPARATOR);\r\n return [SERVER_TELEM_CONSTANTS.SCHEMA_VERSION, requestWithRegionDiscoveryFields, platformFields].join(SERVER_TELEM_CONSTANTS.CATEGORY_SEPARATOR);\r\n };\r\n /**\r\n * API to add MSER Telemetry for the last failed request\r\n */\r\n ServerTelemetryManager.prototype.generateLastRequestHeaderValue = function () {\r\n var lastRequests = this.getLastRequests();\r\n var maxErrors = ServerTelemetryManager.maxErrorsToSend(lastRequests);\r\n var failedRequests = lastRequests.failedRequests.slice(0, 2 * maxErrors).join(SERVER_TELEM_CONSTANTS.VALUE_SEPARATOR);\r\n var errors = lastRequests.errors.slice(0, maxErrors).join(SERVER_TELEM_CONSTANTS.VALUE_SEPARATOR);\r\n var errorCount = lastRequests.errors.length;\r\n // Indicate whether this header contains all data or partial data\r\n var overflow = maxErrors < errorCount ? SERVER_TELEM_CONSTANTS.OVERFLOW_TRUE : SERVER_TELEM_CONSTANTS.OVERFLOW_FALSE;\r\n var platformFields = [errorCount, overflow].join(SERVER_TELEM_CONSTANTS.VALUE_SEPARATOR);\r\n return [SERVER_TELEM_CONSTANTS.SCHEMA_VERSION, lastRequests.cacheHits, failedRequests, errors, platformFields].join(SERVER_TELEM_CONSTANTS.CATEGORY_SEPARATOR);\r\n };\r\n /**\r\n * API to cache token failures for MSER data capture\r\n * @param error\r\n */\r\n ServerTelemetryManager.prototype.cacheFailedRequest = function (error) {\r\n var lastRequests = this.getLastRequests();\r\n if (lastRequests.errors.length >= SERVER_TELEM_CONSTANTS.MAX_CACHED_ERRORS) {\r\n // Remove a cached error to make room, first in first out\r\n lastRequests.failedRequests.shift(); // apiId\r\n lastRequests.failedRequests.shift(); // correlationId\r\n lastRequests.errors.shift();\r\n }\r\n lastRequests.failedRequests.push(this.apiId, this.correlationId);\r\n if (!StringUtils.isEmpty(error.subError)) {\r\n lastRequests.errors.push(error.subError);\r\n }\r\n else if (!StringUtils.isEmpty(error.errorCode)) {\r\n lastRequests.errors.push(error.errorCode);\r\n }\r\n else if (!!error && error.toString()) {\r\n lastRequests.errors.push(error.toString());\r\n }\r\n else {\r\n lastRequests.errors.push(SERVER_TELEM_CONSTANTS.UNKNOWN_ERROR);\r\n }\r\n this.cacheManager.setServerTelemetry(this.telemetryCacheKey, lastRequests);\r\n return;\r\n };\r\n /**\r\n * Update server telemetry cache entry by incrementing cache hit counter\r\n */\r\n ServerTelemetryManager.prototype.incrementCacheHits = function () {\r\n var lastRequests = this.getLastRequests();\r\n lastRequests.cacheHits += 1;\r\n this.cacheManager.setServerTelemetry(this.telemetryCacheKey, lastRequests);\r\n return lastRequests.cacheHits;\r\n };\r\n /**\r\n * Get the server telemetry entity from cache or initialize a new one\r\n */\r\n ServerTelemetryManager.prototype.getLastRequests = function () {\r\n var initialValue = new ServerTelemetryEntity();\r\n var lastRequests = this.cacheManager.getServerTelemetry(this.telemetryCacheKey);\r\n return lastRequests || initialValue;\r\n };\r\n /**\r\n * Remove server telemetry cache entry\r\n */\r\n ServerTelemetryManager.prototype.clearTelemetryCache = function () {\r\n var lastRequests = this.getLastRequests();\r\n var numErrorsFlushed = ServerTelemetryManager.maxErrorsToSend(lastRequests);\r\n var errorCount = lastRequests.errors.length;\r\n if (numErrorsFlushed === errorCount) {\r\n // All errors were sent on last request, clear Telemetry cache\r\n this.cacheManager.removeItem(this.telemetryCacheKey);\r\n }\r\n else {\r\n // Partial data was flushed to server, construct a new telemetry cache item with errors that were not flushed\r\n var serverTelemEntity = new ServerTelemetryEntity();\r\n serverTelemEntity.failedRequests = lastRequests.failedRequests.slice(numErrorsFlushed * 2); // failedRequests contains 2 items for each error\r\n serverTelemEntity.errors = lastRequests.errors.slice(numErrorsFlushed);\r\n this.cacheManager.setServerTelemetry(this.telemetryCacheKey, serverTelemEntity);\r\n }\r\n };\r\n /**\r\n * Returns the maximum number of errors that can be flushed to the server in the next network request\r\n * @param serverTelemetryEntity\r\n */\r\n ServerTelemetryManager.maxErrorsToSend = function (serverTelemetryEntity) {\r\n var i;\r\n var maxErrors = 0;\r\n var dataSize = 0;\r\n var errorCount = serverTelemetryEntity.errors.length;\r\n for (i = 0; i < errorCount; i++) {\r\n // failedRequests parameter contains pairs of apiId and correlationId, multiply index by 2 to preserve pairs\r\n var apiId = serverTelemetryEntity.failedRequests[2 * i] || Constants.EMPTY_STRING;\r\n var correlationId = serverTelemetryEntity.failedRequests[2 * i + 1] || Constants.EMPTY_STRING;\r\n var errorCode = serverTelemetryEntity.errors[i] || Constants.EMPTY_STRING;\r\n // Count number of characters that would be added to header, each character is 1 byte. Add 3 at the end to account for separators\r\n dataSize += apiId.toString().length + correlationId.toString().length + errorCode.length + 3;\r\n if (dataSize < SERVER_TELEM_CONSTANTS.MAX_LAST_HEADER_BYTES) {\r\n // Adding this entry to the header would still keep header size below the limit\r\n maxErrors += 1;\r\n }\r\n else {\r\n break;\r\n }\r\n }\r\n return maxErrors;\r\n };\r\n /**\r\n * Get the region discovery fields\r\n *\r\n * @returns string\r\n */\r\n ServerTelemetryManager.prototype.getRegionDiscoveryFields = function () {\r\n var regionDiscoveryFields = [];\r\n regionDiscoveryFields.push(this.regionUsed || Constants.EMPTY_STRING);\r\n regionDiscoveryFields.push(this.regionSource || Constants.EMPTY_STRING);\r\n regionDiscoveryFields.push(this.regionOutcome || Constants.EMPTY_STRING);\r\n return regionDiscoveryFields.join(\",\");\r\n };\r\n /**\r\n * Update the region discovery metadata\r\n *\r\n * @param regionDiscoveryMetadata\r\n * @returns void\r\n */\r\n ServerTelemetryManager.prototype.updateRegionDiscoveryMetadata = function (regionDiscoveryMetadata) {\r\n this.regionUsed = regionDiscoveryMetadata.region_used;\r\n this.regionSource = regionDiscoveryMetadata.region_source;\r\n this.regionOutcome = regionDiscoveryMetadata.region_outcome;\r\n };\r\n /**\r\n * Set cache outcome\r\n */\r\n ServerTelemetryManager.prototype.setCacheOutcome = function (cacheOutcome) {\r\n this.cacheOutcome = cacheOutcome;\r\n };\r\n return ServerTelemetryManager;\r\n}());\n\nexport { ServerTelemetryManager };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator, __spread, __assign } from '../_virtual/_tslib.js';\nimport { UrlString, ServerTelemetryManager, AccountEntity, AuthenticationScheme, ClientConfigurationError, StringUtils, PerformanceEvents, AuthorityFactory } from '@azure/msal-common';\nimport { version } from '../packageMetadata.js';\nimport { BrowserConstants } from '../utils/BrowserConstants.js';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar BaseInteractionClient = /** @class */ (function () {\r\n function BaseInteractionClient(config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeMessageHandler, correlationId) {\r\n this.config = config;\r\n this.browserStorage = storageImpl;\r\n this.browserCrypto = browserCrypto;\r\n this.networkClient = this.config.system.networkClient;\r\n this.eventHandler = eventHandler;\r\n this.navigationClient = navigationClient;\r\n this.nativeMessageHandler = nativeMessageHandler;\r\n this.correlationId = correlationId || this.browserCrypto.createNewGuid();\r\n this.logger = logger.clone(BrowserConstants.MSAL_SKU, version, this.correlationId);\r\n this.performanceClient = performanceClient;\r\n }\r\n BaseInteractionClient.prototype.clearCacheOnLogout = function (account) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n if (!account) return [3 /*break*/, 5];\r\n if (AccountEntity.accountInfoIsEqual(account, this.browserStorage.getActiveAccount(), false)) {\r\n this.logger.verbose(\"Setting active account to null\");\r\n this.browserStorage.setActiveAccount(null);\r\n }\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n return [4 /*yield*/, this.browserStorage.removeAccount(AccountEntity.generateAccountCacheKey(account))];\r\n case 2:\r\n _a.sent();\r\n this.logger.verbose(\"Cleared cache items belonging to the account provided in the logout request.\");\r\n return [3 /*break*/, 4];\r\n case 3:\r\n _a.sent();\r\n this.logger.error(\"Account provided in logout request was not found. Local cache unchanged.\");\r\n return [3 /*break*/, 4];\r\n case 4: return [3 /*break*/, 9];\r\n case 5:\r\n _a.trys.push([5, 8, , 9]);\r\n this.logger.verbose(\"No account provided in logout request, clearing all cache items.\", this.correlationId);\r\n // Clear all accounts and tokens\r\n return [4 /*yield*/, this.browserStorage.clear()];\r\n case 6:\r\n // Clear all accounts and tokens\r\n _a.sent();\r\n // Clear any stray keys from IndexedDB\r\n return [4 /*yield*/, this.browserCrypto.clearKeystore()];\r\n case 7:\r\n // Clear any stray keys from IndexedDB\r\n _a.sent();\r\n return [3 /*break*/, 9];\r\n case 8:\r\n _a.sent();\r\n this.logger.error(\"Attempted to clear all MSAL cache items and failed. Local cache unchanged.\");\r\n return [3 /*break*/, 9];\r\n case 9: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Initializer function for all request APIs\r\n * @param request\r\n */\r\n BaseInteractionClient.prototype.initializeBaseRequest = function (request, account) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var authority, scopes, validatedRequest, _a;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.InitializeBaseRequest, request.correlationId);\r\n this.logger.verbose(\"Initializing BaseAuthRequest\");\r\n authority = request.authority || this.config.auth.authority;\r\n if (!account) return [3 /*break*/, 2];\r\n return [4 /*yield*/, this.validateRequestAuthority(authority, account)];\r\n case 1:\r\n _b.sent();\r\n _b.label = 2;\r\n case 2:\r\n scopes = __spread(((request && request.scopes) || []));\r\n validatedRequest = __assign(__assign({}, request), { correlationId: this.correlationId, authority: authority,\r\n scopes: scopes });\r\n // Set authenticationScheme to BEARER if not explicitly set in the request\r\n if (!validatedRequest.authenticationScheme) {\r\n validatedRequest.authenticationScheme = AuthenticationScheme.BEARER;\r\n this.logger.verbose(\"Authentication Scheme wasn't explicitly set in request, defaulting to \\\"Bearer\\\" request\");\r\n }\r\n else {\r\n if (validatedRequest.authenticationScheme === AuthenticationScheme.SSH) {\r\n if (!request.sshJwk) {\r\n throw ClientConfigurationError.createMissingSshJwkError();\r\n }\r\n if (!request.sshKid) {\r\n throw ClientConfigurationError.createMissingSshKidError();\r\n }\r\n }\r\n this.logger.verbose(\"Authentication Scheme set to \\\"\" + validatedRequest.authenticationScheme + \"\\\" as configured in Auth request\");\r\n }\r\n if (!(this.config.cache.claimsBasedCachingEnabled && request.claims && !StringUtils.isEmptyObj(request.claims))) return [3 /*break*/, 4];\r\n _a = validatedRequest;\r\n return [4 /*yield*/, this.browserCrypto.hashString(request.claims)];\r\n case 3:\r\n _a.requestedClaimsHash = _b.sent();\r\n _b.label = 4;\r\n case 4: return [2 /*return*/, validatedRequest];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n *\r\n * Use to get the redirect uri configured in MSAL or null.\r\n * @param requestRedirectUri\r\n * @returns Redirect URL\r\n *\r\n */\r\n BaseInteractionClient.prototype.getRedirectUri = function (requestRedirectUri) {\r\n this.logger.verbose(\"getRedirectUri called\");\r\n var redirectUri = requestRedirectUri || this.config.auth.redirectUri || BrowserUtils.getCurrentUri();\r\n return UrlString.getAbsoluteUrl(redirectUri, BrowserUtils.getCurrentUri());\r\n };\r\n /*\r\n * If authority provided in the request does not match environment/authority specified\r\n * in the account or MSAL config, we throw an error.\r\n */\r\n BaseInteractionClient.prototype.validateRequestAuthority = function (authority, account) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var discoveredAuthority;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0: return [4 /*yield*/, this.getDiscoveredAuthority(authority)];\r\n case 1:\r\n discoveredAuthority = _a.sent();\r\n if (!discoveredAuthority.isAlias(account.environment)) {\r\n throw ClientConfigurationError.createAuthorityMismatchError();\r\n }\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n *\r\n * @param apiId\r\n * @param correlationId\r\n * @param forceRefresh\r\n */\r\n BaseInteractionClient.prototype.initializeServerTelemetryManager = function (apiId, forceRefresh) {\r\n this.logger.verbose(\"initializeServerTelemetryManager called\");\r\n var telemetryPayload = {\r\n clientId: this.config.auth.clientId,\r\n correlationId: this.correlationId,\r\n apiId: apiId,\r\n forceRefresh: forceRefresh || false,\r\n wrapperSKU: this.browserStorage.getWrapperMetadata()[0],\r\n wrapperVer: this.browserStorage.getWrapperMetadata()[1]\r\n };\r\n return new ServerTelemetryManager(telemetryPayload, this.browserStorage);\r\n };\r\n /**\r\n * Used to get a discovered version of the default authority.\r\n * @param requestAuthority\r\n * @param requestCorrelationId\r\n */\r\n BaseInteractionClient.prototype.getDiscoveredAuthority = function (requestAuthority) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var authorityOptions;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.verbose(\"getDiscoveredAuthority called\");\r\n authorityOptions = {\r\n protocolMode: this.config.auth.protocolMode,\r\n knownAuthorities: this.config.auth.knownAuthorities,\r\n cloudDiscoveryMetadata: this.config.auth.cloudDiscoveryMetadata,\r\n authorityMetadata: this.config.auth.authorityMetadata\r\n };\r\n if (!requestAuthority) return [3 /*break*/, 2];\r\n this.logger.verbose(\"Creating discovered authority with request authority\");\r\n return [4 /*yield*/, AuthorityFactory.createDiscoveredInstance(requestAuthority, this.config.system.networkClient, this.browserStorage, authorityOptions, this.logger)];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n case 2:\r\n this.logger.verbose(\"Creating discovered authority with configured authority\");\r\n return [4 /*yield*/, AuthorityFactory.createDiscoveredInstance(this.config.auth.authority, this.config.system.networkClient, this.browserStorage, authorityOptions, this.logger)];\r\n case 3: return [2 /*return*/, _a.sent()];\r\n }\r\n });\r\n });\r\n };\r\n return BaseInteractionClient;\r\n}());\n\nexport { BaseInteractionClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __assign, __generator } from '../_virtual/_tslib.js';\nimport { UrlString, Constants, PerformanceEvents, AuthorizationCodeClient, Authority, AuthorityFactory, ResponseMode, StringUtils, ProtocolUtils } from '@azure/msal-common';\nimport { BaseInteractionClient } from './BaseInteractionClient.js';\nimport { BrowserConstants } from '../utils/BrowserConstants.js';\nimport { version } from '../packageMetadata.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { BrowserProtocolUtils } from '../utils/BrowserProtocolUtils.js';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Defines the class structure and helper functions used by the \"standard\", non-brokered auth flows (popup, redirect, silent (RT), silent (iframe))\r\n */\r\nvar StandardInteractionClient = /** @class */ (function (_super) {\r\n __extends(StandardInteractionClient, _super);\r\n function StandardInteractionClient() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n /**\r\n * Generates an auth code request tied to the url request.\r\n * @param request\r\n */\r\n StandardInteractionClient.prototype.initializeAuthorizationCodeRequest = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var generatedPkceParams, authCodeRequest;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.StandardInteractionClientInitializeAuthorizationCodeRequest, request.correlationId);\r\n this.logger.verbose(\"initializeAuthorizationRequest called\", request.correlationId);\r\n return [4 /*yield*/, this.browserCrypto.generatePkceCodes()];\r\n case 1:\r\n generatedPkceParams = _a.sent();\r\n authCodeRequest = __assign(__assign({}, request), { redirectUri: request.redirectUri, code: Constants.EMPTY_STRING, codeVerifier: generatedPkceParams.verifier });\r\n request.codeChallenge = generatedPkceParams.challenge;\r\n request.codeChallengeMethod = Constants.S256_CODE_CHALLENGE_METHOD;\r\n return [2 /*return*/, authCodeRequest];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Initializer for the logout request.\r\n * @param logoutRequest\r\n */\r\n StandardInteractionClient.prototype.initializeLogoutRequest = function (logoutRequest) {\r\n this.logger.verbose(\"initializeLogoutRequest called\", logoutRequest === null || logoutRequest === void 0 ? void 0 : logoutRequest.correlationId);\r\n var validLogoutRequest = __assign({ correlationId: this.correlationId || this.browserCrypto.createNewGuid() }, logoutRequest);\r\n /**\r\n * Set logout_hint to be login_hint from ID Token Claims if present\r\n * and logoutHint attribute wasn't manually set in logout request\r\n */\r\n if (logoutRequest) {\r\n // If logoutHint isn't set and an account was passed in, try to extract logoutHint from ID Token Claims\r\n if (!logoutRequest.logoutHint) {\r\n if (logoutRequest.account) {\r\n var logoutHint = this.getLogoutHintFromIdTokenClaims(logoutRequest.account);\r\n if (logoutHint) {\r\n this.logger.verbose(\"Setting logoutHint to login_hint ID Token Claim value for the account provided\");\r\n validLogoutRequest.logoutHint = logoutHint;\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"logoutHint was not set and account was not passed into logout request, logoutHint will not be set\");\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"logoutHint has already been set in logoutRequest\");\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"logoutHint will not be set since no logout request was configured\");\r\n }\r\n /*\r\n * Only set redirect uri if logout request isn't provided or the set uri isn't null.\r\n * Otherwise, use passed uri, config, or current page.\r\n */\r\n if (!logoutRequest || logoutRequest.postLogoutRedirectUri !== null) {\r\n if (logoutRequest && logoutRequest.postLogoutRedirectUri) {\r\n this.logger.verbose(\"Setting postLogoutRedirectUri to uri set on logout request\", validLogoutRequest.correlationId);\r\n validLogoutRequest.postLogoutRedirectUri = UrlString.getAbsoluteUrl(logoutRequest.postLogoutRedirectUri, BrowserUtils.getCurrentUri());\r\n }\r\n else if (this.config.auth.postLogoutRedirectUri === null) {\r\n this.logger.verbose(\"postLogoutRedirectUri configured as null and no uri set on request, not passing post logout redirect\", validLogoutRequest.correlationId);\r\n }\r\n else if (this.config.auth.postLogoutRedirectUri) {\r\n this.logger.verbose(\"Setting postLogoutRedirectUri to configured uri\", validLogoutRequest.correlationId);\r\n validLogoutRequest.postLogoutRedirectUri = UrlString.getAbsoluteUrl(this.config.auth.postLogoutRedirectUri, BrowserUtils.getCurrentUri());\r\n }\r\n else {\r\n this.logger.verbose(\"Setting postLogoutRedirectUri to current page\", validLogoutRequest.correlationId);\r\n validLogoutRequest.postLogoutRedirectUri = UrlString.getAbsoluteUrl(BrowserUtils.getCurrentUri(), BrowserUtils.getCurrentUri());\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"postLogoutRedirectUri passed as null, not setting post logout redirect uri\", validLogoutRequest.correlationId);\r\n }\r\n return validLogoutRequest;\r\n };\r\n /**\r\n * Parses login_hint ID Token Claim out of AccountInfo object to be used as\r\n * logout_hint in end session request.\r\n * @param account\r\n */\r\n StandardInteractionClient.prototype.getLogoutHintFromIdTokenClaims = function (account) {\r\n var idTokenClaims = account.idTokenClaims;\r\n if (idTokenClaims) {\r\n if (idTokenClaims.login_hint) {\r\n return idTokenClaims.login_hint;\r\n }\r\n else {\r\n this.logger.verbose(\"The ID Token Claims tied to the provided account do not contain a login_hint claim, logoutHint will not be added to logout request\");\r\n }\r\n }\r\n else {\r\n this.logger.verbose(\"The provided account does not contain ID Token Claims, logoutHint will not be added to logout request\");\r\n }\r\n return null;\r\n };\r\n /**\r\n * Creates an Authorization Code Client with the given authority, or the default authority.\r\n * @param serverTelemetryManager\r\n * @param authorityUrl\r\n */\r\n StandardInteractionClient.prototype.createAuthCodeClient = function (serverTelemetryManager, authorityUrl, requestAzureCloudOptions) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var clientConfig;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, this.correlationId);\r\n // Create auth module.\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientGetClientConfiguration, this.correlationId);\r\n return [4 /*yield*/, this.getClientConfiguration(serverTelemetryManager, authorityUrl, requestAzureCloudOptions)];\r\n case 1:\r\n clientConfig = _a.sent();\r\n return [2 /*return*/, new AuthorizationCodeClient(clientConfig, this.performanceClient)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Creates a Client Configuration object with the given request authority, or the default authority.\r\n * @param serverTelemetryManager\r\n * @param requestAuthority\r\n * @param requestCorrelationId\r\n */\r\n StandardInteractionClient.prototype.getClientConfiguration = function (serverTelemetryManager, requestAuthority, requestAzureCloudOptions) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var discoveredAuthority, logger;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.StandardInteractionClientGetClientConfiguration, this.correlationId);\r\n this.logger.verbose(\"getClientConfiguration called\", this.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientGetDiscoveredAuthority, this.correlationId);\r\n return [4 /*yield*/, this.getDiscoveredAuthority(requestAuthority, requestAzureCloudOptions)];\r\n case 1:\r\n discoveredAuthority = _a.sent();\r\n logger = this.config.system.loggerOptions;\r\n return [2 /*return*/, {\r\n authOptions: {\r\n clientId: this.config.auth.clientId,\r\n authority: discoveredAuthority,\r\n clientCapabilities: this.config.auth.clientCapabilities\r\n },\r\n systemOptions: {\r\n tokenRenewalOffsetSeconds: this.config.system.tokenRenewalOffsetSeconds,\r\n preventCorsPreflight: true\r\n },\r\n loggerOptions: {\r\n loggerCallback: logger.loggerCallback,\r\n piiLoggingEnabled: logger.piiLoggingEnabled,\r\n logLevel: logger.logLevel,\r\n correlationId: this.correlationId\r\n },\r\n cacheOptions: {\r\n claimsBasedCachingEnabled: this.config.cache.claimsBasedCachingEnabled\r\n },\r\n cryptoInterface: this.browserCrypto,\r\n networkInterface: this.networkClient,\r\n storageInterface: this.browserStorage,\r\n serverTelemetryManager: serverTelemetryManager,\r\n libraryInfo: {\r\n sku: BrowserConstants.MSAL_SKU,\r\n version: version,\r\n cpu: Constants.EMPTY_STRING,\r\n os: Constants.EMPTY_STRING\r\n },\r\n telemetry: this.config.telemetry\r\n }];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * @param hash\r\n * @param interactionType\r\n */\r\n StandardInteractionClient.prototype.validateAndExtractStateFromHash = function (serverParams, interactionType, requestCorrelationId) {\r\n this.logger.verbose(\"validateAndExtractStateFromHash called\", requestCorrelationId);\r\n if (!serverParams.state) {\r\n throw BrowserAuthError.createHashDoesNotContainStateError();\r\n }\r\n var platformStateObj = BrowserProtocolUtils.extractBrowserRequestState(this.browserCrypto, serverParams.state);\r\n if (!platformStateObj) {\r\n throw BrowserAuthError.createUnableToParseStateError();\r\n }\r\n if (platformStateObj.interactionType !== interactionType) {\r\n throw BrowserAuthError.createStateInteractionTypeMismatchError();\r\n }\r\n this.logger.verbose(\"Returning state from hash\", requestCorrelationId);\r\n return serverParams.state;\r\n };\r\n /**\r\n * Used to get a discovered version of the default authority.\r\n * @param requestAuthority\r\n * @param requestCorrelationId\r\n */\r\n StandardInteractionClient.prototype.getDiscoveredAuthority = function (requestAuthority, requestAzureCloudOptions) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var getAuthorityMeasurement, authorityOptions, userAuthority, builtAuthority;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.StandardInteractionClientGetDiscoveredAuthority, this.correlationId);\r\n this.logger.verbose(\"getDiscoveredAuthority called\", this.correlationId);\r\n getAuthorityMeasurement = (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.startMeasurement(PerformanceEvents.StandardInteractionClientGetDiscoveredAuthority, this.correlationId);\r\n authorityOptions = {\r\n protocolMode: this.config.auth.protocolMode,\r\n knownAuthorities: this.config.auth.knownAuthorities,\r\n cloudDiscoveryMetadata: this.config.auth.cloudDiscoveryMetadata,\r\n authorityMetadata: this.config.auth.authorityMetadata,\r\n skipAuthorityMetadataCache: this.config.auth.skipAuthorityMetadataCache\r\n };\r\n userAuthority = requestAuthority ? requestAuthority : this.config.auth.authority;\r\n builtAuthority = Authority.generateAuthority(userAuthority, requestAzureCloudOptions || this.config.auth.azureCloudOptions);\r\n this.logger.verbose(\"Creating discovered authority with configured authority\", this.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.AuthorityFactoryCreateDiscoveredInstance, this.correlationId);\r\n return [4 /*yield*/, AuthorityFactory.createDiscoveredInstance(builtAuthority, this.config.system.networkClient, this.browserStorage, authorityOptions, this.logger, this.performanceClient, this.correlationId)\r\n .then(function (result) {\r\n getAuthorityMeasurement.endMeasurement({\r\n success: true,\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n getAuthorityMeasurement.endMeasurement({\r\n errorCode: error.errorCode,\r\n subErrorCode: error.subError,\r\n success: false\r\n });\r\n throw error;\r\n })];\r\n case 1: return [2 /*return*/, _b.sent()];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Helper to initialize required request parameters for interactive APIs and ssoSilent()\r\n * @param request\r\n * @param interactionType\r\n */\r\n StandardInteractionClient.prototype.initializeAuthorizationRequest = function (request, interactionType) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var redirectUri, browserState, state, validatedRequest, _a, account, legacyLoginHint;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.StandardInteractionClientInitializeAuthorizationRequest, this.correlationId);\r\n this.logger.verbose(\"initializeAuthorizationRequest called\", this.correlationId);\r\n redirectUri = this.getRedirectUri(request.redirectUri);\r\n browserState = {\r\n interactionType: interactionType\r\n };\r\n state = ProtocolUtils.setRequestState(this.browserCrypto, (request && request.state) || Constants.EMPTY_STRING, browserState);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.InitializeBaseRequest, this.correlationId);\r\n _a = [{}];\r\n return [4 /*yield*/, this.initializeBaseRequest(request)];\r\n case 1:\r\n validatedRequest = __assign.apply(void 0, [__assign.apply(void 0, _a.concat([_b.sent()])), { redirectUri: redirectUri, state: state, nonce: request.nonce || this.browserCrypto.createNewGuid(), responseMode: ResponseMode.FRAGMENT }]);\r\n account = request.account || this.browserStorage.getActiveAccount();\r\n if (account) {\r\n this.logger.verbose(\"Setting validated request account\", this.correlationId);\r\n this.logger.verbosePii(\"Setting validated request account: \" + account.homeAccountId, this.correlationId);\r\n validatedRequest.account = account;\r\n }\r\n // Check for ADAL/MSAL v1 SSO\r\n if (StringUtils.isEmpty(validatedRequest.loginHint) && !account) {\r\n legacyLoginHint = this.browserStorage.getLegacyLoginHint();\r\n if (legacyLoginHint) {\r\n validatedRequest.loginHint = legacyLoginHint;\r\n }\r\n }\r\n return [2 /*return*/, validatedRequest];\r\n }\r\n });\r\n });\r\n };\r\n return StandardInteractionClient;\r\n}(BaseInteractionClient));\n\nexport { StandardInteractionClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends } from '../_virtual/_tslib.js';\nimport { InteractionRequiredAuthError, AuthError } from '@azure/msal-common';\nimport { BrowserAuthError } from './BrowserAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar NativeStatusCode;\r\n(function (NativeStatusCode) {\r\n NativeStatusCode[\"USER_INTERACTION_REQUIRED\"] = \"USER_INTERACTION_REQUIRED\";\r\n NativeStatusCode[\"USER_CANCEL\"] = \"USER_CANCEL\";\r\n NativeStatusCode[\"NO_NETWORK\"] = \"NO_NETWORK\";\r\n NativeStatusCode[\"TRANSIENT_ERROR\"] = \"TRANSIENT_ERROR\";\r\n NativeStatusCode[\"PERSISTENT_ERROR\"] = \"PERSISTENT_ERROR\";\r\n NativeStatusCode[\"DISABLED\"] = \"DISABLED\";\r\n NativeStatusCode[\"ACCOUNT_UNAVAILABLE\"] = \"ACCOUNT_UNAVAILABLE\";\r\n})(NativeStatusCode || (NativeStatusCode = {}));\r\nvar NativeAuthErrorMessage = {\r\n extensionError: {\r\n code: \"ContentError\"\r\n },\r\n userSwitch: {\r\n code: \"user_switch\",\r\n desc: \"User attempted to switch accounts in the native broker, which is not allowed. All new accounts must sign-in through the standard web flow first, please try again.\"\r\n },\r\n tokensNotFoundInCache: {\r\n code: \"tokens_not_found_in_internal_memory_cache\",\r\n desc: \"Tokens not cached in MSAL JS internal memory, please make the WAM request\"\r\n }\r\n};\r\nvar NativeAuthError = /** @class */ (function (_super) {\r\n __extends(NativeAuthError, _super);\r\n function NativeAuthError(errorCode, description, ext) {\r\n var _this = _super.call(this, errorCode, description) || this;\r\n Object.setPrototypeOf(_this, NativeAuthError.prototype);\r\n _this.name = \"NativeAuthError\";\r\n _this.ext = ext;\r\n return _this;\r\n }\r\n /**\r\n * These errors should result in a fallback to the 'standard' browser based auth flow.\r\n */\r\n NativeAuthError.prototype.isFatal = function () {\r\n if (this.ext && this.ext.status && (this.ext.status === NativeStatusCode.PERSISTENT_ERROR || this.ext.status === NativeStatusCode.DISABLED)) {\r\n return true;\r\n }\r\n switch (this.errorCode) {\r\n case NativeAuthErrorMessage.extensionError.code:\r\n return true;\r\n default:\r\n return false;\r\n }\r\n };\r\n /**\r\n * Create the appropriate error object based on the WAM status code.\r\n * @param code\r\n * @param description\r\n * @param ext\r\n * @returns\r\n */\r\n NativeAuthError.createError = function (code, description, ext) {\r\n if (ext && ext.status) {\r\n switch (ext.status) {\r\n case NativeStatusCode.ACCOUNT_UNAVAILABLE:\r\n return InteractionRequiredAuthError.createNativeAccountUnavailableError();\r\n case NativeStatusCode.USER_INTERACTION_REQUIRED:\r\n return new InteractionRequiredAuthError(code, description);\r\n case NativeStatusCode.USER_CANCEL:\r\n return BrowserAuthError.createUserCancelledError();\r\n case NativeStatusCode.NO_NETWORK:\r\n return BrowserAuthError.createNoNetworkConnectivityError();\r\n }\r\n }\r\n return new NativeAuthError(code, description, ext);\r\n };\r\n /**\r\n * Creates user switch error when the user chooses a different account in the native broker prompt\r\n * @returns\r\n */\r\n NativeAuthError.createUserSwitchError = function () {\r\n return new NativeAuthError(NativeAuthErrorMessage.userSwitch.code, NativeAuthErrorMessage.userSwitch.desc);\r\n };\r\n /**\r\n * Creates a tokens not found error when the internal cache look up fails\r\n * @returns NativeAuthError: tokensNotFoundInCache\r\n */\r\n NativeAuthError.createTokensNotFoundInCacheError = function () {\r\n return new NativeAuthError(NativeAuthErrorMessage.tokensNotFoundInCache.code, NativeAuthErrorMessage.tokensNotFoundInCache.desc);\r\n };\r\n return NativeAuthError;\r\n}(AuthError));\n\nexport { NativeAuthError, NativeAuthErrorMessage, NativeStatusCode };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { BaseClient } from './BaseClient.js';\nimport { RequestParameterBuilder } from '../request/RequestParameterBuilder.js';\nimport { AuthenticationScheme, GrantType, HeaderNames, Errors } from '../utils/Constants.js';\nimport { ResponseHandler } from '../response/ResponseHandler.js';\nimport { PopTokenGenerator } from '../crypto/PopTokenGenerator.js';\nimport { StringUtils } from '../utils/StringUtils.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { ClientAuthError } from '../error/ClientAuthError.js';\nimport { ServerError } from '../error/ServerError.js';\nimport { TimeUtils } from '../utils/TimeUtils.js';\nimport { UrlString } from '../url/UrlString.js';\nimport { CcsCredentialType } from '../account/CcsCredential.js';\nimport { buildClientInfoFromHomeAccountId } from '../account/ClientInfo.js';\nimport { InteractionRequiredAuthError, InteractionRequiredAuthErrorMessage } from '../error/InteractionRequiredAuthError.js';\nimport { PerformanceEvents } from '../telemetry/performance/PerformanceEvent.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * OAuth2.0 refresh token client\r\n */\r\nvar RefreshTokenClient = /** @class */ (function (_super) {\r\n __extends(RefreshTokenClient, _super);\r\n function RefreshTokenClient(configuration, performanceClient) {\r\n return _super.call(this, configuration, performanceClient) || this;\r\n }\r\n RefreshTokenClient.prototype.acquireToken = function (request) {\r\n var _a, _b, _c, _d, _e, _f, _g;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var atsMeasurement, reqTimestamp, response, httpVerToken, requestId, responseHandler;\r\n var _this = this;\r\n return __generator(this, function (_h) {\r\n switch (_h.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RefreshTokenClientAcquireToken, request.correlationId);\r\n atsMeasurement = (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.startMeasurement(PerformanceEvents.RefreshTokenClientAcquireToken, request.correlationId);\r\n this.logger.verbose(\"RefreshTokenClientAcquireToken called\", request.correlationId);\r\n reqTimestamp = TimeUtils.nowSeconds();\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.RefreshTokenClientExecuteTokenRequest, request.correlationId);\r\n return [4 /*yield*/, this.executeTokenRequest(request, this.authority)];\r\n case 1:\r\n response = _h.sent();\r\n httpVerToken = (_d = response.headers) === null || _d === void 0 ? void 0 : _d[HeaderNames.X_MS_HTTP_VERSION];\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.addStaticFields({\r\n refreshTokenSize: ((_e = response.body.refresh_token) === null || _e === void 0 ? void 0 : _e.length) || 0,\r\n });\r\n if (httpVerToken) {\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.addStaticFields({\r\n httpVerToken: httpVerToken,\r\n });\r\n }\r\n requestId = (_f = response.headers) === null || _f === void 0 ? void 0 : _f[HeaderNames.X_MS_REQUEST_ID];\r\n responseHandler = new ResponseHandler(this.config.authOptions.clientId, this.cacheManager, this.cryptoUtils, this.logger, this.config.serializableCache, this.config.persistencePlugin);\r\n responseHandler.validateTokenResponse(response.body);\r\n (_g = this.performanceClient) === null || _g === void 0 ? void 0 : _g.setPreQueueTime(PerformanceEvents.HandleServerTokenResponse, request.correlationId);\r\n return [2 /*return*/, responseHandler.handleServerTokenResponse(response.body, this.authority, reqTimestamp, request, undefined, undefined, true, request.forceCache, requestId).then(function (result) {\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.endMeasurement({\r\n success: true\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n _this.logger.verbose(\"Error in fetching refresh token\", request.correlationId);\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.endMeasurement({\r\n errorCode: error.errorCode,\r\n subErrorCode: error.subError,\r\n success: false\r\n });\r\n throw error;\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Gets cached refresh token and attaches to request, then calls acquireToken API\r\n * @param request\r\n */\r\n RefreshTokenClient.prototype.acquireTokenByRefreshToken = function (request) {\r\n var _a, _b, _c, _d;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var isFOCI, noFamilyRTInCache, clientMismatchErrorWithFamilyRT;\r\n return __generator(this, function (_e) {\r\n // Cannot renew token if no request object is given.\r\n if (!request) {\r\n throw ClientConfigurationError.createEmptyTokenRequestError();\r\n }\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RefreshTokenClientAcquireTokenByRefreshToken, request.correlationId);\r\n // We currently do not support silent flow for account === null use cases; This will be revisited for confidential flow usecases\r\n if (!request.account) {\r\n throw ClientAuthError.createNoAccountInSilentRequestError();\r\n }\r\n isFOCI = this.cacheManager.isAppMetadataFOCI(request.account.environment);\r\n // if the app is part of the family, retrive a Family refresh token if present and make a refreshTokenRequest\r\n if (isFOCI) {\r\n try {\r\n (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.setPreQueueTime(PerformanceEvents.RefreshTokenClientAcquireTokenWithCachedRefreshToken, request.correlationId);\r\n return [2 /*return*/, this.acquireTokenWithCachedRefreshToken(request, true)];\r\n }\r\n catch (e) {\r\n noFamilyRTInCache = e instanceof InteractionRequiredAuthError && e.errorCode === InteractionRequiredAuthErrorMessage.noTokensFoundError.code;\r\n clientMismatchErrorWithFamilyRT = e instanceof ServerError && e.errorCode === Errors.INVALID_GRANT_ERROR && e.subError === Errors.CLIENT_MISMATCH_ERROR;\r\n // if family Refresh Token (FRT) cache acquisition fails or if client_mismatch error is seen with FRT, reattempt with application Refresh Token (ART)\r\n if (noFamilyRTInCache || clientMismatchErrorWithFamilyRT) {\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.RefreshTokenClientAcquireTokenWithCachedRefreshToken, request.correlationId);\r\n return [2 /*return*/, this.acquireTokenWithCachedRefreshToken(request, false)];\r\n // throw in all other cases\r\n }\r\n else {\r\n throw e;\r\n }\r\n }\r\n }\r\n // fall back to application refresh token acquisition\r\n (_d = this.performanceClient) === null || _d === void 0 ? void 0 : _d.setPreQueueTime(PerformanceEvents.RefreshTokenClientAcquireTokenWithCachedRefreshToken, request.correlationId);\r\n return [2 /*return*/, this.acquireTokenWithCachedRefreshToken(request, false)];\r\n });\r\n });\r\n };\r\n /**\r\n * makes a network call to acquire tokens by exchanging RefreshToken available in userCache; throws if refresh token is not cached\r\n * @param request\r\n */\r\n RefreshTokenClient.prototype.acquireTokenWithCachedRefreshToken = function (request, foci) {\r\n var _a, _b, _c;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var atsMeasurement, refreshToken, refreshTokenRequest;\r\n return __generator(this, function (_d) {\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RefreshTokenClientAcquireTokenWithCachedRefreshToken, request.correlationId);\r\n atsMeasurement = (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.startMeasurement(PerformanceEvents.RefreshTokenClientAcquireTokenWithCachedRefreshToken, request.correlationId);\r\n this.logger.verbose(\"RefreshTokenClientAcquireTokenWithCachedRefreshToken called\", request.correlationId);\r\n refreshToken = this.cacheManager.getRefreshToken(request.account, foci);\r\n if (!refreshToken) {\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.discardMeasurement();\r\n throw InteractionRequiredAuthError.createNoTokensFoundError();\r\n }\r\n // attach cached RT size to the current measurement\r\n atsMeasurement === null || atsMeasurement === void 0 ? void 0 : atsMeasurement.endMeasurement({\r\n success: true\r\n });\r\n refreshTokenRequest = __assign(__assign({}, request), { refreshToken: refreshToken.secret, authenticationScheme: request.authenticationScheme || AuthenticationScheme.BEARER, ccsCredential: {\r\n credential: request.account.homeAccountId,\r\n type: CcsCredentialType.HOME_ACCOUNT_ID\r\n } });\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.RefreshTokenClientAcquireToken, request.correlationId);\r\n return [2 /*return*/, this.acquireToken(refreshTokenRequest)];\r\n });\r\n });\r\n };\r\n /**\r\n * Constructs the network message and makes a NW call to the underlying secure token service\r\n * @param request\r\n * @param authority\r\n */\r\n RefreshTokenClient.prototype.executeTokenRequest = function (request, authority) {\r\n var _a, _b, _c;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var acquireTokenMeasurement, queryParametersString, endpoint, requestBody, headers, thumbprint;\r\n return __generator(this, function (_d) {\r\n switch (_d.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RefreshTokenClientExecuteTokenRequest, request.correlationId);\r\n acquireTokenMeasurement = (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.startMeasurement(PerformanceEvents.RefreshTokenClientExecuteTokenRequest, request.correlationId);\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.RefreshTokenClientCreateTokenRequestBody, request.correlationId);\r\n queryParametersString = this.createTokenQueryParameters(request);\r\n endpoint = UrlString.appendQueryString(authority.tokenEndpoint, queryParametersString);\r\n return [4 /*yield*/, this.createTokenRequestBody(request)];\r\n case 1:\r\n requestBody = _d.sent();\r\n headers = this.createTokenRequestHeaders(request.ccsCredential);\r\n thumbprint = {\r\n clientId: this.config.authOptions.clientId,\r\n authority: authority.canonicalAuthority,\r\n scopes: request.scopes,\r\n claims: request.claims,\r\n authenticationScheme: request.authenticationScheme,\r\n resourceRequestMethod: request.resourceRequestMethod,\r\n resourceRequestUri: request.resourceRequestUri,\r\n shrClaims: request.shrClaims,\r\n sshKid: request.sshKid\r\n };\r\n return [2 /*return*/, this.executePostToTokenEndpoint(endpoint, requestBody, headers, thumbprint)\r\n .then(function (result) {\r\n acquireTokenMeasurement === null || acquireTokenMeasurement === void 0 ? void 0 : acquireTokenMeasurement.endMeasurement({\r\n success: true\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n acquireTokenMeasurement === null || acquireTokenMeasurement === void 0 ? void 0 : acquireTokenMeasurement.endMeasurement({\r\n success: false\r\n });\r\n throw error;\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Helper function to create the token request body\r\n * @param request\r\n */\r\n RefreshTokenClient.prototype.createTokenRequestBody = function (request) {\r\n var _a, _b, _c;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId, acquireTokenMeasurement, parameterBuilder, clientAssertion, popTokenGenerator, reqCnfData, clientInfo;\r\n return __generator(this, function (_d) {\r\n switch (_d.label) {\r\n case 0:\r\n (_a = this.performanceClient) === null || _a === void 0 ? void 0 : _a.addQueueMeasurement(PerformanceEvents.RefreshTokenClientCreateTokenRequestBody, request.correlationId);\r\n correlationId = request.correlationId;\r\n acquireTokenMeasurement = (_b = this.performanceClient) === null || _b === void 0 ? void 0 : _b.startMeasurement(PerformanceEvents.BaseClientCreateTokenRequestHeaders, correlationId);\r\n parameterBuilder = new RequestParameterBuilder();\r\n parameterBuilder.addClientId(this.config.authOptions.clientId);\r\n parameterBuilder.addScopes(request.scopes);\r\n parameterBuilder.addGrantType(GrantType.REFRESH_TOKEN_GRANT);\r\n parameterBuilder.addClientInfo();\r\n parameterBuilder.addLibraryInfo(this.config.libraryInfo);\r\n parameterBuilder.addApplicationTelemetry(this.config.telemetry.application);\r\n parameterBuilder.addThrottling();\r\n if (this.serverTelemetryManager) {\r\n parameterBuilder.addServerTelemetry(this.serverTelemetryManager);\r\n }\r\n parameterBuilder.addCorrelationId(correlationId);\r\n parameterBuilder.addRefreshToken(request.refreshToken);\r\n if (this.config.clientCredentials.clientSecret) {\r\n parameterBuilder.addClientSecret(this.config.clientCredentials.clientSecret);\r\n }\r\n if (this.config.clientCredentials.clientAssertion) {\r\n clientAssertion = this.config.clientCredentials.clientAssertion;\r\n parameterBuilder.addClientAssertion(clientAssertion.assertion);\r\n parameterBuilder.addClientAssertionType(clientAssertion.assertionType);\r\n }\r\n if (!(request.authenticationScheme === AuthenticationScheme.POP)) return [3 /*break*/, 2];\r\n popTokenGenerator = new PopTokenGenerator(this.cryptoUtils, this.performanceClient);\r\n (_c = this.performanceClient) === null || _c === void 0 ? void 0 : _c.setPreQueueTime(PerformanceEvents.PopTokenGenerateCnf, request.correlationId);\r\n return [4 /*yield*/, popTokenGenerator.generateCnf(request)];\r\n case 1:\r\n reqCnfData = _d.sent();\r\n // SPA PoP requires full Base64Url encoded req_cnf string (unhashed)\r\n parameterBuilder.addPopToken(reqCnfData.reqCnfString);\r\n return [3 /*break*/, 3];\r\n case 2:\r\n if (request.authenticationScheme === AuthenticationScheme.SSH) {\r\n if (request.sshJwk) {\r\n parameterBuilder.addSshJwk(request.sshJwk);\r\n }\r\n else {\r\n acquireTokenMeasurement === null || acquireTokenMeasurement === void 0 ? void 0 : acquireTokenMeasurement.endMeasurement({\r\n success: false\r\n });\r\n throw ClientConfigurationError.createMissingSshJwkError();\r\n }\r\n }\r\n _d.label = 3;\r\n case 3:\r\n if (!StringUtils.isEmptyObj(request.claims) || this.config.authOptions.clientCapabilities && this.config.authOptions.clientCapabilities.length > 0) {\r\n parameterBuilder.addClaims(request.claims, this.config.authOptions.clientCapabilities);\r\n }\r\n if (this.config.systemOptions.preventCorsPreflight && request.ccsCredential) {\r\n switch (request.ccsCredential.type) {\r\n case CcsCredentialType.HOME_ACCOUNT_ID:\r\n try {\r\n clientInfo = buildClientInfoFromHomeAccountId(request.ccsCredential.credential);\r\n parameterBuilder.addCcsOid(clientInfo);\r\n }\r\n catch (e) {\r\n this.logger.verbose(\"Could not parse home account ID for CCS Header: \" + e);\r\n }\r\n break;\r\n case CcsCredentialType.UPN:\r\n parameterBuilder.addCcsUpn(request.ccsCredential.credential);\r\n break;\r\n }\r\n }\r\n acquireTokenMeasurement === null || acquireTokenMeasurement === void 0 ? void 0 : acquireTokenMeasurement.endMeasurement({\r\n success: true\r\n });\r\n return [2 /*return*/, parameterBuilder.createQueryString()];\r\n }\r\n });\r\n });\r\n };\r\n return RefreshTokenClient;\r\n}(BaseClient));\n\nexport { RefreshTokenClient };\n","/*! @azure/msal-common v13.3.3 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { BaseClient } from './BaseClient.js';\nimport { AuthToken } from '../account/AuthToken.js';\nimport { TimeUtils } from '../utils/TimeUtils.js';\nimport { RefreshTokenClient } from './RefreshTokenClient.js';\nimport { ClientAuthError, ClientAuthErrorMessage } from '../error/ClientAuthError.js';\nimport { ClientConfigurationError } from '../error/ClientConfigurationError.js';\nimport { ResponseHandler } from '../response/ResponseHandler.js';\nimport { CacheOutcome } from '../utils/Constants.js';\nimport { StringUtils } from '../utils/StringUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar SilentFlowClient = /** @class */ (function (_super) {\r\n __extends(SilentFlowClient, _super);\r\n function SilentFlowClient(configuration, performanceClient) {\r\n return _super.call(this, configuration, performanceClient) || this;\r\n }\r\n /**\r\n * Retrieves a token from cache if it is still valid, or uses the cached refresh token to renew\r\n * the given token and returns the renewed token\r\n * @param request\r\n */\r\n SilentFlowClient.prototype.acquireToken = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var e_1, refreshTokenClient;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n _a.trys.push([0, 2, , 3]);\r\n return [4 /*yield*/, this.acquireCachedToken(request)];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n case 2:\r\n e_1 = _a.sent();\r\n if (e_1 instanceof ClientAuthError && e_1.errorCode === ClientAuthErrorMessage.tokenRefreshRequired.code) {\r\n refreshTokenClient = new RefreshTokenClient(this.config, this.performanceClient);\r\n return [2 /*return*/, refreshTokenClient.acquireTokenByRefreshToken(request)];\r\n }\r\n else {\r\n throw e_1;\r\n }\r\n case 3: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Retrieves token from cache or throws an error if it must be refreshed.\r\n * @param request\r\n */\r\n SilentFlowClient.prototype.acquireCachedToken = function (request) {\r\n var _a, _b, _c, _d, _e;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var environment, cacheRecord;\r\n return __generator(this, function (_f) {\r\n switch (_f.label) {\r\n case 0:\r\n // Cannot renew token if no request object is given.\r\n if (!request) {\r\n throw ClientConfigurationError.createEmptyTokenRequestError();\r\n }\r\n if (request.forceRefresh) {\r\n // Must refresh due to present force_refresh flag.\r\n (_a = this.serverTelemetryManager) === null || _a === void 0 ? void 0 : _a.setCacheOutcome(CacheOutcome.FORCE_REFRESH);\r\n this.logger.info(\"SilentFlowClient:acquireCachedToken - Skipping cache because forceRefresh is true.\");\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n else if (!this.config.cacheOptions.claimsBasedCachingEnabled && !StringUtils.isEmptyObj(request.claims)) {\r\n // Must refresh due to presence of claims in request preventing cache lookup\r\n (_b = this.serverTelemetryManager) === null || _b === void 0 ? void 0 : _b.setCacheOutcome(CacheOutcome.CLAIMS_REQUESTED_CACHE_SKIPPED);\r\n this.logger.info(\"SilentFlowClient:acquireCachedToken - Skipping cache because claims-based caching is disabled and claims were requested.\");\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n // We currently do not support silent flow for account === null use cases; This will be revisited for confidential flow usecases\r\n if (!request.account) {\r\n throw ClientAuthError.createNoAccountInSilentRequestError();\r\n }\r\n environment = request.authority || this.authority.getPreferredCache();\r\n cacheRecord = this.cacheManager.readCacheRecord(request.account, request, environment);\r\n if (!cacheRecord.accessToken) {\r\n // Must refresh due to non-existent access_token.\r\n (_c = this.serverTelemetryManager) === null || _c === void 0 ? void 0 : _c.setCacheOutcome(CacheOutcome.NO_CACHED_ACCESS_TOKEN);\r\n this.logger.info(\"SilentFlowClient:acquireCachedToken - No access token found in cache for the given properties.\");\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n else if (TimeUtils.wasClockTurnedBack(cacheRecord.accessToken.cachedAt) ||\r\n TimeUtils.isTokenExpired(cacheRecord.accessToken.expiresOn, this.config.systemOptions.tokenRenewalOffsetSeconds)) {\r\n // Must refresh due to expired access_token.\r\n (_d = this.serverTelemetryManager) === null || _d === void 0 ? void 0 : _d.setCacheOutcome(CacheOutcome.CACHED_ACCESS_TOKEN_EXPIRED);\r\n this.logger.info(\"SilentFlowClient:acquireCachedToken - Cached access token is expired or will expire within \" + this.config.systemOptions.tokenRenewalOffsetSeconds + \" seconds.\");\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n else if (cacheRecord.accessToken.refreshOn && TimeUtils.isTokenExpired(cacheRecord.accessToken.refreshOn, 0)) {\r\n // Must refresh due to the refresh_in value.\r\n (_e = this.serverTelemetryManager) === null || _e === void 0 ? void 0 : _e.setCacheOutcome(CacheOutcome.REFRESH_CACHED_ACCESS_TOKEN);\r\n this.logger.info(\"SilentFlowClient:acquireCachedToken - Cached access token's refreshOn property has been exceeded'.\");\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n if (this.config.serverTelemetryManager) {\r\n this.config.serverTelemetryManager.incrementCacheHits();\r\n }\r\n return [4 /*yield*/, this.generateResultFromCacheRecord(cacheRecord, request)];\r\n case 1: return [2 /*return*/, _f.sent()];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Helper function to build response object from the CacheRecord\r\n * @param cacheRecord\r\n */\r\n SilentFlowClient.prototype.generateResultFromCacheRecord = function (cacheRecord, request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var idTokenObj, authTime;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n if (cacheRecord.idToken) {\r\n idTokenObj = new AuthToken(cacheRecord.idToken.secret, this.config.cryptoInterface);\r\n }\r\n // token max_age check\r\n if (request.maxAge || (request.maxAge === 0)) {\r\n authTime = idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.auth_time;\r\n if (!authTime) {\r\n throw ClientAuthError.createAuthTimeNotFoundError();\r\n }\r\n AuthToken.checkMaxAge(authTime, request.maxAge);\r\n }\r\n return [4 /*yield*/, ResponseHandler.generateAuthenticationResult(this.cryptoUtils, this.authority, cacheRecord, true, request, idTokenObj)];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n }\r\n });\r\n });\r\n };\r\n return SilentFlowClient;\r\n}(BaseClient));\n\nexport { SilentFlowClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { StandardInteractionClient } from './StandardInteractionClient.js';\nimport { AuthError, PerformanceEvents, SilentFlowClient } from '@azure/msal-common';\nimport { ApiId } from '../utils/BrowserConstants.js';\nimport { BrowserAuthError, BrowserAuthErrorMessage } from '../error/BrowserAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar SilentCacheClient = /** @class */ (function (_super) {\r\n __extends(SilentCacheClient, _super);\r\n function SilentCacheClient() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n /**\r\n * Returns unexpired tokens from the cache, if available\r\n * @param silentRequest\r\n */\r\n SilentCacheClient.prototype.acquireToken = function (silentRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var acquireTokenMeasurement, serverTelemetryManager, silentAuthClient, cachedToken, error_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n acquireTokenMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.SilentCacheClientAcquireToken, silentRequest.correlationId);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.acquireTokenSilent_silentFlow);\r\n return [4 /*yield*/, this.createSilentFlowClient(serverTelemetryManager, silentRequest.authority, silentRequest.azureCloudOptions)];\r\n case 1:\r\n silentAuthClient = _a.sent();\r\n this.logger.verbose(\"Silent auth client created\");\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 4, , 5]);\r\n return [4 /*yield*/, silentAuthClient.acquireCachedToken(silentRequest)];\r\n case 3:\r\n cachedToken = _a.sent();\r\n acquireTokenMeasurement.endMeasurement({\r\n success: true,\r\n fromCache: true\r\n });\r\n return [2 /*return*/, cachedToken];\r\n case 4:\r\n error_1 = _a.sent();\r\n if (error_1 instanceof BrowserAuthError && error_1.errorCode === BrowserAuthErrorMessage.signingKeyNotFoundInStorage.code) {\r\n this.logger.verbose(\"Signing keypair for bound access token not found. Refreshing bound access token and generating a new crypto keypair.\");\r\n }\r\n acquireTokenMeasurement.endMeasurement({\r\n errorCode: error_1 instanceof AuthError && error_1.errorCode || undefined,\r\n subErrorCode: error_1 instanceof AuthError && error_1.subError || undefined,\r\n success: false\r\n });\r\n throw error_1;\r\n case 5: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Currently Unsupported\r\n */\r\n SilentCacheClient.prototype.logout = function () {\r\n // Synchronous so we must reject\r\n return Promise.reject(BrowserAuthError.createSilentLogoutUnsupportedError());\r\n };\r\n /**\r\n * Creates an Silent Flow Client with the given authority, or the default authority.\r\n * @param serverTelemetryManager\r\n * @param authorityUrl\r\n */\r\n SilentCacheClient.prototype.createSilentFlowClient = function (serverTelemetryManager, authorityUrl, azureCloudOptions) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var clientConfig;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n // Create auth module.\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientGetClientConfiguration, this.correlationId);\r\n return [4 /*yield*/, this.getClientConfiguration(serverTelemetryManager, authorityUrl, azureCloudOptions)];\r\n case 1:\r\n clientConfig = _a.sent();\r\n return [2 /*return*/, new SilentFlowClient(clientConfig, this.performanceClient)];\r\n }\r\n });\r\n });\r\n };\r\n SilentCacheClient.prototype.initializeSilentRequest = function (request, account) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var _a;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.InitializeSilentRequest, this.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.InitializeBaseRequest, this.correlationId);\r\n _a = [__assign({}, request)];\r\n return [4 /*yield*/, this.initializeBaseRequest(request, account)];\r\n case 1: return [2 /*return*/, __assign.apply(void 0, [__assign.apply(void 0, _a.concat([_b.sent()])), { account: account, forceRefresh: request.forceRefresh || false }])];\r\n }\r\n });\r\n });\r\n };\r\n return SilentCacheClient;\r\n}(StandardInteractionClient));\n\nexport { SilentCacheClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign, __rest } from '../_virtual/_tslib.js';\nimport { ScopeSet, AuthToken, Constants, AccountEntity, AuthorityType, IdTokenEntity, AccessTokenEntity, CacheRecord, AuthenticationScheme, PerformanceEvents, TimeUtils, ClientAuthError, PopTokenGenerator, UrlString, OIDC_DEFAULT_SCOPES, PromptValue } from '@azure/msal-common';\nimport { BaseInteractionClient } from './BaseInteractionClient.js';\nimport { TemporaryCacheKeys, NativeExtensionMethod, NativeConstants, ApiId } from '../utils/BrowserConstants.js';\nimport { NativeAuthError } from '../error/NativeAuthError.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { SilentCacheClient } from './SilentCacheClient.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar NativeInteractionClient = /** @class */ (function (_super) {\r\n __extends(NativeInteractionClient, _super);\r\n function NativeInteractionClient(config, browserStorage, browserCrypto, logger, eventHandler, navigationClient, apiId, performanceClient, provider, accountId, nativeStorageImpl, correlationId) {\r\n var _this = _super.call(this, config, browserStorage, browserCrypto, logger, eventHandler, navigationClient, performanceClient, provider, correlationId) || this;\r\n _this.apiId = apiId;\r\n _this.accountId = accountId;\r\n _this.nativeMessageHandler = provider;\r\n _this.nativeStorageManager = nativeStorageImpl;\r\n _this.silentCacheClient = new SilentCacheClient(config, _this.nativeStorageManager, browserCrypto, logger, eventHandler, navigationClient, performanceClient, provider, correlationId);\r\n return _this;\r\n }\r\n /**\r\n * Acquire token from native platform via browser extension\r\n * @param request\r\n */\r\n NativeInteractionClient.prototype.acquireToken = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var nativeATMeasurement, reqTimestamp, nativeRequest, result, messageBody, response, validatedResponse;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"NativeInteractionClient - acquireToken called.\");\r\n nativeATMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.NativeInteractionClientAcquireToken, request.correlationId);\r\n reqTimestamp = TimeUtils.nowSeconds();\r\n return [4 /*yield*/, this.initializeNativeRequest(request)];\r\n case 1:\r\n nativeRequest = _a.sent();\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 4, , 5]);\r\n return [4 /*yield*/, this.acquireTokensFromCache(this.accountId, nativeRequest)];\r\n case 3:\r\n result = _a.sent();\r\n nativeATMeasurement.endMeasurement({\r\n success: true,\r\n isNativeBroker: false,\r\n fromCache: true\r\n });\r\n return [2 /*return*/, result];\r\n case 4:\r\n _a.sent();\r\n // continue with a native call for any and all errors\r\n this.logger.info(\"MSAL internal Cache does not contain tokens, proceed to make a native call\");\r\n return [3 /*break*/, 5];\r\n case 5:\r\n messageBody = {\r\n method: NativeExtensionMethod.GetToken,\r\n request: nativeRequest\r\n };\r\n return [4 /*yield*/, this.nativeMessageHandler.sendMessage(messageBody)];\r\n case 6:\r\n response = _a.sent();\r\n validatedResponse = this.validateNativeResponse(response);\r\n return [2 /*return*/, this.handleNativeResponse(validatedResponse, nativeRequest, reqTimestamp)\r\n .then(function (result) {\r\n nativeATMeasurement.endMeasurement({\r\n success: true,\r\n isNativeBroker: true,\r\n requestId: result.requestId\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n nativeATMeasurement.endMeasurement({\r\n success: false,\r\n errorCode: error.errorCode,\r\n subErrorCode: error.subError,\r\n isNativeBroker: true\r\n });\r\n throw error;\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Creates silent flow request\r\n * @param request\r\n * @param cachedAccount\r\n * @returns CommonSilentFlowRequest\r\n */\r\n NativeInteractionClient.prototype.createSilentCacheRequest = function (request, cachedAccount) {\r\n return {\r\n authority: request.authority,\r\n correlationId: this.correlationId,\r\n scopes: ScopeSet.fromString(request.scope).asArray(),\r\n account: cachedAccount,\r\n forceRefresh: false,\r\n };\r\n };\r\n /**\r\n * Fetches the tokens from the cache if un-expired\r\n * @param nativeAccountId\r\n * @param request\r\n * @returns authenticationResult\r\n */\r\n NativeInteractionClient.prototype.acquireTokensFromCache = function (nativeAccountId, request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var account, silentRequest, result, fullAccount, e_2;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n if (!nativeAccountId) {\r\n this.logger.warning(\"NativeInteractionClient:acquireTokensFromCache - No nativeAccountId provided\");\r\n throw ClientAuthError.createNoAccountFoundError();\r\n }\r\n account = this.browserStorage.getAccountInfoFilteredBy({ nativeAccountId: nativeAccountId });\r\n if (!account) {\r\n throw ClientAuthError.createNoAccountFoundError();\r\n }\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n silentRequest = this.createSilentCacheRequest(request, account);\r\n return [4 /*yield*/, this.silentCacheClient.acquireToken(silentRequest)];\r\n case 2:\r\n result = _a.sent();\r\n fullAccount = __assign(__assign({}, account), { idTokenClaims: result.idTokenClaims });\r\n return [2 /*return*/, __assign(__assign({}, result), { account: fullAccount })];\r\n case 3:\r\n e_2 = _a.sent();\r\n throw e_2;\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Acquires a token from native platform then redirects to the redirectUri instead of returning the response\r\n * @param request\r\n */\r\n NativeInteractionClient.prototype.acquireTokenRedirect = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var nativeRequest, messageBody, response, e_3, navigationOptions, redirectUri;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"NativeInteractionClient - acquireTokenRedirect called.\");\r\n return [4 /*yield*/, this.initializeNativeRequest(request)];\r\n case 1:\r\n nativeRequest = _a.sent();\r\n messageBody = {\r\n method: NativeExtensionMethod.GetToken,\r\n request: nativeRequest\r\n };\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 4, , 5]);\r\n return [4 /*yield*/, this.nativeMessageHandler.sendMessage(messageBody)];\r\n case 3:\r\n response = _a.sent();\r\n this.validateNativeResponse(response);\r\n return [3 /*break*/, 5];\r\n case 4:\r\n e_3 = _a.sent();\r\n // Only throw fatal errors here to allow application to fallback to regular redirect. Otherwise proceed and the error will be thrown in handleRedirectPromise\r\n if (e_3 instanceof NativeAuthError && e_3.isFatal()) {\r\n throw e_3;\r\n }\r\n return [3 /*break*/, 5];\r\n case 5:\r\n this.browserStorage.setTemporaryCache(TemporaryCacheKeys.NATIVE_REQUEST, JSON.stringify(nativeRequest), true);\r\n navigationOptions = {\r\n apiId: ApiId.acquireTokenRedirect,\r\n timeout: this.config.system.redirectNavigationTimeout,\r\n noHistory: false\r\n };\r\n redirectUri = this.config.auth.navigateToLoginRequestUrl ? window.location.href : this.getRedirectUri(request.redirectUri);\r\n return [4 /*yield*/, this.navigationClient.navigateExternal(redirectUri, navigationOptions)];\r\n case 6:\r\n _a.sent(); // Need to treat this as external to ensure handleRedirectPromise is run again\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * If the previous page called native platform for a token using redirect APIs, send the same request again and return the response\r\n */\r\n NativeInteractionClient.prototype.handleRedirectPromise = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var cachedRequest, prompt, request, messageBody, reqTimestamp, response, result, e_4;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"NativeInteractionClient - handleRedirectPromise called.\");\r\n if (!this.browserStorage.isInteractionInProgress(true)) {\r\n this.logger.info(\"handleRedirectPromise called but there is no interaction in progress, returning null.\");\r\n return [2 /*return*/, null];\r\n }\r\n cachedRequest = this.browserStorage.getCachedNativeRequest();\r\n if (!cachedRequest) {\r\n this.logger.verbose(\"NativeInteractionClient - handleRedirectPromise called but there is no cached request, returning null.\");\r\n return [2 /*return*/, null];\r\n }\r\n prompt = cachedRequest.prompt, request = __rest(cachedRequest, [\"prompt\"]);\r\n if (prompt) {\r\n this.logger.verbose(\"NativeInteractionClient - handleRedirectPromise called and prompt was included in the original request, removing prompt from cached request to prevent second interaction with native broker window.\");\r\n }\r\n this.browserStorage.removeItem(this.browserStorage.generateCacheKey(TemporaryCacheKeys.NATIVE_REQUEST));\r\n messageBody = {\r\n method: NativeExtensionMethod.GetToken,\r\n request: request\r\n };\r\n reqTimestamp = TimeUtils.nowSeconds();\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 4]);\r\n this.logger.verbose(\"NativeInteractionClient - handleRedirectPromise sending message to native broker.\");\r\n return [4 /*yield*/, this.nativeMessageHandler.sendMessage(messageBody)];\r\n case 2:\r\n response = _a.sent();\r\n this.validateNativeResponse(response);\r\n result = this.handleNativeResponse(response, request, reqTimestamp);\r\n this.browserStorage.setInteractionInProgress(false);\r\n return [2 /*return*/, result];\r\n case 3:\r\n e_4 = _a.sent();\r\n this.browserStorage.setInteractionInProgress(false);\r\n throw e_4;\r\n case 4: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Logout from native platform via browser extension\r\n * @param request\r\n */\r\n NativeInteractionClient.prototype.logout = function () {\r\n this.logger.trace(\"NativeInteractionClient - logout called.\");\r\n return Promise.reject(\"Logout not implemented yet\");\r\n };\r\n /**\r\n * Transform response from native platform into AuthenticationResult object which will be returned to the end user\r\n * @param response\r\n * @param request\r\n * @param reqTimestamp\r\n */\r\n NativeInteractionClient.prototype.handleNativeResponse = function (response, request, reqTimestamp) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var authority, idTokenObj, homeAccountIdentifier, accountEntity, result;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"NativeInteractionClient - handleNativeResponse called.\");\r\n if (response.account.id !== request.accountId) {\r\n // User switch in native broker prompt is not supported. All users must first sign in through web flow to ensure server state is in sync\r\n throw NativeAuthError.createUserSwitchError();\r\n }\r\n return [4 /*yield*/, this.getDiscoveredAuthority(request.authority)];\r\n case 1:\r\n authority = _a.sent();\r\n idTokenObj = this.createIdTokenObj(response);\r\n homeAccountIdentifier = this.createHomeAccountIdentifier(response, idTokenObj);\r\n accountEntity = AccountEntity.createAccount({\r\n homeAccountId: homeAccountIdentifier,\r\n idTokenClaims: idTokenObj.claims,\r\n clientInfo: response.client_info,\r\n nativeAccountId: response.account.id,\r\n }, authority);\r\n return [4 /*yield*/, this.generateAuthenticationResult(response, request, idTokenObj, accountEntity, authority.canonicalAuthority, reqTimestamp)];\r\n case 2:\r\n result = _a.sent();\r\n // cache accounts and tokens in the appropriate storage\r\n this.cacheAccount(accountEntity);\r\n this.cacheNativeTokens(response, request, homeAccountIdentifier, idTokenObj, result.accessToken, result.tenantId, reqTimestamp);\r\n return [2 /*return*/, result];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Create an idToken Object (not entity)\r\n * @param response\r\n * @returns\r\n */\r\n NativeInteractionClient.prototype.createIdTokenObj = function (response) {\r\n return new AuthToken(response.id_token || Constants.EMPTY_STRING, this.browserCrypto);\r\n };\r\n /**\r\n * creates an homeAccountIdentifier for the account\r\n * @param response\r\n * @param idTokenObj\r\n * @returns\r\n */\r\n NativeInteractionClient.prototype.createHomeAccountIdentifier = function (response, idTokenObj) {\r\n // Save account in browser storage\r\n var homeAccountIdentifier = AccountEntity.generateHomeAccountId(response.client_info || Constants.EMPTY_STRING, AuthorityType.Default, this.logger, this.browserCrypto, idTokenObj.claims);\r\n return homeAccountIdentifier;\r\n };\r\n /**\r\n * Helper to generate scopes\r\n * @param response\r\n * @param request\r\n * @returns\r\n */\r\n NativeInteractionClient.prototype.generateScopes = function (response, request) {\r\n return response.scope ? ScopeSet.fromString(response.scope) : ScopeSet.fromString(request.scope);\r\n };\r\n /**\r\n * If PoP token is requesred, records the PoP token if returned from the WAM, else generates one in the browser\r\n * @param request\r\n * @param response\r\n */\r\n NativeInteractionClient.prototype.generatePopAccessToken = function (response, request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var popTokenGenerator, shrParameters;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n if (!(request.tokenType === AuthenticationScheme.POP)) return [3 /*break*/, 2];\r\n /**\r\n * This code prioritizes SHR returned from the native layer. In case of error/SHR not calculated from WAM and the AT\r\n * is still received, SHR is calculated locally\r\n */\r\n // Check if native layer returned an SHR token\r\n if (response.shr) {\r\n this.logger.trace(\"handleNativeServerResponse: SHR is enabled in native layer\");\r\n return [2 /*return*/, response.shr];\r\n }\r\n popTokenGenerator = new PopTokenGenerator(this.browserCrypto);\r\n shrParameters = {\r\n resourceRequestMethod: request.resourceRequestMethod,\r\n resourceRequestUri: request.resourceRequestUri,\r\n shrClaims: request.shrClaims,\r\n shrNonce: request.shrNonce\r\n };\r\n /**\r\n * KeyID must be present in the native request from when the PoP key was generated in order for\r\n * PopTokenGenerator to query the full key for signing\r\n */\r\n if (!request.keyId) {\r\n throw ClientAuthError.createKeyIdMissingError();\r\n }\r\n return [4 /*yield*/, popTokenGenerator.signPopToken(response.access_token, request.keyId, shrParameters)];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n case 2: return [2 /*return*/, response.access_token];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Generates authentication result\r\n * @param response\r\n * @param request\r\n * @param idTokenObj\r\n * @param accountEntity\r\n * @param authority\r\n * @param reqTimestamp\r\n * @returns\r\n */\r\n NativeInteractionClient.prototype.generateAuthenticationResult = function (response, request, idTokenObj, accountEntity, authority, reqTimestamp) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var mats, responseScopes, accountProperties, uid, tid, responseAccessToken, tokenType, result;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n mats = this.addTelemetryFromNativeResponse(response);\r\n responseScopes = response.scope ? ScopeSet.fromString(response.scope) : ScopeSet.fromString(request.scope);\r\n accountProperties = response.account.properties || {};\r\n uid = accountProperties[\"UID\"] || idTokenObj.claims.oid || idTokenObj.claims.sub || Constants.EMPTY_STRING;\r\n tid = accountProperties[\"TenantId\"] || idTokenObj.claims.tid || Constants.EMPTY_STRING;\r\n return [4 /*yield*/, this.generatePopAccessToken(response, request)];\r\n case 1:\r\n responseAccessToken = _a.sent();\r\n tokenType = (request.tokenType === AuthenticationScheme.POP) ? AuthenticationScheme.POP : AuthenticationScheme.BEARER;\r\n result = {\r\n authority: authority,\r\n uniqueId: uid,\r\n tenantId: tid,\r\n scopes: responseScopes.asArray(),\r\n account: accountEntity.getAccountInfo(),\r\n idToken: response.id_token,\r\n idTokenClaims: idTokenObj.claims,\r\n accessToken: responseAccessToken,\r\n fromCache: mats ? this.isResponseFromCache(mats) : false,\r\n expiresOn: new Date(Number(reqTimestamp + response.expires_in) * 1000),\r\n tokenType: tokenType,\r\n correlationId: this.correlationId,\r\n state: response.state,\r\n fromNativeBroker: true\r\n };\r\n return [2 /*return*/, result];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * cache the account entity in browser storage\r\n * @param accountEntity\r\n */\r\n NativeInteractionClient.prototype.cacheAccount = function (accountEntity) {\r\n var _this = this;\r\n // Store the account info and hence `nativeAccountId` in browser cache\r\n this.browserStorage.setAccount(accountEntity);\r\n // Remove any existing cached tokens for this account in browser storage\r\n this.browserStorage.removeAccountContext(accountEntity).catch(function (e) {\r\n _this.logger.error(\"Error occurred while removing account context from browser storage. \" + e);\r\n });\r\n };\r\n /**\r\n * Stores the access_token and id_token in inmemory storage\r\n * @param response\r\n * @param request\r\n * @param homeAccountIdentifier\r\n * @param idTokenObj\r\n * @param responseAccessToken\r\n * @param tenantId\r\n * @param reqTimestamp\r\n */\r\n NativeInteractionClient.prototype.cacheNativeTokens = function (response, request, homeAccountIdentifier, idTokenObj, responseAccessToken, tenantId, reqTimestamp) {\r\n var cachedIdToken = IdTokenEntity.createIdTokenEntity(homeAccountIdentifier, request.authority, response.id_token || Constants.EMPTY_STRING, request.clientId, idTokenObj.claims.tid || Constants.EMPTY_STRING);\r\n // cache accessToken in inmemory storage\r\n var expiresIn = (request.tokenType === AuthenticationScheme.POP)\r\n ? Constants.SHR_NONCE_VALIDITY\r\n : (typeof response.expires_in === \"string\"\r\n ? parseInt(response.expires_in, 10)\r\n : response.expires_in) || 0;\r\n var tokenExpirationSeconds = reqTimestamp + expiresIn;\r\n var responseScopes = this.generateScopes(response, request);\r\n var cachedAccessToken = AccessTokenEntity.createAccessTokenEntity(homeAccountIdentifier, request.authority, responseAccessToken, request.clientId, idTokenObj\r\n ? idTokenObj.claims.tid || Constants.EMPTY_STRING\r\n : tenantId, responseScopes.printScopes(), tokenExpirationSeconds, 0, this.browserCrypto);\r\n var nativeCacheRecord = new CacheRecord(undefined, cachedIdToken, cachedAccessToken);\r\n this.nativeStorageManager.saveCacheRecord(nativeCacheRecord);\r\n };\r\n NativeInteractionClient.prototype.addTelemetryFromNativeResponse = function (response) {\r\n var mats = this.getMATSFromResponse(response);\r\n if (!mats) {\r\n return null;\r\n }\r\n this.performanceClient.addStaticFields({\r\n extensionId: this.nativeMessageHandler.getExtensionId(),\r\n extensionVersion: this.nativeMessageHandler.getExtensionVersion(),\r\n matsBrokerVersion: mats.broker_version,\r\n matsAccountJoinOnStart: mats.account_join_on_start,\r\n matsAccountJoinOnEnd: mats.account_join_on_end,\r\n matsDeviceJoin: mats.device_join,\r\n matsPromptBehavior: mats.prompt_behavior,\r\n matsApiErrorCode: mats.api_error_code,\r\n matsUiVisible: mats.ui_visible,\r\n matsSilentCode: mats.silent_code,\r\n matsSilentBiSubCode: mats.silent_bi_sub_code,\r\n matsSilentMessage: mats.silent_message,\r\n matsSilentStatus: mats.silent_status,\r\n matsHttpStatus: mats.http_status,\r\n matsHttpEventCount: mats.http_event_count\r\n }, this.correlationId);\r\n return mats;\r\n };\r\n /**\r\n * Validates native platform response before processing\r\n * @param response\r\n */\r\n NativeInteractionClient.prototype.validateNativeResponse = function (response) {\r\n if (response.hasOwnProperty(\"access_token\") &&\r\n response.hasOwnProperty(\"id_token\") &&\r\n response.hasOwnProperty(\"client_info\") &&\r\n response.hasOwnProperty(\"account\") &&\r\n response.hasOwnProperty(\"scope\") &&\r\n response.hasOwnProperty(\"expires_in\")) {\r\n return response;\r\n }\r\n else {\r\n throw NativeAuthError.createUnexpectedError(\"Response missing expected properties.\");\r\n }\r\n };\r\n /**\r\n * Gets MATS telemetry from native response\r\n * @param response\r\n * @returns\r\n */\r\n NativeInteractionClient.prototype.getMATSFromResponse = function (response) {\r\n if (response.properties.MATS) {\r\n try {\r\n return JSON.parse(response.properties.MATS);\r\n }\r\n catch (e) {\r\n this.logger.error(\"NativeInteractionClient - Error parsing MATS telemetry, returning null instead\");\r\n }\r\n }\r\n return null;\r\n };\r\n /**\r\n * Returns whether or not response came from native cache\r\n * @param response\r\n * @returns\r\n */\r\n NativeInteractionClient.prototype.isResponseFromCache = function (mats) {\r\n if (typeof mats.is_cached === \"undefined\") {\r\n this.logger.verbose(\"NativeInteractionClient - MATS telemetry does not contain field indicating if response was served from cache. Returning false.\");\r\n return false;\r\n }\r\n return !!mats.is_cached;\r\n };\r\n /**\r\n * Translates developer provided request object into NativeRequest object\r\n * @param request\r\n */\r\n NativeInteractionClient.prototype.initializeNativeRequest = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var authority, canonicalAuthority, scopes, remainingProperties, scopeSet, getPrompt, validatedRequest, shrParameters, popTokenGenerator, reqCnfData;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"NativeInteractionClient - initializeNativeRequest called\");\r\n authority = request.authority || this.config.auth.authority;\r\n if (!request.account) return [3 /*break*/, 2];\r\n return [4 /*yield*/, this.validateRequestAuthority(authority, request.account)];\r\n case 1:\r\n _a.sent();\r\n _a.label = 2;\r\n case 2:\r\n canonicalAuthority = new UrlString(authority);\r\n canonicalAuthority.validateAsUri();\r\n scopes = request.scopes, remainingProperties = __rest(request, [\"scopes\"]);\r\n scopeSet = new ScopeSet(scopes || []);\r\n scopeSet.appendScopes(OIDC_DEFAULT_SCOPES);\r\n getPrompt = function () {\r\n // If request is silent, prompt is always none\r\n switch (_this.apiId) {\r\n case ApiId.ssoSilent:\r\n case ApiId.acquireTokenSilent_silentFlow:\r\n _this.logger.trace(\"initializeNativeRequest: silent request sets prompt to none\");\r\n return PromptValue.NONE;\r\n }\r\n // Prompt not provided, request may proceed and native broker decides if it needs to prompt\r\n if (!request.prompt) {\r\n _this.logger.trace(\"initializeNativeRequest: prompt was not provided\");\r\n return undefined;\r\n }\r\n // If request is interactive, check if prompt provided is allowed to go directly to native broker\r\n switch (request.prompt) {\r\n case PromptValue.NONE:\r\n case PromptValue.CONSENT:\r\n case PromptValue.LOGIN:\r\n _this.logger.trace(\"initializeNativeRequest: prompt is compatible with native flow\");\r\n return request.prompt;\r\n default:\r\n _this.logger.trace(\"initializeNativeRequest: prompt = \" + request.prompt + \" is not compatible with native flow\");\r\n throw BrowserAuthError.createNativePromptParameterNotSupportedError();\r\n }\r\n };\r\n validatedRequest = __assign(__assign({}, remainingProperties), { accountId: this.accountId, clientId: this.config.auth.clientId, authority: canonicalAuthority.urlString, scope: scopeSet.printScopes(), redirectUri: this.getRedirectUri(request.redirectUri), prompt: getPrompt(), correlationId: this.correlationId, tokenType: request.authenticationScheme, windowTitleSubstring: document.title, extraParameters: __assign(__assign(__assign({}, request.extraQueryParameters), request.tokenQueryParameters), { telemetry: NativeConstants.MATS_TELEMETRY }), extendedExpiryToken: false // Make this configurable?\r\n });\r\n if (!(request.authenticationScheme === AuthenticationScheme.POP)) return [3 /*break*/, 4];\r\n shrParameters = {\r\n resourceRequestUri: request.resourceRequestUri,\r\n resourceRequestMethod: request.resourceRequestMethod,\r\n shrClaims: request.shrClaims,\r\n shrNonce: request.shrNonce\r\n };\r\n popTokenGenerator = new PopTokenGenerator(this.browserCrypto);\r\n return [4 /*yield*/, popTokenGenerator.generateCnf(shrParameters)];\r\n case 3:\r\n reqCnfData = _a.sent();\r\n // to reduce the URL length, it is recommended to send the short form of the req_cnf \r\n validatedRequest.reqCnf = reqCnfData.reqCnfString;\r\n validatedRequest.keyId = reqCnfData.kid;\r\n _a.label = 4;\r\n case 4: return [2 /*return*/, validatedRequest];\r\n }\r\n });\r\n });\r\n };\r\n return NativeInteractionClient;\r\n}(BaseInteractionClient));\n\nexport { NativeInteractionClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../../_virtual/_tslib.js';\nimport { NativeConstants, NativeExtensionMethod } from '../../utils/BrowserConstants.js';\nimport { AuthError, AuthenticationScheme, PerformanceEvents } from '@azure/msal-common';\nimport { NativeAuthError } from '../../error/NativeAuthError.js';\nimport { BrowserAuthError } from '../../error/BrowserAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar NativeMessageHandler = /** @class */ (function () {\r\n function NativeMessageHandler(logger, handshakeTimeoutMs, performanceClient, extensionId) {\r\n this.logger = logger;\r\n this.handshakeTimeoutMs = handshakeTimeoutMs;\r\n this.extensionId = extensionId;\r\n this.resolvers = new Map(); // Used for non-handshake messages\r\n this.handshakeResolvers = new Map(); // Used for handshake messages\r\n this.responseId = 0;\r\n this.messageChannel = new MessageChannel();\r\n this.windowListener = this.onWindowMessage.bind(this); // Window event callback doesn't have access to 'this' unless it's bound\r\n this.performanceClient = performanceClient;\r\n this.handshakeEvent = performanceClient.startMeasurement(PerformanceEvents.NativeMessageHandlerHandshake);\r\n }\r\n /**\r\n * Sends a given message to the extension and resolves with the extension response\r\n * @param body\r\n */\r\n NativeMessageHandler.prototype.sendMessage = function (body) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var req;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n this.logger.trace(\"NativeMessageHandler - sendMessage called.\");\r\n req = {\r\n channel: NativeConstants.CHANNEL_ID,\r\n extensionId: this.extensionId,\r\n responseId: this.responseId++,\r\n body: body\r\n };\r\n this.logger.trace(\"NativeMessageHandler - Sending request to browser extension\");\r\n this.logger.tracePii(\"NativeMessageHandler - Sending request to browser extension: \" + JSON.stringify(req));\r\n this.messageChannel.port1.postMessage(req);\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n _this.resolvers.set(req.responseId, { resolve: resolve, reject: reject });\r\n })];\r\n });\r\n });\r\n };\r\n /**\r\n * Returns an instance of the MessageHandler that has successfully established a connection with an extension\r\n * @param {Logger} logger\r\n * @param {number} handshakeTimeoutMs\r\n * @param {IPerformanceClient} performanceClient\r\n */\r\n NativeMessageHandler.createProvider = function (logger, handshakeTimeoutMs, performanceClient) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var preferredProvider, backupProvider;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n logger.trace(\"NativeMessageHandler - createProvider called.\");\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 3, , 5]);\r\n preferredProvider = new NativeMessageHandler(logger, handshakeTimeoutMs, performanceClient, NativeConstants.PREFERRED_EXTENSION_ID);\r\n return [4 /*yield*/, preferredProvider.sendHandshakeRequest()];\r\n case 2:\r\n _a.sent();\r\n return [2 /*return*/, preferredProvider];\r\n case 3:\r\n _a.sent();\r\n backupProvider = new NativeMessageHandler(logger, handshakeTimeoutMs, performanceClient);\r\n return [4 /*yield*/, backupProvider.sendHandshakeRequest()];\r\n case 4:\r\n _a.sent();\r\n return [2 /*return*/, backupProvider];\r\n case 5: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Send handshake request helper.\r\n */\r\n NativeMessageHandler.prototype.sendHandshakeRequest = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var req;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n this.logger.trace(\"NativeMessageHandler - sendHandshakeRequest called.\");\r\n // Register this event listener before sending handshake\r\n window.addEventListener(\"message\", this.windowListener, false); // false is important, because content script message processing should work first\r\n req = {\r\n channel: NativeConstants.CHANNEL_ID,\r\n extensionId: this.extensionId,\r\n responseId: this.responseId++,\r\n body: {\r\n method: NativeExtensionMethod.HandshakeRequest\r\n }\r\n };\r\n this.handshakeEvent.addStaticFields({\r\n extensionId: this.extensionId,\r\n extensionHandshakeTimeoutMs: this.handshakeTimeoutMs\r\n });\r\n this.messageChannel.port1.onmessage = function (event) {\r\n _this.onChannelMessage(event);\r\n };\r\n window.postMessage(req, window.origin, [this.messageChannel.port2]);\r\n return [2 /*return*/, new Promise(function (resolve, reject) {\r\n _this.handshakeResolvers.set(req.responseId, { resolve: resolve, reject: reject });\r\n _this.timeoutId = window.setTimeout(function () {\r\n /*\r\n * Throw an error if neither HandshakeResponse nor original Handshake request are received in a reasonable timeframe.\r\n * This typically suggests an event handler stopped propagation of the Handshake request but did not respond to it on the MessageChannel port\r\n */\r\n window.removeEventListener(\"message\", _this.windowListener, false);\r\n _this.messageChannel.port1.close();\r\n _this.messageChannel.port2.close();\r\n _this.handshakeEvent.endMeasurement({ extensionHandshakeTimedOut: true, success: false });\r\n reject(BrowserAuthError.createNativeHandshakeTimeoutError());\r\n _this.handshakeResolvers.delete(req.responseId);\r\n }, _this.handshakeTimeoutMs); // Use a reasonable timeout in milliseconds here\r\n })];\r\n });\r\n });\r\n };\r\n /**\r\n * Invoked when a message is posted to the window. If a handshake request is received it means the extension is not installed.\r\n * @param event\r\n */\r\n NativeMessageHandler.prototype.onWindowMessage = function (event) {\r\n this.logger.trace(\"NativeMessageHandler - onWindowMessage called\");\r\n // We only accept messages from ourselves\r\n if (event.source !== window) {\r\n return;\r\n }\r\n var request = event.data;\r\n if (!request.channel || request.channel !== NativeConstants.CHANNEL_ID) {\r\n return;\r\n }\r\n if (request.extensionId && request.extensionId !== this.extensionId) {\r\n return;\r\n }\r\n if (request.body.method === NativeExtensionMethod.HandshakeRequest) {\r\n // If we receive this message back it means no extension intercepted the request, meaning no extension supporting handshake protocol is installed\r\n this.logger.verbose(request.extensionId ? \"Extension with id: \" + request.extensionId + \" not installed\" : \"No extension installed\");\r\n clearTimeout(this.timeoutId);\r\n this.messageChannel.port1.close();\r\n this.messageChannel.port2.close();\r\n window.removeEventListener(\"message\", this.windowListener, false);\r\n var handshakeResolver = this.handshakeResolvers.get(request.responseId);\r\n if (handshakeResolver) {\r\n this.handshakeEvent.endMeasurement({ success: false, extensionInstalled: false });\r\n handshakeResolver.reject(BrowserAuthError.createNativeExtensionNotInstalledError());\r\n }\r\n }\r\n };\r\n /**\r\n * Invoked when a message is received from the extension on the MessageChannel port\r\n * @param event\r\n */\r\n NativeMessageHandler.prototype.onChannelMessage = function (event) {\r\n this.logger.trace(\"NativeMessageHandler - onChannelMessage called.\");\r\n var request = event.data;\r\n var resolver = this.resolvers.get(request.responseId);\r\n var handshakeResolver = this.handshakeResolvers.get(request.responseId);\r\n try {\r\n var method = request.body.method;\r\n if (method === NativeExtensionMethod.Response) {\r\n if (!resolver) {\r\n return;\r\n }\r\n var response = request.body.response;\r\n this.logger.trace(\"NativeMessageHandler - Received response from browser extension\");\r\n this.logger.tracePii(\"NativeMessageHandler - Received response from browser extension: \" + JSON.stringify(response));\r\n if (response.status !== \"Success\") {\r\n resolver.reject(NativeAuthError.createError(response.code, response.description, response.ext));\r\n }\r\n else if (response.result) {\r\n if (response.result[\"code\"] && response.result[\"description\"]) {\r\n resolver.reject(NativeAuthError.createError(response.result[\"code\"], response.result[\"description\"], response.result[\"ext\"]));\r\n }\r\n else {\r\n resolver.resolve(response.result);\r\n }\r\n }\r\n else {\r\n throw AuthError.createUnexpectedError(\"Event does not contain result.\");\r\n }\r\n this.resolvers.delete(request.responseId);\r\n }\r\n else if (method === NativeExtensionMethod.HandshakeResponse) {\r\n if (!handshakeResolver) {\r\n return;\r\n }\r\n clearTimeout(this.timeoutId); // Clear setTimeout\r\n window.removeEventListener(\"message\", this.windowListener, false); // Remove 'No extension' listener\r\n this.extensionId = request.extensionId;\r\n this.extensionVersion = request.body.version;\r\n this.logger.verbose(\"NativeMessageHandler - Received HandshakeResponse from extension: \" + this.extensionId);\r\n this.handshakeEvent.endMeasurement({ extensionInstalled: true, success: true });\r\n handshakeResolver.resolve();\r\n this.handshakeResolvers.delete(request.responseId);\r\n }\r\n // Do nothing if method is not Response or HandshakeResponse\r\n }\r\n catch (err) {\r\n this.logger.error(\"Error parsing response from WAM Extension\");\r\n this.logger.errorPii(\"Error parsing response from WAM Extension: \" + err.toString());\r\n this.logger.errorPii(\"Unable to parse \" + event);\r\n if (resolver) {\r\n resolver.reject(err);\r\n }\r\n else if (handshakeResolver) {\r\n handshakeResolver.reject(err);\r\n }\r\n }\r\n };\r\n /**\r\n * Returns the Id for the browser extension this handler is communicating with\r\n * @returns\r\n */\r\n NativeMessageHandler.prototype.getExtensionId = function () {\r\n return this.extensionId;\r\n };\r\n /**\r\n * Returns the version for the browser extension this handler is communicating with\r\n * @returns\r\n */\r\n NativeMessageHandler.prototype.getExtensionVersion = function () {\r\n return this.extensionVersion;\r\n };\r\n /**\r\n * Returns boolean indicating whether or not the request should attempt to use native broker\r\n * @param logger\r\n * @param config\r\n * @param nativeExtensionProvider\r\n * @param authenticationScheme\r\n */\r\n NativeMessageHandler.isNativeAvailable = function (config, logger, nativeExtensionProvider, authenticationScheme) {\r\n logger.trace(\"isNativeAvailable called\");\r\n if (!config.system.allowNativeBroker) {\r\n logger.trace(\"isNativeAvailable: allowNativeBroker is not enabled, returning false\");\r\n // Developer disabled WAM\r\n return false;\r\n }\r\n if (!nativeExtensionProvider) {\r\n logger.trace(\"isNativeAvailable: WAM extension provider is not initialized, returning false\");\r\n // Extension is not available\r\n return false;\r\n }\r\n if (authenticationScheme) {\r\n switch (authenticationScheme) {\r\n case AuthenticationScheme.BEARER:\r\n case AuthenticationScheme.POP:\r\n logger.trace(\"isNativeAvailable: authenticationScheme is supported, returning true\");\r\n return true;\r\n default:\r\n logger.trace(\"isNativeAvailable: authenticationScheme is not supported, returning false\");\r\n return false;\r\n }\r\n }\r\n return true;\r\n };\r\n return NativeMessageHandler;\r\n}());\n\nexport { NativeMessageHandler };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { PerformanceEvents, StringUtils, ClientAuthError, ServerError, AuthorityFactory } from '@azure/msal-common';\nimport { BrowserAuthError, BrowserAuthErrorMessage } from '../error/BrowserAuthError.js';\nimport { TemporaryCacheKeys } from '../utils/BrowserConstants.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Abstract class which defines operations for a browser interaction handling class.\r\n */\r\nvar InteractionHandler = /** @class */ (function () {\r\n function InteractionHandler(authCodeModule, storageImpl, authCodeRequest, logger, performanceClient) {\r\n this.authModule = authCodeModule;\r\n this.browserStorage = storageImpl;\r\n this.authCodeRequest = authCodeRequest;\r\n this.logger = logger;\r\n this.performanceClient = performanceClient;\r\n }\r\n /**\r\n * Function to handle response parameters from hash.\r\n * @param locationHash\r\n */\r\n InteractionHandler.prototype.handleCodeResponseFromHash = function (locationHash, state, authority, networkModule) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var stateKey, requestState, authCodeResponse;\r\n return __generator(this, function (_a) {\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.HandleCodeResponseFromHash, this.authCodeRequest.correlationId);\r\n this.logger.verbose(\"InteractionHandler.handleCodeResponse called\");\r\n // Check that location hash isn't empty.\r\n if (StringUtils.isEmpty(locationHash)) {\r\n throw BrowserAuthError.createEmptyHashError(locationHash);\r\n }\r\n stateKey = this.browserStorage.generateStateKey(state);\r\n requestState = this.browserStorage.getTemporaryCache(stateKey);\r\n if (!requestState) {\r\n throw ClientAuthError.createStateNotFoundError(\"Cached State\");\r\n }\r\n try {\r\n authCodeResponse = this.authModule.handleFragmentResponse(locationHash, requestState);\r\n }\r\n catch (e) {\r\n if (e instanceof ServerError && e.subError === BrowserAuthErrorMessage.userCancelledError.code) {\r\n // Translate server error caused by user closing native prompt to corresponding first class MSAL error\r\n throw BrowserAuthError.createUserCancelledError();\r\n }\r\n else {\r\n throw e;\r\n }\r\n }\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.HandleCodeResponseFromServer, this.authCodeRequest.correlationId);\r\n return [2 /*return*/, this.handleCodeResponseFromServer(authCodeResponse, state, authority, networkModule)];\r\n });\r\n });\r\n };\r\n /**\r\n * Process auth code response from AAD\r\n * @param authCodeResponse\r\n * @param state\r\n * @param authority\r\n * @param networkModule\r\n * @returns\r\n */\r\n InteractionHandler.prototype.handleCodeResponseFromServer = function (authCodeResponse, state, authority, networkModule, validateNonce) {\r\n if (validateNonce === void 0) { validateNonce = true; }\r\n return __awaiter(this, void 0, void 0, function () {\r\n var stateKey, requestState, nonceKey, cachedNonce, cachedCcsCred, tokenResponse;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.HandleCodeResponseFromServer, this.authCodeRequest.correlationId);\r\n this.logger.trace(\"InteractionHandler.handleCodeResponseFromServer called\");\r\n stateKey = this.browserStorage.generateStateKey(state);\r\n requestState = this.browserStorage.getTemporaryCache(stateKey);\r\n if (!requestState) {\r\n throw ClientAuthError.createStateNotFoundError(\"Cached State\");\r\n }\r\n nonceKey = this.browserStorage.generateNonceKey(requestState);\r\n cachedNonce = this.browserStorage.getTemporaryCache(nonceKey);\r\n // Assign code to request\r\n this.authCodeRequest.code = authCodeResponse.code;\r\n if (!authCodeResponse.cloud_instance_host_name) return [3 /*break*/, 2];\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.UpdateTokenEndpointAuthority, this.authCodeRequest.correlationId);\r\n return [4 /*yield*/, this.updateTokenEndpointAuthority(authCodeResponse.cloud_instance_host_name, authority, networkModule)];\r\n case 1:\r\n _a.sent();\r\n _a.label = 2;\r\n case 2:\r\n // Nonce validation not needed when redirect not involved (e.g. hybrid spa, renewing token via rt)\r\n if (validateNonce) {\r\n authCodeResponse.nonce = cachedNonce || undefined;\r\n }\r\n authCodeResponse.state = requestState;\r\n // Add CCS parameters if available\r\n if (authCodeResponse.client_info) {\r\n this.authCodeRequest.clientInfo = authCodeResponse.client_info;\r\n }\r\n else {\r\n cachedCcsCred = this.checkCcsCredentials();\r\n if (cachedCcsCred) {\r\n this.authCodeRequest.ccsCredential = cachedCcsCred;\r\n }\r\n }\r\n // Acquire token with retrieved code.\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.AuthClientAcquireToken, this.authCodeRequest.correlationId);\r\n return [4 /*yield*/, this.authModule.acquireToken(this.authCodeRequest, authCodeResponse)];\r\n case 3:\r\n tokenResponse = _a.sent();\r\n this.browserStorage.cleanRequestByState(state);\r\n return [2 /*return*/, tokenResponse];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Updates authority based on cloudInstanceHostname\r\n * @param cloudInstanceHostname\r\n * @param authority\r\n * @param networkModule\r\n */\r\n InteractionHandler.prototype.updateTokenEndpointAuthority = function (cloudInstanceHostname, authority, networkModule) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var cloudInstanceAuthorityUri, cloudInstanceAuthority;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.UpdateTokenEndpointAuthority, this.authCodeRequest.correlationId);\r\n cloudInstanceAuthorityUri = \"https://\" + cloudInstanceHostname + \"/\" + authority.tenant + \"/\";\r\n return [4 /*yield*/, AuthorityFactory.createDiscoveredInstance(cloudInstanceAuthorityUri, networkModule, this.browserStorage, authority.options, this.logger, this.performanceClient, this.authCodeRequest.correlationId)];\r\n case 1:\r\n cloudInstanceAuthority = _a.sent();\r\n this.authModule.updateAuthority(cloudInstanceAuthority);\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Looks up ccs creds in the cache\r\n */\r\n InteractionHandler.prototype.checkCcsCredentials = function () {\r\n // Look up ccs credential in temp cache\r\n var cachedCcsCred = this.browserStorage.getTemporaryCache(TemporaryCacheKeys.CCS_CREDENTIAL, true);\r\n if (cachedCcsCred) {\r\n try {\r\n return JSON.parse(cachedCcsCred);\r\n }\r\n catch (e) {\r\n this.authModule.logger.error(\"Cache credential could not be parsed\");\r\n this.authModule.logger.errorPii(\"Cache credential could not be parsed: \" + cachedCcsCred);\r\n }\r\n }\r\n return null;\r\n };\r\n return InteractionHandler;\r\n}());\n\nexport { InteractionHandler };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { OIDC_DEFAULT_SCOPES, StringUtils, UrlString, Constants, AuthError, ThrottlingUtils, ProtocolUtils, PerformanceEvents } from '@azure/msal-common';\nimport { StandardInteractionClient } from './StandardInteractionClient.js';\nimport { EventType } from '../event/EventType.js';\nimport { BrowserConstants, InteractionType, ApiId } from '../utils/BrowserConstants.js';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\nimport { NativeInteractionClient } from './NativeInteractionClient.js';\nimport { NativeMessageHandler } from '../broker/nativeBroker/NativeMessageHandler.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { InteractionHandler } from '../interaction_handler/InteractionHandler.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar PopupClient = /** @class */ (function (_super) {\r\n __extends(PopupClient, _super);\r\n function PopupClient(config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeStorageImpl, nativeMessageHandler, correlationId) {\r\n var _this = _super.call(this, config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeMessageHandler, correlationId) || this;\r\n // Properly sets this reference for the unload event.\r\n _this.unloadWindow = _this.unloadWindow.bind(_this);\r\n _this.nativeStorage = nativeStorageImpl;\r\n return _this;\r\n }\r\n /**\r\n * Acquires tokens by opening a popup window to the /authorize endpoint of the authority\r\n * @param request\r\n */\r\n PopupClient.prototype.acquireToken = function (request) {\r\n try {\r\n var popupName = this.generatePopupName(request.scopes || OIDC_DEFAULT_SCOPES, request.authority || this.config.auth.authority);\r\n var popupWindowAttributes = request.popupWindowAttributes || {};\r\n // asyncPopups flag is true. Acquires token without first opening popup. Popup will be opened later asynchronously.\r\n if (this.config.system.asyncPopups) {\r\n this.logger.verbose(\"asyncPopups set to true, acquiring token\");\r\n // Passes on popup position and dimensions if in request\r\n return this.acquireTokenPopupAsync(request, popupName, popupWindowAttributes);\r\n }\r\n else {\r\n // asyncPopups flag is set to false. Opens popup before acquiring token.\r\n this.logger.verbose(\"asyncPopup set to false, opening popup before acquiring token\");\r\n var popup = this.openSizedPopup(\"about:blank\", popupName, popupWindowAttributes);\r\n return this.acquireTokenPopupAsync(request, popupName, popupWindowAttributes, popup);\r\n }\r\n }\r\n catch (e) {\r\n return Promise.reject(e);\r\n }\r\n };\r\n /**\r\n * Clears local cache for the current user then opens a popup window prompting the user to sign-out of the server\r\n * @param logoutRequest\r\n */\r\n PopupClient.prototype.logout = function (logoutRequest) {\r\n try {\r\n this.logger.verbose(\"logoutPopup called\");\r\n var validLogoutRequest = this.initializeLogoutRequest(logoutRequest);\r\n var popupName = this.generateLogoutPopupName(validLogoutRequest);\r\n var authority = logoutRequest && logoutRequest.authority;\r\n var mainWindowRedirectUri = logoutRequest && logoutRequest.mainWindowRedirectUri;\r\n var popupWindowAttributes = (logoutRequest === null || logoutRequest === void 0 ? void 0 : logoutRequest.popupWindowAttributes) || {};\r\n // asyncPopups flag is true. Acquires token without first opening popup. Popup will be opened later asynchronously.\r\n if (this.config.system.asyncPopups) {\r\n this.logger.verbose(\"asyncPopups set to true\");\r\n // Passes on popup position and dimensions if in request\r\n return this.logoutPopupAsync(validLogoutRequest, popupName, popupWindowAttributes, authority, undefined, mainWindowRedirectUri);\r\n }\r\n else {\r\n // asyncPopups flag is set to false. Opens popup before logging out.\r\n this.logger.verbose(\"asyncPopup set to false, opening popup\");\r\n var popup = this.openSizedPopup(\"about:blank\", popupName, popupWindowAttributes);\r\n return this.logoutPopupAsync(validLogoutRequest, popupName, popupWindowAttributes, authority, popup, mainWindowRedirectUri);\r\n }\r\n }\r\n catch (e) {\r\n // Since this function is synchronous we need to reject\r\n return Promise.reject(e);\r\n }\r\n };\r\n /**\r\n * Helper which obtains an access_token for your API via opening a popup window in the user's browser\r\n * @param validRequest\r\n * @param popupName\r\n * @param popup\r\n * @param popupWindowAttributes\r\n *\r\n * @returns A promise that is fulfilled when this function has completed, or rejected if an error was raised.\r\n */\r\n PopupClient.prototype.acquireTokenPopupAsync = function (request, popupName, popupWindowAttributes, popup) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var serverTelemetryManager, validRequest, authCodeRequest, authClient, isNativeBroker, fetchNativeAccountIdMeasurement, navigateUrl, interactionHandler, popupParameters, popupWindow, hash, serverParams, state_1, nativeInteractionClient, userRequestState, result, e_1;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.verbose(\"acquireTokenPopupAsync called\");\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.acquireTokenPopup);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationRequest, request.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationRequest(request, InteractionType.Popup)];\r\n case 1:\r\n validRequest = _a.sent();\r\n this.browserStorage.updateCacheEntries(validRequest.state, validRequest.nonce, validRequest.authority, validRequest.loginHint || Constants.EMPTY_STRING, validRequest.account || null);\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 8, , 9]);\r\n // Create auth code request and generate PKCE params\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationCodeRequest, request.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationCodeRequest(validRequest)];\r\n case 3:\r\n authCodeRequest = _a.sent();\r\n // Initialize the client\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, request.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeClient(serverTelemetryManager, validRequest.authority, validRequest.azureCloudOptions)];\r\n case 4:\r\n authClient = _a.sent();\r\n this.logger.verbose(\"Auth code client created\");\r\n isNativeBroker = NativeMessageHandler.isNativeAvailable(this.config, this.logger, this.nativeMessageHandler, request.authenticationScheme);\r\n fetchNativeAccountIdMeasurement = void 0;\r\n if (isNativeBroker) {\r\n fetchNativeAccountIdMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.FetchAccountIdWithNativeBroker, request.correlationId);\r\n }\r\n return [4 /*yield*/, authClient.getAuthCodeUrl(__assign(__assign({}, validRequest), { nativeBroker: isNativeBroker }))];\r\n case 5:\r\n navigateUrl = _a.sent();\r\n interactionHandler = new InteractionHandler(authClient, this.browserStorage, authCodeRequest, this.logger, this.performanceClient);\r\n popupParameters = {\r\n popup: popup,\r\n popupName: popupName,\r\n popupWindowAttributes: popupWindowAttributes\r\n };\r\n popupWindow = this.initiateAuthRequest(navigateUrl, popupParameters);\r\n this.eventHandler.emitEvent(EventType.POPUP_OPENED, InteractionType.Popup, { popupWindow: popupWindow }, null);\r\n return [4 /*yield*/, this.monitorPopupForHash(popupWindow)];\r\n case 6:\r\n hash = _a.sent();\r\n serverParams = UrlString.getDeserializedHash(hash);\r\n state_1 = this.validateAndExtractStateFromHash(serverParams, InteractionType.Popup, validRequest.correlationId);\r\n // Remove throttle if it exists\r\n ThrottlingUtils.removeThrottle(this.browserStorage, this.config.auth.clientId, authCodeRequest);\r\n if (serverParams.accountId) {\r\n this.logger.verbose(\"Account id found in hash, calling WAM for token\");\r\n // end measurement for server call with native brokering enabled\r\n if (fetchNativeAccountIdMeasurement) {\r\n fetchNativeAccountIdMeasurement.endMeasurement({\r\n success: true,\r\n isNativeBroker: true\r\n });\r\n }\r\n if (!this.nativeMessageHandler) {\r\n throw BrowserAuthError.createNativeConnectionNotEstablishedError();\r\n }\r\n nativeInteractionClient = new NativeInteractionClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, ApiId.acquireTokenPopup, this.performanceClient, this.nativeMessageHandler, serverParams.accountId, this.nativeStorage, validRequest.correlationId);\r\n userRequestState = ProtocolUtils.parseRequestState(this.browserCrypto, state_1).userRequestState;\r\n return [2 /*return*/, nativeInteractionClient.acquireToken(__assign(__assign({}, validRequest), { state: userRequestState, prompt: undefined // Server should handle the prompt, ideally native broker can do this part silently\r\n })).finally(function () {\r\n _this.browserStorage.cleanRequestByState(state_1);\r\n })];\r\n }\r\n return [4 /*yield*/, interactionHandler.handleCodeResponseFromHash(hash, state_1, authClient.authority, this.networkClient)];\r\n case 7:\r\n result = _a.sent();\r\n return [2 /*return*/, result];\r\n case 8:\r\n e_1 = _a.sent();\r\n if (popup) {\r\n // Close the synchronous popup if an error is thrown before the window unload event is registered\r\n popup.close();\r\n }\r\n if (e_1 instanceof AuthError) {\r\n e_1.setCorrelationId(this.correlationId);\r\n }\r\n serverTelemetryManager.cacheFailedRequest(e_1);\r\n this.browserStorage.cleanRequestByState(validRequest.state);\r\n throw e_1;\r\n case 9: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n *\r\n * @param validRequest\r\n * @param popupName\r\n * @param requestAuthority\r\n * @param popup\r\n * @param mainWindowRedirectUri\r\n * @param popupWindowAttributes\r\n */\r\n PopupClient.prototype.logoutPopupAsync = function (validRequest, popupName, popupWindowAttributes, requestAuthority, popup, mainWindowRedirectUri) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var serverTelemetryManager, authClient, logoutUri, popupWindow, navigationOptions, absoluteUrl, e_2;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.verbose(\"logoutPopupAsync called\");\r\n this.eventHandler.emitEvent(EventType.LOGOUT_START, InteractionType.Popup, validRequest);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.logoutPopup);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 5, , 6]);\r\n // Clear cache on logout\r\n return [4 /*yield*/, this.clearCacheOnLogout(validRequest.account)];\r\n case 2:\r\n // Clear cache on logout\r\n _a.sent();\r\n // Initialize the client\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, validRequest.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeClient(serverTelemetryManager, requestAuthority)];\r\n case 3:\r\n authClient = _a.sent();\r\n this.logger.verbose(\"Auth code client created\");\r\n logoutUri = authClient.getLogoutUri(validRequest);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_SUCCESS, InteractionType.Popup, validRequest);\r\n popupWindow = this.openPopup(logoutUri, { popupName: popupName, popupWindowAttributes: popupWindowAttributes, popup: popup });\r\n this.eventHandler.emitEvent(EventType.POPUP_OPENED, InteractionType.Popup, { popupWindow: popupWindow }, null);\r\n return [4 /*yield*/, this.waitForLogoutPopup(popupWindow)];\r\n case 4:\r\n _a.sent();\r\n if (mainWindowRedirectUri) {\r\n navigationOptions = {\r\n apiId: ApiId.logoutPopup,\r\n timeout: this.config.system.redirectNavigationTimeout,\r\n noHistory: false\r\n };\r\n absoluteUrl = UrlString.getAbsoluteUrl(mainWindowRedirectUri, BrowserUtils.getCurrentUri());\r\n this.logger.verbose(\"Redirecting main window to url specified in the request\");\r\n this.logger.verbosePii(\"Redirecting main window to: \" + absoluteUrl);\r\n this.navigationClient.navigateInternal(absoluteUrl, navigationOptions);\r\n }\r\n else {\r\n this.logger.verbose(\"No main window navigation requested\");\r\n }\r\n return [3 /*break*/, 6];\r\n case 5:\r\n e_2 = _a.sent();\r\n if (popup) {\r\n // Close the synchronous popup if an error is thrown before the window unload event is registered\r\n popup.close();\r\n }\r\n if (e_2 instanceof AuthError) {\r\n e_2.setCorrelationId(this.correlationId);\r\n }\r\n this.browserStorage.setInteractionInProgress(false);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_FAILURE, InteractionType.Popup, null, e_2);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_END, InteractionType.Popup);\r\n serverTelemetryManager.cacheFailedRequest(e_2);\r\n throw e_2;\r\n case 6:\r\n this.eventHandler.emitEvent(EventType.LOGOUT_END, InteractionType.Popup);\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Opens a popup window with given request Url.\r\n * @param requestUrl\r\n */\r\n PopupClient.prototype.initiateAuthRequest = function (requestUrl, params) {\r\n // Check that request url is not empty.\r\n if (!StringUtils.isEmpty(requestUrl)) {\r\n this.logger.infoPii(\"Navigate to: \" + requestUrl);\r\n // Open the popup window to requestUrl.\r\n return this.openPopup(requestUrl, params);\r\n }\r\n else {\r\n // Throw error if request URL is empty.\r\n this.logger.error(\"Navigate url is empty\");\r\n throw BrowserAuthError.createEmptyNavigationUriError();\r\n }\r\n };\r\n /**\r\n * Monitors a window until it loads a url with the same origin.\r\n * @param popupWindow - window that is being monitored\r\n * @param timeout - timeout for processing hash once popup is redirected back to application\r\n */\r\n PopupClient.prototype.monitorPopupForHash = function (popupWindow) {\r\n var _this = this;\r\n return new Promise(function (resolve, reject) {\r\n /*\r\n * Polling for popups needs to be tick-based,\r\n * since a non-trivial amount of time can be spent on interaction (which should not count against the timeout).\r\n */\r\n var maxTicks = _this.config.system.windowHashTimeout / _this.config.system.pollIntervalMilliseconds;\r\n var ticks = 0;\r\n _this.logger.verbose(\"PopupHandler.monitorPopupForHash - polling started\");\r\n var intervalId = setInterval(function () {\r\n // Window is closed\r\n if (popupWindow.closed) {\r\n _this.logger.error(\"PopupHandler.monitorPopupForHash - window closed\");\r\n _this.cleanPopup();\r\n clearInterval(intervalId);\r\n reject(BrowserAuthError.createUserCancelledError());\r\n return;\r\n }\r\n var href = Constants.EMPTY_STRING;\r\n var hash = Constants.EMPTY_STRING;\r\n try {\r\n /*\r\n * Will throw if cross origin,\r\n * which should be caught and ignored\r\n * since we need the interval to keep running while on STS UI.\r\n */\r\n href = popupWindow.location.href;\r\n hash = popupWindow.location.hash;\r\n }\r\n catch (e) { }\r\n // Don't process blank pages or cross domain\r\n if (StringUtils.isEmpty(href) || href === \"about:blank\") {\r\n return;\r\n }\r\n _this.logger.verbose(\"PopupHandler.monitorPopupForHash - popup window is on same origin as caller\");\r\n /*\r\n * Only run clock when we are on same domain for popups\r\n * as popup operations can take a long time.\r\n */\r\n ticks++;\r\n if (hash) {\r\n _this.logger.verbose(\"PopupHandler.monitorPopupForHash - found hash in url\");\r\n clearInterval(intervalId);\r\n _this.cleanPopup(popupWindow);\r\n if (UrlString.hashContainsKnownProperties(hash)) {\r\n _this.logger.verbose(\"PopupHandler.monitorPopupForHash - hash contains known properties, returning.\");\r\n resolve(hash);\r\n }\r\n else {\r\n _this.logger.error(\"PopupHandler.monitorPopupForHash - found hash in url but it does not contain known properties. Check that your router is not changing the hash prematurely.\");\r\n _this.logger.errorPii(\"PopupHandler.monitorPopupForHash - hash found: \" + hash);\r\n reject(BrowserAuthError.createHashDoesNotContainKnownPropertiesError());\r\n }\r\n }\r\n else if (ticks > maxTicks) {\r\n _this.logger.error(\"PopupHandler.monitorPopupForHash - unable to find hash in url, timing out\");\r\n clearInterval(intervalId);\r\n reject(BrowserAuthError.createMonitorPopupTimeoutError());\r\n }\r\n }, _this.config.system.pollIntervalMilliseconds);\r\n });\r\n };\r\n /**\r\n * Waits for user interaction in logout popup window\r\n * @param popupWindow\r\n * @returns\r\n */\r\n PopupClient.prototype.waitForLogoutPopup = function (popupWindow) {\r\n var _this = this;\r\n return new Promise(function (resolve) {\r\n _this.logger.verbose(\"PopupHandler.waitForLogoutPopup - polling started\");\r\n var intervalId = setInterval(function () {\r\n // Window is closed\r\n if (popupWindow.closed) {\r\n _this.logger.error(\"PopupHandler.waitForLogoutPopup - window closed\");\r\n _this.cleanPopup();\r\n clearInterval(intervalId);\r\n resolve();\r\n }\r\n var href = Constants.EMPTY_STRING;\r\n try {\r\n /*\r\n * Will throw if cross origin,\r\n * which should be caught and ignored\r\n * since we need the interval to keep running while on STS UI.\r\n */\r\n href = popupWindow.location.href;\r\n }\r\n catch (e) { }\r\n // Don't process blank pages or cross domain\r\n if (StringUtils.isEmpty(href) || href === \"about:blank\") {\r\n return;\r\n }\r\n _this.logger.verbose(\"PopupHandler.waitForLogoutPopup - popup window is on same origin as caller, closing.\");\r\n clearInterval(intervalId);\r\n _this.cleanPopup(popupWindow);\r\n resolve();\r\n }, _this.config.system.pollIntervalMilliseconds);\r\n });\r\n };\r\n /**\r\n * @hidden\r\n *\r\n * Configures popup window for login.\r\n *\r\n * @param urlNavigate\r\n * @param title\r\n * @param popUpWidth\r\n * @param popUpHeight\r\n * @param popupWindowAttributes\r\n * @ignore\r\n * @hidden\r\n */\r\n PopupClient.prototype.openPopup = function (urlNavigate, popupParams) {\r\n try {\r\n var popupWindow = void 0;\r\n // Popup window passed in, setting url to navigate to\r\n if (popupParams.popup) {\r\n popupWindow = popupParams.popup;\r\n this.logger.verbosePii(\"Navigating popup window to: \" + urlNavigate);\r\n popupWindow.location.assign(urlNavigate);\r\n }\r\n else if (typeof popupParams.popup === \"undefined\") {\r\n // Popup will be undefined if it was not passed in\r\n this.logger.verbosePii(\"Opening popup window to: \" + urlNavigate);\r\n popupWindow = this.openSizedPopup(urlNavigate, popupParams.popupName, popupParams.popupWindowAttributes);\r\n }\r\n // Popup will be null if popups are blocked\r\n if (!popupWindow) {\r\n throw BrowserAuthError.createEmptyWindowCreatedError();\r\n }\r\n if (popupWindow.focus) {\r\n popupWindow.focus();\r\n }\r\n this.currentWindow = popupWindow;\r\n window.addEventListener(\"beforeunload\", this.unloadWindow);\r\n return popupWindow;\r\n }\r\n catch (e) {\r\n this.logger.error(\"error opening popup \" + e.message);\r\n this.browserStorage.setInteractionInProgress(false);\r\n throw BrowserAuthError.createPopupWindowError(e.toString());\r\n }\r\n };\r\n /**\r\n * Helper function to set popup window dimensions and position\r\n * @param urlNavigate\r\n * @param popupName\r\n * @param popupWindowAttributes\r\n * @returns\r\n */\r\n PopupClient.prototype.openSizedPopup = function (urlNavigate, popupName, popupWindowAttributes) {\r\n var _a, _b, _c, _d;\r\n /**\r\n * adding winLeft and winTop to account for dual monitor\r\n * using screenLeft and screenTop for IE8 and earlier\r\n */\r\n var winLeft = window.screenLeft ? window.screenLeft : window.screenX;\r\n var winTop = window.screenTop ? window.screenTop : window.screenY;\r\n /**\r\n * window.innerWidth displays browser window\"s height and width excluding toolbars\r\n * using document.documentElement.clientWidth for IE8 and earlier\r\n */\r\n var winWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;\r\n var winHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;\r\n var width = (_a = popupWindowAttributes.popupSize) === null || _a === void 0 ? void 0 : _a.width;\r\n var height = (_b = popupWindowAttributes.popupSize) === null || _b === void 0 ? void 0 : _b.height;\r\n var top = (_c = popupWindowAttributes.popupPosition) === null || _c === void 0 ? void 0 : _c.top;\r\n var left = (_d = popupWindowAttributes.popupPosition) === null || _d === void 0 ? void 0 : _d.left;\r\n if (!width || width < 0 || width > winWidth) {\r\n this.logger.verbose(\"Default popup window width used. Window width not configured or invalid.\");\r\n width = BrowserConstants.POPUP_WIDTH;\r\n }\r\n if (!height || height < 0 || height > winHeight) {\r\n this.logger.verbose(\"Default popup window height used. Window height not configured or invalid.\");\r\n height = BrowserConstants.POPUP_HEIGHT;\r\n }\r\n if (!top || top < 0 || top > winHeight) {\r\n this.logger.verbose(\"Default popup window top position used. Window top not configured or invalid.\");\r\n top = Math.max(0, ((winHeight / 2) - (BrowserConstants.POPUP_HEIGHT / 2)) + winTop);\r\n }\r\n if (!left || left < 0 || left > winWidth) {\r\n this.logger.verbose(\"Default popup window left position used. Window left not configured or invalid.\");\r\n left = Math.max(0, ((winWidth / 2) - (BrowserConstants.POPUP_WIDTH / 2)) + winLeft);\r\n }\r\n return window.open(urlNavigate, popupName, \"width=\" + width + \", height=\" + height + \", top=\" + top + \", left=\" + left + \", scrollbars=yes\");\r\n };\r\n /**\r\n * Event callback to unload main window.\r\n */\r\n PopupClient.prototype.unloadWindow = function (e) {\r\n this.browserStorage.cleanRequestByInteractionType(InteractionType.Popup);\r\n if (this.currentWindow) {\r\n this.currentWindow.close();\r\n }\r\n // Guarantees browser unload will happen, so no other errors will be thrown.\r\n e.preventDefault();\r\n };\r\n /**\r\n * Closes popup, removes any state vars created during popup calls.\r\n * @param popupWindow\r\n */\r\n PopupClient.prototype.cleanPopup = function (popupWindow) {\r\n if (popupWindow) {\r\n // Close window.\r\n popupWindow.close();\r\n }\r\n // Remove window unload function\r\n window.removeEventListener(\"beforeunload\", this.unloadWindow);\r\n // Interaction is completed - remove interaction status.\r\n this.browserStorage.setInteractionInProgress(false);\r\n };\r\n /**\r\n * Generates the name for the popup based on the client id and request\r\n * @param clientId\r\n * @param request\r\n */\r\n PopupClient.prototype.generatePopupName = function (scopes, authority) {\r\n return BrowserConstants.POPUP_NAME_PREFIX + \".\" + this.config.auth.clientId + \".\" + scopes.join(\"-\") + \".\" + authority + \".\" + this.correlationId;\r\n };\r\n /**\r\n * Generates the name for the popup based on the client id and request for logouts\r\n * @param clientId\r\n * @param request\r\n */\r\n PopupClient.prototype.generateLogoutPopupName = function (request) {\r\n var homeAccountId = request.account && request.account.homeAccountId;\r\n return BrowserConstants.POPUP_NAME_PREFIX + \".\" + this.config.auth.clientId + \".\" + homeAccountId + \".\" + this.correlationId;\r\n };\r\n return PopupClient;\r\n}(StandardInteractionClient));\n\nexport { PopupClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { StringUtils, ClientAuthError, ServerError } from '@azure/msal-common';\nimport { BrowserAuthError, BrowserAuthErrorMessage } from '../error/BrowserAuthError.js';\nimport { TemporaryCacheKeys, ApiId } from '../utils/BrowserConstants.js';\nimport { InteractionHandler } from './InteractionHandler.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar RedirectHandler = /** @class */ (function (_super) {\r\n __extends(RedirectHandler, _super);\r\n function RedirectHandler(authCodeModule, storageImpl, authCodeRequest, logger, browserCrypto, performanceClient) {\r\n var _this = _super.call(this, authCodeModule, storageImpl, authCodeRequest, logger, performanceClient) || this;\r\n _this.browserCrypto = browserCrypto;\r\n return _this;\r\n }\r\n /**\r\n * Redirects window to given URL.\r\n * @param urlNavigate\r\n */\r\n RedirectHandler.prototype.initiateAuthRequest = function (requestUrl, params) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var navigationOptions, navigate;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.verbose(\"RedirectHandler.initiateAuthRequest called\");\r\n if (!!StringUtils.isEmpty(requestUrl)) return [3 /*break*/, 7];\r\n // Cache start page, returns to this page after redirectUri if navigateToLoginRequestUrl is true\r\n if (params.redirectStartPage) {\r\n this.logger.verbose(\"RedirectHandler.initiateAuthRequest: redirectStartPage set, caching start page\");\r\n this.browserStorage.setTemporaryCache(TemporaryCacheKeys.ORIGIN_URI, params.redirectStartPage, true);\r\n }\r\n // Set interaction status in the library.\r\n this.browserStorage.setTemporaryCache(TemporaryCacheKeys.CORRELATION_ID, this.authCodeRequest.correlationId, true);\r\n this.browserStorage.cacheCodeRequest(this.authCodeRequest, this.browserCrypto);\r\n this.logger.infoPii(\"RedirectHandler.initiateAuthRequest: Navigate to: \" + requestUrl);\r\n navigationOptions = {\r\n apiId: ApiId.acquireTokenRedirect,\r\n timeout: params.redirectTimeout,\r\n noHistory: false\r\n };\r\n if (!(typeof params.onRedirectNavigate === \"function\")) return [3 /*break*/, 4];\r\n this.logger.verbose(\"RedirectHandler.initiateAuthRequest: Invoking onRedirectNavigate callback\");\r\n navigate = params.onRedirectNavigate(requestUrl);\r\n if (!(navigate !== false)) return [3 /*break*/, 2];\r\n this.logger.verbose(\"RedirectHandler.initiateAuthRequest: onRedirectNavigate did not return false, navigating\");\r\n return [4 /*yield*/, params.navigationClient.navigateExternal(requestUrl, navigationOptions)];\r\n case 1:\r\n _a.sent();\r\n return [2 /*return*/];\r\n case 2:\r\n this.logger.verbose(\"RedirectHandler.initiateAuthRequest: onRedirectNavigate returned false, stopping navigation\");\r\n return [2 /*return*/];\r\n case 3: return [3 /*break*/, 6];\r\n case 4:\r\n // Navigate window to request URL\r\n this.logger.verbose(\"RedirectHandler.initiateAuthRequest: Navigating window to navigate url\");\r\n return [4 /*yield*/, params.navigationClient.navigateExternal(requestUrl, navigationOptions)];\r\n case 5:\r\n _a.sent();\r\n return [2 /*return*/];\r\n case 6: return [3 /*break*/, 8];\r\n case 7:\r\n // Throw error if request URL is empty.\r\n this.logger.info(\"RedirectHandler.initiateAuthRequest: Navigate url is empty\");\r\n throw BrowserAuthError.createEmptyNavigationUriError();\r\n case 8: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Handle authorization code response in the window.\r\n * @param hash\r\n */\r\n RedirectHandler.prototype.handleCodeResponseFromHash = function (locationHash, state, authority, networkModule) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var stateKey, requestState, authCodeResponse, nonceKey, cachedNonce, cachedCcsCred, tokenResponse;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.verbose(\"RedirectHandler.handleCodeResponse called\");\r\n // Check that location hash isn't empty.\r\n if (StringUtils.isEmpty(locationHash)) {\r\n throw BrowserAuthError.createEmptyHashError(locationHash);\r\n }\r\n // Interaction is completed - remove interaction status.\r\n this.browserStorage.setInteractionInProgress(false);\r\n stateKey = this.browserStorage.generateStateKey(state);\r\n requestState = this.browserStorage.getTemporaryCache(stateKey);\r\n if (!requestState) {\r\n throw ClientAuthError.createStateNotFoundError(\"Cached State\");\r\n }\r\n try {\r\n authCodeResponse = this.authModule.handleFragmentResponse(locationHash, requestState);\r\n }\r\n catch (e) {\r\n if (e instanceof ServerError && e.subError === BrowserAuthErrorMessage.userCancelledError.code) {\r\n // Translate server error caused by user closing native prompt to corresponding first class MSAL error\r\n throw BrowserAuthError.createUserCancelledError();\r\n }\r\n else {\r\n throw e;\r\n }\r\n }\r\n nonceKey = this.browserStorage.generateNonceKey(requestState);\r\n cachedNonce = this.browserStorage.getTemporaryCache(nonceKey);\r\n // Assign code to request\r\n this.authCodeRequest.code = authCodeResponse.code;\r\n if (!authCodeResponse.cloud_instance_host_name) return [3 /*break*/, 2];\r\n return [4 /*yield*/, this.updateTokenEndpointAuthority(authCodeResponse.cloud_instance_host_name, authority, networkModule)];\r\n case 1:\r\n _a.sent();\r\n _a.label = 2;\r\n case 2:\r\n authCodeResponse.nonce = cachedNonce || undefined;\r\n authCodeResponse.state = requestState;\r\n // Add CCS parameters if available\r\n if (authCodeResponse.client_info) {\r\n this.authCodeRequest.clientInfo = authCodeResponse.client_info;\r\n }\r\n else {\r\n cachedCcsCred = this.checkCcsCredentials();\r\n if (cachedCcsCred) {\r\n this.authCodeRequest.ccsCredential = cachedCcsCred;\r\n }\r\n }\r\n return [4 /*yield*/, this.authModule.acquireToken(this.authCodeRequest, authCodeResponse)];\r\n case 3:\r\n tokenResponse = _a.sent();\r\n this.browserStorage.cleanRequestByState(state);\r\n return [2 /*return*/, tokenResponse];\r\n }\r\n });\r\n });\r\n };\r\n return RedirectHandler;\r\n}(InteractionHandler));\n\nexport { RedirectHandler };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { UrlString, AuthError, PerformanceEvents, Constants, ThrottlingUtils, ProtocolUtils } from '@azure/msal-common';\nimport { StandardInteractionClient } from './StandardInteractionClient.js';\nimport { TemporaryCacheKeys, ApiId, InteractionType } from '../utils/BrowserConstants.js';\nimport { RedirectHandler } from '../interaction_handler/RedirectHandler.js';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\nimport { EventType } from '../event/EventType.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { NativeInteractionClient } from './NativeInteractionClient.js';\nimport { NativeMessageHandler } from '../broker/nativeBroker/NativeMessageHandler.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar RedirectClient = /** @class */ (function (_super) {\r\n __extends(RedirectClient, _super);\r\n function RedirectClient(config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeStorageImpl, nativeMessageHandler, correlationId) {\r\n var _this = _super.call(this, config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeMessageHandler, correlationId) || this;\r\n _this.nativeStorage = nativeStorageImpl;\r\n return _this;\r\n }\r\n /**\r\n * Redirects the page to the /authorize endpoint of the IDP\r\n * @param request\r\n */\r\n RedirectClient.prototype.acquireToken = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var validRequest, serverTelemetryManager, handleBackButton, authCodeRequest, authClient, interactionHandler, navigateUrl, redirectStartPage, e_1;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationRequest, request.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationRequest(request, InteractionType.Redirect)];\r\n case 1:\r\n validRequest = _a.sent();\r\n this.browserStorage.updateCacheEntries(validRequest.state, validRequest.nonce, validRequest.authority, validRequest.loginHint || Constants.EMPTY_STRING, validRequest.account || null);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.acquireTokenRedirect);\r\n handleBackButton = function (event) {\r\n // Clear temporary cache if the back button is clicked during the redirect flow.\r\n if (event.persisted) {\r\n _this.logger.verbose(\"Page was restored from back/forward cache. Clearing temporary cache.\");\r\n _this.browserStorage.cleanRequestByState(validRequest.state);\r\n _this.eventHandler.emitEvent(EventType.RESTORE_FROM_BFCACHE, InteractionType.Redirect);\r\n }\r\n };\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 7, , 8]);\r\n // Create auth code request and generate PKCE params\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationCodeRequest, request.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationCodeRequest(validRequest)];\r\n case 3:\r\n authCodeRequest = _a.sent();\r\n // Initialize the client\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, request.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeClient(serverTelemetryManager, validRequest.authority, validRequest.azureCloudOptions)];\r\n case 4:\r\n authClient = _a.sent();\r\n this.logger.verbose(\"Auth code client created\");\r\n interactionHandler = new RedirectHandler(authClient, this.browserStorage, authCodeRequest, this.logger, this.browserCrypto, this.performanceClient);\r\n return [4 /*yield*/, authClient.getAuthCodeUrl(__assign(__assign({}, validRequest), { nativeBroker: NativeMessageHandler.isNativeAvailable(this.config, this.logger, this.nativeMessageHandler, request.authenticationScheme) }))];\r\n case 5:\r\n navigateUrl = _a.sent();\r\n redirectStartPage = this.getRedirectStartPage(request.redirectStartPage);\r\n this.logger.verbosePii(\"Redirect start page: \" + redirectStartPage);\r\n // Clear temporary cache if the back button is clicked during the redirect flow.\r\n window.addEventListener(\"pageshow\", handleBackButton);\r\n return [4 /*yield*/, interactionHandler.initiateAuthRequest(navigateUrl, {\r\n navigationClient: this.navigationClient,\r\n redirectTimeout: this.config.system.redirectNavigationTimeout,\r\n redirectStartPage: redirectStartPage,\r\n onRedirectNavigate: request.onRedirectNavigate\r\n })];\r\n case 6: \r\n // Show the UI once the url has been created. Response will come back in the hash, which will be handled in the handleRedirectCallback function.\r\n return [2 /*return*/, _a.sent()];\r\n case 7:\r\n e_1 = _a.sent();\r\n if (e_1 instanceof AuthError) {\r\n e_1.setCorrelationId(this.correlationId);\r\n }\r\n window.removeEventListener(\"pageshow\", handleBackButton);\r\n serverTelemetryManager.cacheFailedRequest(e_1);\r\n this.browserStorage.cleanRequestByState(validRequest.state);\r\n throw e_1;\r\n case 8: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Checks if navigateToLoginRequestUrl is set, and:\r\n * - if true, performs logic to cache and navigate\r\n * - if false, handles hash string and parses response\r\n * @param hash\r\n */\r\n RedirectClient.prototype.handleRedirectPromise = function (hash) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var serverTelemetryManager, responseHash, state, serverParams, loginRequestUrl, loginRequestUrlNormalized, currentUrlNormalized, handleHashResult, navigationOptions, processHashOnRedirect, homepage, e_2;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.handleRedirectPromise);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 10, , 11]);\r\n if (!this.browserStorage.isInteractionInProgress(true)) {\r\n this.logger.info(\"handleRedirectPromise called but there is no interaction in progress, returning null.\");\r\n return [2 /*return*/, null];\r\n }\r\n responseHash = this.getRedirectResponseHash(hash || window.location.hash);\r\n if (!responseHash) {\r\n // Not a recognized server response hash or hash not associated with a redirect request\r\n this.logger.info(\"handleRedirectPromise did not detect a response hash as a result of a redirect. Cleaning temporary cache.\");\r\n this.browserStorage.cleanRequestByInteractionType(InteractionType.Redirect);\r\n return [2 /*return*/, null];\r\n }\r\n state = void 0;\r\n try {\r\n serverParams = UrlString.getDeserializedHash(responseHash);\r\n state = this.validateAndExtractStateFromHash(serverParams, InteractionType.Redirect);\r\n this.logger.verbose(\"State extracted from hash\");\r\n }\r\n catch (e) {\r\n this.logger.info(\"handleRedirectPromise was unable to extract state due to: \" + e);\r\n this.browserStorage.cleanRequestByInteractionType(InteractionType.Redirect);\r\n return [2 /*return*/, null];\r\n }\r\n loginRequestUrl = this.browserStorage.getTemporaryCache(TemporaryCacheKeys.ORIGIN_URI, true) || Constants.EMPTY_STRING;\r\n loginRequestUrlNormalized = UrlString.removeHashFromUrl(loginRequestUrl);\r\n currentUrlNormalized = UrlString.removeHashFromUrl(window.location.href);\r\n if (!(loginRequestUrlNormalized === currentUrlNormalized && this.config.auth.navigateToLoginRequestUrl)) return [3 /*break*/, 3];\r\n // We are on the page we need to navigate to - handle hash\r\n this.logger.verbose(\"Current page is loginRequestUrl, handling hash\");\r\n return [4 /*yield*/, this.handleHash(responseHash, state, serverTelemetryManager)];\r\n case 2:\r\n handleHashResult = _a.sent();\r\n if (loginRequestUrl.indexOf(\"#\") > -1) {\r\n // Replace current hash with non-msal hash, if present\r\n BrowserUtils.replaceHash(loginRequestUrl);\r\n }\r\n return [2 /*return*/, handleHashResult];\r\n case 3:\r\n if (!!this.config.auth.navigateToLoginRequestUrl) return [3 /*break*/, 4];\r\n this.logger.verbose(\"NavigateToLoginRequestUrl set to false, handling hash\");\r\n return [2 /*return*/, this.handleHash(responseHash, state, serverTelemetryManager)];\r\n case 4:\r\n if (!(!BrowserUtils.isInIframe() || this.config.system.allowRedirectInIframe)) return [3 /*break*/, 9];\r\n /*\r\n * Returned from authority using redirect - need to perform navigation before processing response\r\n * Cache the hash to be retrieved after the next redirect\r\n */\r\n this.browserStorage.setTemporaryCache(TemporaryCacheKeys.URL_HASH, responseHash, true);\r\n navigationOptions = {\r\n apiId: ApiId.handleRedirectPromise,\r\n timeout: this.config.system.redirectNavigationTimeout,\r\n noHistory: true\r\n };\r\n processHashOnRedirect = true;\r\n if (!(!loginRequestUrl || loginRequestUrl === \"null\")) return [3 /*break*/, 6];\r\n homepage = BrowserUtils.getHomepage();\r\n // Cache the homepage under ORIGIN_URI to ensure cached hash is processed on homepage\r\n this.browserStorage.setTemporaryCache(TemporaryCacheKeys.ORIGIN_URI, homepage, true);\r\n this.logger.warning(\"Unable to get valid login request url from cache, redirecting to home page\");\r\n return [4 /*yield*/, this.navigationClient.navigateInternal(homepage, navigationOptions)];\r\n case 5:\r\n processHashOnRedirect = _a.sent();\r\n return [3 /*break*/, 8];\r\n case 6:\r\n // Navigate to page that initiated the redirect request\r\n this.logger.verbose(\"Navigating to loginRequestUrl: \" + loginRequestUrl);\r\n return [4 /*yield*/, this.navigationClient.navigateInternal(loginRequestUrl, navigationOptions)];\r\n case 7:\r\n processHashOnRedirect = _a.sent();\r\n _a.label = 8;\r\n case 8:\r\n // If navigateInternal implementation returns false, handle the hash now\r\n if (!processHashOnRedirect) {\r\n return [2 /*return*/, this.handleHash(responseHash, state, serverTelemetryManager)];\r\n }\r\n _a.label = 9;\r\n case 9: return [2 /*return*/, null];\r\n case 10:\r\n e_2 = _a.sent();\r\n if (e_2 instanceof AuthError) {\r\n e_2.setCorrelationId(this.correlationId);\r\n }\r\n serverTelemetryManager.cacheFailedRequest(e_2);\r\n this.browserStorage.cleanRequestByInteractionType(InteractionType.Redirect);\r\n throw e_2;\r\n case 11: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Gets the response hash for a redirect request\r\n * Returns null if interactionType in the state value is not \"redirect\" or the hash does not contain known properties\r\n * @param hash\r\n */\r\n RedirectClient.prototype.getRedirectResponseHash = function (hash) {\r\n this.logger.verbose(\"getRedirectResponseHash called\");\r\n // Get current location hash from window or cache.\r\n var isResponseHash = UrlString.hashContainsKnownProperties(hash);\r\n if (isResponseHash) {\r\n BrowserUtils.clearHash(window);\r\n this.logger.verbose(\"Hash contains known properties, returning response hash\");\r\n return hash;\r\n }\r\n var cachedHash = this.browserStorage.getTemporaryCache(TemporaryCacheKeys.URL_HASH, true);\r\n this.browserStorage.removeItem(this.browserStorage.generateCacheKey(TemporaryCacheKeys.URL_HASH));\r\n this.logger.verbose(\"Hash does not contain known properties, returning cached hash\");\r\n return cachedHash;\r\n };\r\n /**\r\n * Checks if hash exists and handles in window.\r\n * @param hash\r\n * @param state\r\n */\r\n RedirectClient.prototype.handleHash = function (hash, state, serverTelemetryManager) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var cachedRequest, serverParams, nativeInteractionClient, userRequestState, currentAuthority, authClient, interactionHandler;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n cachedRequest = this.browserStorage.getCachedRequest(state, this.browserCrypto);\r\n this.logger.verbose(\"handleHash called, retrieved cached request\");\r\n serverParams = UrlString.getDeserializedHash(hash);\r\n if (serverParams.accountId) {\r\n this.logger.verbose(\"Account id found in hash, calling WAM for token\");\r\n if (!this.nativeMessageHandler) {\r\n throw BrowserAuthError.createNativeConnectionNotEstablishedError();\r\n }\r\n nativeInteractionClient = new NativeInteractionClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, ApiId.acquireTokenPopup, this.performanceClient, this.nativeMessageHandler, serverParams.accountId, this.nativeStorage, cachedRequest.correlationId);\r\n userRequestState = ProtocolUtils.parseRequestState(this.browserCrypto, state).userRequestState;\r\n return [2 /*return*/, nativeInteractionClient.acquireToken(__assign(__assign({}, cachedRequest), { state: userRequestState, prompt: undefined // Server should handle the prompt, ideally native broker can do this part silently\r\n })).finally(function () {\r\n _this.browserStorage.cleanRequestByState(state);\r\n })];\r\n }\r\n currentAuthority = this.browserStorage.getCachedAuthority(state);\r\n if (!currentAuthority) {\r\n throw BrowserAuthError.createNoCachedAuthorityError();\r\n }\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, cachedRequest.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeClient(serverTelemetryManager, currentAuthority)];\r\n case 1:\r\n authClient = _a.sent();\r\n this.logger.verbose(\"Auth code client created\");\r\n ThrottlingUtils.removeThrottle(this.browserStorage, this.config.auth.clientId, cachedRequest);\r\n interactionHandler = new RedirectHandler(authClient, this.browserStorage, cachedRequest, this.logger, this.browserCrypto, this.performanceClient);\r\n return [4 /*yield*/, interactionHandler.handleCodeResponseFromHash(hash, state, authClient.authority, this.networkClient)];\r\n case 2: return [2 /*return*/, _a.sent()];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Use to log out the current user, and redirect the user to the postLogoutRedirectUri.\r\n * Default behaviour is to redirect the user to `window.location.href`.\r\n * @param logoutRequest\r\n */\r\n RedirectClient.prototype.logout = function (logoutRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var validLogoutRequest, serverTelemetryManager, navigationOptions, authClient, logoutUri, navigate, e_3;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.verbose(\"logoutRedirect called\");\r\n validLogoutRequest = this.initializeLogoutRequest(logoutRequest);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.logout);\r\n _a.label = 1;\r\n case 1:\r\n _a.trys.push([1, 10, , 11]);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_START, InteractionType.Redirect, logoutRequest);\r\n // Clear cache on logout\r\n return [4 /*yield*/, this.clearCacheOnLogout(validLogoutRequest.account)];\r\n case 2:\r\n // Clear cache on logout\r\n _a.sent();\r\n navigationOptions = {\r\n apiId: ApiId.logout,\r\n timeout: this.config.system.redirectNavigationTimeout,\r\n noHistory: false\r\n };\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, validLogoutRequest.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeClient(serverTelemetryManager, logoutRequest && logoutRequest.authority)];\r\n case 3:\r\n authClient = _a.sent();\r\n this.logger.verbose(\"Auth code client created\");\r\n logoutUri = authClient.getLogoutUri(validLogoutRequest);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_SUCCESS, InteractionType.Redirect, validLogoutRequest);\r\n if (!(logoutRequest && typeof logoutRequest.onRedirectNavigate === \"function\")) return [3 /*break*/, 7];\r\n navigate = logoutRequest.onRedirectNavigate(logoutUri);\r\n if (!(navigate !== false)) return [3 /*break*/, 5];\r\n this.logger.verbose(\"Logout onRedirectNavigate did not return false, navigating\");\r\n // Ensure interaction is in progress\r\n if (!this.browserStorage.getInteractionInProgress()) {\r\n this.browserStorage.setInteractionInProgress(true);\r\n }\r\n return [4 /*yield*/, this.navigationClient.navigateExternal(logoutUri, navigationOptions)];\r\n case 4:\r\n _a.sent();\r\n return [2 /*return*/];\r\n case 5:\r\n // Ensure interaction is not in progress\r\n this.browserStorage.setInteractionInProgress(false);\r\n this.logger.verbose(\"Logout onRedirectNavigate returned false, stopping navigation\");\r\n _a.label = 6;\r\n case 6: return [3 /*break*/, 9];\r\n case 7:\r\n // Ensure interaction is in progress\r\n if (!this.browserStorage.getInteractionInProgress()) {\r\n this.browserStorage.setInteractionInProgress(true);\r\n }\r\n return [4 /*yield*/, this.navigationClient.navigateExternal(logoutUri, navigationOptions)];\r\n case 8:\r\n _a.sent();\r\n return [2 /*return*/];\r\n case 9: return [3 /*break*/, 11];\r\n case 10:\r\n e_3 = _a.sent();\r\n if (e_3 instanceof AuthError) {\r\n e_3.setCorrelationId(this.correlationId);\r\n }\r\n serverTelemetryManager.cacheFailedRequest(e_3);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_FAILURE, InteractionType.Redirect, null, e_3);\r\n this.eventHandler.emitEvent(EventType.LOGOUT_END, InteractionType.Redirect);\r\n throw e_3;\r\n case 11:\r\n this.eventHandler.emitEvent(EventType.LOGOUT_END, InteractionType.Redirect);\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Use to get the redirectStartPage either from request or use current window\r\n * @param requestStartPage\r\n */\r\n RedirectClient.prototype.getRedirectStartPage = function (requestStartPage) {\r\n var redirectStartPage = requestStartPage || window.location.href;\r\n return UrlString.getAbsoluteUrl(redirectStartPage, BrowserUtils.getCurrentUri());\r\n };\r\n return RedirectClient;\r\n}(StandardInteractionClient));\n\nexport { RedirectClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator } from '../_virtual/_tslib.js';\nimport { PerformanceEvents, StringUtils, Constants, UrlString } from '@azure/msal-common';\nimport { InteractionHandler } from './InteractionHandler.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { DEFAULT_IFRAME_TIMEOUT_MS } from '../config/Configuration.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar SilentHandler = /** @class */ (function (_super) {\r\n __extends(SilentHandler, _super);\r\n function SilentHandler(authCodeModule, storageImpl, authCodeRequest, logger, systemOptions, performanceClient) {\r\n var _this = _super.call(this, authCodeModule, storageImpl, authCodeRequest, logger, performanceClient) || this;\r\n _this.navigateFrameWait = systemOptions.navigateFrameWait;\r\n _this.pollIntervalMilliseconds = systemOptions.pollIntervalMilliseconds;\r\n return _this;\r\n }\r\n /**\r\n * Creates a hidden iframe to given URL using user-requested scopes as an id.\r\n * @param urlNavigate\r\n * @param userRequestScopes\r\n */\r\n SilentHandler.prototype.initiateAuthRequest = function (requestUrl) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.SilentHandlerInitiateAuthRequest, this.authCodeRequest.correlationId);\r\n if (StringUtils.isEmpty(requestUrl)) {\r\n // Throw error if request URL is empty.\r\n this.logger.info(\"Navigate url is empty\");\r\n throw BrowserAuthError.createEmptyNavigationUriError();\r\n }\r\n if (!this.navigateFrameWait) return [3 /*break*/, 2];\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.SilentHandlerLoadFrame, this.authCodeRequest.correlationId);\r\n return [4 /*yield*/, this.loadFrame(requestUrl)];\r\n case 1: return [2 /*return*/, _a.sent()];\r\n case 2: return [2 /*return*/, this.loadFrameSync(requestUrl)];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Monitors an iframe content window until it loads a url with a known hash, or hits a specified timeout.\r\n * @param iframe\r\n * @param timeout\r\n */\r\n SilentHandler.prototype.monitorIframeForHash = function (iframe, timeout) {\r\n var _this = this;\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.SilentHandlerMonitorIframeForHash, this.authCodeRequest.correlationId);\r\n return new Promise(function (resolve, reject) {\r\n if (timeout < DEFAULT_IFRAME_TIMEOUT_MS) {\r\n _this.logger.warning(\"system.loadFrameTimeout or system.iframeHashTimeout set to lower (\" + timeout + \"ms) than the default (\" + DEFAULT_IFRAME_TIMEOUT_MS + \"ms). This may result in timeouts.\");\r\n }\r\n /*\r\n * Polling for iframes can be purely timing based,\r\n * since we don't need to account for interaction.\r\n */\r\n var nowMark = window.performance.now();\r\n var timeoutMark = nowMark + timeout;\r\n var intervalId = setInterval(function () {\r\n if (window.performance.now() > timeoutMark) {\r\n _this.removeHiddenIframe(iframe);\r\n clearInterval(intervalId);\r\n reject(BrowserAuthError.createMonitorIframeTimeoutError());\r\n return;\r\n }\r\n var href = Constants.EMPTY_STRING;\r\n var contentWindow = iframe.contentWindow;\r\n try {\r\n /*\r\n * Will throw if cross origin,\r\n * which should be caught and ignored\r\n * since we need the interval to keep running while on STS UI.\r\n */\r\n href = contentWindow ? contentWindow.location.href : Constants.EMPTY_STRING;\r\n }\r\n catch (e) { }\r\n if (StringUtils.isEmpty(href)) {\r\n return;\r\n }\r\n var contentHash = contentWindow ? contentWindow.location.hash : Constants.EMPTY_STRING;\r\n if (UrlString.hashContainsKnownProperties(contentHash)) {\r\n // Success case\r\n _this.removeHiddenIframe(iframe);\r\n clearInterval(intervalId);\r\n resolve(contentHash);\r\n return;\r\n }\r\n }, _this.pollIntervalMilliseconds);\r\n });\r\n };\r\n /**\r\n * @hidden\r\n * Loads iframe with authorization endpoint URL\r\n * @ignore\r\n */\r\n SilentHandler.prototype.loadFrame = function (urlNavigate) {\r\n var _this = this;\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.SilentHandlerLoadFrame, this.authCodeRequest.correlationId);\r\n /*\r\n * This trick overcomes iframe navigation in IE\r\n * IE does not load the page consistently in iframe\r\n */\r\n return new Promise(function (resolve, reject) {\r\n var frameHandle = _this.createHiddenIframe();\r\n setTimeout(function () {\r\n if (!frameHandle) {\r\n reject(\"Unable to load iframe\");\r\n return;\r\n }\r\n frameHandle.src = urlNavigate;\r\n resolve(frameHandle);\r\n }, _this.navigateFrameWait);\r\n });\r\n };\r\n /**\r\n * @hidden\r\n * Loads the iframe synchronously when the navigateTimeFrame is set to `0`\r\n * @param urlNavigate\r\n * @param frameName\r\n * @param logger\r\n */\r\n SilentHandler.prototype.loadFrameSync = function (urlNavigate) {\r\n var frameHandle = this.createHiddenIframe();\r\n frameHandle.src = urlNavigate;\r\n return frameHandle;\r\n };\r\n /**\r\n * @hidden\r\n * Creates a new hidden iframe or gets an existing one for silent token renewal.\r\n * @ignore\r\n */\r\n SilentHandler.prototype.createHiddenIframe = function () {\r\n var authFrame = document.createElement(\"iframe\");\r\n authFrame.className = \"msalSilentIframe\";\r\n authFrame.style.visibility = \"hidden\";\r\n authFrame.style.position = \"absolute\";\r\n authFrame.style.width = authFrame.style.height = \"0\";\r\n authFrame.style.border = \"0\";\r\n authFrame.setAttribute(\"sandbox\", \"allow-scripts allow-same-origin allow-forms\");\r\n document.getElementsByTagName(\"body\")[0].appendChild(authFrame);\r\n return authFrame;\r\n };\r\n /**\r\n * @hidden\r\n * Removes a hidden iframe from the page.\r\n * @ignore\r\n */\r\n SilentHandler.prototype.removeHiddenIframe = function (iframe) {\r\n if (document.body === iframe.parentNode) {\r\n document.body.removeChild(iframe);\r\n }\r\n };\r\n return SilentHandler;\r\n}(InteractionHandler));\n\nexport { SilentHandler };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { AuthError, PerformanceEvents, Constants, StringUtils, PromptValue, UrlString, ProtocolUtils } from '@azure/msal-common';\nimport { StandardInteractionClient } from './StandardInteractionClient.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { InteractionType } from '../utils/BrowserConstants.js';\nimport { SilentHandler } from '../interaction_handler/SilentHandler.js';\nimport { NativeMessageHandler } from '../broker/nativeBroker/NativeMessageHandler.js';\nimport { NativeInteractionClient } from './NativeInteractionClient.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar SilentIframeClient = /** @class */ (function (_super) {\r\n __extends(SilentIframeClient, _super);\r\n function SilentIframeClient(config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, apiId, performanceClient, nativeStorageImpl, nativeMessageHandler, correlationId) {\r\n var _this = _super.call(this, config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeMessageHandler, correlationId) || this;\r\n _this.apiId = apiId;\r\n _this.nativeStorage = nativeStorageImpl;\r\n return _this;\r\n }\r\n /**\r\n * Acquires a token silently by opening a hidden iframe to the /authorize endpoint with prompt=none or prompt=no_session\r\n * @param request\r\n */\r\n SilentIframeClient.prototype.acquireToken = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var acquireTokenMeasurement, silentRequest, serverTelemetryManager, authClient, e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.SilentIframeClientAcquireToken, request.correlationId);\r\n this.logger.verbose(\"acquireTokenByIframe called\");\r\n acquireTokenMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.SilentIframeClientAcquireToken, request.correlationId);\r\n // Check that we have some SSO data\r\n if (StringUtils.isEmpty(request.loginHint) && StringUtils.isEmpty(request.sid) && (!request.account || StringUtils.isEmpty(request.account.username))) {\r\n this.logger.warning(\"No user hint provided. The authorization server may need more information to complete this request.\");\r\n }\r\n // Check that prompt is set to none or no_session, throw error if it is set to anything else.\r\n if (request.prompt && (request.prompt !== PromptValue.NONE) && (request.prompt !== PromptValue.NO_SESSION)) {\r\n acquireTokenMeasurement.endMeasurement({\r\n success: false\r\n });\r\n throw BrowserAuthError.createSilentPromptValueError(request.prompt);\r\n }\r\n // Create silent request\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationRequest, request.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationRequest(__assign(__assign({}, request), { prompt: request.prompt || PromptValue.NONE }), InteractionType.Silent)];\r\n case 1:\r\n silentRequest = _a.sent();\r\n this.browserStorage.updateCacheEntries(silentRequest.state, silentRequest.nonce, silentRequest.authority, silentRequest.loginHint || Constants.EMPTY_STRING, silentRequest.account || null);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(this.apiId);\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 5, , 6]);\r\n // Initialize the client\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientCreateAuthCodeClient, request.correlationId);\r\n return [4 /*yield*/, this.createAuthCodeClient(serverTelemetryManager, silentRequest.authority, silentRequest.azureCloudOptions)];\r\n case 3:\r\n authClient = _a.sent();\r\n this.logger.verbose(\"Auth code client created\");\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.SilentIframeClientTokenHelper, request.correlationId);\r\n return [4 /*yield*/, this.silentTokenHelper(authClient, silentRequest).then(function (result) {\r\n acquireTokenMeasurement.endMeasurement({\r\n success: true,\r\n fromCache: false,\r\n requestId: result.requestId\r\n });\r\n return result;\r\n })];\r\n case 4: return [2 /*return*/, _a.sent()];\r\n case 5:\r\n e_1 = _a.sent();\r\n if (e_1 instanceof AuthError) {\r\n e_1.setCorrelationId(this.correlationId);\r\n }\r\n serverTelemetryManager.cacheFailedRequest(e_1);\r\n this.browserStorage.cleanRequestByState(silentRequest.state);\r\n acquireTokenMeasurement.endMeasurement({\r\n errorCode: e_1 instanceof AuthError && e_1.errorCode || undefined,\r\n subErrorCode: e_1 instanceof AuthError && e_1.subError || undefined,\r\n success: false\r\n });\r\n throw e_1;\r\n case 6: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Currently Unsupported\r\n */\r\n SilentIframeClient.prototype.logout = function () {\r\n // Synchronous so we must reject\r\n return Promise.reject(BrowserAuthError.createSilentLogoutUnsupportedError());\r\n };\r\n /**\r\n * Helper which acquires an authorization code silently using a hidden iframe from given url\r\n * using the scopes requested as part of the id, and exchanges the code for a set of OAuth tokens.\r\n * @param navigateUrl\r\n * @param userRequestScopes\r\n */\r\n SilentIframeClient.prototype.silentTokenHelper = function (authClient, silentRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var authCodeRequest, navigateUrl, silentHandler, msalFrame, hash, serverParams, state, nativeInteractionClient, userRequestState;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.SilentIframeClientTokenHelper, silentRequest.correlationId);\r\n // Create auth code request and generate PKCE params\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationCodeRequest, silentRequest.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationCodeRequest(silentRequest)];\r\n case 1:\r\n authCodeRequest = _a.sent();\r\n // Create authorize request url\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.GetAuthCodeUrl, silentRequest.correlationId);\r\n return [4 /*yield*/, authClient.getAuthCodeUrl(__assign(__assign({}, silentRequest), { nativeBroker: NativeMessageHandler.isNativeAvailable(this.config, this.logger, this.nativeMessageHandler, silentRequest.authenticationScheme) }))];\r\n case 2:\r\n navigateUrl = _a.sent();\r\n silentHandler = new SilentHandler(authClient, this.browserStorage, authCodeRequest, this.logger, this.config.system, this.performanceClient);\r\n // Get the frame handle for the silent request\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.SilentHandlerInitiateAuthRequest, silentRequest.correlationId);\r\n return [4 /*yield*/, silentHandler.initiateAuthRequest(navigateUrl)];\r\n case 3:\r\n msalFrame = _a.sent();\r\n // Monitor the window for the hash. Return the string value and close the popup when the hash is received. Default timeout is 60 seconds.\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.SilentHandlerMonitorIframeForHash, silentRequest.correlationId);\r\n return [4 /*yield*/, silentHandler.monitorIframeForHash(msalFrame, this.config.system.iframeHashTimeout)];\r\n case 4:\r\n hash = _a.sent();\r\n serverParams = UrlString.getDeserializedHash(hash);\r\n state = this.validateAndExtractStateFromHash(serverParams, InteractionType.Silent, authCodeRequest.correlationId);\r\n if (serverParams.accountId) {\r\n this.logger.verbose(\"Account id found in hash, calling WAM for token\");\r\n if (!this.nativeMessageHandler) {\r\n throw BrowserAuthError.createNativeConnectionNotEstablishedError();\r\n }\r\n nativeInteractionClient = new NativeInteractionClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, this.apiId, this.performanceClient, this.nativeMessageHandler, serverParams.accountId, this.browserStorage, this.correlationId);\r\n userRequestState = ProtocolUtils.parseRequestState(this.browserCrypto, state).userRequestState;\r\n return [2 /*return*/, nativeInteractionClient.acquireToken(__assign(__assign({}, silentRequest), { state: userRequestState, prompt: silentRequest.prompt || PromptValue.NONE })).finally(function () {\r\n _this.browserStorage.cleanRequestByState(state);\r\n })];\r\n }\r\n // Handle response from hash string\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.HandleCodeResponseFromHash, silentRequest.correlationId);\r\n return [2 /*return*/, silentHandler.handleCodeResponseFromHash(hash, state, authClient.authority, this.networkClient)];\r\n }\r\n });\r\n });\r\n };\r\n return SilentIframeClient;\r\n}(StandardInteractionClient));\n\nexport { SilentIframeClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { StandardInteractionClient } from './StandardInteractionClient.js';\nimport { PerformanceEvents, AuthError, RefreshTokenClient } from '@azure/msal-common';\nimport { ApiId } from '../utils/BrowserConstants.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar SilentRefreshClient = /** @class */ (function (_super) {\r\n __extends(SilentRefreshClient, _super);\r\n function SilentRefreshClient() {\r\n return _super !== null && _super.apply(this, arguments) || this;\r\n }\r\n /**\r\n * Exchanges the refresh token for new tokens\r\n * @param request\r\n */\r\n SilentRefreshClient.prototype.acquireToken = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var silentRequest, _a, acquireTokenMeasurement, serverTelemetryManager, refreshTokenClient;\r\n var _this = this;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.SilentRefreshClientAcquireToken, request.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.InitializeBaseRequest, request.correlationId);\r\n _a = [__assign({}, request)];\r\n return [4 /*yield*/, this.initializeBaseRequest(request, request.account)];\r\n case 1:\r\n silentRequest = __assign.apply(void 0, _a.concat([_b.sent()]));\r\n acquireTokenMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.SilentRefreshClientAcquireToken, silentRequest.correlationId);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(ApiId.acquireTokenSilent_silentFlow);\r\n return [4 /*yield*/, this.createRefreshTokenClient(serverTelemetryManager, silentRequest.authority, silentRequest.azureCloudOptions)];\r\n case 2:\r\n refreshTokenClient = _b.sent();\r\n this.logger.verbose(\"Refresh token client created\");\r\n // Send request to renew token. Auth module will throw errors if token cannot be renewed.\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.RefreshTokenClientAcquireTokenByRefreshToken, request.correlationId);\r\n return [2 /*return*/, refreshTokenClient.acquireTokenByRefreshToken(silentRequest)\r\n .then(function (result) {\r\n acquireTokenMeasurement.endMeasurement({\r\n success: true,\r\n fromCache: result.fromCache,\r\n requestId: result.requestId\r\n });\r\n return result;\r\n })\r\n .catch(function (e) {\r\n if (e instanceof AuthError) {\r\n e.setCorrelationId(_this.correlationId);\r\n }\r\n serverTelemetryManager.cacheFailedRequest(e);\r\n acquireTokenMeasurement.endMeasurement({\r\n errorCode: e.errorCode,\r\n subErrorCode: e.subError,\r\n success: false\r\n });\r\n throw e;\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Currently Unsupported\r\n */\r\n SilentRefreshClient.prototype.logout = function () {\r\n // Synchronous so we must reject\r\n return Promise.reject(BrowserAuthError.createSilentLogoutUnsupportedError());\r\n };\r\n /**\r\n * Creates a Refresh Client with the given authority, or the default authority.\r\n * @param serverTelemetryManager\r\n * @param authorityUrl\r\n */\r\n SilentRefreshClient.prototype.createRefreshTokenClient = function (serverTelemetryManager, authorityUrl, azureCloudOptions) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var clientConfig;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n // Create auth module.\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientGetClientConfiguration, this.correlationId);\r\n return [4 /*yield*/, this.getClientConfiguration(serverTelemetryManager, authorityUrl, azureCloudOptions)];\r\n case 1:\r\n clientConfig = _a.sent();\r\n return [2 /*return*/, new RefreshTokenClient(clientConfig, this.performanceClient)];\r\n }\r\n });\r\n });\r\n };\r\n return SilentRefreshClient;\r\n}(StandardInteractionClient));\n\nexport { SilentRefreshClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { AuthToken, AccountEntity, CacheRecord, Authority, IdTokenEntity, ScopeSet, AccessTokenEntity, RefreshTokenEntity, Constants } from '@azure/msal-common';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * Token cache manager\r\n */\r\nvar TokenCache = /** @class */ (function () {\r\n function TokenCache(configuration, storage, logger, cryptoObj) {\r\n this.isBrowserEnvironment = typeof window !== \"undefined\";\r\n this.config = configuration;\r\n this.storage = storage;\r\n this.logger = logger;\r\n this.cryptoObj = cryptoObj;\r\n }\r\n // Move getAllAccounts here and cache utility APIs\r\n /**\r\n * API to load tokens to msal-browser cache.\r\n * @param request\r\n * @param response\r\n * @param options\r\n * @returns `AuthenticationResult` for the response that was loaded.\r\n */\r\n TokenCache.prototype.loadExternalTokens = function (request, response, options) {\r\n this.logger.info(\"TokenCache - loadExternalTokens called\");\r\n if (!response.id_token) {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"Please ensure server response includes id token.\");\r\n }\r\n var idToken = new AuthToken(response.id_token, this.cryptoObj);\r\n var cacheRecord;\r\n var authority;\r\n var cacheRecordAccount;\r\n if (request.account) {\r\n cacheRecordAccount = AccountEntity.createFromAccountInfo(request.account);\r\n cacheRecord = new CacheRecord(cacheRecordAccount, this.loadIdToken(idToken, cacheRecordAccount.homeAccountId, request.account.environment, request.account.tenantId), this.loadAccessToken(request, response, cacheRecordAccount.homeAccountId, request.account.environment, request.account.tenantId, options), this.loadRefreshToken(request, response, cacheRecordAccount.homeAccountId, request.account.environment));\r\n }\r\n else if (request.authority) {\r\n var authorityUrl = Authority.generateAuthority(request.authority, request.azureCloudOptions);\r\n var authorityOptions = {\r\n protocolMode: this.config.auth.protocolMode,\r\n knownAuthorities: this.config.auth.knownAuthorities,\r\n cloudDiscoveryMetadata: this.config.auth.cloudDiscoveryMetadata,\r\n authorityMetadata: this.config.auth.authorityMetadata,\r\n skipAuthorityMetadataCache: this.config.auth.skipAuthorityMetadataCache,\r\n };\r\n authority = new Authority(authorityUrl, this.config.system.networkClient, this.storage, authorityOptions, this.logger);\r\n // \"clientInfo\" from options takes precedence over \"clientInfo\" in response\r\n if (options.clientInfo) {\r\n this.logger.trace(\"TokenCache - homeAccountId from options\");\r\n cacheRecordAccount = this.loadAccount(idToken, authority, options.clientInfo);\r\n cacheRecord = new CacheRecord(cacheRecordAccount, this.loadIdToken(idToken, cacheRecordAccount.homeAccountId, authority.hostnameAndPort, authority.tenant), this.loadAccessToken(request, response, cacheRecordAccount.homeAccountId, authority.hostnameAndPort, authority.tenant, options), this.loadRefreshToken(request, response, cacheRecordAccount.homeAccountId, authority.hostnameAndPort));\r\n }\r\n else if (response.client_info) {\r\n this.logger.trace(\"TokenCache - homeAccountId from response\");\r\n cacheRecordAccount = this.loadAccount(idToken, authority, response.client_info);\r\n cacheRecord = new CacheRecord(cacheRecordAccount, this.loadIdToken(idToken, cacheRecordAccount.homeAccountId, authority.hostnameAndPort, authority.tenant), this.loadAccessToken(request, response, cacheRecordAccount.homeAccountId, authority.hostnameAndPort, authority.tenant, options), this.loadRefreshToken(request, response, cacheRecordAccount.homeAccountId, authority.hostnameAndPort));\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"Please provide clientInfo in the response or options.\");\r\n }\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"Please provide a request with an account or a request with authority.\");\r\n }\r\n return this.generateAuthenticationResult(request, idToken, cacheRecord, cacheRecordAccount, authority);\r\n };\r\n /**\r\n * Helper function to load account to msal-browser cache\r\n * @param idToken\r\n * @param environment\r\n * @param clientInfo\r\n * @param authorityType\r\n * @param requestHomeAccountId\r\n * @returns `AccountEntity`\r\n */\r\n TokenCache.prototype.loadAccount = function (idToken, authority, clientInfo, requestHomeAccountId) {\r\n var homeAccountId;\r\n if (requestHomeAccountId) {\r\n homeAccountId = requestHomeAccountId;\r\n }\r\n else if (authority.authorityType !== undefined && clientInfo) {\r\n homeAccountId = AccountEntity.generateHomeAccountId(clientInfo, authority.authorityType, this.logger, this.cryptoObj, idToken.claims);\r\n }\r\n if (!homeAccountId) {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"Unexpected missing homeAccountId\");\r\n }\r\n var accountEntity = AccountEntity.createAccount({ homeAccountId: homeAccountId, idTokenClaims: idToken.claims, clientInfo: clientInfo, environment: authority.hostnameAndPort }, authority);\r\n if (this.isBrowserEnvironment) {\r\n this.logger.verbose(\"TokenCache - loading account\");\r\n this.storage.setAccount(accountEntity);\r\n return accountEntity;\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"loadExternalTokens is designed to work in browser environments only.\");\r\n }\r\n };\r\n /**\r\n * Helper function to load id tokens to msal-browser cache\r\n * @param idToken\r\n * @param homeAccountId\r\n * @param environment\r\n * @param tenantId\r\n * @returns `IdTokenEntity`\r\n */\r\n TokenCache.prototype.loadIdToken = function (idToken, homeAccountId, environment, tenantId) {\r\n var idTokenEntity = IdTokenEntity.createIdTokenEntity(homeAccountId, environment, idToken.rawToken, this.config.auth.clientId, tenantId);\r\n if (this.isBrowserEnvironment) {\r\n this.logger.verbose(\"TokenCache - loading id token\");\r\n this.storage.setIdTokenCredential(idTokenEntity);\r\n return idTokenEntity;\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"loadExternalTokens is designed to work in browser environments only.\");\r\n }\r\n };\r\n /**\r\n * Helper function to load access tokens to msal-browser cache\r\n * @param request\r\n * @param response\r\n * @param homeAccountId\r\n * @param environment\r\n * @param tenantId\r\n * @returns `AccessTokenEntity`\r\n */\r\n TokenCache.prototype.loadAccessToken = function (request, response, homeAccountId, environment, tenantId, options) {\r\n if (!response.access_token) {\r\n this.logger.verbose(\"TokenCache - No access token provided for caching\");\r\n return null;\r\n }\r\n if (!response.expires_in) {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"Please ensure server response includes expires_in value.\");\r\n }\r\n if (!options.extendedExpiresOn) {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"Please provide an extendedExpiresOn value in the options.\");\r\n }\r\n var scopes = new ScopeSet(request.scopes).printScopes();\r\n var expiresOn = options.expiresOn || (response.expires_in + new Date().getTime() / 1000);\r\n var extendedExpiresOn = options.extendedExpiresOn;\r\n var accessTokenEntity = AccessTokenEntity.createAccessTokenEntity(homeAccountId, environment, response.access_token, this.config.auth.clientId, tenantId, scopes, expiresOn, extendedExpiresOn, this.cryptoObj);\r\n if (this.isBrowserEnvironment) {\r\n this.logger.verbose(\"TokenCache - loading access token\");\r\n this.storage.setAccessTokenCredential(accessTokenEntity);\r\n return accessTokenEntity;\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"loadExternalTokens is designed to work in browser environments only.\");\r\n }\r\n };\r\n /**\r\n * Helper function to load refresh tokens to msal-browser cache\r\n * @param request\r\n * @param response\r\n * @param homeAccountId\r\n * @param environment\r\n * @returns `RefreshTokenEntity`\r\n */\r\n TokenCache.prototype.loadRefreshToken = function (request, response, homeAccountId, environment) {\r\n if (!response.refresh_token) {\r\n this.logger.verbose(\"TokenCache - No refresh token provided for caching\");\r\n return null;\r\n }\r\n var refreshTokenEntity = RefreshTokenEntity.createRefreshTokenEntity(homeAccountId, environment, response.refresh_token, this.config.auth.clientId);\r\n if (this.isBrowserEnvironment) {\r\n this.logger.verbose(\"TokenCache - loading refresh token\");\r\n this.storage.setRefreshTokenCredential(refreshTokenEntity);\r\n return refreshTokenEntity;\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToLoadTokenError(\"loadExternalTokens is designed to work in browser environments only.\");\r\n }\r\n };\r\n /**\r\n * Helper function to generate an `AuthenticationResult` for the result.\r\n * @param request\r\n * @param idTokenObj\r\n * @param cacheRecord\r\n * @param accountEntity\r\n * @param authority\r\n * @returns `AuthenticationResult`\r\n */\r\n TokenCache.prototype.generateAuthenticationResult = function (request, idTokenObj, cacheRecord, accountEntity, authority) {\r\n var _a;\r\n var accessToken = Constants.EMPTY_STRING;\r\n var responseScopes = [];\r\n var expiresOn = null;\r\n var extExpiresOn;\r\n if (cacheRecord.accessToken) {\r\n accessToken = cacheRecord.accessToken.secret;\r\n responseScopes = ScopeSet.fromString(cacheRecord.accessToken.target).asArray();\r\n expiresOn = new Date(Number(cacheRecord.accessToken.expiresOn) * 1000);\r\n extExpiresOn = new Date(Number(cacheRecord.accessToken.extendedExpiresOn) * 1000);\r\n }\r\n var uid = (idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.oid) || (idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.sub) || Constants.EMPTY_STRING;\r\n var tid = (idTokenObj === null || idTokenObj === void 0 ? void 0 : idTokenObj.claims.tid) || Constants.EMPTY_STRING;\r\n return {\r\n authority: authority ? authority.canonicalAuthority : Constants.EMPTY_STRING,\r\n uniqueId: uid,\r\n tenantId: tid,\r\n scopes: responseScopes,\r\n account: accountEntity ? accountEntity.getAccountInfo() : null,\r\n idToken: idTokenObj ? idTokenObj.rawToken : Constants.EMPTY_STRING,\r\n idTokenClaims: idTokenObj ? idTokenObj.claims : {},\r\n accessToken: accessToken,\r\n fromCache: true,\r\n expiresOn: expiresOn,\r\n correlationId: request.correlationId || Constants.EMPTY_STRING,\r\n requestId: Constants.EMPTY_STRING,\r\n extExpiresOn: extExpiresOn,\r\n familyId: Constants.EMPTY_STRING,\r\n tokenType: ((_a = cacheRecord === null || cacheRecord === void 0 ? void 0 : cacheRecord.accessToken) === null || _a === void 0 ? void 0 : _a.tokenType) || Constants.EMPTY_STRING,\r\n state: Constants.EMPTY_STRING,\r\n cloudGraphHostName: accountEntity.cloudGraphHostName || Constants.EMPTY_STRING,\r\n msGraphHost: accountEntity.msGraphHost || Constants.EMPTY_STRING,\r\n code: undefined,\r\n fromNativeBroker: false\r\n };\r\n };\r\n return TokenCache;\r\n}());\n\nexport { TokenCache };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends } from '../_virtual/_tslib.js';\nimport { AuthorizationCodeClient } from '@azure/msal-common';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar HybridSpaAuthorizationCodeClient = /** @class */ (function (_super) {\r\n __extends(HybridSpaAuthorizationCodeClient, _super);\r\n function HybridSpaAuthorizationCodeClient(config) {\r\n var _this = _super.call(this, config) || this;\r\n _this.includeRedirectUri = false;\r\n return _this;\r\n }\r\n return HybridSpaAuthorizationCodeClient;\r\n}(AuthorizationCodeClient));\n\nexport { HybridSpaAuthorizationCodeClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { AuthError, PerformanceEvents, Constants } from '@azure/msal-common';\nimport { StandardInteractionClient } from './StandardInteractionClient.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { InteractionType } from '../utils/BrowserConstants.js';\nimport { SilentHandler } from '../interaction_handler/SilentHandler.js';\nimport { HybridSpaAuthorizationCodeClient } from './HybridSpaAuthorizationCodeClient.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar SilentAuthCodeClient = /** @class */ (function (_super) {\r\n __extends(SilentAuthCodeClient, _super);\r\n function SilentAuthCodeClient(config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, apiId, performanceClient, nativeMessageHandler, correlationId) {\r\n var _this = _super.call(this, config, storageImpl, browserCrypto, logger, eventHandler, navigationClient, performanceClient, nativeMessageHandler, correlationId) || this;\r\n _this.apiId = apiId;\r\n return _this;\r\n }\r\n /**\r\n * Acquires a token silently by redeeming an authorization code against the /token endpoint\r\n * @param request\r\n */\r\n SilentAuthCodeClient.prototype.acquireToken = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var silentRequest, serverTelemetryManager, authCodeRequest, clientConfig, authClient, silentHandler, e_1;\r\n return __generator(this, function (_a) {\r\n switch (_a.label) {\r\n case 0:\r\n this.logger.trace(\"SilentAuthCodeClient.acquireToken called\");\r\n // Auth code payload is required\r\n if (!request.code) {\r\n throw BrowserAuthError.createAuthCodeRequiredError();\r\n }\r\n // Create silent request\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientInitializeAuthorizationRequest, request.correlationId);\r\n return [4 /*yield*/, this.initializeAuthorizationRequest(request, InteractionType.Silent)];\r\n case 1:\r\n silentRequest = _a.sent();\r\n this.browserStorage.updateCacheEntries(silentRequest.state, silentRequest.nonce, silentRequest.authority, silentRequest.loginHint || Constants.EMPTY_STRING, silentRequest.account || null);\r\n serverTelemetryManager = this.initializeServerTelemetryManager(this.apiId);\r\n _a.label = 2;\r\n case 2:\r\n _a.trys.push([2, 4, , 5]);\r\n authCodeRequest = __assign(__assign({}, silentRequest), { code: request.code });\r\n // Initialize the client\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.StandardInteractionClientGetClientConfiguration, request.correlationId);\r\n return [4 /*yield*/, this.getClientConfiguration(serverTelemetryManager, silentRequest.authority)];\r\n case 3:\r\n clientConfig = _a.sent();\r\n authClient = new HybridSpaAuthorizationCodeClient(clientConfig);\r\n this.logger.verbose(\"Auth code client created\");\r\n silentHandler = new SilentHandler(authClient, this.browserStorage, authCodeRequest, this.logger, this.config.system, this.performanceClient);\r\n // Handle auth code parameters from request\r\n return [2 /*return*/, silentHandler.handleCodeResponseFromServer({\r\n code: request.code,\r\n msgraph_host: request.msGraphHost,\r\n cloud_graph_host_name: request.cloudGraphHostName,\r\n cloud_instance_host_name: request.cloudInstanceHostName\r\n }, silentRequest.state, authClient.authority, this.networkClient, false)];\r\n case 4:\r\n e_1 = _a.sent();\r\n if (e_1 instanceof AuthError) {\r\n e_1.setCorrelationId(this.correlationId);\r\n }\r\n serverTelemetryManager.cacheFailedRequest(e_1);\r\n this.browserStorage.cleanRequestByState(silentRequest.state);\r\n throw e_1;\r\n case 5: return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Currently Unsupported\r\n */\r\n SilentAuthCodeClient.prototype.logout = function () {\r\n // Synchronous so we must reject\r\n return Promise.reject(BrowserAuthError.createSilentLogoutUnsupportedError());\r\n };\r\n return SilentAuthCodeClient;\r\n}(StandardInteractionClient));\n\nexport { SilentAuthCodeClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar BrowserPerformanceMeasurement = /** @class */ (function () {\r\n function BrowserPerformanceMeasurement(name, correlationId) {\r\n this.correlationId = correlationId;\r\n this.measureName = BrowserPerformanceMeasurement.makeMeasureName(name, correlationId);\r\n this.startMark = BrowserPerformanceMeasurement.makeStartMark(name, correlationId);\r\n this.endMark = BrowserPerformanceMeasurement.makeEndMark(name, correlationId);\r\n }\r\n BrowserPerformanceMeasurement.makeMeasureName = function (name, correlationId) {\r\n return \"msal.measure.\" + name + \".\" + correlationId;\r\n };\r\n BrowserPerformanceMeasurement.makeStartMark = function (name, correlationId) {\r\n return \"msal.start.\" + name + \".\" + correlationId;\r\n };\r\n BrowserPerformanceMeasurement.makeEndMark = function (name, correlationId) {\r\n return \"msal.end.\" + name + \".\" + correlationId;\r\n };\r\n BrowserPerformanceMeasurement.supportsBrowserPerformance = function () {\r\n return typeof window !== \"undefined\" &&\r\n typeof window.performance !== \"undefined\" &&\r\n typeof window.performance.mark === \"function\" &&\r\n typeof window.performance.measure === \"function\" &&\r\n typeof window.performance.clearMarks === \"function\" &&\r\n typeof window.performance.clearMeasures === \"function\" &&\r\n typeof window.performance.getEntriesByName === \"function\";\r\n };\r\n /**\r\n * Flush browser marks and measurements.\r\n * @param {string} correlationId\r\n * @param {SubMeasurement} measurements\r\n */\r\n BrowserPerformanceMeasurement.flushMeasurements = function (correlationId, measurements) {\r\n if (BrowserPerformanceMeasurement.supportsBrowserPerformance()) {\r\n try {\r\n measurements.forEach(function (measurement) {\r\n var measureName = BrowserPerformanceMeasurement.makeMeasureName(measurement.name, correlationId);\r\n var entriesForMeasurement = window.performance.getEntriesByName(measureName, \"measure\");\r\n if (entriesForMeasurement.length > 0) {\r\n window.performance.clearMeasures(measureName);\r\n window.performance.clearMarks(BrowserPerformanceMeasurement.makeStartMark(measureName, correlationId));\r\n window.performance.clearMarks(BrowserPerformanceMeasurement.makeEndMark(measureName, correlationId));\r\n }\r\n });\r\n }\r\n catch (e) {\r\n // Silently catch and return null\r\n }\r\n }\r\n };\r\n BrowserPerformanceMeasurement.prototype.startMeasurement = function () {\r\n if (BrowserPerformanceMeasurement.supportsBrowserPerformance()) {\r\n try {\r\n window.performance.mark(this.startMark);\r\n }\r\n catch (e) {\r\n // Silently catch\r\n }\r\n }\r\n };\r\n BrowserPerformanceMeasurement.prototype.endMeasurement = function () {\r\n if (BrowserPerformanceMeasurement.supportsBrowserPerformance()) {\r\n try {\r\n window.performance.mark(this.endMark);\r\n window.performance.measure(this.measureName, this.startMark, this.endMark);\r\n }\r\n catch (e) {\r\n // Silently catch\r\n }\r\n }\r\n };\r\n BrowserPerformanceMeasurement.prototype.flushMeasurement = function () {\r\n if (BrowserPerformanceMeasurement.supportsBrowserPerformance()) {\r\n try {\r\n var entriesForMeasurement = window.performance.getEntriesByName(this.measureName, \"measure\");\r\n if (entriesForMeasurement.length > 0) {\r\n var durationMs = entriesForMeasurement[0].duration;\r\n window.performance.clearMeasures(this.measureName);\r\n window.performance.clearMarks(this.startMark);\r\n window.performance.clearMarks(this.endMark);\r\n return durationMs;\r\n }\r\n }\r\n catch (e) {\r\n // Silently catch and return null\r\n }\r\n }\r\n return null;\r\n };\r\n return BrowserPerformanceMeasurement;\r\n}());\n\nexport { BrowserPerformanceMeasurement };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __assign } from '../_virtual/_tslib.js';\nimport { PerformanceClient } from '@azure/msal-common';\nimport { BrowserCrypto } from '../crypto/BrowserCrypto.js';\nimport { GuidGenerator } from '../crypto/GuidGenerator.js';\nimport { BrowserPerformanceMeasurement } from './BrowserPerformanceMeasurement.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar BrowserPerformanceClient = /** @class */ (function (_super) {\r\n __extends(BrowserPerformanceClient, _super);\r\n function BrowserPerformanceClient(clientId, authority, logger, libraryName, libraryVersion, applicationTelemetry, cryptoOptions) {\r\n var _this = _super.call(this, clientId, authority, logger, libraryName, libraryVersion, applicationTelemetry) || this;\r\n _this.browserCrypto = new BrowserCrypto(_this.logger, cryptoOptions);\r\n _this.guidGenerator = new GuidGenerator(_this.browserCrypto);\r\n return _this;\r\n }\r\n BrowserPerformanceClient.prototype.startPerformanceMeasuremeant = function (measureName, correlationId) {\r\n return new BrowserPerformanceMeasurement(measureName, correlationId);\r\n };\r\n BrowserPerformanceClient.prototype.generateId = function () {\r\n return this.guidGenerator.generateGuid();\r\n };\r\n BrowserPerformanceClient.prototype.getPageVisibility = function () {\r\n var _a;\r\n return ((_a = document.visibilityState) === null || _a === void 0 ? void 0 : _a.toString()) || null;\r\n };\r\n BrowserPerformanceClient.prototype.deleteIncompleteSubMeasurements = function (inProgressEvent) {\r\n var rootEvent = this.eventsByCorrelationId.get(inProgressEvent.event.correlationId);\r\n var isRootEvent = rootEvent && rootEvent.eventId === inProgressEvent.event.eventId;\r\n var incompleteMeasurements = [];\r\n if (isRootEvent && (rootEvent === null || rootEvent === void 0 ? void 0 : rootEvent.incompleteSubMeasurements)) {\r\n rootEvent.incompleteSubMeasurements.forEach(function (subMeasurement) {\r\n incompleteMeasurements.push(__assign({}, subMeasurement));\r\n });\r\n }\r\n // Clean up remaining marks for incomplete sub-measurements\r\n if (incompleteMeasurements.length > 0) {\r\n BrowserPerformanceMeasurement.flushMeasurements(inProgressEvent.event.correlationId, incompleteMeasurements);\r\n }\r\n };\r\n BrowserPerformanceClient.prototype.supportsBrowserPerformanceNow = function () {\r\n return typeof window !== \"undefined\" &&\r\n typeof window.performance !== \"undefined\" &&\r\n typeof window.performance.now === \"function\";\r\n };\r\n /**\r\n * Starts measuring performance for a given operation. Returns a function that should be used to end the measurement.\r\n * Also captures browser page visibilityState.\r\n *\r\n * @param {PerformanceEvents} measureName\r\n * @param {?string} [correlationId]\r\n * @returns {((event?: Partial) => PerformanceEvent| null)}\r\n */\r\n BrowserPerformanceClient.prototype.startMeasurement = function (measureName, correlationId) {\r\n var _this = this;\r\n // Capture page visibilityState and then invoke start/end measurement\r\n var startPageVisibility = this.getPageVisibility();\r\n var inProgressEvent = _super.prototype.startMeasurement.call(this, measureName, correlationId);\r\n return __assign(__assign({}, inProgressEvent), { endMeasurement: function (event) {\r\n var res = inProgressEvent.endMeasurement(__assign({ startPageVisibility: startPageVisibility, endPageVisibility: _this.getPageVisibility() }, event));\r\n _this.deleteIncompleteSubMeasurements(inProgressEvent);\r\n return res;\r\n }, discardMeasurement: function () {\r\n inProgressEvent.discardMeasurement();\r\n _this.deleteIncompleteSubMeasurements(inProgressEvent);\r\n inProgressEvent.measurement.flushMeasurement();\r\n } });\r\n };\r\n /**\r\n * Adds pre-queue time to preQueueTimeByCorrelationId map.\r\n * @param {PerformanceEvents} eventName\r\n * @param {?string} correlationId\r\n * @returns\r\n */\r\n BrowserPerformanceClient.prototype.setPreQueueTime = function (eventName, correlationId) {\r\n if (!this.supportsBrowserPerformanceNow()) {\r\n this.logger.trace(\"BrowserPerformanceClient: window performance API not available, unable to set telemetry queue time for \" + eventName);\r\n return;\r\n }\r\n if (!correlationId) {\r\n this.logger.trace(\"BrowserPerformanceClient: correlationId for \" + eventName + \" not provided, unable to set telemetry queue time\");\r\n return;\r\n }\r\n var preQueueEvent = this.preQueueTimeByCorrelationId.get(correlationId);\r\n /**\r\n * Manually complete queue measurement if there is an incomplete pre-queue event.\r\n * Incomplete pre-queue events are instrumentation bugs that should be fixed.\r\n */\r\n if (preQueueEvent) {\r\n this.logger.trace(\"BrowserPerformanceClient: Incomplete pre-queue \" + preQueueEvent.name + \" found\", correlationId);\r\n this.addQueueMeasurement(preQueueEvent.name, correlationId, undefined, true);\r\n }\r\n this.preQueueTimeByCorrelationId.set(correlationId, { name: eventName, time: window.performance.now() });\r\n };\r\n /**\r\n * Calculates and adds queue time measurement for given performance event.\r\n *\r\n * @param {PerformanceEvents} eventName\r\n * @param {?string} correlationId\r\n * @param {?number} queueTime\r\n * @param {?boolean} manuallyCompleted - indicator for manually completed queue measurements\r\n * @returns\r\n */\r\n BrowserPerformanceClient.prototype.addQueueMeasurement = function (eventName, correlationId, queueTime, manuallyCompleted) {\r\n if (!this.supportsBrowserPerformanceNow()) {\r\n this.logger.trace(\"BrowserPerformanceClient: window performance API not available, unable to add queue measurement for \" + eventName);\r\n return;\r\n }\r\n if (!correlationId) {\r\n this.logger.trace(\"BrowserPerformanceClient: correlationId for \" + eventName + \" not provided, unable to add queue measurement\");\r\n return;\r\n }\r\n var preQueueTime = _super.prototype.getPreQueueTime.call(this, eventName, correlationId);\r\n if (!preQueueTime) {\r\n return;\r\n }\r\n var currentTime = window.performance.now();\r\n var resQueueTime = queueTime || _super.prototype.calculateQueuedTime.call(this, preQueueTime, currentTime);\r\n return _super.prototype.addQueueMeasurement.call(this, eventName, correlationId, resQueueTime, manuallyCompleted);\r\n };\r\n return BrowserPerformanceClient;\r\n}(PerformanceClient));\n\nexport { BrowserPerformanceClient };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __extends, __awaiter, __assign, __generator } from '../_virtual/_tslib.js';\nimport { PerformanceEvents, AccountEntity, Constants, ServerError, InteractionRequiredAuthError, InteractionRequiredAuthErrorMessage } from '@azure/msal-common';\nimport { DEFAULT_REQUEST, InteractionType, CacheLookupPolicy, ApiId, BrowserConstants } from '../utils/BrowserConstants.js';\nimport { ClientApplication } from './ClientApplication.js';\nimport { EventType } from '../event/EventType.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { NativeAuthError } from '../error/NativeAuthError.js';\nimport { NativeMessageHandler } from '../broker/nativeBroker/NativeMessageHandler.js';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\n/**\r\n * The PublicClientApplication class is the object exposed by the library to perform authentication and authorization functions in Single Page Applications\r\n * to obtain JWT tokens as described in the OAuth 2.0 Authorization Code Flow with PKCE specification.\r\n */\r\nvar PublicClientApplication = /** @class */ (function (_super) {\r\n __extends(PublicClientApplication, _super);\r\n /**\r\n * @constructor\r\n * Constructor for the PublicClientApplication used to instantiate the PublicClientApplication object\r\n *\r\n * Important attributes in the Configuration object for auth are:\r\n * - clientID: the application ID of your application. You can obtain one by registering your application with our Application registration portal : https://portal.azure.com/#blade/Microsoft_AAD_IAM/ActiveDirectoryMenuBlade/RegisteredAppsPreview\r\n * - authority: the authority URL for your application.\r\n * - redirect_uri: the uri of your application registered in the portal.\r\n *\r\n * In Azure AD, authority is a URL indicating the Azure active directory that MSAL uses to obtain tokens.\r\n * It is of the form https://login.microsoftonline.com/{Enter_the_Tenant_Info_Here}\r\n * If your application supports Accounts in one organizational directory, replace \"Enter_the_Tenant_Info_Here\" value with the Tenant Id or Tenant name (for example, contoso.microsoft.com).\r\n * If your application supports Accounts in any organizational directory, replace \"Enter_the_Tenant_Info_Here\" value with organizations.\r\n * If your application supports Accounts in any organizational directory and personal Microsoft accounts, replace \"Enter_the_Tenant_Info_Here\" value with common.\r\n * To restrict support to Personal Microsoft accounts only, replace \"Enter_the_Tenant_Info_Here\" value with consumers.\r\n *\r\n * In Azure B2C, authority is of the form https://{instance}/tfp/{tenant}/{policyName}/\r\n * Full B2C functionality will be available in this library in future versions.\r\n *\r\n * @param configuration object for the MSAL PublicClientApplication instance\r\n */\r\n function PublicClientApplication(configuration) {\r\n var _this = _super.call(this, configuration) || this;\r\n _this.astsAsyncMeasurement = undefined;\r\n _this.activeSilentTokenRequests = new Map();\r\n // Register listener functions\r\n _this.trackPageVisibility = _this.trackPageVisibility.bind(_this);\r\n return _this;\r\n }\r\n /**\r\n * Use when initiating the login process by redirecting the user's browser to the authorization endpoint. This function redirects the page, so\r\n * any code that follows this function will not execute.\r\n *\r\n * IMPORTANT: It is NOT recommended to have code that is dependent on the resolution of the Promise. This function will navigate away from the current\r\n * browser window. It currently returns a Promise in order to reflect the asynchronous nature of the code running in this function.\r\n *\r\n * @param request\r\n */\r\n PublicClientApplication.prototype.loginRedirect = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId;\r\n return __generator(this, function (_a) {\r\n correlationId = this.getRequestCorrelationId(request);\r\n this.logger.verbose(\"loginRedirect called\", correlationId);\r\n return [2 /*return*/, this.acquireTokenRedirect(__assign({ correlationId: correlationId }, (request || DEFAULT_REQUEST)))];\r\n });\r\n });\r\n };\r\n /**\r\n * Use when initiating the login process via opening a popup window in the user's browser\r\n *\r\n * @param request\r\n *\r\n * @returns A promise that is fulfilled when this function has completed, or rejected if an error was raised.\r\n */\r\n PublicClientApplication.prototype.loginPopup = function (request) {\r\n var correlationId = this.getRequestCorrelationId(request);\r\n this.logger.verbose(\"loginPopup called\", correlationId);\r\n return this.acquireTokenPopup(__assign({ correlationId: correlationId }, (request || DEFAULT_REQUEST)));\r\n };\r\n /**\r\n * Silently acquire an access token for a given set of scopes. Returns currently processing promise if parallel requests are made.\r\n *\r\n * @param {@link (SilentRequest:type)}\r\n * @returns {Promise.} - a promise that is fulfilled when this function has completed, or rejected if an error was raised. Returns the {@link AuthResponse} object\r\n */\r\n PublicClientApplication.prototype.acquireTokenSilent = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId, atsMeasurement, account, thumbprint, silentRequestKey, cachedResponse, response;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n correlationId = this.getRequestCorrelationId(request);\r\n atsMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.AcquireTokenSilent, correlationId);\r\n atsMeasurement.addStaticFields({\r\n cacheLookupPolicy: request.cacheLookupPolicy\r\n });\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Silent);\r\n this.logger.verbose(\"acquireTokenSilent called\", correlationId);\r\n account = request.account || this.getActiveAccount();\r\n if (!account) {\r\n throw BrowserAuthError.createNoAccountError();\r\n }\r\n thumbprint = {\r\n clientId: this.config.auth.clientId,\r\n authority: request.authority || Constants.EMPTY_STRING,\r\n scopes: request.scopes,\r\n homeAccountIdentifier: account.homeAccountId,\r\n claims: request.claims,\r\n authenticationScheme: request.authenticationScheme,\r\n resourceRequestMethod: request.resourceRequestMethod,\r\n resourceRequestUri: request.resourceRequestUri,\r\n shrClaims: request.shrClaims,\r\n sshKid: request.sshKid\r\n };\r\n silentRequestKey = JSON.stringify(thumbprint);\r\n cachedResponse = this.activeSilentTokenRequests.get(silentRequestKey);\r\n if (typeof cachedResponse === \"undefined\") {\r\n this.logger.verbose(\"acquireTokenSilent called for the first time, storing active request\", correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.AcquireTokenSilentAsync, correlationId);\r\n response = this.acquireTokenSilentAsync(__assign(__assign({}, request), { correlationId: correlationId }), account)\r\n .then(function (result) {\r\n _this.activeSilentTokenRequests.delete(silentRequestKey);\r\n atsMeasurement.addStaticFields({\r\n accessTokenSize: result.accessToken.length,\r\n idTokenSize: result.idToken.length\r\n });\r\n atsMeasurement.endMeasurement({\r\n success: true,\r\n fromCache: result.fromCache,\r\n isNativeBroker: result.fromNativeBroker,\r\n cacheLookupPolicy: request.cacheLookupPolicy,\r\n requestId: result.requestId,\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n _this.activeSilentTokenRequests.delete(silentRequestKey);\r\n atsMeasurement.endMeasurement({\r\n errorCode: error.errorCode,\r\n subErrorCode: error.subError,\r\n success: false\r\n });\r\n throw error;\r\n });\r\n this.activeSilentTokenRequests.set(silentRequestKey, response);\r\n return [2 /*return*/, response];\r\n }\r\n else {\r\n this.logger.verbose(\"acquireTokenSilent has been called previously, returning the result from the first call\", correlationId);\r\n // Discard measurements for memoized calls, as they are usually only a couple of ms and will artificially deflate metrics\r\n atsMeasurement.discardMeasurement();\r\n return [2 /*return*/, cachedResponse];\r\n }\r\n });\r\n });\r\n };\r\n PublicClientApplication.prototype.trackPageVisibility = function () {\r\n if (!this.astsAsyncMeasurement) {\r\n return;\r\n }\r\n this.logger.info(\"Perf: Visibility change detected\");\r\n this.astsAsyncMeasurement.increment({\r\n visibilityChangeCount: 1,\r\n });\r\n };\r\n /**\r\n * Silently acquire an access token for a given set of scopes. Will use cached token if available, otherwise will attempt to acquire a new token from the network via refresh token.\r\n * @param {@link (SilentRequest:type)}\r\n * @param {@link (AccountInfo:type)}\r\n * @returns {Promise.} - a promise that is fulfilled when this function has completed, or rejected if an error was raised. Returns the {@link AuthResponse}\r\n */\r\n PublicClientApplication.prototype.acquireTokenSilentAsync = function (request, account) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var result, silentRequest, silentCacheClient, silentRequest_1, requestWithCLP_1;\r\n var _this = this;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.AcquireTokenSilentAsync, request.correlationId);\r\n this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_START, InteractionType.Silent, request);\r\n this.astsAsyncMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.AcquireTokenSilentAsync, request.correlationId);\r\n (_a = this.astsAsyncMeasurement) === null || _a === void 0 ? void 0 : _a.increment({\r\n visibilityChangeCount: 0\r\n });\r\n document.addEventListener(\"visibilitychange\", this.trackPageVisibility);\r\n if (!(NativeMessageHandler.isNativeAvailable(this.config, this.logger, this.nativeExtensionProvider, request.authenticationScheme) && account.nativeAccountId)) return [3 /*break*/, 1];\r\n this.logger.verbose(\"acquireTokenSilent - attempting to acquire token from native platform\");\r\n silentRequest = __assign(__assign({}, request), { account: account });\r\n result = this.acquireTokenNative(silentRequest, ApiId.acquireTokenSilent_silentFlow).catch(function (e) { return __awaiter(_this, void 0, void 0, function () {\r\n var silentIframeClient;\r\n return __generator(this, function (_a) {\r\n // If native token acquisition fails for availability reasons fallback to web flow\r\n if (e instanceof NativeAuthError && e.isFatal()) {\r\n this.logger.verbose(\"acquireTokenSilent - native platform unavailable, falling back to web flow\");\r\n this.nativeExtensionProvider = undefined; // Prevent future requests from continuing to attempt\r\n silentIframeClient = this.createSilentIframeClient(request.correlationId);\r\n return [2 /*return*/, silentIframeClient.acquireToken(request)];\r\n }\r\n throw e;\r\n });\r\n }); });\r\n return [3 /*break*/, 3];\r\n case 1:\r\n this.logger.verbose(\"acquireTokenSilent - attempting to acquire token from web flow\");\r\n silentCacheClient = this.createSilentCacheClient(request.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.InitializeSilentRequest, request.correlationId);\r\n return [4 /*yield*/, silentCacheClient.initializeSilentRequest(request, account)];\r\n case 2:\r\n silentRequest_1 = _b.sent();\r\n requestWithCLP_1 = __assign(__assign({}, request), { \r\n // set the request's CacheLookupPolicy to Default if it was not optionally passed in\r\n cacheLookupPolicy: request.cacheLookupPolicy || CacheLookupPolicy.Default });\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.AcquireTokenFromCache, silentRequest_1.correlationId);\r\n result = this.acquireTokenFromCache(silentCacheClient, silentRequest_1, requestWithCLP_1).catch(function (cacheError) {\r\n if (requestWithCLP_1.cacheLookupPolicy === CacheLookupPolicy.AccessToken) {\r\n throw cacheError;\r\n }\r\n // block the reload if it occurred inside a hidden iframe\r\n BrowserUtils.blockReloadInHiddenIframes();\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_NETWORK_START, InteractionType.Silent, silentRequest_1);\r\n _this.performanceClient.setPreQueueTime(PerformanceEvents.AcquireTokenByRefreshToken, silentRequest_1.correlationId);\r\n return _this.acquireTokenByRefreshToken(silentRequest_1, requestWithCLP_1).catch(function (refreshTokenError) {\r\n var isServerError = refreshTokenError instanceof ServerError;\r\n var isInteractionRequiredError = refreshTokenError instanceof InteractionRequiredAuthError;\r\n var rtNotFound = (refreshTokenError.errorCode === InteractionRequiredAuthErrorMessage.noTokensFoundError.code);\r\n var isInvalidGrantError = (refreshTokenError.errorCode === BrowserConstants.INVALID_GRANT_ERROR);\r\n if ((!isServerError ||\r\n !isInvalidGrantError ||\r\n isInteractionRequiredError ||\r\n requestWithCLP_1.cacheLookupPolicy === CacheLookupPolicy.AccessTokenAndRefreshToken ||\r\n requestWithCLP_1.cacheLookupPolicy === CacheLookupPolicy.RefreshToken)\r\n && (requestWithCLP_1.cacheLookupPolicy !== CacheLookupPolicy.Skip)\r\n && !rtNotFound) {\r\n throw refreshTokenError;\r\n }\r\n _this.logger.verbose(\"Refresh token expired/invalid or CacheLookupPolicy is set to Skip, attempting acquire token by iframe.\", request.correlationId);\r\n _this.performanceClient.setPreQueueTime(PerformanceEvents.AcquireTokenBySilentIframe, silentRequest_1.correlationId);\r\n return _this.acquireTokenBySilentIframe(silentRequest_1);\r\n });\r\n });\r\n _b.label = 3;\r\n case 3: return [2 /*return*/, result.then(function (response) {\r\n var _a;\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_SUCCESS, InteractionType.Silent, response);\r\n (_a = _this.astsAsyncMeasurement) === null || _a === void 0 ? void 0 : _a.endMeasurement({\r\n success: true,\r\n fromCache: response.fromCache,\r\n isNativeBroker: response.fromNativeBroker,\r\n requestId: response.requestId\r\n });\r\n return response;\r\n }).catch(function (tokenRenewalError) {\r\n var _a;\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_FAILURE, InteractionType.Silent, null, tokenRenewalError);\r\n (_a = _this.astsAsyncMeasurement) === null || _a === void 0 ? void 0 : _a.endMeasurement({\r\n errorCode: tokenRenewalError.errorCode,\r\n subErrorCode: tokenRenewalError.subError,\r\n success: false\r\n });\r\n throw tokenRenewalError;\r\n }).finally(function () {\r\n document.removeEventListener(\"visibilitychange\", _this.trackPageVisibility);\r\n })];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Hydrates cache with the tokens and account in the AuthenticationResult object\r\n * @param result\r\n * @param request - The request object that was used to obtain the AuthenticationResult\r\n * @returns\r\n */\r\n PublicClientApplication.prototype.hydrateCache = function (result, request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var accountEntity;\r\n return __generator(this, function (_a) {\r\n this.logger.verbose(\"hydrateCache called\");\r\n if (result.account) {\r\n accountEntity = AccountEntity.createFromAccountInfo(result.account, result.cloudGraphHostName, result.msGraphHost);\r\n this.browserStorage.setAccount(accountEntity);\r\n if (result.fromNativeBroker) {\r\n this.logger.verbose(\"Response was from native broker, storing in-memory\");\r\n // Tokens from native broker are stored in-memory\r\n return [2 /*return*/, this.nativeInternalStorage.hydrateCache(result, request)];\r\n }\r\n else {\r\n return [2 /*return*/, this.browserStorage.hydrateCache(result, request)];\r\n }\r\n }\r\n return [2 /*return*/];\r\n });\r\n });\r\n };\r\n return PublicClientApplication;\r\n}(ClientApplication));\n\nexport { PublicClientApplication };\n","/*! @azure/msal-browser v2.39.0 2024-06-06 */\n'use strict';\nimport { __awaiter, __generator, __assign } from '../_virtual/_tslib.js';\nimport { CryptoOps } from '../crypto/CryptoOps.js';\nimport { PerformanceEvents, InteractionRequiredAuthError, PromptValue, Constants, Logger, StubPerformanceClient, DEFAULT_CRYPTO_IMPLEMENTATION, AuthError, ClientAuthError } from '@azure/msal-common';\nimport { BrowserCacheManager, DEFAULT_BROWSER_CACHE_MANAGER } from '../cache/BrowserCacheManager.js';\nimport { buildConfiguration } from '../config/Configuration.js';\nimport { InteractionType, ApiId, BrowserCacheLocation, TemporaryCacheKeys, CacheLookupPolicy } from '../utils/BrowserConstants.js';\nimport { BrowserUtils } from '../utils/BrowserUtils.js';\nimport { name, version } from '../packageMetadata.js';\nimport { EventType } from '../event/EventType.js';\nimport { BrowserConfigurationAuthError } from '../error/BrowserConfigurationAuthError.js';\nimport { EventHandler } from '../event/EventHandler.js';\nimport { PopupClient } from '../interaction_client/PopupClient.js';\nimport { RedirectClient } from '../interaction_client/RedirectClient.js';\nimport { SilentIframeClient } from '../interaction_client/SilentIframeClient.js';\nimport { SilentRefreshClient } from '../interaction_client/SilentRefreshClient.js';\nimport { TokenCache } from '../cache/TokenCache.js';\nimport { NativeInteractionClient } from '../interaction_client/NativeInteractionClient.js';\nimport { NativeMessageHandler } from '../broker/nativeBroker/NativeMessageHandler.js';\nimport { NativeAuthError } from '../error/NativeAuthError.js';\nimport { SilentCacheClient } from '../interaction_client/SilentCacheClient.js';\nimport { SilentAuthCodeClient } from '../interaction_client/SilentAuthCodeClient.js';\nimport { BrowserAuthError } from '../error/BrowserAuthError.js';\nimport { BrowserPerformanceClient } from '../telemetry/BrowserPerformanceClient.js';\n\n/*\r\n * Copyright (c) Microsoft Corporation. All rights reserved.\r\n * Licensed under the MIT License.\r\n */\r\nvar ClientApplication = /** @class */ (function () {\r\n /**\r\n * @constructor\r\n * Constructor for the PublicClientApplication used to instantiate the PublicClientApplication object\r\n *\r\n * Important attributes in the Configuration object for auth are:\r\n * - clientID: the application ID of your application. You can obtain one by registering your application with our Application registration portal : https://portal.azure.com/#blade/Microsoft_AAD_IAM/ActiveDirectoryMenuBlade/RegisteredAppsPreview\r\n * - authority: the authority URL for your application.\r\n * - redirect_uri: the uri of your application registered in the portal.\r\n *\r\n * In Azure AD, authority is a URL indicating the Azure active directory that MSAL uses to obtain tokens.\r\n * It is of the form https://login.microsoftonline.com/{Enter_the_Tenant_Info_Here}\r\n * If your application supports Accounts in one organizational directory, replace \"Enter_the_Tenant_Info_Here\" value with the Tenant Id or Tenant name (for example, contoso.microsoft.com).\r\n * If your application supports Accounts in any organizational directory, replace \"Enter_the_Tenant_Info_Here\" value with organizations.\r\n * If your application supports Accounts in any organizational directory and personal Microsoft accounts, replace \"Enter_the_Tenant_Info_Here\" value with common.\r\n * To restrict support to Personal Microsoft accounts only, replace \"Enter_the_Tenant_Info_Here\" value with consumers.\r\n *\r\n * In Azure B2C, authority is of the form https://{instance}/tfp/{tenant}/{policyName}/\r\n * Full B2C functionality will be available in this library in future versions.\r\n *\r\n * @param configuration Object for the MSAL PublicClientApplication instance\r\n */\r\n function ClientApplication(configuration) {\r\n /*\r\n * If loaded in an environment where window is not available,\r\n * set internal flag to false so that further requests fail.\r\n * This is to support server-side rendering environments.\r\n */\r\n this.isBrowserEnvironment = typeof window !== \"undefined\";\r\n // Set the configuration.\r\n this.config = buildConfiguration(configuration, this.isBrowserEnvironment);\r\n this.initialized = false;\r\n // Initialize logger\r\n this.logger = new Logger(this.config.system.loggerOptions, name, version);\r\n // Initialize the network module class.\r\n this.networkClient = this.config.system.networkClient;\r\n // Initialize the navigation client class.\r\n this.navigationClient = this.config.system.navigationClient;\r\n // Initialize redirectResponse Map\r\n this.redirectResponse = new Map();\r\n // Initial hybrid spa map\r\n this.hybridAuthCodeResponses = new Map();\r\n // Initialize performance client\r\n this.performanceClient = this.isBrowserEnvironment ?\r\n new BrowserPerformanceClient(this.config.auth.clientId, this.config.auth.authority, this.logger, name, version, this.config.telemetry.application, this.config.system.cryptoOptions) :\r\n new StubPerformanceClient(this.config.auth.clientId, this.config.auth.authority, this.logger, name, version, this.config.telemetry.application);\r\n // Initialize the crypto class.\r\n this.browserCrypto = this.isBrowserEnvironment ? new CryptoOps(this.logger, this.performanceClient, this.config.system.cryptoOptions) : DEFAULT_CRYPTO_IMPLEMENTATION;\r\n this.eventHandler = new EventHandler(this.logger, this.browserCrypto);\r\n // Initialize the browser storage class.\r\n this.browserStorage = this.isBrowserEnvironment ?\r\n new BrowserCacheManager(this.config.auth.clientId, this.config.cache, this.browserCrypto, this.logger) :\r\n DEFAULT_BROWSER_CACHE_MANAGER(this.config.auth.clientId, this.logger);\r\n // initialize in memory storage for native flows\r\n var nativeCacheOptions = {\r\n cacheLocation: BrowserCacheLocation.MemoryStorage,\r\n temporaryCacheLocation: BrowserCacheLocation.MemoryStorage,\r\n storeAuthStateInCookie: false,\r\n secureCookies: false,\r\n cacheMigrationEnabled: false,\r\n claimsBasedCachingEnabled: true\r\n };\r\n this.nativeInternalStorage = new BrowserCacheManager(this.config.auth.clientId, nativeCacheOptions, this.browserCrypto, this.logger);\r\n // Initialize the token cache\r\n this.tokenCache = new TokenCache(this.config, this.browserStorage, this.logger, this.browserCrypto);\r\n // Register listener functions\r\n this.trackPageVisibilityWithMeasurement = this.trackPageVisibilityWithMeasurement.bind(this);\r\n }\r\n /**\r\n * Initializer function to perform async startup tasks such as connecting to WAM extension\r\n */\r\n ClientApplication.prototype.initialize = function () {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var allowNativeBroker, initMeasurement, _a, e_1, claimsTokensRemovalMeasurement;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.logger.trace(\"initialize called\");\r\n if (this.initialized) {\r\n this.logger.info(\"initialize has already been called, exiting early.\");\r\n return [2 /*return*/];\r\n }\r\n allowNativeBroker = this.config.system.allowNativeBroker;\r\n initMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.InitializeClientApplication);\r\n this.eventHandler.emitEvent(EventType.INITIALIZE_START);\r\n if (!allowNativeBroker) return [3 /*break*/, 4];\r\n _b.label = 1;\r\n case 1:\r\n _b.trys.push([1, 3, , 4]);\r\n _a = this;\r\n return [4 /*yield*/, NativeMessageHandler.createProvider(this.logger, this.config.system.nativeBrokerHandshakeTimeout, this.performanceClient)];\r\n case 2:\r\n _a.nativeExtensionProvider = _b.sent();\r\n return [3 /*break*/, 4];\r\n case 3:\r\n e_1 = _b.sent();\r\n this.logger.verbose(e_1);\r\n return [3 /*break*/, 4];\r\n case 4:\r\n if (!!this.config.cache.claimsBasedCachingEnabled) return [3 /*break*/, 6];\r\n this.logger.verbose(\"Claims-based caching is disabled. Clearing the previous cache with claims\");\r\n claimsTokensRemovalMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.ClearTokensAndKeysWithClaims);\r\n return [4 /*yield*/, this.browserStorage.clearTokensAndKeysWithClaims()];\r\n case 5:\r\n _b.sent();\r\n claimsTokensRemovalMeasurement.endMeasurement({ success: true });\r\n _b.label = 6;\r\n case 6:\r\n this.initialized = true;\r\n this.eventHandler.emitEvent(EventType.INITIALIZE_END);\r\n initMeasurement.endMeasurement({ allowNativeBroker: allowNativeBroker, success: true });\r\n return [2 /*return*/];\r\n }\r\n });\r\n });\r\n };\r\n // #region Redirect Flow\r\n /**\r\n * Event handler function which allows users to fire events after the PublicClientApplication object\r\n * has loaded during redirect flows. This should be invoked on all page loads involved in redirect\r\n * auth flows.\r\n * @param hash Hash to process. Defaults to the current value of window.location.hash. Only needs to be provided explicitly if the response to be handled is not contained in the current value.\r\n * @returns Token response or null. If the return value is null, then no auth redirect was detected.\r\n */\r\n ClientApplication.prototype.handleRedirectPromise = function (hash) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var loggedInAccounts, redirectResponseKey, response, request, redirectResponse, nativeClient, correlationId, redirectClient;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n this.logger.verbose(\"handleRedirectPromise called\");\r\n // Block token acquisition before initialize has been called if native brokering is enabled\r\n BrowserUtils.blockNativeBrokerCalledBeforeInitialized(this.config.system.allowNativeBroker, this.initialized);\r\n loggedInAccounts = this.getAllAccounts();\r\n if (this.isBrowserEnvironment) {\r\n redirectResponseKey = hash || Constants.EMPTY_STRING;\r\n response = this.redirectResponse.get(redirectResponseKey);\r\n if (typeof response === \"undefined\") {\r\n this.eventHandler.emitEvent(EventType.HANDLE_REDIRECT_START, InteractionType.Redirect);\r\n this.logger.verbose(\"handleRedirectPromise has been called for the first time, storing the promise\");\r\n request = this.browserStorage.getCachedNativeRequest();\r\n redirectResponse = void 0;\r\n if (request && NativeMessageHandler.isNativeAvailable(this.config, this.logger, this.nativeExtensionProvider) && this.nativeExtensionProvider && !hash) {\r\n this.logger.trace(\"handleRedirectPromise - acquiring token from native platform\");\r\n nativeClient = new NativeInteractionClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, ApiId.handleRedirectPromise, this.performanceClient, this.nativeExtensionProvider, request.accountId, this.nativeInternalStorage, request.correlationId);\r\n redirectResponse = nativeClient.handleRedirectPromise();\r\n }\r\n else {\r\n this.logger.trace(\"handleRedirectPromise - acquiring token from web flow\");\r\n correlationId = this.browserStorage.getTemporaryCache(TemporaryCacheKeys.CORRELATION_ID, true) || Constants.EMPTY_STRING;\r\n redirectClient = this.createRedirectClient(correlationId);\r\n redirectResponse = redirectClient.handleRedirectPromise(hash);\r\n }\r\n response = redirectResponse.then(function (result) {\r\n if (result) {\r\n // Emit login event if number of accounts change\r\n var isLoggingIn = loggedInAccounts.length < _this.getAllAccounts().length;\r\n if (isLoggingIn) {\r\n _this.eventHandler.emitEvent(EventType.LOGIN_SUCCESS, InteractionType.Redirect, result);\r\n _this.logger.verbose(\"handleRedirectResponse returned result, login success\");\r\n }\r\n else {\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_SUCCESS, InteractionType.Redirect, result);\r\n _this.logger.verbose(\"handleRedirectResponse returned result, acquire token success\");\r\n }\r\n }\r\n _this.eventHandler.emitEvent(EventType.HANDLE_REDIRECT_END, InteractionType.Redirect);\r\n return result;\r\n }).catch(function (e) {\r\n // Emit login event if there is an account\r\n if (loggedInAccounts.length > 0) {\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_FAILURE, InteractionType.Redirect, null, e);\r\n }\r\n else {\r\n _this.eventHandler.emitEvent(EventType.LOGIN_FAILURE, InteractionType.Redirect, null, e);\r\n }\r\n _this.eventHandler.emitEvent(EventType.HANDLE_REDIRECT_END, InteractionType.Redirect);\r\n throw e;\r\n });\r\n this.redirectResponse.set(redirectResponseKey, response);\r\n }\r\n else {\r\n this.logger.verbose(\"handleRedirectPromise has been called previously, returning the result from the first call\");\r\n }\r\n return [2 /*return*/, response];\r\n }\r\n this.logger.verbose(\"handleRedirectPromise returns null, not browser environment\");\r\n return [2 /*return*/, null];\r\n });\r\n });\r\n };\r\n /**\r\n * Use when you want to obtain an access_token for your API by redirecting the user's browser window to the authorization endpoint. This function redirects\r\n * the page, so any code that follows this function will not execute.\r\n *\r\n * IMPORTANT: It is NOT recommended to have code that is dependent on the resolution of the Promise. This function will navigate away from the current\r\n * browser window. It currently returns a Promise in order to reflect the asynchronous nature of the code running in this function.\r\n *\r\n * @param request\r\n */\r\n ClientApplication.prototype.acquireTokenRedirect = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId, isLoggedIn, result, nativeClient, redirectClient;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n correlationId = this.getRequestCorrelationId(request);\r\n this.logger.verbose(\"acquireTokenRedirect called\", correlationId);\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Redirect);\r\n isLoggedIn = this.getAllAccounts().length > 0;\r\n if (isLoggedIn) {\r\n this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_START, InteractionType.Redirect, request);\r\n }\r\n else {\r\n this.eventHandler.emitEvent(EventType.LOGIN_START, InteractionType.Redirect, request);\r\n }\r\n if (this.nativeExtensionProvider && this.canUseNative(request)) {\r\n nativeClient = new NativeInteractionClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, ApiId.acquireTokenRedirect, this.performanceClient, this.nativeExtensionProvider, this.getNativeAccountId(request), this.nativeInternalStorage, request.correlationId);\r\n result = nativeClient.acquireTokenRedirect(request).catch(function (e) {\r\n if (e instanceof NativeAuthError && e.isFatal()) {\r\n _this.nativeExtensionProvider = undefined; // If extension gets uninstalled during session prevent future requests from continuing to attempt\r\n var redirectClient = _this.createRedirectClient(request.correlationId);\r\n return redirectClient.acquireToken(request);\r\n }\r\n else if (e instanceof InteractionRequiredAuthError) {\r\n _this.logger.verbose(\"acquireTokenRedirect - Resolving interaction required error thrown by native broker by falling back to web flow\");\r\n var redirectClient = _this.createRedirectClient(request.correlationId);\r\n return redirectClient.acquireToken(request);\r\n }\r\n _this.browserStorage.setInteractionInProgress(false);\r\n throw e;\r\n });\r\n }\r\n else {\r\n redirectClient = this.createRedirectClient(request.correlationId);\r\n result = redirectClient.acquireToken(request);\r\n }\r\n return [2 /*return*/, result.catch(function (e) {\r\n // If logged in, emit acquire token events\r\n if (isLoggedIn) {\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_FAILURE, InteractionType.Redirect, null, e);\r\n }\r\n else {\r\n _this.eventHandler.emitEvent(EventType.LOGIN_FAILURE, InteractionType.Redirect, null, e);\r\n }\r\n throw e;\r\n })];\r\n });\r\n });\r\n };\r\n // #endregion\r\n // #region Popup Flow\r\n /**\r\n * Use when you want to obtain an access_token for your API via opening a popup window in the user's browser\r\n *\r\n * @param request\r\n *\r\n * @returns A promise that is fulfilled when this function has completed, or rejected if an error was raised.\r\n */\r\n ClientApplication.prototype.acquireTokenPopup = function (request) {\r\n var _this = this;\r\n var correlationId = this.getRequestCorrelationId(request);\r\n var atPopupMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.AcquireTokenPopup, correlationId);\r\n try {\r\n this.logger.verbose(\"acquireTokenPopup called\", correlationId);\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Popup);\r\n }\r\n catch (e) {\r\n // Since this function is syncronous we need to reject\r\n return Promise.reject(e);\r\n }\r\n // If logged in, emit acquire token events\r\n var loggedInAccounts = this.getAllAccounts();\r\n if (loggedInAccounts.length > 0) {\r\n this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_START, InteractionType.Popup, request);\r\n }\r\n else {\r\n this.eventHandler.emitEvent(EventType.LOGIN_START, InteractionType.Popup, request);\r\n }\r\n var result;\r\n if (this.canUseNative(request)) {\r\n result = this.acquireTokenNative(request, ApiId.acquireTokenPopup).then(function (response) {\r\n _this.browserStorage.setInteractionInProgress(false);\r\n atPopupMeasurement.endMeasurement({\r\n success: true,\r\n isNativeBroker: true,\r\n requestId: response.requestId\r\n });\r\n return response;\r\n }).catch(function (e) {\r\n if (e instanceof NativeAuthError && e.isFatal()) {\r\n _this.nativeExtensionProvider = undefined; // If extension gets uninstalled during session prevent future requests from continuing to attempt\r\n var popupClient = _this.createPopupClient(request.correlationId);\r\n return popupClient.acquireToken(request);\r\n }\r\n else if (e instanceof InteractionRequiredAuthError) {\r\n _this.logger.verbose(\"acquireTokenPopup - Resolving interaction required error thrown by native broker by falling back to web flow\");\r\n var popupClient = _this.createPopupClient(request.correlationId);\r\n return popupClient.acquireToken(request);\r\n }\r\n _this.browserStorage.setInteractionInProgress(false);\r\n throw e;\r\n });\r\n }\r\n else {\r\n var popupClient = this.createPopupClient(request.correlationId);\r\n result = popupClient.acquireToken(request);\r\n }\r\n return result.then(function (result) {\r\n /*\r\n * If logged in, emit acquire token events\r\n */\r\n var isLoggingIn = loggedInAccounts.length < _this.getAllAccounts().length;\r\n if (isLoggingIn) {\r\n _this.eventHandler.emitEvent(EventType.LOGIN_SUCCESS, InteractionType.Popup, result);\r\n }\r\n else {\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_SUCCESS, InteractionType.Popup, result);\r\n }\r\n atPopupMeasurement.addStaticFields({\r\n accessTokenSize: result.accessToken.length,\r\n idTokenSize: result.idToken.length\r\n });\r\n atPopupMeasurement.endMeasurement({\r\n success: true,\r\n requestId: result.requestId\r\n });\r\n return result;\r\n }).catch(function (e) {\r\n if (loggedInAccounts.length > 0) {\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_FAILURE, InteractionType.Popup, null, e);\r\n }\r\n else {\r\n _this.eventHandler.emitEvent(EventType.LOGIN_FAILURE, InteractionType.Popup, null, e);\r\n }\r\n atPopupMeasurement.endMeasurement({\r\n errorCode: e.errorCode,\r\n subErrorCode: e.subError,\r\n success: false\r\n });\r\n // Since this function is syncronous we need to reject\r\n return Promise.reject(e);\r\n });\r\n };\r\n ClientApplication.prototype.trackPageVisibilityWithMeasurement = function () {\r\n var measurement = this.ssoSilentMeasurement || this.acquireTokenByCodeAsyncMeasurement;\r\n if (!measurement) {\r\n return;\r\n }\r\n this.logger.info(\"Perf: Visibility change detected in \", measurement.event.name);\r\n measurement.increment({\r\n visibilityChangeCount: 1,\r\n });\r\n };\r\n // #endregion\r\n // #region Silent Flow\r\n /**\r\n * This function uses a hidden iframe to fetch an authorization code from the eSTS. There are cases where this may not work:\r\n * - Any browser using a form of Intelligent Tracking Prevention\r\n * - If there is not an established session with the service\r\n *\r\n * In these cases, the request must be done inside a popup or full frame redirect.\r\n *\r\n * For the cases where interaction is required, you cannot send a request with prompt=none.\r\n *\r\n * If your refresh token has expired, you can use this function to fetch a new set of tokens silently as long as\r\n * you session on the server still exists.\r\n * @param request {@link SsoSilentRequest}\r\n *\r\n * @returns A promise that is fulfilled when this function has completed, or rejected if an error was raised.\r\n */\r\n ClientApplication.prototype.ssoSilent = function (request) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId, validRequest, result, silentIframeClient;\r\n var _this = this;\r\n return __generator(this, function (_b) {\r\n correlationId = this.getRequestCorrelationId(request);\r\n validRequest = __assign(__assign({}, request), { \r\n // will be PromptValue.NONE or PromptValue.NO_SESSION\r\n prompt: request.prompt, correlationId: correlationId });\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Silent);\r\n this.ssoSilentMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.SsoSilent, correlationId);\r\n (_a = this.ssoSilentMeasurement) === null || _a === void 0 ? void 0 : _a.increment({\r\n visibilityChangeCount: 0\r\n });\r\n document.addEventListener(\"visibilitychange\", this.trackPageVisibilityWithMeasurement);\r\n this.logger.verbose(\"ssoSilent called\", correlationId);\r\n this.eventHandler.emitEvent(EventType.SSO_SILENT_START, InteractionType.Silent, validRequest);\r\n if (this.canUseNative(validRequest)) {\r\n result = this.acquireTokenNative(validRequest, ApiId.ssoSilent).catch(function (e) {\r\n // If native token acquisition fails for availability reasons fallback to standard flow\r\n if (e instanceof NativeAuthError && e.isFatal()) {\r\n _this.nativeExtensionProvider = undefined; // If extension gets uninstalled during session prevent future requests from continuing to attempt\r\n var silentIframeClient = _this.createSilentIframeClient(validRequest.correlationId);\r\n return silentIframeClient.acquireToken(validRequest);\r\n }\r\n throw e;\r\n });\r\n }\r\n else {\r\n silentIframeClient = this.createSilentIframeClient(validRequest.correlationId);\r\n result = silentIframeClient.acquireToken(validRequest);\r\n }\r\n return [2 /*return*/, result.then(function (response) {\r\n var _a, _b;\r\n _this.eventHandler.emitEvent(EventType.SSO_SILENT_SUCCESS, InteractionType.Silent, response);\r\n (_a = _this.ssoSilentMeasurement) === null || _a === void 0 ? void 0 : _a.addStaticFields({\r\n accessTokenSize: response.accessToken.length,\r\n idTokenSize: response.idToken.length\r\n });\r\n (_b = _this.ssoSilentMeasurement) === null || _b === void 0 ? void 0 : _b.endMeasurement({\r\n success: true,\r\n isNativeBroker: response.fromNativeBroker,\r\n requestId: response.requestId\r\n });\r\n return response;\r\n }).catch(function (e) {\r\n var _a;\r\n _this.eventHandler.emitEvent(EventType.SSO_SILENT_FAILURE, InteractionType.Silent, null, e);\r\n (_a = _this.ssoSilentMeasurement) === null || _a === void 0 ? void 0 : _a.endMeasurement({\r\n errorCode: e.errorCode,\r\n subErrorCode: e.subError,\r\n success: false\r\n });\r\n throw e;\r\n }).finally(function () {\r\n document.removeEventListener(\"visibilitychange\", _this.trackPageVisibilityWithMeasurement);\r\n })];\r\n });\r\n });\r\n };\r\n /**\r\n * This function redeems an authorization code (passed as code) from the eSTS token endpoint.\r\n * This authorization code should be acquired server-side using a confidential client to acquire a spa_code.\r\n * This API is not indended for normal authorization code acquisition and redemption.\r\n *\r\n * Redemption of this authorization code will not require PKCE, as it was acquired by a confidential client.\r\n *\r\n * @param request {@link AuthorizationCodeRequest}\r\n * @returns A promise that is fulfilled when this function has completed, or rejected if an error was raised.\r\n */\r\n ClientApplication.prototype.acquireTokenByCode = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId, atbcMeasurement, hybridAuthCode_1, response;\r\n var _this = this;\r\n return __generator(this, function (_a) {\r\n correlationId = this.getRequestCorrelationId(request);\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Silent);\r\n this.logger.trace(\"acquireTokenByCode called\", correlationId);\r\n this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_BY_CODE_START, InteractionType.Silent, request);\r\n atbcMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.AcquireTokenByCode, request.correlationId);\r\n try {\r\n if (request.code && request.nativeAccountId) {\r\n // Throw error in case server returns both spa_code and spa_accountid in exchange for auth code.\r\n throw BrowserAuthError.createSpaCodeAndNativeAccountIdPresentError();\r\n }\r\n else if (request.code) {\r\n hybridAuthCode_1 = request.code;\r\n response = this.hybridAuthCodeResponses.get(hybridAuthCode_1);\r\n if (!response) {\r\n this.logger.verbose(\"Initiating new acquireTokenByCode request\", correlationId);\r\n response = this.acquireTokenByCodeAsync(__assign(__assign({}, request), { correlationId: correlationId }))\r\n .then(function (result) {\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_BY_CODE_SUCCESS, InteractionType.Silent, result);\r\n _this.hybridAuthCodeResponses.delete(hybridAuthCode_1);\r\n atbcMeasurement.addStaticFields({\r\n accessTokenSize: result.accessToken.length,\r\n idTokenSize: result.idToken.length\r\n });\r\n atbcMeasurement.endMeasurement({\r\n success: true,\r\n isNativeBroker: result.fromNativeBroker,\r\n requestId: result.requestId\r\n });\r\n return result;\r\n })\r\n .catch(function (error) {\r\n _this.hybridAuthCodeResponses.delete(hybridAuthCode_1);\r\n _this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_BY_CODE_FAILURE, InteractionType.Silent, null, error);\r\n atbcMeasurement.endMeasurement({\r\n errorCode: error.errorCode,\r\n subErrorCode: error.subError,\r\n success: false\r\n });\r\n throw error;\r\n });\r\n this.hybridAuthCodeResponses.set(hybridAuthCode_1, response);\r\n }\r\n else {\r\n this.logger.verbose(\"Existing acquireTokenByCode request found\", request.correlationId);\r\n atbcMeasurement.discardMeasurement();\r\n }\r\n return [2 /*return*/, response];\r\n }\r\n else if (request.nativeAccountId) {\r\n if (this.canUseNative(request, request.nativeAccountId)) {\r\n return [2 /*return*/, this.acquireTokenNative(request, ApiId.acquireTokenByCode, request.nativeAccountId).catch(function (e) {\r\n // If native token acquisition fails for availability reasons fallback to standard flow\r\n if (e instanceof NativeAuthError && e.isFatal()) {\r\n _this.nativeExtensionProvider = undefined; // If extension gets uninstalled during session prevent future requests from continuing to attempt\r\n }\r\n throw e;\r\n })];\r\n }\r\n else {\r\n throw BrowserAuthError.createUnableToAcquireTokenFromNativePlatformError();\r\n }\r\n }\r\n else {\r\n throw BrowserAuthError.createAuthCodeOrNativeAccountIdRequiredError();\r\n }\r\n }\r\n catch (e) {\r\n this.eventHandler.emitEvent(EventType.ACQUIRE_TOKEN_BY_CODE_FAILURE, InteractionType.Silent, null, e);\r\n atbcMeasurement.endMeasurement({\r\n errorCode: e instanceof AuthError && e.errorCode || undefined,\r\n subErrorCode: e instanceof AuthError && e.subError || undefined,\r\n success: false\r\n });\r\n throw e;\r\n }\r\n return [2 /*return*/];\r\n });\r\n });\r\n };\r\n /**\r\n * Creates a SilentAuthCodeClient to redeem an authorization code.\r\n * @param request\r\n * @returns Result of the operation to redeem the authorization code\r\n */\r\n ClientApplication.prototype.acquireTokenByCodeAsync = function (request) {\r\n var _a;\r\n return __awaiter(this, void 0, void 0, function () {\r\n var silentAuthCodeClient, silentTokenResult;\r\n var _this = this;\r\n return __generator(this, function (_b) {\r\n switch (_b.label) {\r\n case 0:\r\n this.logger.trace(\"acquireTokenByCodeAsync called\", request.correlationId);\r\n this.acquireTokenByCodeAsyncMeasurement = this.performanceClient.startMeasurement(PerformanceEvents.AcquireTokenByCodeAsync, request.correlationId);\r\n (_a = this.acquireTokenByCodeAsyncMeasurement) === null || _a === void 0 ? void 0 : _a.increment({\r\n visibilityChangeCount: 0\r\n });\r\n document.addEventListener(\"visibilitychange\", this.trackPageVisibilityWithMeasurement);\r\n silentAuthCodeClient = this.createSilentAuthCodeClient(request.correlationId);\r\n return [4 /*yield*/, silentAuthCodeClient.acquireToken(request).then(function (response) {\r\n var _a;\r\n (_a = _this.acquireTokenByCodeAsyncMeasurement) === null || _a === void 0 ? void 0 : _a.endMeasurement({\r\n success: true,\r\n fromCache: response.fromCache,\r\n isNativeBroker: response.fromNativeBroker,\r\n requestId: response.requestId\r\n });\r\n return response;\r\n }).catch(function (tokenRenewalError) {\r\n var _a;\r\n (_a = _this.acquireTokenByCodeAsyncMeasurement) === null || _a === void 0 ? void 0 : _a.endMeasurement({\r\n errorCode: tokenRenewalError.errorCode,\r\n subErrorCode: tokenRenewalError.subError,\r\n success: false\r\n });\r\n throw tokenRenewalError;\r\n }).finally(function () {\r\n document.removeEventListener(\"visibilitychange\", _this.trackPageVisibilityWithMeasurement);\r\n })];\r\n case 1:\r\n silentTokenResult = _b.sent();\r\n return [2 /*return*/, silentTokenResult];\r\n }\r\n });\r\n });\r\n };\r\n /**\r\n * Attempt to acquire an access token from the cache\r\n * @param silentCacheClient SilentCacheClient\r\n * @param commonRequest CommonSilentFlowRequest\r\n * @param silentRequest SilentRequest\r\n * @returns A promise that, when resolved, returns the access token\r\n */\r\n ClientApplication.prototype.acquireTokenFromCache = function (silentCacheClient, commonRequest, silentRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n return __generator(this, function (_a) {\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.AcquireTokenFromCache, commonRequest.correlationId);\r\n switch (silentRequest.cacheLookupPolicy) {\r\n case CacheLookupPolicy.Default:\r\n case CacheLookupPolicy.AccessToken:\r\n case CacheLookupPolicy.AccessTokenAndRefreshToken:\r\n return [2 /*return*/, silentCacheClient.acquireToken(commonRequest)];\r\n default:\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n return [2 /*return*/];\r\n });\r\n });\r\n };\r\n /**\r\n * Attempt to acquire an access token via a refresh token\r\n * @param commonRequest CommonSilentFlowRequest\r\n * @param silentRequest SilentRequest\r\n * @returns A promise that, when resolved, returns the access token\r\n */\r\n ClientApplication.prototype.acquireTokenByRefreshToken = function (commonRequest, silentRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var silentRefreshClient;\r\n return __generator(this, function (_a) {\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.AcquireTokenByRefreshToken, commonRequest.correlationId);\r\n switch (silentRequest.cacheLookupPolicy) {\r\n case CacheLookupPolicy.Default:\r\n case CacheLookupPolicy.AccessTokenAndRefreshToken:\r\n case CacheLookupPolicy.RefreshToken:\r\n case CacheLookupPolicy.RefreshTokenAndNetwork:\r\n silentRefreshClient = this.createSilentRefreshClient(commonRequest.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.SilentRefreshClientAcquireToken, commonRequest.correlationId);\r\n return [2 /*return*/, silentRefreshClient.acquireToken(commonRequest)];\r\n default:\r\n throw ClientAuthError.createRefreshRequiredError();\r\n }\r\n return [2 /*return*/];\r\n });\r\n });\r\n };\r\n /**\r\n * Attempt to acquire an access token via an iframe\r\n * @param request CommonSilentFlowRequest\r\n * @returns A promise that, when resolved, returns the access token\r\n */\r\n ClientApplication.prototype.acquireTokenBySilentIframe = function (request) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var silentIframeClient;\r\n return __generator(this, function (_a) {\r\n this.performanceClient.addQueueMeasurement(PerformanceEvents.AcquireTokenBySilentIframe, request.correlationId);\r\n silentIframeClient = this.createSilentIframeClient(request.correlationId);\r\n this.performanceClient.setPreQueueTime(PerformanceEvents.SilentIframeClientAcquireToken, request.correlationId);\r\n return [2 /*return*/, silentIframeClient.acquireToken(request)];\r\n });\r\n });\r\n };\r\n // #endregion\r\n // #region Logout\r\n /**\r\n * Deprecated logout function. Use logoutRedirect or logoutPopup instead\r\n * @param logoutRequest\r\n * @deprecated\r\n */\r\n ClientApplication.prototype.logout = function (logoutRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId;\r\n return __generator(this, function (_a) {\r\n correlationId = this.getRequestCorrelationId(logoutRequest);\r\n this.logger.warning(\"logout API is deprecated and will be removed in msal-browser v3.0.0. Use logoutRedirect instead.\", correlationId);\r\n return [2 /*return*/, this.logoutRedirect(__assign({ correlationId: correlationId }, logoutRequest))];\r\n });\r\n });\r\n };\r\n /**\r\n * Use to log out the current user, and redirect the user to the postLogoutRedirectUri.\r\n * Default behaviour is to redirect the user to `window.location.href`.\r\n * @param logoutRequest\r\n */\r\n ClientApplication.prototype.logoutRedirect = function (logoutRequest) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var correlationId, redirectClient;\r\n return __generator(this, function (_a) {\r\n correlationId = this.getRequestCorrelationId(logoutRequest);\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Redirect);\r\n redirectClient = this.createRedirectClient(correlationId);\r\n return [2 /*return*/, redirectClient.logout(logoutRequest)];\r\n });\r\n });\r\n };\r\n /**\r\n * Clears local cache for the current user then opens a popup window prompting the user to sign-out of the server\r\n * @param logoutRequest\r\n */\r\n ClientApplication.prototype.logoutPopup = function (logoutRequest) {\r\n try {\r\n var correlationId = this.getRequestCorrelationId(logoutRequest);\r\n this.preflightBrowserEnvironmentCheck(InteractionType.Popup);\r\n var popupClient = this.createPopupClient(correlationId);\r\n return popupClient.logout(logoutRequest);\r\n }\r\n catch (e) {\r\n // Since this function is syncronous we need to reject\r\n return Promise.reject(e);\r\n }\r\n };\r\n // #endregion\r\n // #region Account APIs\r\n /**\r\n * Returns all accounts that MSAL currently has data for.\r\n * (the account object is created at the time of successful login)\r\n * or empty array when no accounts are found\r\n * @returns Array of account objects in cache\r\n */\r\n ClientApplication.prototype.getAllAccounts = function () {\r\n this.logger.verbose(\"getAllAccounts called\");\r\n return this.isBrowserEnvironment ? this.browserStorage.getAllAccounts() : [];\r\n };\r\n /**\r\n * Returns the signed in account matching username.\r\n * (the account object is created at the time of successful login)\r\n * or null when no matching account is found.\r\n * This API is provided for convenience but getAccountById should be used for best reliability\r\n * @param username\r\n * @returns The account object stored in MSAL\r\n */\r\n ClientApplication.prototype.getAccountByUsername = function (username) {\r\n this.logger.trace(\"getAccountByUsername called\");\r\n if (!username) {\r\n this.logger.warning(\"getAccountByUsername: No username provided\");\r\n return null;\r\n }\r\n var account = this.browserStorage.getAccountInfoFilteredBy({ username: username });\r\n if (account) {\r\n this.logger.verbose(\"getAccountByUsername: Account matching username found, returning\");\r\n this.logger.verbosePii(\"getAccountByUsername: Returning signed-in accounts matching username: \" + username);\r\n return account;\r\n }\r\n else {\r\n this.logger.verbose(\"getAccountByUsername: No matching account found, returning null\");\r\n return null;\r\n }\r\n };\r\n /**\r\n * Returns the signed in account matching homeAccountId.\r\n * (the account object is created at the time of successful login)\r\n * or null when no matching account is found\r\n * @param homeAccountId\r\n * @returns The account object stored in MSAL\r\n */\r\n ClientApplication.prototype.getAccountByHomeId = function (homeAccountId) {\r\n this.logger.trace(\"getAccountByHomeId called\");\r\n if (!homeAccountId) {\r\n this.logger.warning(\"getAccountByHomeId: No homeAccountId provided\");\r\n return null;\r\n }\r\n var account = this.browserStorage.getAccountInfoFilteredBy({ homeAccountId: homeAccountId });\r\n if (account) {\r\n this.logger.verbose(\"getAccountByHomeId: Account matching homeAccountId found, returning\");\r\n this.logger.verbosePii(\"getAccountByHomeId: Returning signed-in accounts matching homeAccountId: \" + homeAccountId);\r\n return account;\r\n }\r\n else {\r\n this.logger.verbose(\"getAccountByHomeId: No matching account found, returning null\");\r\n return null;\r\n }\r\n };\r\n /**\r\n * Returns the signed in account matching localAccountId.\r\n * (the account object is created at the time of successful login)\r\n * or null when no matching account is found\r\n * @param localAccountId\r\n * @returns The account object stored in MSAL\r\n */\r\n ClientApplication.prototype.getAccountByLocalId = function (localAccountId) {\r\n this.logger.trace(\"getAccountByLocalId called\");\r\n if (!localAccountId) {\r\n this.logger.warning(\"getAccountByLocalId: No localAccountId provided\");\r\n return null;\r\n }\r\n var account = this.browserStorage.getAccountInfoFilteredBy({ localAccountId: localAccountId });\r\n if (account) {\r\n this.logger.verbose(\"getAccountByLocalId: Account matching localAccountId found, returning\");\r\n this.logger.verbosePii(\"getAccountByLocalId: Returning signed-in accounts matching localAccountId: \" + localAccountId);\r\n return account;\r\n }\r\n else {\r\n this.logger.verbose(\"getAccountByLocalId: No matching account found, returning null\");\r\n return null;\r\n }\r\n };\r\n /**\r\n * Sets the account to use as the active account. If no account is passed to the acquireToken APIs, then MSAL will use this active account.\r\n * @param account\r\n */\r\n ClientApplication.prototype.setActiveAccount = function (account) {\r\n this.browserStorage.setActiveAccount(account);\r\n };\r\n /**\r\n * Gets the currently active account\r\n */\r\n ClientApplication.prototype.getActiveAccount = function () {\r\n return this.browserStorage.getActiveAccount();\r\n };\r\n // #endregion\r\n // #region Helpers\r\n /**\r\n * Helper to validate app environment before making an auth request\r\n *\r\n * @protected\r\n * @param {InteractionType} interactionType What kind of interaction is being used\r\n * @param {boolean} [setInteractionInProgress=true] Whether to set interaction in progress temp cache flag\r\n */\r\n ClientApplication.prototype.preflightBrowserEnvironmentCheck = function (interactionType, setInteractionInProgress) {\r\n if (setInteractionInProgress === void 0) { setInteractionInProgress = true; }\r\n this.logger.verbose(\"preflightBrowserEnvironmentCheck started\");\r\n // Block request if not in browser environment\r\n BrowserUtils.blockNonBrowserEnvironment(this.isBrowserEnvironment);\r\n // Block redirects if in an iframe\r\n BrowserUtils.blockRedirectInIframe(interactionType, this.config.system.allowRedirectInIframe);\r\n // Block auth requests inside a hidden iframe\r\n BrowserUtils.blockReloadInHiddenIframes();\r\n // Block redirectUri opened in a popup from calling MSAL APIs\r\n BrowserUtils.blockAcquireTokenInPopups();\r\n // Block token acquisition before initialize has been called if native brokering is enabled\r\n BrowserUtils.blockNativeBrokerCalledBeforeInitialized(this.config.system.allowNativeBroker, this.initialized);\r\n // Block redirects if memory storage is enabled but storeAuthStateInCookie is not\r\n if (interactionType === InteractionType.Redirect &&\r\n this.config.cache.cacheLocation === BrowserCacheLocation.MemoryStorage &&\r\n !this.config.cache.storeAuthStateInCookie) {\r\n throw BrowserConfigurationAuthError.createInMemoryRedirectUnavailableError();\r\n }\r\n if (interactionType === InteractionType.Redirect || interactionType === InteractionType.Popup) {\r\n this.preflightInteractiveRequest(setInteractionInProgress);\r\n }\r\n };\r\n /**\r\n * Preflight check for interactive requests\r\n *\r\n * @protected\r\n * @param {boolean} setInteractionInProgress Whether to set interaction in progress temp cache flag\r\n */\r\n ClientApplication.prototype.preflightInteractiveRequest = function (setInteractionInProgress) {\r\n this.logger.verbose(\"preflightInteractiveRequest called, validating app environment\");\r\n // block the reload if it occurred inside a hidden iframe\r\n BrowserUtils.blockReloadInHiddenIframes();\r\n // Set interaction in progress temporary cache or throw if alread set.\r\n if (setInteractionInProgress) {\r\n this.browserStorage.setInteractionInProgress(true);\r\n }\r\n };\r\n /**\r\n * Acquire a token from native device (e.g. WAM)\r\n * @param request\r\n */\r\n ClientApplication.prototype.acquireTokenNative = function (request, apiId, accountId) {\r\n return __awaiter(this, void 0, void 0, function () {\r\n var nativeClient;\r\n return __generator(this, function (_a) {\r\n this.logger.trace(\"acquireTokenNative called\");\r\n if (!this.nativeExtensionProvider) {\r\n throw BrowserAuthError.createNativeConnectionNotEstablishedError();\r\n }\r\n nativeClient = new NativeInteractionClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, apiId, this.performanceClient, this.nativeExtensionProvider, accountId || this.getNativeAccountId(request), this.nativeInternalStorage, request.correlationId);\r\n return [2 /*return*/, nativeClient.acquireToken(request)];\r\n });\r\n });\r\n };\r\n /**\r\n * Returns boolean indicating if this request can use the native broker\r\n * @param request\r\n */\r\n ClientApplication.prototype.canUseNative = function (request, accountId) {\r\n this.logger.trace(\"canUseNative called\");\r\n if (!NativeMessageHandler.isNativeAvailable(this.config, this.logger, this.nativeExtensionProvider, request.authenticationScheme)) {\r\n this.logger.trace(\"canUseNative: isNativeAvailable returned false, returning false\");\r\n return false;\r\n }\r\n if (request.prompt) {\r\n switch (request.prompt) {\r\n case PromptValue.NONE:\r\n case PromptValue.CONSENT:\r\n case PromptValue.LOGIN:\r\n this.logger.trace(\"canUseNative: prompt is compatible with native flow\");\r\n break;\r\n default:\r\n this.logger.trace(\"canUseNative: prompt = \" + request.prompt + \" is not compatible with native flow, returning false\");\r\n return false;\r\n }\r\n }\r\n if (!accountId && !this.getNativeAccountId(request)) {\r\n this.logger.trace(\"canUseNative: nativeAccountId is not available, returning false\");\r\n return false;\r\n }\r\n return true;\r\n };\r\n /**\r\n * Get the native accountId from the account\r\n * @param request\r\n * @returns\r\n */\r\n ClientApplication.prototype.getNativeAccountId = function (request) {\r\n var account = request.account || this.browserStorage.getAccountInfoByHints(request.loginHint, request.sid) || this.getActiveAccount();\r\n return account && account.nativeAccountId || \"\";\r\n };\r\n /**\r\n * Returns new instance of the Popup Interaction Client\r\n * @param correlationId\r\n */\r\n ClientApplication.prototype.createPopupClient = function (correlationId) {\r\n return new PopupClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, this.performanceClient, this.nativeInternalStorage, this.nativeExtensionProvider, correlationId);\r\n };\r\n /**\r\n * Returns new instance of the Redirect Interaction Client\r\n * @param correlationId\r\n */\r\n ClientApplication.prototype.createRedirectClient = function (correlationId) {\r\n return new RedirectClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, this.performanceClient, this.nativeInternalStorage, this.nativeExtensionProvider, correlationId);\r\n };\r\n /**\r\n * Returns new instance of the Silent Iframe Interaction Client\r\n * @param correlationId\r\n */\r\n ClientApplication.prototype.createSilentIframeClient = function (correlationId) {\r\n return new SilentIframeClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, ApiId.ssoSilent, this.performanceClient, this.nativeInternalStorage, this.nativeExtensionProvider, correlationId);\r\n };\r\n /**\r\n * Returns new instance of the Silent Cache Interaction Client\r\n */\r\n ClientApplication.prototype.createSilentCacheClient = function (correlationId) {\r\n return new SilentCacheClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, this.performanceClient, this.nativeExtensionProvider, correlationId);\r\n };\r\n /**\r\n * Returns new instance of the Silent Refresh Interaction Client\r\n */\r\n ClientApplication.prototype.createSilentRefreshClient = function (correlationId) {\r\n return new SilentRefreshClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, this.performanceClient, this.nativeExtensionProvider, correlationId);\r\n };\r\n /**\r\n * Returns new instance of the Silent AuthCode Interaction Client\r\n */\r\n ClientApplication.prototype.createSilentAuthCodeClient = function (correlationId) {\r\n return new SilentAuthCodeClient(this.config, this.browserStorage, this.browserCrypto, this.logger, this.eventHandler, this.navigationClient, ApiId.acquireTokenByCode, this.performanceClient, this.nativeExtensionProvider, correlationId);\r\n };\r\n /**\r\n * Adds event callbacks to array\r\n * @param callback\r\n */\r\n ClientApplication.prototype.addEventCallback = function (callback) {\r\n return this.eventHandler.addEventCallback(callback);\r\n };\r\n /**\r\n * Removes callback with provided id from callback array\r\n * @param callbackId\r\n */\r\n ClientApplication.prototype.removeEventCallback = function (callbackId) {\r\n this.eventHandler.removeEventCallback(callbackId);\r\n };\r\n /**\r\n * Registers a callback to receive performance events.\r\n *\r\n * @param {PerformanceCallbackFunction} callback\r\n * @returns {string}\r\n */\r\n ClientApplication.prototype.addPerformanceCallback = function (callback) {\r\n return this.performanceClient.addPerformanceCallback(callback);\r\n };\r\n /**\r\n * Removes a callback registered with addPerformanceCallback.\r\n *\r\n * @param {string} callbackId\r\n * @returns {boolean}\r\n */\r\n ClientApplication.prototype.removePerformanceCallback = function (callbackId) {\r\n return this.performanceClient.removePerformanceCallback(callbackId);\r\n };\r\n /**\r\n * Adds event listener that emits an event when a user account is added or removed from localstorage in a different browser tab or window\r\n */\r\n ClientApplication.prototype.enableAccountStorageEvents = function () {\r\n this.eventHandler.enableAccountStorageEvents();\r\n };\r\n /**\r\n * Removes event listener that emits an event when a user account is added or removed from localstorage in a different browser tab or window\r\n */\r\n ClientApplication.prototype.disableAccountStorageEvents = function () {\r\n this.eventHandler.disableAccountStorageEvents();\r\n };\r\n /**\r\n * Gets the token cache for the application.\r\n */\r\n ClientApplication.prototype.getTokenCache = function () {\r\n return this.tokenCache;\r\n };\r\n /**\r\n * Returns the logger instance\r\n */\r\n ClientApplication.prototype.getLogger = function () {\r\n return this.logger;\r\n };\r\n /**\r\n * Replaces the default logger set in configurations with new Logger with new configurations\r\n * @param logger Logger instance\r\n */\r\n ClientApplication.prototype.setLogger = function (logger) {\r\n this.logger = logger;\r\n };\r\n /**\r\n * Called by wrapper libraries (Angular & React) to set SKU and Version passed down to telemetry, logger, etc.\r\n * @param sku\r\n * @param version\r\n */\r\n ClientApplication.prototype.initializeWrapperLibrary = function (sku, version) {\r\n // Validate the SKU passed in is one we expect\r\n this.browserStorage.setWrapperMetadata(sku, version);\r\n };\r\n /**\r\n * Sets navigation client\r\n * @param navigationClient\r\n */\r\n ClientApplication.prototype.setNavigationClient = function (navigationClient) {\r\n this.navigationClient = navigationClient;\r\n };\r\n /**\r\n * Returns the configuration object\r\n */\r\n ClientApplication.prototype.getConfiguration = function () {\r\n return this.config;\r\n };\r\n /**\r\n * Generates a correlation id for a request if none is provided.\r\n *\r\n * @protected\r\n * @param {?Partial} [request]\r\n * @returns {string}\r\n */\r\n ClientApplication.prototype.getRequestCorrelationId = function (request) {\r\n if (request === null || request === void 0 ? void 0 : request.correlationId) {\r\n return request.correlationId;\r\n }\r\n if (this.isBrowserEnvironment) {\r\n return this.browserCrypto.createNewGuid();\r\n }\r\n /*\r\n * Included for fallback for non-browser environments,\r\n * and to ensure this method always returns a string.\r\n */\r\n return Constants.EMPTY_STRING;\r\n };\r\n return ClientApplication;\r\n}());\n\nexport { ClientApplication };\n","import * as i0 from '@angular/core';\nimport { ElementRef, Injector, Directive, EventEmitter, Inject, Output, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Throws an exception when attempting to attach a null portal to a host.\n * @docs-private\n */\nfunction throwNullPortalError() {\n throw Error('Must provide a portal to attach');\n}\n/**\n * Throws an exception when attempting to attach a portal to a host that is already attached.\n * @docs-private\n */\nfunction throwPortalAlreadyAttachedError() {\n throw Error('Host already has a portal attached');\n}\n/**\n * Throws an exception when attempting to attach a portal to an already-disposed host.\n * @docs-private\n */\nfunction throwPortalOutletAlreadyDisposedError() {\n throw Error('This PortalOutlet has already been disposed');\n}\n/**\n * Throws an exception when attempting to attach an unknown portal type.\n * @docs-private\n */\nfunction throwUnknownPortalTypeError() {\n throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' +\n 'a ComponentPortal or a TemplatePortal.');\n}\n/**\n * Throws an exception when attempting to attach a portal to a null host.\n * @docs-private\n */\nfunction throwNullPortalOutletError() {\n throw Error('Attempting to attach a portal to a null PortalOutlet');\n}\n/**\n * Throws an exception when attempting to detach a portal that is not attached.\n * @docs-private\n */\nfunction throwNoPortalAttachedError() {\n throw Error('Attempting to detach a portal that is not attached to a host');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A `Portal` is something that you want to render somewhere else.\n * It can be attach to / detached from a `PortalOutlet`.\n */\nclass Portal {\n /** Attach this portal to a host. */\n attach(host) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (host == null) {\n throwNullPortalOutletError();\n }\n if (host.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n }\n this._attachedHost = host;\n return host.attach(this);\n }\n /** Detach this portal from its host */\n detach() {\n let host = this._attachedHost;\n if (host != null) {\n this._attachedHost = null;\n host.detach();\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwNoPortalAttachedError();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalOutlet reference without performing `attach()`. This is used directly by\n * the PortalOutlet when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal extends Portal {\n constructor(component, viewContainerRef, injector, componentFactoryResolver, projectableNodes) {\n super();\n this.component = component;\n this.viewContainerRef = viewContainerRef;\n this.injector = injector;\n this.componentFactoryResolver = componentFactoryResolver;\n this.projectableNodes = projectableNodes;\n }\n}\n/**\n * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef).\n */\nclass TemplatePortal extends Portal {\n constructor(\n /** The embedded template that will be used to instantiate an embedded View in the host. */\n templateRef, \n /** Reference to the ViewContainer into which the template will be stamped out. */\n viewContainerRef, \n /** Contextual data to be passed in to the embedded view. */\n context, \n /** The injector to use for the embedded view. */\n injector) {\n super();\n this.templateRef = templateRef;\n this.viewContainerRef = viewContainerRef;\n this.context = context;\n this.injector = injector;\n }\n get origin() {\n return this.templateRef.elementRef;\n }\n /**\n * Attach the portal to the provided `PortalOutlet`.\n * When a context is provided it will override the `context` property of the `TemplatePortal`\n * instance.\n */\n attach(host, context = this.context) {\n this.context = context;\n return super.attach(host);\n }\n detach() {\n this.context = undefined;\n return super.detach();\n }\n}\n/**\n * A `DomPortal` is a portal whose DOM element will be taken from its current position\n * in the DOM and moved into a portal outlet, when it is attached. On detach, the content\n * will be restored to its original position.\n */\nclass DomPortal extends Portal {\n constructor(element) {\n super();\n this.element = element instanceof ElementRef ? element.nativeElement : element;\n }\n}\n/**\n * Partial implementation of PortalOutlet that handles attaching\n * ComponentPortal and TemplatePortal.\n */\nclass BasePortalOutlet {\n constructor() {\n /** Whether this host has already been permanently disposed. */\n this._isDisposed = false;\n // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method.\n this.attachDomPortal = null;\n }\n /** Whether this host has an attached portal. */\n hasAttached() {\n return !!this._attachedPortal;\n }\n /** Attaches a portal. */\n attach(portal) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!portal) {\n throwNullPortalError();\n }\n if (this.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n if (this._isDisposed) {\n throwPortalOutletAlreadyDisposedError();\n }\n }\n if (portal instanceof ComponentPortal) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal);\n }\n else if (portal instanceof TemplatePortal) {\n this._attachedPortal = portal;\n return this.attachTemplatePortal(portal);\n // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`.\n }\n else if (this.attachDomPortal && portal instanceof DomPortal) {\n this._attachedPortal = portal;\n return this.attachDomPortal(portal);\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwUnknownPortalTypeError();\n }\n }\n /** Detaches a previously attached portal. */\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost(null);\n this._attachedPortal = null;\n }\n this._invokeDisposeFn();\n }\n /** Permanently dispose of this portal host. */\n dispose() {\n if (this.hasAttached()) {\n this.detach();\n }\n this._invokeDisposeFn();\n this._isDisposed = true;\n }\n /** @docs-private */\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n _invokeDisposeFn() {\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = null;\n }\n }\n}\n/**\n * @deprecated Use `BasePortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass BasePortalHost extends BasePortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n */\nclass DomPortalOutlet extends BasePortalOutlet {\n /**\n * @param outletElement Element into which the content is projected.\n * @param _componentFactoryResolver Used to resolve the component factory.\n * Only required when attaching component portals.\n * @param _appRef Reference to the application. Only used in component portals when there\n * is no `ViewContainerRef` available.\n * @param _defaultInjector Injector to use as a fallback when the portal being attached doesn't\n * have one. Only used for component portals.\n * @param _document Reference to the document. Used when attaching a DOM portal. Will eventually\n * become a required parameter.\n */\n constructor(\n /** Element into which the content is projected. */\n outletElement, _componentFactoryResolver, _appRef, _defaultInjector, \n /**\n * @deprecated `_document` Parameter to be made required.\n * @breaking-change 10.0.0\n */\n _document) {\n super();\n this.outletElement = outletElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._defaultInjector = _defaultInjector;\n /**\n * Attaches a DOM portal by transferring its content into the outlet.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 10.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n element.parentNode.insertBefore(anchorNode, element);\n this.outletElement.appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n // We can't use `replaceWith` here because IE doesn't support it.\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n const resolver = (portal.componentFactoryResolver || this._componentFactoryResolver);\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !resolver) {\n throw Error('Cannot attach component portal to outlet without a ComponentFactoryResolver.');\n }\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the view to the application.\n if (portal.viewContainerRef) {\n componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector, portal.projectableNodes || undefined);\n this.setDisposeFn(() => componentRef.destroy());\n }\n else {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !this._appRef) {\n throw Error('Cannot attach component portal to outlet without an ApplicationRef.');\n }\n componentRef = componentFactory.create(portal.injector || this._defaultInjector || Injector.NULL);\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n // Verify that the ApplicationRef has registered views before trying to detach a host view.\n // This check also protects the `detachView` from being called on a destroyed ApplicationRef.\n if (this._appRef.viewCount > 0) {\n this._appRef.detachView(componentRef.hostView);\n }\n componentRef.destroy();\n });\n }\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n this.outletElement.appendChild(this._getComponentRootNode(componentRef));\n this._attachedPortal = portal;\n return componentRef;\n }\n /**\n * Attaches a template portal to the DOM as an embedded view.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n let viewContainer = portal.viewContainerRef;\n let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n // The method `createEmbeddedView` will add the view as a child of the viewContainer.\n // But for the DomPortalOutlet the view can be added everywhere in the DOM\n // (e.g Overlay Container) To move the view to the specified host element. We just\n // re-append the existing root nodes.\n viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode));\n // Note that we want to detect changes after the nodes have been moved so that\n // any directives inside the portal that are looking at the DOM inside a lifecycle\n // hook won't be invoked too early.\n viewRef.detectChanges();\n this.setDisposeFn(() => {\n let index = viewContainer.indexOf(viewRef);\n if (index !== -1) {\n viewContainer.remove(index);\n }\n });\n this._attachedPortal = portal;\n // TODO(jelbourn): Return locals from view.\n return viewRef;\n }\n /**\n * Clears out a portal from the DOM.\n */\n dispose() {\n super.dispose();\n this.outletElement.remove();\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n/**\n * @deprecated Use `DomPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass DomPortalHost extends DomPortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal,\n * the directive instance itself can be attached to a host, enabling declarative use of portals.\n */\nclass CdkPortal extends TemplatePortal {\n constructor(templateRef, viewContainerRef) {\n super(templateRef, viewContainerRef);\n }\n}\nCdkPortal.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortal, deps: [{ token: i0.TemplateRef }, { token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortal.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkPortal, selector: \"[cdkPortal]\", exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortal, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortal]',\n exportAs: 'cdkPortal',\n }]\n }], ctorParameters: function () { return [{ type: i0.TemplateRef }, { type: i0.ViewContainerRef }]; } });\n/**\n * @deprecated Use `CdkPortal` instead.\n * @breaking-change 9.0.0\n */\nclass TemplatePortalDirective extends CdkPortal {\n}\nTemplatePortalDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: TemplatePortalDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nTemplatePortalDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: TemplatePortalDirective, selector: \"[cdk-portal], [portal]\", providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ], exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: TemplatePortalDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-portal], [portal]',\n exportAs: 'cdkPortal',\n providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ],\n }]\n }] });\n/**\n * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be\n * directly attached to it, enabling declarative use.\n *\n * Usage:\n * ``\n */\nclass CdkPortalOutlet extends BasePortalOutlet {\n constructor(_componentFactoryResolver, _viewContainerRef, \n /**\n * @deprecated `_document` parameter to be made required.\n * @breaking-change 9.0.0\n */\n _document) {\n super();\n this._componentFactoryResolver = _componentFactoryResolver;\n this._viewContainerRef = _viewContainerRef;\n /** Whether the portal component is initialized. */\n this._isInitialized = false;\n /** Emits when a portal is attached to the outlet. */\n this.attached = new EventEmitter();\n /**\n * Attaches the given DomPortal to this PortalHost by moving all of the portal content into it.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 9.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n portal.setAttachedHost(this);\n element.parentNode.insertBefore(anchorNode, element);\n this._getRootNode().appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /** Portal associated with the Portal outlet. */\n get portal() {\n return this._attachedPortal;\n }\n set portal(portal) {\n // Ignore the cases where the `portal` is set to a falsy value before the lifecycle hooks have\n // run. This handles the cases where the user might do something like `
`\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal || null;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedRef = this._attachedPortal = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector, portal.projectableNodes || undefined);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE\n ? nativeElement\n : nativeElement.parentNode);\n }\n}\nCdkPortalOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortalOutlet, deps: [{ token: i0.ComponentFactoryResolver }, { token: i0.ViewContainerRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortalOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkPortalOutlet, selector: \"[cdkPortalOutlet]\", inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortalOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n inputs: ['portal: cdkPortalOutlet'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ComponentFactoryResolver }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { attached: [{\n type: Output\n }] } });\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n}\nPortalHostDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalHostDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nPortalHostDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: PortalHostDirective, selector: \"[cdkPortalHost], [portalHost]\", inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ], exportAs: [\"cdkPortalHost\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalHostDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: ['portal: cdkPortalHost'],\n providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ],\n }]\n }] });\nclass PortalModule {\n}\nPortalModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPortalModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule, declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] });\nPortalModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n","import * as i1 from '@angular/cdk/scrolling';\nimport { ScrollingModule } from '@angular/cdk/scrolling';\nexport { CdkScrollable, ScrollDispatcher, ViewportRuler } from '@angular/cdk/scrolling';\nimport * as i6 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, Optional, ElementRef, ApplicationRef, ANIMATION_MODULE_TYPE, InjectionToken, Directive, EventEmitter, Input, Output, NgModule } from '@angular/core';\nimport { coerceCssPixelValue, coerceArray, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/platform';\nimport { supportsScrollBehavior, _getEventTarget, _isTestEnvironment } from '@angular/cdk/platform';\nimport { filter, take, takeUntil, takeWhile } from 'rxjs/operators';\nimport * as i5 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { DomPortalOutlet, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { Subject, Subscription, merge } from 'rxjs';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst scrollBehaviorSupported = supportsScrollBehavior();\n/**\n * Strategy that will prevent the user from scrolling while the overlay is visible.\n */\nclass BlockScrollStrategy {\n constructor(_viewportRuler, document) {\n this._viewportRuler = _viewportRuler;\n this._previousHTMLStyles = { top: '', left: '' };\n this._isEnabled = false;\n this._document = document;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach() { }\n /** Blocks page-level scroll while the attached overlay is open. */\n enable() {\n if (this._canBeEnabled()) {\n const root = this._document.documentElement;\n this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition();\n // Cache the previous inline styles in case the user had set them.\n this._previousHTMLStyles.left = root.style.left || '';\n this._previousHTMLStyles.top = root.style.top || '';\n // Note: we're using the `html` node, instead of the `body`, because the `body` may\n // have the user agent margin, whereas the `html` is guaranteed not to have one.\n root.style.left = coerceCssPixelValue(-this._previousScrollPosition.left);\n root.style.top = coerceCssPixelValue(-this._previousScrollPosition.top);\n root.classList.add('cdk-global-scrollblock');\n this._isEnabled = true;\n }\n }\n /** Unblocks page-level scroll while the attached overlay is open. */\n disable() {\n if (this._isEnabled) {\n const html = this._document.documentElement;\n const body = this._document.body;\n const htmlStyle = html.style;\n const bodyStyle = body.style;\n const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || '';\n const previousBodyScrollBehavior = bodyStyle.scrollBehavior || '';\n this._isEnabled = false;\n htmlStyle.left = this._previousHTMLStyles.left;\n htmlStyle.top = this._previousHTMLStyles.top;\n html.classList.remove('cdk-global-scrollblock');\n // Disable user-defined smooth scrolling temporarily while we restore the scroll position.\n // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior\n // Note that we don't mutate the property if the browser doesn't support `scroll-behavior`,\n // because it can throw off feature detections in `supportsScrollBehavior` which\n // checks for `'scrollBehavior' in documentElement.style`.\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto';\n }\n window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top);\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = previousHtmlScrollBehavior;\n bodyStyle.scrollBehavior = previousBodyScrollBehavior;\n }\n }\n }\n _canBeEnabled() {\n // Since the scroll strategies can't be singletons, we have to use a global CSS class\n // (`cdk-global-scrollblock`) to make sure that we don't try to disable global\n // scrolling multiple times.\n const html = this._document.documentElement;\n if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) {\n return false;\n }\n const body = this._document.body;\n const viewport = this._viewportRuler.getViewportSize();\n return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when attempting to attach an already-attached scroll strategy.\n */\nfunction getMatScrollStrategyAlreadyAttachedError() {\n return Error(`Scroll strategy has already been attached.`);\n}\n\n/**\n * Strategy that will close the overlay as soon as the user starts scrolling.\n */\nclass CloseScrollStrategy {\n constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._config = _config;\n this._scrollSubscription = null;\n /** Detaches the overlay ref and disables the scroll strategy. */\n this._detach = () => {\n this.disable();\n if (this._overlayRef.hasAttached()) {\n this._ngZone.run(() => this._overlayRef.detach());\n }\n };\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables the closing of the attached overlay on scroll. */\n enable() {\n if (this._scrollSubscription) {\n return;\n }\n const stream = this._scrollDispatcher.scrolled(0).pipe(filter(scrollable => {\n return (!scrollable ||\n !this._overlayRef.overlayElement.contains(scrollable.getElementRef().nativeElement));\n }));\n if (this._config && this._config.threshold && this._config.threshold > 1) {\n this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n this._scrollSubscription = stream.subscribe(() => {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) {\n this._detach();\n }\n else {\n this._overlayRef.updatePosition();\n }\n });\n }\n else {\n this._scrollSubscription = stream.subscribe(this._detach);\n }\n }\n /** Disables the closing the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Scroll strategy that doesn't do anything. */\nclass NoopScrollStrategy {\n /** Does nothing, as this scroll strategy is a no-op. */\n enable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n disable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n attach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Gets whether an element is scrolled outside of view by any of its parent scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is scrolled out of view\n * @docs-private\n */\nfunction isElementScrolledOutsideView(element, scrollContainers) {\n return scrollContainers.some(containerBounds => {\n const outsideAbove = element.bottom < containerBounds.top;\n const outsideBelow = element.top > containerBounds.bottom;\n const outsideLeft = element.right < containerBounds.left;\n const outsideRight = element.left > containerBounds.right;\n return outsideAbove || outsideBelow || outsideLeft || outsideRight;\n });\n}\n/**\n * Gets whether an element is clipped by any of its scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is clipped\n * @docs-private\n */\nfunction isElementClippedByScrolling(element, scrollContainers) {\n return scrollContainers.some(scrollContainerRect => {\n const clippedAbove = element.top < scrollContainerRect.top;\n const clippedBelow = element.bottom > scrollContainerRect.bottom;\n const clippedLeft = element.left < scrollContainerRect.left;\n const clippedRight = element.right > scrollContainerRect.right;\n return clippedAbove || clippedBelow || clippedLeft || clippedRight;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Strategy that will update the element position as the user is scrolling.\n */\nclass RepositionScrollStrategy {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n this._config = _config;\n this._scrollSubscription = null;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables repositioning of the attached overlay on scroll. */\n enable() {\n if (!this._scrollSubscription) {\n const throttle = this._config ? this._config.scrollThrottle : 0;\n this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => {\n this._overlayRef.updatePosition();\n // TODO(crisbeto): make `close` on by default once all components can handle it.\n if (this._config && this._config.autoClose) {\n const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect();\n const { width, height } = this._viewportRuler.getViewportSize();\n // TODO(crisbeto): include all ancestor scroll containers here once\n // we have a way of exposing the trigger element to the scroll strategy.\n const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }];\n if (isElementScrolledOutsideView(overlayRect, parentRects)) {\n this.disable();\n this._ngZone.run(() => this._overlayRef.detach());\n }\n }\n });\n }\n }\n /** Disables repositioning of the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Options for how an overlay will handle scrolling.\n *\n * Users can provide a custom value for `ScrollStrategyOptions` to replace the default\n * behaviors. This class primarily acts as a factory for ScrollStrategy instances.\n */\nclass ScrollStrategyOptions {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n /** Do nothing on scroll. */\n this.noop = () => new NoopScrollStrategy();\n /**\n * Close the overlay as soon as the user scrolls.\n * @param config Configuration to be used inside the scroll strategy.\n */\n this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config);\n /** Block scrolling. */\n this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document);\n /**\n * Update the overlay's position on scroll.\n * @param config Configuration to be used inside the scroll strategy.\n * Allows debouncing the reposition calls.\n */\n this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config);\n this._document = document;\n }\n}\nScrollStrategyOptions.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollStrategyOptions, deps: [{ token: i1.ScrollDispatcher }, { token: i1.ViewportRuler }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollStrategyOptions.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollStrategyOptions, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollStrategyOptions, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.ScrollDispatcher }, { type: i1.ViewportRuler }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Initial configuration used when creating an overlay. */\nclass OverlayConfig {\n constructor(config) {\n /** Strategy to be used when handling scroll events while the overlay is open. */\n this.scrollStrategy = new NoopScrollStrategy();\n /** Custom class to add to the overlay pane. */\n this.panelClass = '';\n /** Whether the overlay has a backdrop. */\n this.hasBackdrop = false;\n /** Custom class to add to the backdrop */\n this.backdropClass = 'cdk-overlay-dark-backdrop';\n /**\n * Whether the overlay should be disposed of when the user goes backwards/forwards in history.\n * Note that this usually doesn't include clicking on links (unless the user is using\n * the `HashLocationStrategy`).\n */\n this.disposeOnNavigation = false;\n if (config) {\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n const configKeys = Object.keys(config);\n for (const key of configKeys) {\n if (config[key] !== undefined) {\n // TypeScript, as of version 3.5, sees the left-hand-side of this expression\n // as \"I don't know *which* key this is, so the only valid value is the intersection\n // of all the possible values.\" In this case, that happens to be `undefined`. TypeScript\n // is not smart enough to see that the right-hand-side is actually an access of the same\n // exact type with the same exact key, meaning that the value type must be identical.\n // So we use `any` to work around this.\n this[key] = config[key];\n }\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The points of the origin element and the overlay element to connect. */\nclass ConnectionPositionPair {\n constructor(origin, overlay, \n /** Offset along the X axis. */\n offsetX, \n /** Offset along the Y axis. */\n offsetY, \n /** Class(es) to be applied to the panel while this position is active. */\n panelClass) {\n this.offsetX = offsetX;\n this.offsetY = offsetY;\n this.panelClass = panelClass;\n this.originX = origin.originX;\n this.originY = origin.originY;\n this.overlayX = overlay.overlayX;\n this.overlayY = overlay.overlayY;\n }\n}\n/**\n * Set of properties regarding the position of the origin and overlay relative to the viewport\n * with respect to the containing Scrollable elements.\n *\n * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the\n * bounds of any one of the strategy's Scrollable's bounding client rectangle.\n *\n * The overlay and origin are outside view if there is no overlap between their bounding client\n * rectangle and any one of the strategy's Scrollable's bounding client rectangle.\n *\n * ----------- -----------\n * | outside | | clipped |\n * | view | --------------------------\n * | | | | | |\n * ---------- | ----------- |\n * -------------------------- | |\n * | | | Scrollable |\n * | | | |\n * | | --------------------------\n * | Scrollable |\n * | |\n * --------------------------\n *\n * @docs-private\n */\nclass ScrollingVisibility {\n}\n/** The change event emitted by the strategy when a fallback position is used. */\nclass ConnectedOverlayPositionChange {\n constructor(\n /** The position used as a result of this change. */\n connectionPair, \n /** @docs-private */\n scrollableViewProperties) {\n this.connectionPair = connectionPair;\n this.scrollableViewProperties = scrollableViewProperties;\n }\n}\n/**\n * Validates whether a vertical position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateVerticalPosition(property, value) {\n if (value !== 'top' && value !== 'bottom' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"top\", \"bottom\" or \"center\".`);\n }\n}\n/**\n * Validates whether a horizontal position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateHorizontalPosition(property, value) {\n if (value !== 'start' && value !== 'end' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"start\", \"end\" or \"center\".`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass BaseOverlayDispatcher {\n constructor(document) {\n /** Currently attached overlays in the order they were attached. */\n this._attachedOverlays = [];\n this._document = document;\n }\n ngOnDestroy() {\n this.detach();\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n // Ensure that we don't get the same overlay multiple times.\n this.remove(overlayRef);\n this._attachedOverlays.push(overlayRef);\n }\n /** Remove an overlay from the list of attached overlay refs. */\n remove(overlayRef) {\n const index = this._attachedOverlays.indexOf(overlayRef);\n if (index > -1) {\n this._attachedOverlays.splice(index, 1);\n }\n // Remove the global listener once there are no more overlays.\n if (this._attachedOverlays.length === 0) {\n this.detach();\n }\n }\n}\nBaseOverlayDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BaseOverlayDispatcher, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBaseOverlayDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BaseOverlayDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BaseOverlayDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching keyboard events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayKeyboardDispatcher extends BaseOverlayDispatcher {\n constructor(document, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._ngZone = _ngZone;\n /** Keyboard event listener that will be attached to the body. */\n this._keydownListener = (event) => {\n const overlays = this._attachedOverlays;\n for (let i = overlays.length - 1; i > -1; i--) {\n // Dispatch the keydown event to the top overlay which has subscribers to its keydown events.\n // We want to target the most recent overlay, rather than trying to match where the event came\n // from, because some components might open an overlay, but keep focus on a trigger element\n // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions,\n // because we don't want overlays that don't handle keyboard events to block the ones below\n // them that do.\n if (overlays[i]._keydownEvents.observers.length > 0) {\n const keydownEvents = overlays[i]._keydownEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => keydownEvents.next(event));\n }\n else {\n keydownEvents.next(event);\n }\n break;\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Lazily start dispatcher once first overlay is added\n if (!this._isAttached) {\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._document.body.addEventListener('keydown', this._keydownListener));\n }\n else {\n this._document.body.addEventListener('keydown', this._keydownListener);\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n this._document.body.removeEventListener('keydown', this._keydownListener);\n this._isAttached = false;\n }\n }\n}\nOverlayKeyboardDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayKeyboardDispatcher, deps: [{ token: DOCUMENT }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayKeyboardDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayKeyboardDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayKeyboardDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching mouse click events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayOutsideClickDispatcher extends BaseOverlayDispatcher {\n constructor(document, _platform, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._cursorStyleIsSet = false;\n /** Store pointerdown event target to track origin of click. */\n this._pointerDownListener = (event) => {\n this._pointerDownEventTarget = _getEventTarget(event);\n };\n /** Click event listener that will be attached to the body propagate phase. */\n this._clickListener = (event) => {\n const target = _getEventTarget(event);\n // In case of a click event, we want to check the origin of the click\n // (e.g. in case where a user starts a click inside the overlay and\n // releases the click outside of it).\n // This is done by using the event target of the preceding pointerdown event.\n // Every click event caused by a pointer device has a preceding pointerdown\n // event, unless the click was programmatically triggered (e.g. in a unit test).\n const origin = event.type === 'click' && this._pointerDownEventTarget\n ? this._pointerDownEventTarget\n : target;\n // Reset the stored pointerdown event target, to avoid having it interfere\n // in subsequent events.\n this._pointerDownEventTarget = null;\n // We copy the array because the original may be modified asynchronously if the\n // outsidePointerEvents listener decides to detach overlays resulting in index errors inside\n // the for loop.\n const overlays = this._attachedOverlays.slice();\n // Dispatch the mouse event to the top overlay which has subscribers to its mouse events.\n // We want to target all overlays for which the click could be considered as outside click.\n // As soon as we reach an overlay for which the click is not outside click we break off\n // the loop.\n for (let i = overlays.length - 1; i > -1; i--) {\n const overlayRef = overlays[i];\n if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) {\n continue;\n }\n // If it's a click inside the overlay, just break - we should do nothing\n // If it's an outside click (both origin and target of the click) dispatch the mouse event,\n // and proceed with the next overlay\n if (overlayRef.overlayElement.contains(target) ||\n overlayRef.overlayElement.contains(origin)) {\n break;\n }\n const outsidePointerEvents = overlayRef._outsidePointerEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => outsidePointerEvents.next(event));\n }\n else {\n outsidePointerEvents.next(event);\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Safari on iOS does not generate click events for non-interactive\n // elements. However, we want to receive a click for any element outside\n // the overlay. We can force a \"clickable\" state by setting\n // `cursor: pointer` on the document body. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile\n // https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html\n if (!this._isAttached) {\n const body = this._document.body;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._addEventListeners(body));\n }\n else {\n this._addEventListeners(body);\n }\n // click event is not fired on iOS. To make element \"clickable\" we are\n // setting the cursor to pointer\n if (this._platform.IOS && !this._cursorStyleIsSet) {\n this._cursorOriginalValue = body.style.cursor;\n body.style.cursor = 'pointer';\n this._cursorStyleIsSet = true;\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n const body = this._document.body;\n body.removeEventListener('pointerdown', this._pointerDownListener, true);\n body.removeEventListener('click', this._clickListener, true);\n body.removeEventListener('auxclick', this._clickListener, true);\n body.removeEventListener('contextmenu', this._clickListener, true);\n if (this._platform.IOS && this._cursorStyleIsSet) {\n body.style.cursor = this._cursorOriginalValue;\n this._cursorStyleIsSet = false;\n }\n this._isAttached = false;\n }\n }\n _addEventListeners(body) {\n body.addEventListener('pointerdown', this._pointerDownListener, true);\n body.addEventListener('click', this._clickListener, true);\n body.addEventListener('auxclick', this._clickListener, true);\n body.addEventListener('contextmenu', this._clickListener, true);\n }\n}\nOverlayOutsideClickDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayOutsideClickDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Container inside which all overlays will render. */\nclass OverlayContainer {\n constructor(document, _platform) {\n this._platform = _platform;\n this._document = document;\n }\n ngOnDestroy() {\n this._containerElement?.remove();\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const containerClass = 'cdk-overlay-container';\n // TODO(crisbeto): remove the testing check once we have an overlay testing\n // module or Angular starts tearing down the testing `NgModule`. See:\n // https://github.com/angular/angular/issues/18831\n if (this._platform.isBrowser || _isTestEnvironment()) {\n const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform=\"server\"], ` + `.${containerClass}[platform=\"test\"]`);\n // Remove any old containers from the opposite platform.\n // This can happen when transitioning from the server to the client.\n for (let i = 0; i < oppositePlatformContainers.length; i++) {\n oppositePlatformContainers[i].remove();\n }\n }\n const container = this._document.createElement('div');\n container.classList.add(containerClass);\n // A long time ago we kept adding new overlay containers whenever a new app was instantiated,\n // but at some point we added logic which clears the duplicate ones in order to avoid leaks.\n // The new logic was a little too aggressive since it was breaking some legitimate use cases.\n // To mitigate the problem we made it so that only containers from a different platform are\n // cleared, but the side-effect was that people started depending on the overly-aggressive\n // logic to clean up their tests for them. Until we can introduce an overlay-specific testing\n // module which does the cleanup, we try to detect that we're in a test environment and we\n // always clear the container. See #17006.\n // TODO(crisbeto): remove the test environment check once we have an overlay testing module.\n if (_isTestEnvironment()) {\n container.setAttribute('platform', 'test');\n }\n else if (!this._platform.isBrowser) {\n container.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n}\nOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, _location, _outsideClickDispatcher, _animationsDisabled = false) {\n this._portalOutlet = _portalOutlet;\n this._host = _host;\n this._pane = _pane;\n this._config = _config;\n this._ngZone = _ngZone;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._document = _document;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._animationsDisabled = _animationsDisabled;\n this._backdropElement = null;\n this._backdropClick = new Subject();\n this._attachments = new Subject();\n this._detachments = new Subject();\n this._locationChanges = Subscription.EMPTY;\n this._backdropClickHandler = (event) => this._backdropClick.next(event);\n this._backdropTransitionendHandler = (event) => {\n this._disposeBackdrop(event.target);\n };\n /** Stream of keydown events dispatched to this overlay. */\n this._keydownEvents = new Subject();\n /** Stream of mouse outside events dispatched to this overlay. */\n this._outsidePointerEvents = new Subject();\n if (_config.scrollStrategy) {\n this._scrollStrategy = _config.scrollStrategy;\n this._scrollStrategy.attach(this);\n }\n this._positionStrategy = _config.positionStrategy;\n }\n /** The overlay's HTML element */\n get overlayElement() {\n return this._pane;\n }\n /** The overlay's backdrop HTML element. */\n get backdropElement() {\n return this._backdropElement;\n }\n /**\n * Wrapper around the panel element. Can be used for advanced\n * positioning where a wrapper with specific styling is\n * required around the overlay pane.\n */\n get hostElement() {\n return this._host;\n }\n /**\n * Attaches content, given via a Portal, to the overlay.\n * If the overlay is configured to have a backdrop, it will be created.\n *\n * @param portal Portal instance to which to attach the overlay.\n * @returns The portal attachment result.\n */\n attach(portal) {\n // Insert the host into the DOM before attaching the portal, otherwise\n // the animations module will skip animations on repeat attachments.\n if (!this._host.parentElement && this._previousHostParent) {\n this._previousHostParent.appendChild(this._host);\n }\n const attachResult = this._portalOutlet.attach(portal);\n if (this._positionStrategy) {\n this._positionStrategy.attach(this);\n }\n this._updateStackingOrder();\n this._updateElementSize();\n this._updateElementDirection();\n if (this._scrollStrategy) {\n this._scrollStrategy.enable();\n }\n // Update the position once the zone is stable so that the overlay will be fully rendered\n // before attempting to position it, as the position may depend on the size of the rendered\n // content.\n this._ngZone.onStable.pipe(take(1)).subscribe(() => {\n // The overlay could've been detached before the zone has stabilized.\n if (this.hasAttached()) {\n this.updatePosition();\n }\n });\n // Enable pointer events for the overlay pane element.\n this._togglePointerEvents(true);\n if (this._config.hasBackdrop) {\n this._attachBackdrop();\n }\n if (this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, true);\n }\n // Only emit the `attachments` event once all other setup is done.\n this._attachments.next();\n // Track this overlay by the keyboard dispatcher\n this._keyboardDispatcher.add(this);\n if (this._config.disposeOnNavigation) {\n this._locationChanges = this._location.subscribe(() => this.dispose());\n }\n this._outsideClickDispatcher.add(this);\n // TODO(crisbeto): the null check is here, because the portal outlet returns `any`.\n // We should be guaranteed for the result to be `ComponentRef | EmbeddedViewRef`, but\n // `instanceof EmbeddedViewRef` doesn't appear to work at the moment.\n if (typeof attachResult?.onDestroy === 'function') {\n // In most cases we control the portal and we know when it is being detached so that\n // we can finish the disposal process. The exception is if the user passes in a custom\n // `ViewContainerRef` that isn't destroyed through the overlay API. Note that we use\n // `detach` here instead of `dispose`, because we don't know if the user intends to\n // reattach the overlay at a later point. It also has the advantage of waiting for animations.\n attachResult.onDestroy(() => {\n if (this.hasAttached()) {\n // We have to delay the `detach` call, because detaching immediately prevents\n // other destroy hooks from running. This is likely a framework bug similar to\n // https://github.com/angular/angular/issues/46119\n this._ngZone.runOutsideAngular(() => Promise.resolve().then(() => this.detach()));\n }\n });\n }\n return attachResult;\n }\n /**\n * Detaches an overlay from a portal.\n * @returns The portal detachment result.\n */\n detach() {\n if (!this.hasAttached()) {\n return;\n }\n this.detachBackdrop();\n // When the overlay is detached, the pane element should disable pointer events.\n // This is necessary because otherwise the pane element will cover the page and disable\n // pointer events therefore. Depends on the position strategy and the applied pane boundaries.\n this._togglePointerEvents(false);\n if (this._positionStrategy && this._positionStrategy.detach) {\n this._positionStrategy.detach();\n }\n if (this._scrollStrategy) {\n this._scrollStrategy.disable();\n }\n const detachmentResult = this._portalOutlet.detach();\n // Only emit after everything is detached.\n this._detachments.next();\n // Remove this overlay from keyboard dispatcher tracking.\n this._keyboardDispatcher.remove(this);\n // Keeping the host element in the DOM can cause scroll jank, because it still gets\n // rendered, even though it's transparent and unclickable which is why we remove it.\n this._detachContentWhenStable();\n this._locationChanges.unsubscribe();\n this._outsideClickDispatcher.remove(this);\n return detachmentResult;\n }\n /** Cleans up the overlay from the DOM. */\n dispose() {\n const isAttached = this.hasAttached();\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._disposeScrollStrategy();\n this._disposeBackdrop(this._backdropElement);\n this._locationChanges.unsubscribe();\n this._keyboardDispatcher.remove(this);\n this._portalOutlet.dispose();\n this._attachments.complete();\n this._backdropClick.complete();\n this._keydownEvents.complete();\n this._outsidePointerEvents.complete();\n this._outsideClickDispatcher.remove(this);\n this._host?.remove();\n this._previousHostParent = this._pane = this._host = null;\n if (isAttached) {\n this._detachments.next();\n }\n this._detachments.complete();\n }\n /** Whether the overlay has attached content. */\n hasAttached() {\n return this._portalOutlet.hasAttached();\n }\n /** Gets an observable that emits when the backdrop has been clicked. */\n backdropClick() {\n return this._backdropClick;\n }\n /** Gets an observable that emits when the overlay has been attached. */\n attachments() {\n return this._attachments;\n }\n /** Gets an observable that emits when the overlay has been detached. */\n detachments() {\n return this._detachments;\n }\n /** Gets an observable of keydown events targeted to this overlay. */\n keydownEvents() {\n return this._keydownEvents;\n }\n /** Gets an observable of pointer events targeted outside this overlay. */\n outsidePointerEvents() {\n return this._outsidePointerEvents;\n }\n /** Gets the current overlay configuration, which is immutable. */\n getConfig() {\n return this._config;\n }\n /** Updates the position of the overlay based on the position strategy. */\n updatePosition() {\n if (this._positionStrategy) {\n this._positionStrategy.apply();\n }\n }\n /** Switches to a new position strategy and updates the overlay position. */\n updatePositionStrategy(strategy) {\n if (strategy === this._positionStrategy) {\n return;\n }\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._positionStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n this.updatePosition();\n }\n }\n /** Update the size properties of the overlay. */\n updateSize(sizeConfig) {\n this._config = { ...this._config, ...sizeConfig };\n this._updateElementSize();\n }\n /** Sets the LTR/RTL direction for the overlay. */\n setDirection(dir) {\n this._config = { ...this._config, direction: dir };\n this._updateElementDirection();\n }\n /** Add a CSS class or an array of classes to the overlay pane. */\n addPanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, true);\n }\n }\n /** Remove a CSS class or an array of classes from the overlay pane. */\n removePanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, false);\n }\n }\n /**\n * Returns the layout direction of the overlay panel.\n */\n getDirection() {\n const direction = this._config.direction;\n if (!direction) {\n return 'ltr';\n }\n return typeof direction === 'string' ? direction : direction.value;\n }\n /** Switches to a new scroll strategy. */\n updateScrollStrategy(strategy) {\n if (strategy === this._scrollStrategy) {\n return;\n }\n this._disposeScrollStrategy();\n this._scrollStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n strategy.enable();\n }\n }\n /** Updates the text direction of the overlay panel. */\n _updateElementDirection() {\n this._host.setAttribute('dir', this.getDirection());\n }\n /** Updates the size of the overlay element based on the overlay config. */\n _updateElementSize() {\n if (!this._pane) {\n return;\n }\n const style = this._pane.style;\n style.width = coerceCssPixelValue(this._config.width);\n style.height = coerceCssPixelValue(this._config.height);\n style.minWidth = coerceCssPixelValue(this._config.minWidth);\n style.minHeight = coerceCssPixelValue(this._config.minHeight);\n style.maxWidth = coerceCssPixelValue(this._config.maxWidth);\n style.maxHeight = coerceCssPixelValue(this._config.maxHeight);\n }\n /** Toggles the pointer events for the overlay pane element. */\n _togglePointerEvents(enablePointer) {\n this._pane.style.pointerEvents = enablePointer ? '' : 'none';\n }\n /** Attaches a backdrop for this overlay. */\n _attachBackdrop() {\n const showingClass = 'cdk-overlay-backdrop-showing';\n this._backdropElement = this._document.createElement('div');\n this._backdropElement.classList.add('cdk-overlay-backdrop');\n if (this._animationsDisabled) {\n this._backdropElement.classList.add('cdk-overlay-backdrop-noop-animation');\n }\n if (this._config.backdropClass) {\n this._toggleClasses(this._backdropElement, this._config.backdropClass, true);\n }\n // Insert the backdrop before the pane in the DOM order,\n // in order to handle stacked overlays properly.\n this._host.parentElement.insertBefore(this._backdropElement, this._host);\n // Forward backdrop clicks such that the consumer of the overlay can perform whatever\n // action desired when such a click occurs (usually closing the overlay).\n this._backdropElement.addEventListener('click', this._backdropClickHandler);\n // Add class to fade-in the backdrop after one frame.\n if (!this._animationsDisabled && typeof requestAnimationFrame !== 'undefined') {\n this._ngZone.runOutsideAngular(() => {\n requestAnimationFrame(() => {\n if (this._backdropElement) {\n this._backdropElement.classList.add(showingClass);\n }\n });\n });\n }\n else {\n this._backdropElement.classList.add(showingClass);\n }\n }\n /**\n * Updates the stacking order of the element, moving it to the top if necessary.\n * This is required in cases where one overlay was detached, while another one,\n * that should be behind it, was destroyed. The next time both of them are opened,\n * the stacking will be wrong, because the detached element's pane will still be\n * in its original DOM position.\n */\n _updateStackingOrder() {\n if (this._host.nextSibling) {\n this._host.parentNode.appendChild(this._host);\n }\n }\n /** Detaches the backdrop (if any) associated with the overlay. */\n detachBackdrop() {\n const backdropToDetach = this._backdropElement;\n if (!backdropToDetach) {\n return;\n }\n if (this._animationsDisabled) {\n this._disposeBackdrop(backdropToDetach);\n return;\n }\n backdropToDetach.classList.remove('cdk-overlay-backdrop-showing');\n this._ngZone.runOutsideAngular(() => {\n backdropToDetach.addEventListener('transitionend', this._backdropTransitionendHandler);\n });\n // If the backdrop doesn't have a transition, the `transitionend` event won't fire.\n // In this case we make it unclickable and we try to remove it after a delay.\n backdropToDetach.style.pointerEvents = 'none';\n // Run this outside the Angular zone because there's nothing that Angular cares about.\n // If it were to run inside the Angular zone, every test that used Overlay would have to be\n // either async or fakeAsync.\n this._backdropTimeout = this._ngZone.runOutsideAngular(() => setTimeout(() => {\n this._disposeBackdrop(backdropToDetach);\n }, 500));\n }\n /** Toggles a single CSS class or an array of classes on an element. */\n _toggleClasses(element, cssClasses, isAdd) {\n const classes = coerceArray(cssClasses || []).filter(c => !!c);\n if (classes.length) {\n isAdd ? element.classList.add(...classes) : element.classList.remove(...classes);\n }\n }\n /** Detaches the overlay content next time the zone stabilizes. */\n _detachContentWhenStable() {\n // Normally we wouldn't have to explicitly run this outside the `NgZone`, however\n // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will\n // be patched to run inside the zone, which will throw us into an infinite loop.\n this._ngZone.runOutsideAngular(() => {\n // We can't remove the host here immediately, because the overlay pane's content\n // might still be animating. This stream helps us avoid interrupting the animation\n // by waiting for the pane to become empty.\n const subscription = this._ngZone.onStable\n .pipe(takeUntil(merge(this._attachments, this._detachments)))\n .subscribe(() => {\n // Needs a couple of checks for the pane and host, because\n // they may have been removed by the time the zone stabilizes.\n if (!this._pane || !this._host || this._pane.children.length === 0) {\n if (this._pane && this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, false);\n }\n if (this._host && this._host.parentElement) {\n this._previousHostParent = this._host.parentElement;\n this._host.remove();\n }\n subscription.unsubscribe();\n }\n });\n });\n }\n /** Disposes of a scroll strategy. */\n _disposeScrollStrategy() {\n const scrollStrategy = this._scrollStrategy;\n if (scrollStrategy) {\n scrollStrategy.disable();\n if (scrollStrategy.detach) {\n scrollStrategy.detach();\n }\n }\n }\n /** Removes a backdrop element from the DOM. */\n _disposeBackdrop(backdrop) {\n if (backdrop) {\n backdrop.removeEventListener('click', this._backdropClickHandler);\n backdrop.removeEventListener('transitionend', this._backdropTransitionendHandler);\n backdrop.remove();\n // It is possible that a new portal has been attached to this overlay since we started\n // removing the backdrop. If that is the case, only clear the backdrop reference if it\n // is still the same instance that we started to remove.\n if (this._backdropElement === backdrop) {\n this._backdropElement = null;\n }\n }\n if (this._backdropTimeout) {\n clearTimeout(this._backdropTimeout);\n this._backdropTimeout = undefined;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: refactor clipping detection into a separate thing (part of scrolling module)\n// TODO: doesn't handle both flexible width and height when it has to scroll along both axis.\n/** Class to be added to the overlay bounding box. */\nconst boundingBoxClass = 'cdk-overlay-connected-position-bounding-box';\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n */\nclass FlexibleConnectedPositionStrategy {\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */\n this._lastBoundingBoxSize = { width: 0, height: 0 };\n /** Whether the overlay was pushed in a previous positioning. */\n this._isPushed = false;\n /** Whether the overlay can be pushed on-screen on the initial open. */\n this._canPush = true;\n /** Whether the overlay can grow via flexible width/height after the initial open. */\n this._growAfterOpen = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this._hasFlexibleDimensions = true;\n /** Whether the overlay position is locked. */\n this._positionLocked = false;\n /** Amount of space that must be maintained between the overlay and the edge of the viewport. */\n this._viewportMargin = 0;\n /** The Scrollable containers used to check scrollable view properties on position change. */\n this._scrollables = [];\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n /** Subject that emits whenever the position changes. */\n this._positionChanges = new Subject();\n /** Subscription to viewport size changes. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Default offset for the overlay along the x axis. */\n this._offsetX = 0;\n /** Default offset for the overlay along the y axis. */\n this._offsetY = 0;\n /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */\n this._appliedPanelClasses = [];\n /** Observable sequence of position changes. */\n this.positionChanges = this._positionChanges;\n this.setOrigin(connectedTo);\n }\n /** Attaches this position strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef &&\n overlayRef !== this._overlayRef &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This position strategy is already attached to an overlay');\n }\n this._validatePositions();\n overlayRef.hostElement.classList.add(boundingBoxClass);\n this._overlayRef = overlayRef;\n this._boundingBox = overlayRef.hostElement;\n this._pane = overlayRef.overlayElement;\n this._isDisposed = false;\n this._isInitialRender = true;\n this._lastPosition = null;\n this._resizeSubscription.unsubscribe();\n this._resizeSubscription = this._viewportRuler.change().subscribe(() => {\n // When the window is resized, we want to trigger the next reposition as if it\n // was an initial render, in order for the strategy to pick a new optimal position,\n // otherwise position locking will cause it to stay at the old one.\n this._isInitialRender = true;\n this.apply();\n });\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin best fits on-screen.\n *\n * The selection of a position goes as follows:\n * - If any positions fit completely within the viewport as-is,\n * choose the first position that does so.\n * - If flexible dimensions are enabled and at least one satisfies the given minimum width/height,\n * choose the position with the greatest available size modified by the positions' weight.\n * - If pushing is enabled, take the position that went off-screen the least and push it\n * on-screen.\n * - If none of the previous criteria were met, use the position that goes off-screen the least.\n * @docs-private\n */\n apply() {\n // We shouldn't do anything if the strategy was disposed or we're on the server.\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n // If the position has been applied already (e.g. when the overlay was opened) and the\n // consumer opted into locking in the position, re-use the old position, in order to\n // prevent the overlay from jumping around.\n if (!this._isInitialRender && this._positionLocked && this._lastPosition) {\n this.reapplyLastPosition();\n return;\n }\n this._clearPanelClasses();\n this._resetOverlayElementStyles();\n this._resetBoundingBoxStyles();\n // We need the bounding rects for the origin, the overlay and the container to determine how to position\n // the overlay relative to the origin.\n // We use the viewport rect to determine whether a position would go off-screen.\n this._viewportRect = this._getNarrowedViewportRect();\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originRect = this._originRect;\n const overlayRect = this._overlayRect;\n const viewportRect = this._viewportRect;\n const containerRect = this._containerRect;\n // Positions where the overlay will fit with flexible dimensions.\n const flexibleFits = [];\n // Fallback if none of the preferred positions fit within the viewport.\n let fallback;\n // Go through each of the preferred positions looking for a good fit.\n // If a good fit is found, it will be applied immediately.\n for (let pos of this._preferredPositions) {\n // Get the exact (x, y) coordinate for the point-of-origin on the origin element.\n let originPoint = this._getOriginPoint(originRect, containerRect, pos);\n // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the\n // overlay in this position. We use the top-left corner for calculations and later translate\n // this into an appropriate (top, left, bottom, right) style.\n let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos);\n // Calculate how well the overlay would fit into the viewport with this point.\n let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos);\n // If the overlay, without any further work, fits into the viewport, use this position.\n if (overlayFit.isCompletelyWithinViewport) {\n this._isPushed = false;\n this._applyPosition(pos, originPoint);\n return;\n }\n // If the overlay has flexible dimensions, we can use this position\n // so long as there's enough space for the minimum dimensions.\n if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) {\n // Save positions where the overlay will fit with flexible dimensions. We will use these\n // if none of the positions fit *without* flexible dimensions.\n flexibleFits.push({\n position: pos,\n origin: originPoint,\n overlayRect,\n boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos),\n });\n continue;\n }\n // If the current preferred position does not fit on the screen, remember the position\n // if it has more visible area on-screen than we've seen and move onto the next preferred\n // position.\n if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) {\n fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect };\n }\n }\n // If there are any positions where the overlay would fit with flexible dimensions, choose the\n // one that has the greatest area available modified by the position's weight\n if (flexibleFits.length) {\n let bestFit = null;\n let bestScore = -1;\n for (const fit of flexibleFits) {\n const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1);\n if (score > bestScore) {\n bestScore = score;\n bestFit = fit;\n }\n }\n this._isPushed = false;\n this._applyPosition(bestFit.position, bestFit.origin);\n return;\n }\n // When none of the preferred positions fit within the viewport, take the position\n // that went off-screen the least and attempt to push it on-screen.\n if (this._canPush) {\n // TODO(jelbourn): after pushing, the opening \"direction\" of the overlay might not make sense.\n this._isPushed = true;\n this._applyPosition(fallback.position, fallback.originPoint);\n return;\n }\n // All options for getting the overlay within the viewport have been exhausted, so go with the\n // position that went off-screen the least.\n this._applyPosition(fallback.position, fallback.originPoint);\n }\n detach() {\n this._clearPanelClasses();\n this._lastPosition = null;\n this._previousPushAmount = null;\n this._resizeSubscription.unsubscribe();\n }\n /** Cleanup after the element gets destroyed. */\n dispose() {\n if (this._isDisposed) {\n return;\n }\n // We can't use `_resetBoundingBoxStyles` here, because it resets\n // some properties to zero, rather than removing them.\n if (this._boundingBox) {\n extendStyles(this._boundingBox.style, {\n top: '',\n left: '',\n right: '',\n bottom: '',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n if (this._pane) {\n this._resetOverlayElementStyles();\n }\n if (this._overlayRef) {\n this._overlayRef.hostElement.classList.remove(boundingBoxClass);\n }\n this.detach();\n this._positionChanges.complete();\n this._overlayRef = this._boundingBox = null;\n this._isDisposed = true;\n }\n /**\n * This re-aligns the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n reapplyLastPosition() {\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n const lastPosition = this._lastPosition;\n if (lastPosition) {\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._viewportRect = this._getNarrowedViewportRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originPoint = this._getOriginPoint(this._originRect, this._containerRect, lastPosition);\n this._applyPosition(lastPosition, originPoint);\n }\n else {\n this.apply();\n }\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._scrollables = scrollables;\n return this;\n }\n /**\n * Adds new preferred positions.\n * @param positions List of positions options for this overlay.\n */\n withPositions(positions) {\n this._preferredPositions = positions;\n // If the last calculated position object isn't part of the positions anymore, clear\n // it in order to avoid it being picked up if the consumer tries to re-apply.\n if (positions.indexOf(this._lastPosition) === -1) {\n this._lastPosition = null;\n }\n this._validatePositions();\n return this;\n }\n /**\n * Sets a minimum distance the overlay may be positioned to the edge of the viewport.\n * @param margin Required margin between the overlay and the viewport edge in pixels.\n */\n withViewportMargin(margin) {\n this._viewportMargin = margin;\n return this;\n }\n /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */\n withFlexibleDimensions(flexibleDimensions = true) {\n this._hasFlexibleDimensions = flexibleDimensions;\n return this;\n }\n /** Sets whether the overlay can grow after the initial open via flexible width/height. */\n withGrowAfterOpen(growAfterOpen = true) {\n this._growAfterOpen = growAfterOpen;\n return this;\n }\n /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */\n withPush(canPush = true) {\n this._canPush = canPush;\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked = true) {\n this._positionLocked = isLocked;\n return this;\n }\n /**\n * Sets the origin, relative to which to position the overlay.\n * Using an element origin is useful for building components that need to be positioned\n * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be\n * used for cases like contextual menus which open relative to the user's pointer.\n * @param origin Reference to the new origin.\n */\n setOrigin(origin) {\n this._origin = origin;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the x-axis.\n * @param offset New offset in the X axis.\n */\n withDefaultOffsetX(offset) {\n this._offsetX = offset;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the y-axis.\n * @param offset New offset in the Y axis.\n */\n withDefaultOffsetY(offset) {\n this._offsetY = offset;\n return this;\n }\n /**\n * Configures that the position strategy should set a `transform-origin` on some elements\n * inside the overlay, depending on the current position that is being applied. This is\n * useful for the cases where the origin of an animation can change depending on the\n * alignment of the overlay.\n * @param selector CSS selector that will be used to find the target\n * elements onto which to set the transform origin.\n */\n withTransformOriginOn(selector) {\n this._transformOriginSelector = selector;\n return this;\n }\n /**\n * Gets the (x, y) coordinate of a connection point on the origin based on a relative position.\n */\n _getOriginPoint(originRect, containerRect, pos) {\n let x;\n if (pos.originX == 'center') {\n // Note: when centering we should always use the `left`\n // offset, otherwise the position will be wrong in RTL.\n x = originRect.left + originRect.width / 2;\n }\n else {\n const startX = this._isRtl() ? originRect.right : originRect.left;\n const endX = this._isRtl() ? originRect.left : originRect.right;\n x = pos.originX == 'start' ? startX : endX;\n }\n // When zooming in Safari the container rectangle contains negative values for the position\n // and we need to re-add them to the calculated coordinates.\n if (containerRect.left < 0) {\n x -= containerRect.left;\n }\n let y;\n if (pos.originY == 'center') {\n y = originRect.top + originRect.height / 2;\n }\n else {\n y = pos.originY == 'top' ? originRect.top : originRect.bottom;\n }\n // Normally the containerRect's top value would be zero, however when the overlay is attached to an input\n // (e.g. in an autocomplete), mobile browsers will shift everything in order to put the input in the middle\n // of the screen and to make space for the virtual keyboard. We need to account for this offset,\n // otherwise our positioning will be thrown off.\n // Additionally, when zooming in Safari this fixes the vertical position.\n if (containerRect.top < 0) {\n y -= containerRect.top;\n }\n return { x, y };\n }\n /**\n * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and\n * origin point to which the overlay should be connected.\n */\n _getOverlayPoint(originPoint, overlayRect, pos) {\n // Calculate the (overlayStartX, overlayStartY), the start of the\n // potential overlay position relative to the origin point.\n let overlayStartX;\n if (pos.overlayX == 'center') {\n overlayStartX = -overlayRect.width / 2;\n }\n else if (pos.overlayX === 'start') {\n overlayStartX = this._isRtl() ? -overlayRect.width : 0;\n }\n else {\n overlayStartX = this._isRtl() ? 0 : -overlayRect.width;\n }\n let overlayStartY;\n if (pos.overlayY == 'center') {\n overlayStartY = -overlayRect.height / 2;\n }\n else {\n overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height;\n }\n // The (x, y) coordinates of the overlay.\n return {\n x: originPoint.x + overlayStartX,\n y: originPoint.y + overlayStartY,\n };\n }\n /** Gets how well an overlay at the given point will fit within the viewport. */\n _getOverlayFit(point, rawOverlayRect, viewport, position) {\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n let { x, y } = point;\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n // Account for the offsets since they could push the overlay out of the viewport.\n if (offsetX) {\n x += offsetX;\n }\n if (offsetY) {\n y += offsetY;\n }\n // How much the overlay would overflow at this position, on each side.\n let leftOverflow = 0 - x;\n let rightOverflow = x + overlay.width - viewport.width;\n let topOverflow = 0 - y;\n let bottomOverflow = y + overlay.height - viewport.height;\n // Visible parts of the element on each axis.\n let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow);\n let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow);\n let visibleArea = visibleWidth * visibleHeight;\n return {\n visibleArea,\n isCompletelyWithinViewport: overlay.width * overlay.height === visibleArea,\n fitsInViewportVertically: visibleHeight === overlay.height,\n fitsInViewportHorizontally: visibleWidth == overlay.width,\n };\n }\n /**\n * Whether the overlay can fit within the viewport when it may resize either its width or height.\n * @param fit How well the overlay fits in the viewport at some position.\n * @param point The (x, y) coordinates of the overlay at some position.\n * @param viewport The geometry of the viewport.\n */\n _canFitWithFlexibleDimensions(fit, point, viewport) {\n if (this._hasFlexibleDimensions) {\n const availableHeight = viewport.bottom - point.y;\n const availableWidth = viewport.right - point.x;\n const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight);\n const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth);\n const verticalFit = fit.fitsInViewportVertically || (minHeight != null && minHeight <= availableHeight);\n const horizontalFit = fit.fitsInViewportHorizontally || (minWidth != null && minWidth <= availableWidth);\n return verticalFit && horizontalFit;\n }\n return false;\n }\n /**\n * Gets the point at which the overlay can be \"pushed\" on-screen. If the overlay is larger than\n * the viewport, the top-left corner will be pushed on-screen (with overflow occurring on the\n * right and bottom).\n *\n * @param start Starting point from which the overlay is pushed.\n * @param rawOverlayRect Dimensions of the overlay.\n * @param scrollPosition Current viewport scroll position.\n * @returns The point at which to position the overlay after pushing. This is effectively a new\n * originPoint.\n */\n _pushOverlayOnScreen(start, rawOverlayRect, scrollPosition) {\n // If the position is locked and we've pushed the overlay already, reuse the previous push\n // amount, rather than pushing it again. If we were to continue pushing, the element would\n // remain in the viewport, which goes against the expectations when position locking is enabled.\n if (this._previousPushAmount && this._positionLocked) {\n return {\n x: start.x + this._previousPushAmount.x,\n y: start.y + this._previousPushAmount.y,\n };\n }\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n const viewport = this._viewportRect;\n // Determine how much the overlay goes outside the viewport on each\n // side, which we'll use to decide which direction to push it.\n const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0);\n const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0);\n const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0);\n const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0);\n // Amount by which to push the overlay in each axis such that it remains on-screen.\n let pushX = 0;\n let pushY = 0;\n // If the overlay fits completely within the bounds of the viewport, push it from whichever\n // direction is goes off-screen. Otherwise, push the top-left corner such that its in the\n // viewport and allow for the trailing end of the overlay to go out of bounds.\n if (overlay.width <= viewport.width) {\n pushX = overflowLeft || -overflowRight;\n }\n else {\n pushX = start.x < this._viewportMargin ? viewport.left - scrollPosition.left - start.x : 0;\n }\n if (overlay.height <= viewport.height) {\n pushY = overflowTop || -overflowBottom;\n }\n else {\n pushY = start.y < this._viewportMargin ? viewport.top - scrollPosition.top - start.y : 0;\n }\n this._previousPushAmount = { x: pushX, y: pushY };\n return {\n x: start.x + pushX,\n y: start.y + pushY,\n };\n }\n /**\n * Applies a computed position to the overlay and emits a position change.\n * @param position The position preference\n * @param originPoint The point on the origin element where the overlay is connected.\n */\n _applyPosition(position, originPoint) {\n this._setTransformOrigin(position);\n this._setOverlayElementStyles(originPoint, position);\n this._setBoundingBoxStyles(originPoint, position);\n if (position.panelClass) {\n this._addPanelClasses(position.panelClass);\n }\n // Save the last connected position in case the position needs to be re-calculated.\n this._lastPosition = position;\n // Notify that the position has been changed along with its change properties.\n // We only emit if we've got any subscriptions, because the scroll visibility\n // calculations can be somewhat expensive.\n if (this._positionChanges.observers.length) {\n const scrollableViewProperties = this._getScrollVisibility();\n const changeEvent = new ConnectedOverlayPositionChange(position, scrollableViewProperties);\n this._positionChanges.next(changeEvent);\n }\n this._isInitialRender = false;\n }\n /** Sets the transform origin based on the configured selector and the passed-in position. */\n _setTransformOrigin(position) {\n if (!this._transformOriginSelector) {\n return;\n }\n const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector);\n let xOrigin;\n let yOrigin = position.overlayY;\n if (position.overlayX === 'center') {\n xOrigin = 'center';\n }\n else if (this._isRtl()) {\n xOrigin = position.overlayX === 'start' ? 'right' : 'left';\n }\n else {\n xOrigin = position.overlayX === 'start' ? 'left' : 'right';\n }\n for (let i = 0; i < elements.length; i++) {\n elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`;\n }\n }\n /**\n * Gets the position and size of the overlay's sizing container.\n *\n * This method does no measuring and applies no styles so that we can cheaply compute the\n * bounds for all positions and choose the best fit based on these results.\n */\n _calculateBoundingBoxRect(origin, position) {\n const viewport = this._viewportRect;\n const isRtl = this._isRtl();\n let height, top, bottom;\n if (position.overlayY === 'top') {\n // Overlay is opening \"downward\" and thus is bound by the bottom viewport edge.\n top = origin.y;\n height = viewport.height - top + this._viewportMargin;\n }\n else if (position.overlayY === 'bottom') {\n // Overlay is opening \"upward\" and thus is bound by the top viewport edge. We need to add\n // the viewport margin back in, because the viewport rect is narrowed down to remove the\n // margin, whereas the `origin` position is calculated based on its `ClientRect`.\n bottom = viewport.height - origin.y + this._viewportMargin * 2;\n height = viewport.height - bottom + this._viewportMargin;\n }\n else {\n // If neither top nor bottom, it means that the overlay is vertically centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.bottom - origin.y` and\n // `origin.y - viewport.top`.\n const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y);\n const previousHeight = this._lastBoundingBoxSize.height;\n height = smallestDistanceToViewportEdge * 2;\n top = origin.y - smallestDistanceToViewportEdge;\n if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) {\n top = origin.y - previousHeight / 2;\n }\n }\n // The overlay is opening 'right-ward' (the content flows to the right).\n const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) || (position.overlayX === 'end' && isRtl);\n // The overlay is opening 'left-ward' (the content flows to the left).\n const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) || (position.overlayX === 'start' && isRtl);\n let width, left, right;\n if (isBoundedByLeftViewportEdge) {\n right = viewport.width - origin.x + this._viewportMargin;\n width = origin.x - this._viewportMargin;\n }\n else if (isBoundedByRightViewportEdge) {\n left = origin.x;\n width = viewport.right - origin.x;\n }\n else {\n // If neither start nor end, it means that the overlay is horizontally centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.right - origin.x` and\n // `origin.x - viewport.left`.\n const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x);\n const previousWidth = this._lastBoundingBoxSize.width;\n width = smallestDistanceToViewportEdge * 2;\n left = origin.x - smallestDistanceToViewportEdge;\n if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) {\n left = origin.x - previousWidth / 2;\n }\n }\n return { top: top, left: left, bottom: bottom, right: right, width, height };\n }\n /**\n * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the\n * origin's connection point and stretches to the bounds of the viewport.\n *\n * @param origin The point on the origin element where the overlay is connected.\n * @param position The position preference\n */\n _setBoundingBoxStyles(origin, position) {\n const boundingBoxRect = this._calculateBoundingBoxRect(origin, position);\n // It's weird if the overlay *grows* while scrolling, so we take the last size into account\n // when applying a new size.\n if (!this._isInitialRender && !this._growAfterOpen) {\n boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height);\n boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width);\n }\n const styles = {};\n if (this._hasExactPosition()) {\n styles.top = styles.left = '0';\n styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = '';\n styles.width = styles.height = '100%';\n }\n else {\n const maxHeight = this._overlayRef.getConfig().maxHeight;\n const maxWidth = this._overlayRef.getConfig().maxWidth;\n styles.height = coerceCssPixelValue(boundingBoxRect.height);\n styles.top = coerceCssPixelValue(boundingBoxRect.top);\n styles.bottom = coerceCssPixelValue(boundingBoxRect.bottom);\n styles.width = coerceCssPixelValue(boundingBoxRect.width);\n styles.left = coerceCssPixelValue(boundingBoxRect.left);\n styles.right = coerceCssPixelValue(boundingBoxRect.right);\n // Push the pane content towards the proper direction.\n if (position.overlayX === 'center') {\n styles.alignItems = 'center';\n }\n else {\n styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start';\n }\n if (position.overlayY === 'center') {\n styles.justifyContent = 'center';\n }\n else {\n styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start';\n }\n if (maxHeight) {\n styles.maxHeight = coerceCssPixelValue(maxHeight);\n }\n if (maxWidth) {\n styles.maxWidth = coerceCssPixelValue(maxWidth);\n }\n }\n this._lastBoundingBoxSize = boundingBoxRect;\n extendStyles(this._boundingBox.style, styles);\n }\n /** Resets the styles for the bounding box so that a new positioning can be computed. */\n _resetBoundingBoxStyles() {\n extendStyles(this._boundingBox.style, {\n top: '0',\n left: '0',\n right: '0',\n bottom: '0',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n /** Resets the styles for the overlay pane so that a new positioning can be computed. */\n _resetOverlayElementStyles() {\n extendStyles(this._pane.style, {\n top: '',\n left: '',\n bottom: '',\n right: '',\n position: '',\n transform: '',\n });\n }\n /** Sets positioning styles to the overlay element. */\n _setOverlayElementStyles(originPoint, position) {\n const styles = {};\n const hasExactPosition = this._hasExactPosition();\n const hasFlexibleDimensions = this._hasFlexibleDimensions;\n const config = this._overlayRef.getConfig();\n if (hasExactPosition) {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition));\n extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition));\n }\n else {\n styles.position = 'static';\n }\n // Use a transform to apply the offsets. We do this because the `center` positions rely on\n // being in the normal flex flow and setting a `top` / `left` at all will completely throw\n // off the position. We also can't use margins, because they won't have an effect in some\n // cases where the element doesn't have anything to \"push off of\". Finally, this works\n // better both with flexible and non-flexible positioning.\n let transformString = '';\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n if (offsetX) {\n transformString += `translateX(${offsetX}px) `;\n }\n if (offsetY) {\n transformString += `translateY(${offsetY}px)`;\n }\n styles.transform = transformString.trim();\n // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because\n // we need these values to both be set to \"100%\" for the automatic flexible sizing to work.\n // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint.\n // Note that this doesn't apply when we have an exact position, in which case we do want to\n // apply them because they'll be cleared from the bounding box.\n if (config.maxHeight) {\n if (hasExactPosition) {\n styles.maxHeight = coerceCssPixelValue(config.maxHeight);\n }\n else if (hasFlexibleDimensions) {\n styles.maxHeight = '';\n }\n }\n if (config.maxWidth) {\n if (hasExactPosition) {\n styles.maxWidth = coerceCssPixelValue(config.maxWidth);\n }\n else if (hasFlexibleDimensions) {\n styles.maxWidth = '';\n }\n }\n extendStyles(this._pane.style, styles);\n }\n /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayY(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the\n // preferred position has changed since the last `apply`.\n let styles = { top: '', bottom: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `top` or `bottom` based on whether the overlay wants to appear\n // above or below the origin and the direction in which the element will expand.\n if (position.overlayY === 'bottom') {\n // When using `bottom`, we adjust the y position such that it is the distance\n // from the bottom of the viewport rather than the top.\n const documentHeight = this._document.documentElement.clientHeight;\n styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`;\n }\n else {\n styles.top = coerceCssPixelValue(overlayPoint.y);\n }\n return styles;\n }\n /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayX(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the preferred position has\n // changed since the last `apply`.\n let styles = { left: '', right: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `left` or `right` based on whether the overlay wants to appear \"before\"\n // or \"after\" the origin, which determines the direction in which the element will expand.\n // For the horizontal axis, the meaning of \"before\" and \"after\" change based on whether the\n // page is in RTL or LTR.\n let horizontalStyleProperty;\n if (this._isRtl()) {\n horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right';\n }\n else {\n horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left';\n }\n // When we're setting `right`, we adjust the x position such that it is the distance\n // from the right edge of the viewport rather than the left edge.\n if (horizontalStyleProperty === 'right') {\n const documentWidth = this._document.documentElement.clientWidth;\n styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`;\n }\n else {\n styles.left = coerceCssPixelValue(overlayPoint.x);\n }\n return styles;\n }\n /**\n * Gets the view properties of the trigger and overlay, including whether they are clipped\n * or completely outside the view of any of the strategy's scrollables.\n */\n _getScrollVisibility() {\n // Note: needs fresh rects since the position could've changed.\n const originBounds = this._getOriginRect();\n const overlayBounds = this._pane.getBoundingClientRect();\n // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers\n // every time, we should be able to use the scrollTop of the containers if the size of those\n // containers hasn't changed.\n const scrollContainerBounds = this._scrollables.map(scrollable => {\n return scrollable.getElementRef().nativeElement.getBoundingClientRect();\n });\n return {\n isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds),\n isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds),\n isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds),\n isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds),\n };\n }\n /** Subtracts the amount that an element is overflowing on an axis from its length. */\n _subtractOverflows(length, ...overflows) {\n return overflows.reduce((currentValue, currentOverflow) => {\n return currentValue - Math.max(currentOverflow, 0);\n }, length);\n }\n /** Narrows the given viewport rect by the current _viewportMargin. */\n _getNarrowedViewportRect() {\n // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler,\n // because we want to use the `clientWidth` and `clientHeight` as the base. The difference\n // being that the client properties don't include the scrollbar, as opposed to `innerWidth`\n // and `innerHeight` that do. This is necessary, because the overlay container uses\n // 100% `width` and `height` which don't include the scrollbar either.\n const width = this._document.documentElement.clientWidth;\n const height = this._document.documentElement.clientHeight;\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n return {\n top: scrollPosition.top + this._viewportMargin,\n left: scrollPosition.left + this._viewportMargin,\n right: scrollPosition.left + width - this._viewportMargin,\n bottom: scrollPosition.top + height - this._viewportMargin,\n width: width - 2 * this._viewportMargin,\n height: height - 2 * this._viewportMargin,\n };\n }\n /** Whether the we're dealing with an RTL context */\n _isRtl() {\n return this._overlayRef.getDirection() === 'rtl';\n }\n /** Determines whether the overlay uses exact or flexible positioning. */\n _hasExactPosition() {\n return !this._hasFlexibleDimensions || this._isPushed;\n }\n /** Retrieves the offset of a position along the x or y axis. */\n _getOffset(position, axis) {\n if (axis === 'x') {\n // We don't do something like `position['offset' + axis]` in\n // order to avoid breaking minifiers that rename properties.\n return position.offsetX == null ? this._offsetX : position.offsetX;\n }\n return position.offsetY == null ? this._offsetY : position.offsetY;\n }\n /** Validates that the current position match the expected values. */\n _validatePositions() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._preferredPositions.length) {\n throw Error('FlexibleConnectedPositionStrategy: At least one position is required.');\n }\n // TODO(crisbeto): remove these once Angular's template type\n // checking is advanced enough to catch these cases.\n this._preferredPositions.forEach(pair => {\n validateHorizontalPosition('originX', pair.originX);\n validateVerticalPosition('originY', pair.originY);\n validateHorizontalPosition('overlayX', pair.overlayX);\n validateVerticalPosition('overlayY', pair.overlayY);\n });\n }\n }\n /** Adds a single CSS class or an array of classes on the overlay panel. */\n _addPanelClasses(cssClasses) {\n if (this._pane) {\n coerceArray(cssClasses).forEach(cssClass => {\n if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) {\n this._appliedPanelClasses.push(cssClass);\n this._pane.classList.add(cssClass);\n }\n });\n }\n }\n /** Clears the classes that the position strategy has applied from the overlay panel. */\n _clearPanelClasses() {\n if (this._pane) {\n this._appliedPanelClasses.forEach(cssClass => {\n this._pane.classList.remove(cssClass);\n });\n this._appliedPanelClasses = [];\n }\n }\n /** Returns the ClientRect of the current origin. */\n _getOriginRect() {\n const origin = this._origin;\n if (origin instanceof ElementRef) {\n return origin.nativeElement.getBoundingClientRect();\n }\n // Check for Element so SVG elements are also supported.\n if (origin instanceof Element) {\n return origin.getBoundingClientRect();\n }\n const width = origin.width || 0;\n const height = origin.height || 0;\n // If the origin is a point, return a client rect as if it was a 0x0 element at the point.\n return {\n top: origin.y,\n bottom: origin.y + height,\n left: origin.x,\n right: origin.x + width,\n height,\n width,\n };\n }\n}\n/** Shallow-extends a stylesheet object with another stylesheet object. */\nfunction extendStyles(destination, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = source[key];\n }\n }\n return destination;\n}\n/**\n * Extracts the pixel value as a number from a value, if it's a number\n * or a CSS pixel string (e.g. `1337px`). Otherwise returns null.\n */\nfunction getPixelValue(input) {\n if (typeof input !== 'number' && input != null) {\n const [value, units] = input.split(cssUnitPattern);\n return !units || units === 'px' ? parseFloat(value) : null;\n }\n return input || null;\n}\n/**\n * Gets a version of an element's bounding `ClientRect` where all the values are rounded down to\n * the nearest pixel. This allows us to account for the cases where there may be sub-pixel\n * deviations in the `ClientRect` returned by the browser (e.g. when zoomed in with a percentage\n * size, see #21350).\n */\nfunction getRoundedBoundingClientRect(clientRect) {\n return {\n top: Math.floor(clientRect.top),\n right: Math.floor(clientRect.right),\n bottom: Math.floor(clientRect.bottom),\n left: Math.floor(clientRect.left),\n width: Math.floor(clientRect.width),\n height: Math.floor(clientRect.height),\n };\n}\nconst STANDARD_DROPDOWN_BELOW_POSITIONS = [\n { originX: 'start', originY: 'bottom', overlayX: 'start', overlayY: 'top' },\n { originX: 'start', originY: 'top', overlayX: 'start', overlayY: 'bottom' },\n { originX: 'end', originY: 'bottom', overlayX: 'end', overlayY: 'top' },\n { originX: 'end', originY: 'top', overlayX: 'end', overlayY: 'bottom' },\n];\nconst STANDARD_DROPDOWN_ADJACENT_POSITIONS = [\n { originX: 'end', originY: 'top', overlayX: 'start', overlayY: 'top' },\n { originX: 'end', originY: 'bottom', overlayX: 'start', overlayY: 'bottom' },\n { originX: 'start', originY: 'top', overlayX: 'end', overlayY: 'top' },\n { originX: 'start', originY: 'bottom', overlayX: 'end', overlayY: 'bottom' },\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Class to be added to the overlay pane wrapper. */\nconst wrapperClass = 'cdk-global-overlay-wrapper';\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * explicit position relative to the browser's viewport. We use flexbox, instead of\n * transforms, in order to avoid issues with subpixel rendering which can cause the\n * element to become blurry.\n */\nclass GlobalPositionStrategy {\n constructor() {\n this._cssPosition = 'static';\n this._topOffset = '';\n this._bottomOffset = '';\n this._alignItems = '';\n this._xPosition = '';\n this._xOffset = '';\n this._width = '';\n this._height = '';\n this._isDisposed = false;\n }\n attach(overlayRef) {\n const config = overlayRef.getConfig();\n this._overlayRef = overlayRef;\n if (this._width && !config.width) {\n overlayRef.updateSize({ width: this._width });\n }\n if (this._height && !config.height) {\n overlayRef.updateSize({ height: this._height });\n }\n overlayRef.hostElement.classList.add(wrapperClass);\n this._isDisposed = false;\n }\n /**\n * Sets the top position of the overlay. Clears any previously set vertical position.\n * @param value New top offset.\n */\n top(value = '') {\n this._bottomOffset = '';\n this._topOffset = value;\n this._alignItems = 'flex-start';\n return this;\n }\n /**\n * Sets the left position of the overlay. Clears any previously set horizontal position.\n * @param value New left offset.\n */\n left(value = '') {\n this._xOffset = value;\n this._xPosition = 'left';\n return this;\n }\n /**\n * Sets the bottom position of the overlay. Clears any previously set vertical position.\n * @param value New bottom offset.\n */\n bottom(value = '') {\n this._topOffset = '';\n this._bottomOffset = value;\n this._alignItems = 'flex-end';\n return this;\n }\n /**\n * Sets the right position of the overlay. Clears any previously set horizontal position.\n * @param value New right offset.\n */\n right(value = '') {\n this._xOffset = value;\n this._xPosition = 'right';\n return this;\n }\n /**\n * Sets the overlay to the start of the viewport, depending on the overlay direction.\n * This will be to the left in LTR layouts and to the right in RTL.\n * @param offset Offset from the edge of the screen.\n */\n start(value = '') {\n this._xOffset = value;\n this._xPosition = 'start';\n return this;\n }\n /**\n * Sets the overlay to the end of the viewport, depending on the overlay direction.\n * This will be to the right in LTR layouts and to the left in RTL.\n * @param offset Offset from the edge of the screen.\n */\n end(value = '') {\n this._xOffset = value;\n this._xPosition = 'end';\n return this;\n }\n /**\n * Sets the overlay width and clears any previously set width.\n * @param value New width for the overlay\n * @deprecated Pass the `width` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n width(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ width: value });\n }\n else {\n this._width = value;\n }\n return this;\n }\n /**\n * Sets the overlay height and clears any previously set height.\n * @param value New height for the overlay\n * @deprecated Pass the `height` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n height(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ height: value });\n }\n else {\n this._height = value;\n }\n return this;\n }\n /**\n * Centers the overlay horizontally with an optional offset.\n * Clears any previously set horizontal position.\n *\n * @param offset Overlay offset from the horizontal center.\n */\n centerHorizontally(offset = '') {\n this.left(offset);\n this._xPosition = 'center';\n return this;\n }\n /**\n * Centers the overlay vertically with an optional offset.\n * Clears any previously set vertical position.\n *\n * @param offset Overlay offset from the vertical center.\n */\n centerVertically(offset = '') {\n this.top(offset);\n this._alignItems = 'center';\n return this;\n }\n /**\n * Apply the position to the element.\n * @docs-private\n */\n apply() {\n // Since the overlay ref applies the strategy asynchronously, it could\n // have been disposed before it ends up being applied. If that is the\n // case, we shouldn't do anything.\n if (!this._overlayRef || !this._overlayRef.hasAttached()) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parentStyles = this._overlayRef.hostElement.style;\n const config = this._overlayRef.getConfig();\n const { width, height, maxWidth, maxHeight } = config;\n const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') &&\n (!maxWidth || maxWidth === '100%' || maxWidth === '100vw');\n const shouldBeFlushVertically = (height === '100%' || height === '100vh') &&\n (!maxHeight || maxHeight === '100%' || maxHeight === '100vh');\n const xPosition = this._xPosition;\n const xOffset = this._xOffset;\n const isRtl = this._overlayRef.getConfig().direction === 'rtl';\n let marginLeft = '';\n let marginRight = '';\n let justifyContent = '';\n if (shouldBeFlushHorizontally) {\n justifyContent = 'flex-start';\n }\n else if (xPosition === 'center') {\n justifyContent = 'center';\n if (isRtl) {\n marginRight = xOffset;\n }\n else {\n marginLeft = xOffset;\n }\n }\n else if (isRtl) {\n if (xPosition === 'left' || xPosition === 'end') {\n justifyContent = 'flex-end';\n marginLeft = xOffset;\n }\n else if (xPosition === 'right' || xPosition === 'start') {\n justifyContent = 'flex-start';\n marginRight = xOffset;\n }\n }\n else if (xPosition === 'left' || xPosition === 'start') {\n justifyContent = 'flex-start';\n marginLeft = xOffset;\n }\n else if (xPosition === 'right' || xPosition === 'end') {\n justifyContent = 'flex-end';\n marginRight = xOffset;\n }\n styles.position = this._cssPosition;\n styles.marginLeft = shouldBeFlushHorizontally ? '0' : marginLeft;\n styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset;\n styles.marginBottom = this._bottomOffset;\n styles.marginRight = shouldBeFlushHorizontally ? '0' : marginRight;\n parentStyles.justifyContent = justifyContent;\n parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems;\n }\n /**\n * Cleans up the DOM changes from the position strategy.\n * @docs-private\n */\n dispose() {\n if (this._isDisposed || !this._overlayRef) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parent = this._overlayRef.hostElement;\n const parentStyles = parent.style;\n parent.classList.remove(wrapperClass);\n parentStyles.justifyContent =\n parentStyles.alignItems =\n styles.marginTop =\n styles.marginBottom =\n styles.marginLeft =\n styles.marginRight =\n styles.position =\n '';\n this._overlayRef = null;\n this._isDisposed = true;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Builder for overlay position strategy. */\nclass OverlayPositionBuilder {\n constructor(_viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n }\n /**\n * Creates a global position strategy.\n */\n global() {\n return new GlobalPositionStrategy();\n }\n /**\n * Creates a flexible position strategy.\n * @param origin Origin relative to which to position the overlay.\n */\n flexibleConnectedTo(origin) {\n return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n}\nOverlayPositionBuilder.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayPositionBuilder, deps: [{ token: i1.ViewportRuler }, { token: DOCUMENT }, { token: i1$1.Platform }, { token: OverlayContainer }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayPositionBuilder.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayPositionBuilder, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayPositionBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.ViewportRuler }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: OverlayContainer }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Next overlay unique ID. */\nlet nextUniqueId = 0;\n// Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver\n// which needs to be different depending on where OverlayModule is imported.\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one.\n */\nclass Overlay {\n constructor(\n /** Scrolling strategies that can be used when creating an overlay. */\n scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, _location, _outsideClickDispatcher, _animationsModuleType) {\n this.scrollStrategies = scrollStrategies;\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._positionBuilder = _positionBuilder;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._injector = _injector;\n this._ngZone = _ngZone;\n this._document = _document;\n this._directionality = _directionality;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._animationsModuleType = _animationsModuleType;\n }\n /**\n * Creates an overlay.\n * @param config Configuration applied to the overlay.\n * @returns Reference to the created overlay.\n */\n create(config) {\n const host = this._createHostElement();\n const pane = this._createPaneElement(host);\n const portalOutlet = this._createPortalOutlet(pane);\n const overlayConfig = new OverlayConfig(config);\n overlayConfig.direction = overlayConfig.direction || this._directionality.value;\n return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher, this._animationsModuleType === 'NoopAnimations');\n }\n /**\n * Gets a position builder that can be used, via fluent API,\n * to construct and configure a position strategy.\n * @returns An overlay position builder.\n */\n position() {\n return this._positionBuilder;\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(host) {\n const pane = this._document.createElement('div');\n pane.id = `cdk-overlay-${nextUniqueId++}`;\n pane.classList.add('cdk-overlay-pane');\n host.appendChild(pane);\n return pane;\n }\n /**\n * Creates the host element that wraps around an overlay\n * and can be used for advanced positioning.\n * @returns Newly-create host element.\n */\n _createHostElement() {\n const host = this._document.createElement('div');\n this._overlayContainer.getContainerElement().appendChild(host);\n return host;\n }\n /**\n * Create a DomPortalOutlet into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal outlet.\n * @returns A portal outlet for the given DOM element.\n */\n _createPortalOutlet(pane) {\n // We have to resolve the ApplicationRef later in order to allow people\n // to use overlay-based providers during app initialization.\n if (!this._appRef) {\n this._appRef = this._injector.get(ApplicationRef);\n }\n return new DomPortalOutlet(pane, this._componentFactoryResolver, this._appRef, this._injector, this._document);\n }\n}\nOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Overlay, deps: [{ token: ScrollStrategyOptions }, { token: OverlayContainer }, { token: i0.ComponentFactoryResolver }, { token: OverlayPositionBuilder }, { token: OverlayKeyboardDispatcher }, { token: i0.Injector }, { token: i0.NgZone }, { token: DOCUMENT }, { token: i5.Directionality }, { token: i6.Location }, { token: OverlayOutsideClickDispatcher }, { token: ANIMATION_MODULE_TYPE, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlay.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Overlay, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Overlay, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: i0.ComponentFactoryResolver }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: i0.Injector }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i5.Directionality }, { type: i6.Location }, { type: OverlayOutsideClickDispatcher }, { type: undefined, decorators: [{\n type: Inject,\n args: [ANIMATION_MODULE_TYPE]\n }, {\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Default set of positions for the overlay. Follows the behavior of a dropdown. */\nconst defaultPositionList = [\n {\n originX: 'start',\n originY: 'bottom',\n overlayX: 'start',\n overlayY: 'top',\n },\n {\n originX: 'start',\n originY: 'top',\n overlayX: 'start',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'top',\n overlayX: 'end',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'bottom',\n overlayX: 'end',\n overlayY: 'top',\n },\n];\n/** Injection token that determines the scroll handling while the connected overlay is open. */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new InjectionToken('cdk-connected-overlay-scroll-strategy');\n/**\n * Directive applied to an element to make it usable as an origin for an Overlay using a\n * ConnectedPositionStrategy.\n */\nclass CdkOverlayOrigin {\n constructor(\n /** Reference to the element on which the directive is applied. */\n elementRef) {\n this.elementRef = elementRef;\n }\n}\nCdkOverlayOrigin.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkOverlayOrigin, deps: [{ token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkOverlayOrigin.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkOverlayOrigin, isStandalone: true, selector: \"[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]\", exportAs: [\"cdkOverlayOrigin\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkOverlayOrigin, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]',\n exportAs: 'cdkOverlayOrigin',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }]; } });\n/**\n * Directive to facilitate declarative creation of an\n * Overlay using a FlexibleConnectedPositionStrategy.\n */\nclass CdkConnectedOverlay {\n /** The offset in pixels for the overlay connection point on the x-axis */\n get offsetX() {\n return this._offsetX;\n }\n set offsetX(offsetX) {\n this._offsetX = offsetX;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** The offset in pixels for the overlay connection point on the y-axis */\n get offsetY() {\n return this._offsetY;\n }\n set offsetY(offsetY) {\n this._offsetY = offsetY;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** Whether or not the overlay should attach a backdrop. */\n get hasBackdrop() {\n return this._hasBackdrop;\n }\n set hasBackdrop(value) {\n this._hasBackdrop = coerceBooleanProperty(value);\n }\n /** Whether or not the overlay should be locked when scrolling. */\n get lockPosition() {\n return this._lockPosition;\n }\n set lockPosition(value) {\n this._lockPosition = coerceBooleanProperty(value);\n }\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n get flexibleDimensions() {\n return this._flexibleDimensions;\n }\n set flexibleDimensions(value) {\n this._flexibleDimensions = coerceBooleanProperty(value);\n }\n /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */\n get growAfterOpen() {\n return this._growAfterOpen;\n }\n set growAfterOpen(value) {\n this._growAfterOpen = coerceBooleanProperty(value);\n }\n /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */\n get push() {\n return this._push;\n }\n set push(value) {\n this._push = coerceBooleanProperty(value);\n }\n // TODO(jelbourn): inputs for size, scroll behavior, animation, etc.\n constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) {\n this._overlay = _overlay;\n this._dir = _dir;\n this._hasBackdrop = false;\n this._lockPosition = false;\n this._growAfterOpen = false;\n this._flexibleDimensions = false;\n this._push = false;\n this._backdropSubscription = Subscription.EMPTY;\n this._attachSubscription = Subscription.EMPTY;\n this._detachSubscription = Subscription.EMPTY;\n this._positionSubscription = Subscription.EMPTY;\n /** Margin between the overlay and the viewport edges. */\n this.viewportMargin = 0;\n /** Whether the overlay is open. */\n this.open = false;\n /** Whether the overlay can be closed by user interaction. */\n this.disableClose = false;\n /** Event emitted when the backdrop is clicked. */\n this.backdropClick = new EventEmitter();\n /** Event emitted when the position has changed. */\n this.positionChange = new EventEmitter();\n /** Event emitted when the overlay has been attached. */\n this.attach = new EventEmitter();\n /** Event emitted when the overlay has been detached. */\n this.detach = new EventEmitter();\n /** Emits when there are keyboard events that are targeted at the overlay. */\n this.overlayKeydown = new EventEmitter();\n /** Emits when there are mouse outside click events that are targeted at the overlay. */\n this.overlayOutsideClick = new EventEmitter();\n this._templatePortal = new TemplatePortal(templateRef, viewContainerRef);\n this._scrollStrategyFactory = scrollStrategyFactory;\n this.scrollStrategy = this._scrollStrategyFactory();\n }\n /** The associated overlay reference. */\n get overlayRef() {\n return this._overlayRef;\n }\n /** The element's layout direction. */\n get dir() {\n return this._dir ? this._dir.value : 'ltr';\n }\n ngOnDestroy() {\n this._attachSubscription.unsubscribe();\n this._detachSubscription.unsubscribe();\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n if (this._overlayRef) {\n this._overlayRef.dispose();\n }\n }\n ngOnChanges(changes) {\n if (this._position) {\n this._updatePositionStrategy(this._position);\n this._overlayRef.updateSize({\n width: this.width,\n minWidth: this.minWidth,\n height: this.height,\n minHeight: this.minHeight,\n });\n if (changes['origin'] && this.open) {\n this._position.apply();\n }\n }\n if (changes['open']) {\n this.open ? this._attachOverlay() : this._detachOverlay();\n }\n }\n /** Creates an overlay */\n _createOverlay() {\n if (!this.positions || !this.positions.length) {\n this.positions = defaultPositionList;\n }\n const overlayRef = (this._overlayRef = this._overlay.create(this._buildConfig()));\n this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit());\n this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit());\n overlayRef.keydownEvents().subscribe((event) => {\n this.overlayKeydown.next(event);\n if (event.keyCode === ESCAPE && !this.disableClose && !hasModifierKey(event)) {\n event.preventDefault();\n this._detachOverlay();\n }\n });\n this._overlayRef.outsidePointerEvents().subscribe((event) => {\n this.overlayOutsideClick.next(event);\n });\n }\n /** Builds the overlay config based on the directive's inputs */\n _buildConfig() {\n const positionStrategy = (this._position =\n this.positionStrategy || this._createPositionStrategy());\n const overlayConfig = new OverlayConfig({\n direction: this._dir,\n positionStrategy,\n scrollStrategy: this.scrollStrategy,\n hasBackdrop: this.hasBackdrop,\n });\n if (this.width || this.width === 0) {\n overlayConfig.width = this.width;\n }\n if (this.height || this.height === 0) {\n overlayConfig.height = this.height;\n }\n if (this.minWidth || this.minWidth === 0) {\n overlayConfig.minWidth = this.minWidth;\n }\n if (this.minHeight || this.minHeight === 0) {\n overlayConfig.minHeight = this.minHeight;\n }\n if (this.backdropClass) {\n overlayConfig.backdropClass = this.backdropClass;\n }\n if (this.panelClass) {\n overlayConfig.panelClass = this.panelClass;\n }\n return overlayConfig;\n }\n /** Updates the state of a position strategy, based on the values of the directive inputs. */\n _updatePositionStrategy(positionStrategy) {\n const positions = this.positions.map(currentPosition => ({\n originX: currentPosition.originX,\n originY: currentPosition.originY,\n overlayX: currentPosition.overlayX,\n overlayY: currentPosition.overlayY,\n offsetX: currentPosition.offsetX || this.offsetX,\n offsetY: currentPosition.offsetY || this.offsetY,\n panelClass: currentPosition.panelClass || undefined,\n }));\n return positionStrategy\n .setOrigin(this._getFlexibleConnectedPositionStrategyOrigin())\n .withPositions(positions)\n .withFlexibleDimensions(this.flexibleDimensions)\n .withPush(this.push)\n .withGrowAfterOpen(this.growAfterOpen)\n .withViewportMargin(this.viewportMargin)\n .withLockedPosition(this.lockPosition)\n .withTransformOriginOn(this.transformOriginSelector);\n }\n /** Returns the position strategy of the overlay to be set on the overlay config */\n _createPositionStrategy() {\n const strategy = this._overlay\n .position()\n .flexibleConnectedTo(this._getFlexibleConnectedPositionStrategyOrigin());\n this._updatePositionStrategy(strategy);\n return strategy;\n }\n _getFlexibleConnectedPositionStrategyOrigin() {\n if (this.origin instanceof CdkOverlayOrigin) {\n return this.origin.elementRef;\n }\n else {\n return this.origin;\n }\n }\n /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */\n _attachOverlay() {\n if (!this._overlayRef) {\n this._createOverlay();\n }\n else {\n // Update the overlay size, in case the directive's inputs have changed\n this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop;\n }\n if (!this._overlayRef.hasAttached()) {\n this._overlayRef.attach(this._templatePortal);\n }\n if (this.hasBackdrop) {\n this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => {\n this.backdropClick.emit(event);\n });\n }\n else {\n this._backdropSubscription.unsubscribe();\n }\n this._positionSubscription.unsubscribe();\n // Only subscribe to `positionChanges` if requested, because putting\n // together all the information for it can be expensive.\n if (this.positionChange.observers.length > 0) {\n this._positionSubscription = this._position.positionChanges\n .pipe(takeWhile(() => this.positionChange.observers.length > 0))\n .subscribe(position => {\n this.positionChange.emit(position);\n if (this.positionChange.observers.length === 0) {\n this._positionSubscription.unsubscribe();\n }\n });\n }\n }\n /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */\n _detachOverlay() {\n if (this._overlayRef) {\n this._overlayRef.detach();\n }\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n }\n}\nCdkConnectedOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkConnectedOverlay, deps: [{ token: Overlay }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY }, { token: i5.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkConnectedOverlay.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkConnectedOverlay, isStandalone: true, selector: \"[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]\", inputs: { origin: [\"cdkConnectedOverlayOrigin\", \"origin\"], positions: [\"cdkConnectedOverlayPositions\", \"positions\"], positionStrategy: [\"cdkConnectedOverlayPositionStrategy\", \"positionStrategy\"], offsetX: [\"cdkConnectedOverlayOffsetX\", \"offsetX\"], offsetY: [\"cdkConnectedOverlayOffsetY\", \"offsetY\"], width: [\"cdkConnectedOverlayWidth\", \"width\"], height: [\"cdkConnectedOverlayHeight\", \"height\"], minWidth: [\"cdkConnectedOverlayMinWidth\", \"minWidth\"], minHeight: [\"cdkConnectedOverlayMinHeight\", \"minHeight\"], backdropClass: [\"cdkConnectedOverlayBackdropClass\", \"backdropClass\"], panelClass: [\"cdkConnectedOverlayPanelClass\", \"panelClass\"], viewportMargin: [\"cdkConnectedOverlayViewportMargin\", \"viewportMargin\"], scrollStrategy: [\"cdkConnectedOverlayScrollStrategy\", \"scrollStrategy\"], open: [\"cdkConnectedOverlayOpen\", \"open\"], disableClose: [\"cdkConnectedOverlayDisableClose\", \"disableClose\"], transformOriginSelector: [\"cdkConnectedOverlayTransformOriginOn\", \"transformOriginSelector\"], hasBackdrop: [\"cdkConnectedOverlayHasBackdrop\", \"hasBackdrop\"], lockPosition: [\"cdkConnectedOverlayLockPosition\", \"lockPosition\"], flexibleDimensions: [\"cdkConnectedOverlayFlexibleDimensions\", \"flexibleDimensions\"], growAfterOpen: [\"cdkConnectedOverlayGrowAfterOpen\", \"growAfterOpen\"], push: [\"cdkConnectedOverlayPush\", \"push\"] }, outputs: { backdropClick: \"backdropClick\", positionChange: \"positionChange\", attach: \"attach\", detach: \"detach\", overlayKeydown: \"overlayKeydown\", overlayOutsideClick: \"overlayOutsideClick\" }, exportAs: [\"cdkConnectedOverlay\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkConnectedOverlay, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]',\n exportAs: 'cdkConnectedOverlay',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: Overlay }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY]\n }] }, { type: i5.Directionality, decorators: [{\n type: Optional\n }] }]; }, propDecorators: { origin: [{\n type: Input,\n args: ['cdkConnectedOverlayOrigin']\n }], positions: [{\n type: Input,\n args: ['cdkConnectedOverlayPositions']\n }], positionStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayPositionStrategy']\n }], offsetX: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetX']\n }], offsetY: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetY']\n }], width: [{\n type: Input,\n args: ['cdkConnectedOverlayWidth']\n }], height: [{\n type: Input,\n args: ['cdkConnectedOverlayHeight']\n }], minWidth: [{\n type: Input,\n args: ['cdkConnectedOverlayMinWidth']\n }], minHeight: [{\n type: Input,\n args: ['cdkConnectedOverlayMinHeight']\n }], backdropClass: [{\n type: Input,\n args: ['cdkConnectedOverlayBackdropClass']\n }], panelClass: [{\n type: Input,\n args: ['cdkConnectedOverlayPanelClass']\n }], viewportMargin: [{\n type: Input,\n args: ['cdkConnectedOverlayViewportMargin']\n }], scrollStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayScrollStrategy']\n }], open: [{\n type: Input,\n args: ['cdkConnectedOverlayOpen']\n }], disableClose: [{\n type: Input,\n args: ['cdkConnectedOverlayDisableClose']\n }], transformOriginSelector: [{\n type: Input,\n args: ['cdkConnectedOverlayTransformOriginOn']\n }], hasBackdrop: [{\n type: Input,\n args: ['cdkConnectedOverlayHasBackdrop']\n }], lockPosition: [{\n type: Input,\n args: ['cdkConnectedOverlayLockPosition']\n }], flexibleDimensions: [{\n type: Input,\n args: ['cdkConnectedOverlayFlexibleDimensions']\n }], growAfterOpen: [{\n type: Input,\n args: ['cdkConnectedOverlayGrowAfterOpen']\n }], push: [{\n type: Input,\n args: ['cdkConnectedOverlayPush']\n }], backdropClick: [{\n type: Output\n }], positionChange: [{\n type: Output\n }], attach: [{\n type: Output\n }], detach: [{\n type: Output\n }], overlayKeydown: [{\n type: Output\n }], overlayOutsideClick: [{\n type: Output\n }] } });\n/** @docs-private */\nfunction CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) {\n return () => overlay.scrollStrategies.reposition();\n}\n/** @docs-private */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = {\n provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,\n deps: [Overlay],\n useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY,\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass OverlayModule {\n}\nOverlayModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nOverlayModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, imports: [BidiModule, PortalModule, ScrollingModule, CdkConnectedOverlay, CdkOverlayOrigin], exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule] });\nOverlayModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER], imports: [BidiModule, PortalModule, ScrollingModule, ScrollingModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PortalModule, ScrollingModule, CdkConnectedOverlay, CdkOverlayOrigin],\n exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule],\n providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Alternative to OverlayContainer that supports correct displaying of overlay elements in\n * Fullscreen mode\n * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen\n *\n * Should be provided in the root component.\n */\nclass FullscreenOverlayContainer extends OverlayContainer {\n constructor(_document, platform) {\n super(_document, platform);\n }\n ngOnDestroy() {\n super.ngOnDestroy();\n if (this._fullScreenEventName && this._fullScreenListener) {\n this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener);\n }\n }\n _createContainer() {\n super._createContainer();\n this._adjustParentForFullscreenChange();\n this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange());\n }\n _adjustParentForFullscreenChange() {\n if (!this._containerElement) {\n return;\n }\n const fullscreenElement = this.getFullscreenElement();\n const parent = fullscreenElement || this._document.body;\n parent.appendChild(this._containerElement);\n }\n _addFullscreenChangeListener(fn) {\n const eventName = this._getEventName();\n if (eventName) {\n if (this._fullScreenListener) {\n this._document.removeEventListener(eventName, this._fullScreenListener);\n }\n this._document.addEventListener(eventName, fn);\n this._fullScreenListener = fn;\n }\n }\n _getEventName() {\n if (!this._fullScreenEventName) {\n const _document = this._document;\n if (_document.fullscreenEnabled) {\n this._fullScreenEventName = 'fullscreenchange';\n }\n else if (_document.webkitFullscreenEnabled) {\n this._fullScreenEventName = 'webkitfullscreenchange';\n }\n else if (_document.mozFullScreenEnabled) {\n this._fullScreenEventName = 'mozfullscreenchange';\n }\n else if (_document.msFullscreenEnabled) {\n this._fullScreenEventName = 'MSFullscreenChange';\n }\n }\n return this._fullScreenEventName;\n }\n /**\n * When the page is put into fullscreen mode, a specific element is specified.\n * Only that element and its children are visible when in fullscreen mode.\n */\n getFullscreenElement() {\n const _document = this._document;\n return (_document.fullscreenElement ||\n _document.webkitFullscreenElement ||\n _document.mozFullScreenElement ||\n _document.msFullscreenElement ||\n null);\n }\n}\nFullscreenOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FullscreenOverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nFullscreenOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FullscreenOverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FullscreenOverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, STANDARD_DROPDOWN_ADJACENT_POSITIONS, STANDARD_DROPDOWN_BELOW_POSITIONS, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition };\n","import { NgModule } from '@angular/core';\nimport { PublicContactUsComponent } from './public-contact-us.component';\nimport { CommonModule } from '@angular/common';\nimport { FormFieldModule, TextAreaModule } from '@progress/kendo-angular-inputs';\nimport { ReactiveFormsModule } from '@angular/forms';\nimport { RouterModule } from '@angular/router';\nimport { TranslateModule } from '@ngx-translate/core';\nimport { RecaptchaFormsModule, RecaptchaModule } from 'ng-recaptcha';\nimport { FileSelectModule } from '@progress/kendo-angular-upload';\nimport { EditorModule } from '@progress/kendo-angular-editor';\nimport { CommunicationSharedModule } from '../../dashboard/communication/shared/communication-shared.module';\nimport { ButtonsModule } from '@progress/kendo-angular-buttons';\nimport { BrowserModule } from '@angular/platform-browser';\nimport { AngularSvgIconModule } from 'angular-svg-icon';\nimport { FloatingLabelModule } from '@progress/kendo-angular-label';\nimport { IconWrapModule } from '../../core/shared/components/icon-wrap/icon-wrap.module';\n\n@NgModule({\n declarations: [PublicContactUsComponent ],\n exports: [PublicContactUsComponent],\n imports: [\n CommonModule,\n FormFieldModule,\n ReactiveFormsModule,\n RouterModule,\n TranslateModule,\n RecaptchaFormsModule,\n RecaptchaModule,\n FileSelectModule,\n EditorModule,\n CommunicationSharedModule,\n ButtonsModule,\n BrowserModule,\n AngularSvgIconModule,\n FloatingLabelModule,\n IconWrapModule,\n TextAreaModule\n ]\n})\nexport class PublicContactUsModule {}\n","//Angular Core\nimport { BrowserAnimationsModule } from '@angular/platform-browser/animations';\nimport { BrowserModule, HammerGestureConfig, HAMMER_GESTURE_CONFIG, Title } from '@angular/platform-browser';\nimport { NgModule, Injectable } from '@angular/core';\nimport { CommonModule } from '@angular/common';\nimport { FormsModule, ReactiveFormsModule } from '@angular/forms';\nimport { HttpClient, HttpClientModule, HTTP_INTERCEPTORS } from '@angular/common/http';\nimport { RouterModule } from '@angular/router';\n\n//Routing\nimport { AppRoutes } from './app.routing';\nimport { AppComponent } from './app.component';\n\n//Layout Service - Required\nimport { pagesToggleService } from './@pages/services/toggler.service';\n\n//Shared Layout Components\n\nimport { TranslateModule, TranslateLoader } from '@ngx-translate/core';\n\n//Sample Blank Pages - Optional\nimport { LandingPageComponent } from './landing-page/landing-page.component';\nimport { HttpClientTrans } from './core/services/http-translation.service';\nimport { NotFoundPageComponent } from './not-found-page/not-found-page.component';\nimport { ButtonsModule } from '@progress/kendo-angular-buttons';\nimport { GridModule } from '@progress/kendo-angular-grid';\nimport { environment } from '../environments/environment';\nimport { ChartsModule } from '@progress/kendo-angular-charts';\nimport 'hammerjs';\nimport { DialogsModule } from '@progress/kendo-angular-dialog';\nimport { InputsModule } from '@progress/kendo-angular-inputs';\nimport { CondensedComponent } from './@pages/layouts';\nimport { UploadModule } from '@progress/kendo-angular-upload';\nimport { DropDownsModule } from '@progress/kendo-angular-dropdowns';\nimport { CookieDeclarationComponent } from './cookie-declaration/cookie-declaration.component';\nimport { LabelModule } from '@progress/kendo-angular-label';\nimport { RemoteTranslationsLoader } from './helpers/remote-translation-loader';\nimport { HttpErrorInterceptor } from './core/services/error-intercetor.service';\nimport { LanguageInterceptor } from './core/services/language-interceptor.service';\nimport { SpinnerInterceptor } from './core/services/spinner.service';\nimport { ForbiddenPageComponent } from './forbidden-page/forbidden-page.component';\nimport { ThankYouPageComponent } from './thank-you-page/thank-you-page.component';\nimport {\n BrowserCacheLocation,\n InteractionType,\n IPublicClientApplication,\n PublicClientApplication\n} from '@azure/msal-browser';\nimport { OverlayModule } from '@angular/cdk/overlay';\nimport { LogoutPageComponent } from './logout-page/logout-page.component';\nimport { NoAccessComponent } from './no-access/no-access.component';\nimport { LayoutModule } from '@progress/kendo-angular-layout';\nimport { NotificationModule } from '@progress/kendo-angular-notification';\nimport { SharedModule } from './core/shared/shared.module';\nimport { GoogleTagManagerService } from 'angular-google-tag-manager';\nimport { ImportExportService } from './dashboard/import-export/import-export.service';\nimport { PublicContactUsModule } from './public/public-contact-us/public-contact-us.module';\nimport { RECAPTCHA_SETTINGS, RecaptchaFormsModule, RecaptchaV3Module } from 'ng-recaptcha';\nimport {\n MsalGuard,\n MsalInterceptor,\n MsalBroadcastService,\n MsalInterceptorConfiguration,\n MsalModule,\n MsalService,\n MSAL_GUARD_CONFIG,\n MSAL_INSTANCE,\n MSAL_INTERCEPTOR_CONFIG,\n MsalGuardConfiguration,\n MsalRedirectComponent\n} from '@azure/msal-angular';\nimport { AngularSvgIconModule } from 'angular-svg-icon';\n\nconst lang = navigator.language.split('-')[0] ? navigator.language.split('-')[0] : 'en';\n\n//Hammer Config Overide\n//https://github.com/angular/angular/issues/10541\n@Injectable()\nexport class AppHammerConfig extends HammerGestureConfig {\n overrides = {\n pinch: { enable: false },\n rotate: { enable: false }\n };\n}\n\nexport function createTranslateLoader(http: HttpClientTrans) {\n return new RemoteTranslationsLoader(http, '');\n}\nexport function MSALInstanceFactory(): IPublicClientApplication {\n return new PublicClientApplication({\n auth: environment.auth,\n cache: {\n cacheLocation: BrowserCacheLocation.LocalStorage, // This configures where your cache will be stored\n storeAuthStateInCookie: false // Set this to \"true\" if you are having issues on IE11 or Edge\n }\n });\n}\n\nexport function MSALInterceptorConfigFactory(): MsalInterceptorConfiguration {\n const protectedResourceMap = new Map>();\n protectedResourceMap.set('https://graph.microsoft.com/v1.0/me', ['user.read']);\n protectedResourceMap.set(environment.baseUrl, environment.apiUrl);\n\n return {\n interactionType: InteractionType.Redirect,\n protectedResourceMap,\n authRequest: {\n prompt: 'none'\n }\n };\n}\n\nexport function MSALGuardConfigFactory(): MsalGuardConfiguration {\n return {\n interactionType: InteractionType.Redirect,\n authRequest: {\n scopes: ['user.read']\n }\n };\n}\n\nconst isIframe = window !== window.parent && !window.opener;\n\n@NgModule({\n declarations: [\n AppComponent,\n CondensedComponent,\n LandingPageComponent,\n NotFoundPageComponent,\n CookieDeclarationComponent,\n ForbiddenPageComponent,\n ThankYouPageComponent,\n LogoutPageComponent,\n NoAccessComponent\n ],\n imports: [\n BrowserModule,\n BrowserAnimationsModule,\n CommonModule,\n FormsModule,\n HttpClientModule,\n AngularSvgIconModule.forRoot(),\n RouterModule.forRoot(AppRoutes, {\n useHash: true\n // Don't perform initial navigation in iframes\n // initialNavigation: !isIframe ? 'enabled' : 'disabled'\n }),\n TranslateModule.forRoot({\n defaultLanguage: lang,\n loader: {\n provide: TranslateLoader,\n useFactory: createTranslateLoader,\n deps: [HttpClientTrans]\n },\n isolate: false\n }),\n ButtonsModule,\n GridModule,\n ChartsModule,\n DialogsModule,\n InputsModule,\n UploadModule,\n DropDownsModule,\n LabelModule,\n OverlayModule,\n LayoutModule,\n DropDownsModule,\n SharedModule,\n NotificationModule,\n ReactiveFormsModule,\n PublicContactUsModule,\n RecaptchaV3Module,\n RecaptchaFormsModule\n ],\n providers: [\n pagesToggleService,\n MsalService,\n MsalGuard,\n MsalBroadcastService,\n GoogleTagManagerService,\n Title,\n {\n provide: HAMMER_GESTURE_CONFIG,\n useClass: AppHammerConfig\n },\n {\n provide: 'API_BASE_URL',\n useValue: environment.baseUrl\n },\n {\n provide: 'USERS_BROWSER_LANG',\n useValue: lang\n },\n {\n provide: HTTP_INTERCEPTORS,\n useClass: HttpErrorInterceptor,\n multi: true\n },\n {\n provide: HTTP_INTERCEPTORS,\n useClass: SpinnerInterceptor,\n multi: true\n },\n {\n provide: HTTP_INTERCEPTORS,\n useClass: MsalInterceptor,\n multi: true\n },\n {\n provide: HTTP_INTERCEPTORS,\n useClass: LanguageInterceptor,\n multi: true\n },\n {\n provide: MSAL_INSTANCE,\n useFactory: MSALInstanceFactory\n },\n {\n provide: MSAL_GUARD_CONFIG,\n useFactory: MSALGuardConfigFactory\n },\n {\n provide: MSAL_INTERCEPTOR_CONFIG,\n useFactory: MSALInterceptorConfigFactory\n },\n {\n provide: 'googleTagManagerId',\n useValue: 'GTM-MS44BTS'\n },\n { provide: RECAPTCHA_SETTINGS, useValue: { siteKey: environment.recaptchaKey } },\n ImportExportService\n ],\n bootstrap: [AppComponent, MsalRedirectComponent]\n})\nexport class AppModule {}\n","import { enableProdMode } from '@angular/core';\nimport { platformBrowserDynamic } from '@angular/platform-browser-dynamic';\nimport 'hammerjs';\nimport { AppModule } from './app/app.module';\nimport { environment } from './environments/environment';\n\nif (environment.production) {\n enableProdMode();\n}\n\nplatformBrowserDynamic().bootstrapModule(AppModule);\n","/**\n * @license Angular v15.2.10\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the [AnimationBuilder.build](api/animations/AnimationBuilder#build)() method\n * to create a programmatic animation. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)()\n * method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of [`state()`](api/animations/state)\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of\n * [`state()`](api/animations/state) and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n *
...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n *
\n * \n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* AnimationMetadataType.Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* AnimationMetadataType.Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* AnimationMetadataType.Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* AnimationMetadataType.Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation [`state`](api/animations/state), within an animation\n *`sequence`, or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow an element to animate from\n * a height of 0 up to its full height:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* AnimationMetadataType.Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* AnimationMetadataType.State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* AnimationMetadataType.Keyframes */, steps };\n}\n/**\n * Declares an animation transition which is played when a certain specified condition is met.\n *\n * @param stateChangeExpr A string with a specific format or a function that specifies when the\n * animation transition should occur (see [State Change Expression](#state-change-expression)).\n *\n * @param steps One or more animation objects that represent the animation's instructions.\n *\n * @param options An options object that can be used to specify a delay for the animation or provide\n * custom parameters for it.\n *\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n *\n * ### State Change Expression\n *\n * The State Change Expression instructs Angular when to run the transition's animations, it can\n *either be\n * - a string with a specific syntax\n * - or a function that compares the previous and current state (value of the expression bound to\n * the element's trigger) and returns `true` if the transition should occur or `false` otherwise\n *\n * The string format can be:\n * - `fromState => toState`, which indicates that the transition's animations should occur then the\n * expression bound to the trigger's element goes from `fromState` to `toState`\n *\n * _Example:_\n * ```typescript\n * transition('open => closed', animate('.5s ease-out', style({ height: 0 }) ))\n * ```\n *\n * - `fromState <=> toState`, which indicates that the transition's animations should occur then\n * the expression bound to the trigger's element goes from `fromState` to `toState` or vice versa\n *\n * _Example:_\n * ```typescript\n * transition('enabled <=> disabled', animate('1s cubic-bezier(0.8,0.3,0,1)'))\n * ```\n *\n * - `:enter`/`:leave`, which indicates that the transition's animations should occur when the\n * element enters or exists the DOM\n *\n * _Example:_\n * ```typescript\n * transition(':enter', [\n * style({ opacity: 0 }),\n * animate('500ms', style({ opacity: 1 }))\n * ])\n * ```\n *\n * - `:increment`/`:decrement`, which indicates that the transition's animations should occur when\n * the numerical expression bound to the trigger's element has increased in value or decreased\n *\n * _Example:_\n * ```typescript\n * transition(':increment', query('@counter', animateChild()))\n * ```\n *\n * - a sequence of any of the above divided by commas, which indicates that transition's animations\n * should occur whenever one of the state change expressions matches\n *\n * _Example:_\n * ```typescript\n * transition(':increment, * => enabled, :enter', animate('1s ease', keyframes([\n * style({ transform: 'scale(1)', offset: 0}),\n * style({ transform: 'scale(1.1)', offset: 0.7}),\n * style({ transform: 'scale(1)', offset: 1})\n * ]))),\n * ```\n *\n * Also note that in such context:\n * - `void` can be used to indicate the absence of the element\n * - asterisks can be used as wildcards that match any state\n * - (as a consequence of the above, `void => *` is equivalent to `:enter` and `* => void` is\n * equivalent to `:leave`)\n * - `true` and `false` also match expression values of `1` and `0` respectively (but do not match\n * _truthy_ and _falsy_ values)\n *\n *
\n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\"on => off, open => closed\", animate(500)),\n * transition(\"* <=> error\", query('.indicator', animateChild()))\n * ])\n * ```\n *\n * - Transition animations applied based on custom logic dependent\n * on the trigger's expression value and provided parameters\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\n * (fromState, toState, _element, params) =>\n * ['firststep', 'laststep'].includes(fromState.toLowerCase())\n * && toState === params?.['target'],\n * animate('1s')\n * )\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* AnimationMetadataType.Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* AnimationMetadataType.Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimationMetadataType.AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimationMetadataType.AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements (not\n * all elements can be queried via these tokens, see\n * [Entering and Leaving Elements](#entering-and-leaving-elements))\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n *\n * ### Multiple Tokens\n *\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Entering and Leaving Elements\n *\n * Not all elements can be queried via the `:enter` and `:leave` tokens, the only ones\n * that can are those that Angular assumes can enter/leave based on their own logic\n * (if their insertion/removal is simply a consequence of that of their parent they\n * should be queried via a different token in their parent's `:enter`/`:leave` transitions).\n *\n * The only elements Angular assumes can enter/leave based on their own logic (thus the only\n * ones that can be queried via the `:enter` and `:leave` tokens) are:\n * - Those inserted dynamically (via `ViewContainerRef`)\n * - Those that have a structural directive (which, under the hood, are a subset of the above ones)\n *\n *
\n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n *
\n *\n * There is an exception to what previously mentioned, besides elements entering/leaving based on\n * their own logic, elements with an animation trigger can always be queried via `:leave` when\n * their parent is also leaving.\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n *
\n *
Title
\n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* AnimationMetadataType.Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n * \n *
\n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* AnimationMetadataType.Stagger */, timings, animation };\n}\n\nfunction scheduleMicroTask(cb) {\n Promise.resolve().then(cb);\n}\n\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n this._finished = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nconst ɵPRE_STYLE = '!';\n\n/**\n * @module\n * @description\n * Entry point for all animation APIs of the animation package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n","import * as i0 from '@angular/core';\nimport { InjectionToken, inject, EventEmitter, Injectable, Optional, Inject, Directive, Output, Input, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to inject the document into Directionality.\n * This is used so that the value can be faked in tests.\n *\n * We can't use the real document in tests because changing the real `dir` causes geometry-based\n * tests in Safari to fail.\n *\n * We also can't re-provide the DOCUMENT token from platform-browser because the unit tests\n * themselves use things like `querySelector` in test code.\n *\n * This token is defined in a separate file from Directionality as a workaround for\n * https://github.com/angular/angular/issues/22559\n *\n * @docs-private\n */\nconst DIR_DOCUMENT = new InjectionToken('cdk-dir-doc', {\n providedIn: 'root',\n factory: DIR_DOCUMENT_FACTORY,\n});\n/** @docs-private */\nfunction DIR_DOCUMENT_FACTORY() {\n return inject(DOCUMENT);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Regex that matches locales with an RTL script. Taken from `goog.i18n.bidi.isRtlLanguage`. */\nconst RTL_LOCALE_PATTERN = /^(ar|ckb|dv|he|iw|fa|nqo|ps|sd|ug|ur|yi|.*[-_](Adlm|Arab|Hebr|Nkoo|Rohg|Thaa))(?!.*[-_](Latn|Cyrl)($|-|_))($|-|_)/i;\n/** Resolves a string value to a specific direction. */\nfunction _resolveDirectionality(rawValue) {\n const value = rawValue?.toLowerCase() || '';\n if (value === 'auto' && typeof navigator !== 'undefined' && navigator?.language) {\n return RTL_LOCALE_PATTERN.test(navigator.language) ? 'rtl' : 'ltr';\n }\n return value === 'rtl' ? 'rtl' : 'ltr';\n}\n/**\n * The directionality (LTR / RTL) context for the application (or a subtree of it).\n * Exposes the current direction and a stream of direction changes.\n */\nclass Directionality {\n constructor(_document) {\n /** The current 'ltr' or 'rtl' value. */\n this.value = 'ltr';\n /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */\n this.change = new EventEmitter();\n if (_document) {\n const bodyDir = _document.body ? _document.body.dir : null;\n const htmlDir = _document.documentElement ? _document.documentElement.dir : null;\n this.value = _resolveDirectionality(bodyDir || htmlDir || 'ltr');\n }\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDirectionality.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Directionality, deps: [{ token: DIR_DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nDirectionality.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Directionality, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Directionality, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DIR_DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive to listen for changes of direction of part of the DOM.\n *\n * Provides itself as Directionality such that descendant directives only need to ever inject\n * Directionality to get the closest direction.\n */\nclass Dir {\n constructor() {\n /** Normalized direction that accounts for invalid/unsupported values. */\n this._dir = 'ltr';\n /** Whether the `value` has been set to its initial value. */\n this._isInitialized = false;\n /** Event emitted when the direction changes. */\n this.change = new EventEmitter();\n }\n /** @docs-private */\n get dir() {\n return this._dir;\n }\n set dir(value) {\n const previousValue = this._dir;\n // Note: `_resolveDirectionality` resolves the language based on the browser's language,\n // whereas the browser does it based on the content of the element. Since doing so based\n // on the content can be expensive, for now we're doing the simpler matching.\n this._dir = _resolveDirectionality(value);\n this._rawDir = value;\n if (previousValue !== this._dir && this._isInitialized) {\n this.change.emit(this._dir);\n }\n }\n /** Current layout direction of the element. */\n get value() {\n return this.dir;\n }\n /** Initialize once default value has been set. */\n ngAfterContentInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDir.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Dir, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nDir.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: Dir, selector: \"[dir]\", inputs: { dir: \"dir\" }, outputs: { change: \"dirChange\" }, host: { properties: { \"attr.dir\": \"_rawDir\" } }, providers: [{ provide: Directionality, useExisting: Dir }], exportAs: [\"dir\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Dir, decorators: [{\n type: Directive,\n args: [{\n selector: '[dir]',\n providers: [{ provide: Directionality, useExisting: Dir }],\n host: { '[attr.dir]': '_rawDir' },\n exportAs: 'dir',\n }]\n }], propDecorators: { change: [{\n type: Output,\n args: ['dirChange']\n }], dir: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass BidiModule {\n}\nBidiModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nBidiModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule, declarations: [Dir], exports: [Dir] });\nBidiModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [Dir],\n declarations: [Dir],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BidiModule, DIR_DOCUMENT, Dir, Directionality };\n","import { ElementRef } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a data-bound value (typically a string) to a boolean. */\nfunction coerceBooleanProperty(value) {\n return value != null && `${value}` !== 'false';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceNumberProperty(value, fallbackValue = 0) {\n return _isNumberValue(value) ? Number(value) : fallbackValue;\n}\n/**\n * Whether the provided value is considered a number.\n * @docs-private\n */\nfunction _isNumberValue(value) {\n // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string,\n // and other non-number values as NaN, where Number just uses 0) but it considers the string\n // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN.\n return !isNaN(parseFloat(value)) && !isNaN(Number(value));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceArray(value) {\n return Array.isArray(value) ? value : [value];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a value to a CSS pixel value. */\nfunction coerceCssPixelValue(value) {\n if (value == null) {\n return '';\n }\n return typeof value === 'string' ? value : `${value}px`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces an ElementRef or an Element into an element.\n * Useful for APIs that can accept either a ref or the native element itself.\n */\nfunction coerceElement(elementOrRef) {\n return elementOrRef instanceof ElementRef ? elementOrRef.nativeElement : elementOrRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces a value to an array of trimmed non-empty strings.\n * Any input that is not an array, `null` or `undefined` will be turned into a string\n * via `toString()` and subsequently split with the given separator.\n * `null` and `undefined` will result in an empty array.\n * This results in the following outcomes:\n * - `null` -> `[]`\n * - `[null]` -> `[\"null\"]`\n * - `[\"a\", \"b \", \" \"]` -> `[\"a\", \"b\"]`\n * - `[1, [2, 3]]` -> `[\"1\", \"2,3\"]`\n * - `[{ a: 0 }]` -> `[\"[object Object]\"]`\n * - `{ a: 0 }` -> `[\"[object\", \"Object]\"]`\n *\n * Useful for defining CSS classes or table columns.\n * @param value the value to coerce into an array of strings\n * @param separator split-separator if value isn't an array\n */\nfunction coerceStringArray(value, separator = /\\s+/) {\n const result = [];\n if (value != null) {\n const sourceValues = Array.isArray(value) ? value : `${value}`.split(separator);\n for (const sourceValue of sourceValues) {\n const trimmedString = `${sourceValue}`.trim();\n if (trimmedString) {\n result.push(trimmedString);\n }\n }\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\nexport { _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty, coerceStringArray };\n","import * as i0 from '@angular/core';\nimport { PLATFORM_ID, Injectable, Inject, NgModule } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Whether the current platform supports the V8 Break Iterator. The V8 check\n// is necessary to detect all Blink based browsers.\nlet hasV8BreakIterator;\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\n// the consumer is providing a polyfilled `Map`. See:\n// https://github.com/Microsoft/ChakraCore/issues/3189\n// https://github.com/angular/components/issues/15687\ntry {\n hasV8BreakIterator = typeof Intl !== 'undefined' && Intl.v8BreakIterator;\n}\ncatch {\n hasV8BreakIterator = false;\n}\n/**\n * Service to detect the current platform by comparing the userAgent strings and\n * checking browser-specific global properties.\n */\nclass Platform {\n constructor(_platformId) {\n this._platformId = _platformId;\n // We want to use the Angular platform check because if the Document is shimmed\n // without the navigator, the following checks will fail. This is preferred because\n // sometimes the Document may be shimmed without the user's knowledge or intention\n /** Whether the Angular application is being rendered in the browser. */\n this.isBrowser = this._platformId\n ? isPlatformBrowser(this._platformId)\n : typeof document === 'object' && !!document;\n /** Whether the current browser is Microsoft Edge. */\n this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent);\n /** Whether the current rendering engine is Microsoft Trident. */\n this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent);\n // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check.\n /** Whether the current rendering engine is Blink. */\n this.BLINK = this.isBrowser &&\n !!(window.chrome || hasV8BreakIterator) &&\n typeof CSS !== 'undefined' &&\n !this.EDGE &&\n !this.TRIDENT;\n // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to\n // ensure that Webkit runs standalone and is not used as another engine's base.\n /** Whether the current rendering engine is WebKit. */\n this.WEBKIT = this.isBrowser &&\n /AppleWebKit/i.test(navigator.userAgent) &&\n !this.BLINK &&\n !this.EDGE &&\n !this.TRIDENT;\n /** Whether the current platform is Apple iOS. */\n this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) && !('MSStream' in window);\n // It's difficult to detect the plain Gecko engine, because most of the browsers identify\n // them self as Gecko-like browsers and modify the userAgent's according to that.\n // Since we only cover one explicit Firefox case, we can simply check for Firefox\n // instead of having an unstable check for Gecko.\n /** Whether the current browser is Firefox. */\n this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent);\n /** Whether the current platform is Android. */\n // Trident on mobile adds the android platform to the userAgent to trick detections.\n this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT;\n // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake\n // this and just place the Safari keyword in the userAgent. To be more safe about Safari every\n // Safari browser should also use Webkit as its layout engine.\n /** Whether the current browser is Safari. */\n this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT;\n }\n}\nPlatform.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Platform, deps: [{ token: PLATFORM_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nPlatform.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Platform, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Platform, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass PlatformModule {\n}\nPlatformModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPlatformModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule });\nPlatformModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result Set of input types support by the current browser. */\nlet supportedInputTypes;\n/** Types of `` that *might* be supported. */\nconst candidateInputTypes = [\n // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after\n // first changing it to something else:\n // The specified value \"\" does not conform to the required format.\n // The format is \"#rrggbb\" where rr, gg, bb are two-digit hexadecimal numbers.\n 'color',\n 'button',\n 'checkbox',\n 'date',\n 'datetime-local',\n 'email',\n 'file',\n 'hidden',\n 'image',\n 'month',\n 'number',\n 'password',\n 'radio',\n 'range',\n 'reset',\n 'search',\n 'submit',\n 'tel',\n 'text',\n 'time',\n 'url',\n 'week',\n];\n/** @returns The input types supported by this browser. */\nfunction getSupportedInputTypes() {\n // Result is cached.\n if (supportedInputTypes) {\n return supportedInputTypes;\n }\n // We can't check if an input type is not supported until we're on the browser, so say that\n // everything is supported when not on the browser. We don't use `Platform` here since it's\n // just a helper function and can't inject it.\n if (typeof document !== 'object' || !document) {\n supportedInputTypes = new Set(candidateInputTypes);\n return supportedInputTypes;\n }\n let featureTestInput = document.createElement('input');\n supportedInputTypes = new Set(candidateInputTypes.filter(value => {\n featureTestInput.setAttribute('type', value);\n return featureTestInput.type === value;\n }));\n return supportedInputTypes;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of whether the user's browser supports passive event listeners. */\nlet supportsPassiveEvents;\n/**\n * Checks whether the user's browser supports passive event listeners.\n * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n */\nfunction supportsPassiveEventListeners() {\n if (supportsPassiveEvents == null && typeof window !== 'undefined') {\n try {\n window.addEventListener('test', null, Object.defineProperty({}, 'passive', {\n get: () => (supportsPassiveEvents = true),\n }));\n }\n finally {\n supportsPassiveEvents = supportsPassiveEvents || false;\n }\n }\n return supportsPassiveEvents;\n}\n/**\n * Normalizes an `AddEventListener` object to something that can be passed\n * to `addEventListener` on any browser, no matter whether it supports the\n * `options` parameter.\n * @param options Object to be normalized.\n */\nfunction normalizePassiveListenerOptions(options) {\n return supportsPassiveEventListeners() ? options : !!options.capture;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */\nlet rtlScrollAxisType;\n/** Cached result of the check that indicates whether the browser supports scroll behaviors. */\nlet scrollBehaviorSupported;\n/** Check whether the browser supports scroll behaviors. */\nfunction supportsScrollBehavior() {\n if (scrollBehaviorSupported == null) {\n // If we're not in the browser, it can't be supported. Also check for `Element`, because\n // some projects stub out the global `document` during SSR which can throw us off.\n if (typeof document !== 'object' || !document || typeof Element !== 'function' || !Element) {\n scrollBehaviorSupported = false;\n return scrollBehaviorSupported;\n }\n // If the element can have a `scrollBehavior` style, we can be sure that it's supported.\n if ('scrollBehavior' in document.documentElement.style) {\n scrollBehaviorSupported = true;\n }\n else {\n // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's\n // supported but it doesn't handle scroll behavior, or it has been polyfilled.\n const scrollToFunction = Element.prototype.scrollTo;\n if (scrollToFunction) {\n // We can detect if the function has been polyfilled by calling `toString` on it. Native\n // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get\n // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider\n // polyfilled functions as supporting scroll behavior.\n scrollBehaviorSupported = !/\\{\\s*\\[native code\\]\\s*\\}/.test(scrollToFunction.toString());\n }\n else {\n scrollBehaviorSupported = false;\n }\n }\n }\n return scrollBehaviorSupported;\n}\n/**\n * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL,\n * Firefox & Safari are NEGATED, and IE & Edge are INVERTED.\n */\nfunction getRtlScrollAxisType() {\n // We can't check unless we're on the browser. Just assume 'normal' if we're not.\n if (typeof document !== 'object' || !document) {\n return 0 /* RtlScrollAxisType.NORMAL */;\n }\n if (rtlScrollAxisType == null) {\n // Create a 1px wide scrolling container and a 2px wide content element.\n const scrollContainer = document.createElement('div');\n const containerStyle = scrollContainer.style;\n scrollContainer.dir = 'rtl';\n containerStyle.width = '1px';\n containerStyle.overflow = 'auto';\n containerStyle.visibility = 'hidden';\n containerStyle.pointerEvents = 'none';\n containerStyle.position = 'absolute';\n const content = document.createElement('div');\n const contentStyle = content.style;\n contentStyle.width = '2px';\n contentStyle.height = '1px';\n scrollContainer.appendChild(content);\n document.body.appendChild(scrollContainer);\n rtlScrollAxisType = 0 /* RtlScrollAxisType.NORMAL */;\n // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL\n // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're\n // dealing with one of the other two types of browsers.\n if (scrollContainer.scrollLeft === 0) {\n // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an\n // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by\n // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will\n // return 0 when we read it again.\n scrollContainer.scrollLeft = 1;\n rtlScrollAxisType =\n scrollContainer.scrollLeft === 0 ? 1 /* RtlScrollAxisType.NEGATED */ : 2 /* RtlScrollAxisType.INVERTED */;\n }\n scrollContainer.remove();\n }\n return rtlScrollAxisType;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet shadowDomIsSupported;\n/** Checks whether the user's browser support Shadow DOM. */\nfunction _supportsShadowDom() {\n if (shadowDomIsSupported == null) {\n const head = typeof document !== 'undefined' ? document.head : null;\n shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow));\n }\n return shadowDomIsSupported;\n}\n/** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */\nfunction _getShadowRoot(element) {\n if (_supportsShadowDom()) {\n const rootNode = element.getRootNode ? element.getRootNode() : null;\n // Note that this should be caught by `_supportsShadowDom`, but some\n // teams have been able to hit this code path on unsupported browsers.\n if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n }\n return null;\n}\n/**\n * Gets the currently-focused element on the page while\n * also piercing through Shadow DOM boundaries.\n */\nfunction _getFocusedElementPierceShadowDom() {\n let activeElement = typeof document !== 'undefined' && document\n ? document.activeElement\n : null;\n while (activeElement && activeElement.shadowRoot) {\n const newActiveElement = activeElement.shadowRoot.activeElement;\n if (newActiveElement === activeElement) {\n break;\n }\n else {\n activeElement = newActiveElement;\n }\n }\n return activeElement;\n}\n/** Gets the target of an event while accounting for Shadow DOM. */\nfunction _getEventTarget(event) {\n // If an event is bound outside the Shadow DOM, the `event.target` will\n // point to the shadow root so we have to use `composedPath` instead.\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether the code is currently running in a test environment. */\nfunction _isTestEnvironment() {\n // We can't use `declare const` because it causes conflicts inside Google with the real typings\n // for these symbols and we can't read them off the global object, because they don't appear to\n // be attached there for some runners like Jest.\n // (see: https://github.com/angular/components/issues/23365#issuecomment-938146643)\n return (\n // @ts-ignore\n (typeof __karma__ !== 'undefined' && !!__karma__) ||\n // @ts-ignore\n (typeof jasmine !== 'undefined' && !!jasmine) ||\n // @ts-ignore\n (typeof jest !== 'undefined' && !!jest) ||\n // @ts-ignore\n (typeof Mocha !== 'undefined' && !!Mocha));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { Platform, PlatformModule, _getEventTarget, _getFocusedElementPierceShadowDom, _getShadowRoot, _isTestEnvironment, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior };\n","import { Subscriber } from '../Subscriber';\nexport function pairwise() {\n return (source) => source.lift(new PairwiseOperator());\n}\nclass PairwiseOperator {\n call(subscriber, source) {\n return source.subscribe(new PairwiseSubscriber(subscriber));\n }\n}\nclass PairwiseSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.hasPrev = false;\n }\n _next(value) {\n let pair;\n if (this.hasPrev) {\n pair = [this.prev, value];\n }\n else {\n this.hasPrev = true;\n }\n this.prev = value;\n if (pair) {\n this.destination.next(pair);\n }\n }\n}\n","import { ConnectableObservable, isObservable, of, Subject } from 'rxjs';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DataSource {\n}\n/** Checks whether an object is a data source. */\nfunction isDataSource(value) {\n // Check if the value is a DataSource by observing if it has a connect function. Cannot\n // be checked as an `instanceof DataSource` since people could create their own sources\n // that match the interface, but don't extend DataSource. We also can't use `isObservable`\n // here, because of some internal apps.\n return value && typeof value.connect === 'function' && !(value instanceof ConnectableObservable);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** DataSource wrapper for a native array. */\nclass ArrayDataSource extends DataSource {\n constructor(_data) {\n super();\n this._data = _data;\n }\n connect() {\n return isObservable(this._data) ? this._data : of(this._data);\n }\n disconnect() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that destroys views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will always construct a new embedded view for each item.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _DisposeViewRepeaterStrategy {\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n const insertContext = itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = viewContainerRef.createEmbeddedView(insertContext.templateRef, insertContext.context, insertContext.index);\n operation = 1 /* _ViewRepeaterOperation.INSERTED */;\n }\n else if (currentIndex == null) {\n viewContainerRef.remove(adjustedPreviousIndex);\n operation = 3 /* _ViewRepeaterOperation.REMOVED */;\n }\n else {\n view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n operation = 2 /* _ViewRepeaterOperation.MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view?.context,\n operation,\n record,\n });\n }\n });\n }\n detach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that caches views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will reuse one of the cached views instead of creating a new\n * embedded view. Recycling cached views reduces the quantity of expensive DOM\n * inserts.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _RecycleViewRepeaterStrategy {\n constructor() {\n /**\n * The size of the cache used to store unused views.\n * Setting the cache size to `0` will disable caching. Defaults to 20 views.\n */\n this.viewCacheSize = 20;\n /**\n * View cache that stores embedded view instances that have been previously stamped out,\n * but don't are not currently rendered. The view repeater will reuse these views rather than\n * creating brand new ones.\n *\n * TODO(michaeljamesparsons) Investigate whether using a linked list would improve performance.\n */\n this._viewCache = [];\n }\n /** Apply changes to the DOM. */\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n // Rearrange the views to put them in the right location.\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n // Item added.\n const viewArgsFactory = () => itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = this._insertView(viewArgsFactory, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = view ? 1 /* _ViewRepeaterOperation.INSERTED */ : 0 /* _ViewRepeaterOperation.REPLACED */;\n }\n else if (currentIndex == null) {\n // Item removed.\n this._detachAndCacheView(adjustedPreviousIndex, viewContainerRef);\n operation = 3 /* _ViewRepeaterOperation.REMOVED */;\n }\n else {\n // Item moved.\n view = this._moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = 2 /* _ViewRepeaterOperation.MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view?.context,\n operation,\n record,\n });\n }\n });\n }\n detach() {\n for (const view of this._viewCache) {\n view.destroy();\n }\n this._viewCache = [];\n }\n /**\n * Inserts a view for a new item, either from the cache or by creating a new\n * one. Returns `undefined` if the item was inserted into a cached view.\n */\n _insertView(viewArgsFactory, currentIndex, viewContainerRef, value) {\n const cachedView = this._insertViewFromCache(currentIndex, viewContainerRef);\n if (cachedView) {\n cachedView.context.$implicit = value;\n return undefined;\n }\n const viewArgs = viewArgsFactory();\n return viewContainerRef.createEmbeddedView(viewArgs.templateRef, viewArgs.context, viewArgs.index);\n }\n /** Detaches the view at the given index and inserts into the view cache. */\n _detachAndCacheView(index, viewContainerRef) {\n const detachedView = viewContainerRef.detach(index);\n this._maybeCacheView(detachedView, viewContainerRef);\n }\n /** Moves view at the previous index to the current index. */\n _moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, value) {\n const view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n view.context.$implicit = value;\n return view;\n }\n /**\n * Cache the given detached view. If the cache is full, the view will be\n * destroyed.\n */\n _maybeCacheView(view, viewContainerRef) {\n if (this._viewCache.length < this.viewCacheSize) {\n this._viewCache.push(view);\n }\n else {\n const index = viewContainerRef.indexOf(view);\n // The host component could remove views from the container outside of\n // the view repeater. It's unlikely this will occur, but just in case,\n // destroy the view on its own, otherwise destroy it through the\n // container to ensure that all the references are removed.\n if (index === -1) {\n view.destroy();\n }\n else {\n viewContainerRef.remove(index);\n }\n }\n }\n /** Inserts a recycled view from the cache at the given index. */\n _insertViewFromCache(index, viewContainerRef) {\n const cachedView = this._viewCache.pop();\n if (cachedView) {\n viewContainerRef.insert(cachedView, index);\n }\n return cachedView || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to be used to power selecting one or more options from a list.\n */\nclass SelectionModel {\n /** Selected values. */\n get selected() {\n if (!this._selected) {\n this._selected = Array.from(this._selection.values());\n }\n return this._selected;\n }\n constructor(_multiple = false, initiallySelectedValues, _emitChanges = true, compareWith) {\n this._multiple = _multiple;\n this._emitChanges = _emitChanges;\n this.compareWith = compareWith;\n /** Currently-selected values. */\n this._selection = new Set();\n /** Keeps track of the deselected options that haven't been emitted by the change event. */\n this._deselectedToEmit = [];\n /** Keeps track of the selected options that haven't been emitted by the change event. */\n this._selectedToEmit = [];\n /** Event emitted when the value has changed. */\n this.changed = new Subject();\n if (initiallySelectedValues && initiallySelectedValues.length) {\n if (_multiple) {\n initiallySelectedValues.forEach(value => this._markSelected(value));\n }\n else {\n this._markSelected(initiallySelectedValues[0]);\n }\n // Clear the array in order to avoid firing the change event for preselected values.\n this._selectedToEmit.length = 0;\n }\n }\n /**\n * Selects a value or an array of values.\n * @param values The values to select\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n select(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._markSelected(value));\n const changed = this._hasQueuedChanges();\n this._emitChangeEvent();\n return changed;\n }\n /**\n * Deselects a value or an array of values.\n * @param values The values to deselect\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n deselect(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._unmarkSelected(value));\n const changed = this._hasQueuedChanges();\n this._emitChangeEvent();\n return changed;\n }\n /**\n * Sets the selected values\n * @param values The new selected values\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n setSelection(...values) {\n this._verifyValueAssignment(values);\n const oldValues = this.selected;\n const newSelectedSet = new Set(values);\n values.forEach(value => this._markSelected(value));\n oldValues\n .filter(value => !newSelectedSet.has(value))\n .forEach(value => this._unmarkSelected(value));\n const changed = this._hasQueuedChanges();\n this._emitChangeEvent();\n return changed;\n }\n /**\n * Toggles a value between selected and deselected.\n * @param value The value to toggle\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n toggle(value) {\n return this.isSelected(value) ? this.deselect(value) : this.select(value);\n }\n /**\n * Clears all of the selected values.\n * @param flushEvent Whether to flush the changes in an event.\n * If false, the changes to the selection will be flushed along with the next event.\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n clear(flushEvent = true) {\n this._unmarkAll();\n const changed = this._hasQueuedChanges();\n if (flushEvent) {\n this._emitChangeEvent();\n }\n return changed;\n }\n /**\n * Determines whether a value is selected.\n */\n isSelected(value) {\n return this._selection.has(this._getConcreteValue(value));\n }\n /**\n * Determines whether the model does not have a value.\n */\n isEmpty() {\n return this._selection.size === 0;\n }\n /**\n * Determines whether the model has a value.\n */\n hasValue() {\n return !this.isEmpty();\n }\n /**\n * Sorts the selected values based on a predicate function.\n */\n sort(predicate) {\n if (this._multiple && this.selected) {\n this._selected.sort(predicate);\n }\n }\n /**\n * Gets whether multiple values can be selected.\n */\n isMultipleSelection() {\n return this._multiple;\n }\n /** Emits a change event and clears the records of selected and deselected values. */\n _emitChangeEvent() {\n // Clear the selected values so they can be re-cached.\n this._selected = null;\n if (this._selectedToEmit.length || this._deselectedToEmit.length) {\n this.changed.next({\n source: this,\n added: this._selectedToEmit,\n removed: this._deselectedToEmit,\n });\n this._deselectedToEmit = [];\n this._selectedToEmit = [];\n }\n }\n /** Selects a value. */\n _markSelected(value) {\n value = this._getConcreteValue(value);\n if (!this.isSelected(value)) {\n if (!this._multiple) {\n this._unmarkAll();\n }\n if (!this.isSelected(value)) {\n this._selection.add(value);\n }\n if (this._emitChanges) {\n this._selectedToEmit.push(value);\n }\n }\n }\n /** Deselects a value. */\n _unmarkSelected(value) {\n value = this._getConcreteValue(value);\n if (this.isSelected(value)) {\n this._selection.delete(value);\n if (this._emitChanges) {\n this._deselectedToEmit.push(value);\n }\n }\n }\n /** Clears out the selected values. */\n _unmarkAll() {\n if (!this.isEmpty()) {\n this._selection.forEach(value => this._unmarkSelected(value));\n }\n }\n /**\n * Verifies the value assignment and throws an error if the specified value array is\n * including multiple values while the selection model is not supporting multiple values.\n */\n _verifyValueAssignment(values) {\n if (values.length > 1 && !this._multiple && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMultipleValuesInSingleSelectionError();\n }\n }\n /** Whether there are queued up change to be emitted. */\n _hasQueuedChanges() {\n return !!(this._deselectedToEmit.length || this._selectedToEmit.length);\n }\n /** Returns a value that is comparable to inputValue by applying compareWith function, returns the same inputValue otherwise. */\n _getConcreteValue(inputValue) {\n if (!this.compareWith) {\n return inputValue;\n }\n else {\n for (let selectedValue of this._selection) {\n if (this.compareWith(inputValue, selectedValue)) {\n return selectedValue;\n }\n }\n return inputValue;\n }\n }\n}\n/**\n * Returns an error that reports that multiple values are passed into a selection model\n * with a single value.\n * @docs-private\n */\nfunction getMultipleValuesInSingleSelectionError() {\n return Error('Cannot pass multiple values into SelectionModel with single-value mode.');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to coordinate unique selection based on name.\n * Intended to be consumed as an Angular service.\n * This service is needed because native radio change events are only fired on the item currently\n * being selected, and we still need to uncheck the previous selection.\n *\n * This service does not *store* any IDs and names because they may change at any time, so it is\n * less error-prone if they are simply passed through when the events occur.\n */\nclass UniqueSelectionDispatcher {\n constructor() {\n this._listeners = [];\n }\n /**\n * Notify other items that selection for the given name has been set.\n * @param id ID of the item.\n * @param name Name of the item.\n */\n notify(id, name) {\n for (let listener of this._listeners) {\n listener(id, name);\n }\n }\n /**\n * Listen for future changes to item selection.\n * @return Function used to deregister listener\n */\n listen(listener) {\n this._listeners.push(listener);\n return () => {\n this._listeners = this._listeners.filter((registered) => {\n return listener !== registered;\n });\n };\n }\n ngOnDestroy() {\n this._listeners = [];\n }\n}\nUniqueSelectionDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: UniqueSelectionDispatcher, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nUniqueSelectionDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: UniqueSelectionDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: UniqueSelectionDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token for {@link _ViewRepeater}. This token is for use by Angular Material only.\n * @docs-private\n */\nconst _VIEW_REPEATER_STRATEGY = new InjectionToken('_ViewRepeater');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ArrayDataSource, DataSource, SelectionModel, UniqueSelectionDispatcher, _DisposeViewRepeaterStrategy, _RecycleViewRepeaterStrategy, _VIEW_REPEATER_STRATEGY, getMultipleValuesInSingleSelectionError, isDataSource };\n","import { coerceNumberProperty, coerceElement, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, forwardRef, Directive, Input, Injectable, Optional, Inject, inject, Component, ViewEncapsulation, ChangeDetectionStrategy, Output, ViewChild, SkipSelf, ElementRef, NgModule } from '@angular/core';\nimport { Subject, of, Observable, fromEvent, animationFrameScheduler, asapScheduler, Subscription, isObservable } from 'rxjs';\nimport { distinctUntilChanged, auditTime, filter, takeUntil, startWith, pairwise, switchMap, shareReplay } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\nimport { getRtlScrollAxisType, supportsScrollBehavior, Platform } from '@angular/cdk/platform';\nimport { DOCUMENT } from '@angular/common';\nimport * as i2 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport * as i2$1 from '@angular/cdk/collections';\nimport { isDataSource, ArrayDataSource, _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy } from '@angular/cdk/collections';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the virtual scrolling strategy. */\nconst VIRTUAL_SCROLL_STRATEGY = new InjectionToken('VIRTUAL_SCROLL_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Virtual scrolling strategy for lists with items of known fixed size. */\nclass FixedSizeVirtualScrollStrategy {\n /**\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n constructor(itemSize, minBufferPx, maxBufferPx) {\n this._scrolledIndexChange = new Subject();\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n this.scrolledIndexChange = this._scrolledIndexChange.pipe(distinctUntilChanged());\n /** The attached viewport. */\n this._viewport = null;\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n }\n /**\n * Attaches this scroll strategy to a viewport.\n * @param viewport The viewport to attach this strategy to.\n */\n attach(viewport) {\n this._viewport = viewport;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** Detaches this scroll strategy from the currently attached viewport. */\n detach() {\n this._scrolledIndexChange.complete();\n this._viewport = null;\n }\n /**\n * Update the item size and buffer size.\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {\n if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');\n }\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentScrolled() {\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onDataLengthChanged() {\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentRendered() {\n /* no-op */\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onRenderedOffsetChanged() {\n /* no-op */\n }\n /**\n * Scroll to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling.\n */\n scrollToIndex(index, behavior) {\n if (this._viewport) {\n this._viewport.scrollToOffset(index * this._itemSize, behavior);\n }\n }\n /** Update the viewport's total content size. */\n _updateTotalContentSize() {\n if (!this._viewport) {\n return;\n }\n this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);\n }\n /** Update the viewport's rendered range. */\n _updateRenderedRange() {\n if (!this._viewport) {\n return;\n }\n const renderedRange = this._viewport.getRenderedRange();\n const newRange = { start: renderedRange.start, end: renderedRange.end };\n const viewportSize = this._viewport.getViewportSize();\n const dataLength = this._viewport.getDataLength();\n let scrollOffset = this._viewport.measureScrollOffset();\n // Prevent NaN as result when dividing by zero.\n let firstVisibleIndex = this._itemSize > 0 ? scrollOffset / this._itemSize : 0;\n // If user scrolls to the bottom of the list and data changes to a smaller list\n if (newRange.end > dataLength) {\n // We have to recalculate the first visible index based on new data length and viewport size.\n const maxVisibleItems = Math.ceil(viewportSize / this._itemSize);\n const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems));\n // If first visible index changed we must update scroll offset to handle start/end buffers\n // Current range must also be adjusted to cover the new position (bottom of new list).\n if (firstVisibleIndex != newVisibleIndex) {\n firstVisibleIndex = newVisibleIndex;\n scrollOffset = newVisibleIndex * this._itemSize;\n newRange.start = Math.floor(firstVisibleIndex);\n }\n newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems));\n }\n const startBuffer = scrollOffset - newRange.start * this._itemSize;\n if (startBuffer < this._minBufferPx && newRange.start != 0) {\n const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);\n newRange.start = Math.max(0, newRange.start - expandStart);\n newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));\n }\n else {\n const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);\n if (endBuffer < this._minBufferPx && newRange.end != dataLength) {\n const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);\n if (expandEnd > 0) {\n newRange.end = Math.min(dataLength, newRange.end + expandEnd);\n newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));\n }\n }\n }\n this._viewport.setRenderedRange(newRange);\n this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);\n this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));\n }\n}\n/**\n * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created\n * `FixedSizeVirtualScrollStrategy` from the given directive.\n * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the\n * `FixedSizeVirtualScrollStrategy` from.\n */\nfunction _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {\n return fixedSizeDir._scrollStrategy;\n}\n/** A virtual scroll strategy that supports fixed-size items. */\nclass CdkFixedSizeVirtualScroll {\n constructor() {\n this._itemSize = 20;\n this._minBufferPx = 100;\n this._maxBufferPx = 200;\n /** The scroll strategy used by this directive. */\n this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n /** The size of the items in the list (in pixels). */\n get itemSize() {\n return this._itemSize;\n }\n set itemSize(value) {\n this._itemSize = coerceNumberProperty(value);\n }\n /**\n * The minimum amount of buffer rendered beyond the viewport (in pixels).\n * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.\n */\n get minBufferPx() {\n return this._minBufferPx;\n }\n set minBufferPx(value) {\n this._minBufferPx = coerceNumberProperty(value);\n }\n /**\n * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.\n */\n get maxBufferPx() {\n return this._maxBufferPx;\n }\n set maxBufferPx(value) {\n this._maxBufferPx = coerceNumberProperty(value);\n }\n ngOnChanges() {\n this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n}\nCdkFixedSizeVirtualScroll.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nCdkFixedSizeVirtualScroll.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkFixedSizeVirtualScroll, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[itemSize]\", inputs: { itemSize: \"itemSize\", minBufferPx: \"minBufferPx\", maxBufferPx: \"maxBufferPx\" }, providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[itemSize]',\n standalone: true,\n providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ],\n }]\n }], propDecorators: { itemSize: [{\n type: Input\n }], minBufferPx: [{\n type: Input\n }], maxBufferPx: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the scrolling events by default. */\nconst DEFAULT_SCROLL_TIME = 20;\n/**\n * Service contained all registered Scrollable references and emits an event when any one of the\n * Scrollable references emit a scrolled event.\n */\nclass ScrollDispatcher {\n constructor(_ngZone, _platform, document) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n /** Subject for notifying that a registered scrollable reference element has been scrolled. */\n this._scrolled = new Subject();\n /** Keeps track of the global `scroll` and `resize` subscriptions. */\n this._globalSubscription = null;\n /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */\n this._scrolledCount = 0;\n /**\n * Map of all the scrollable references that are registered with the service and their\n * scroll event subscriptions.\n */\n this.scrollContainers = new Map();\n this._document = document;\n }\n /**\n * Registers a scrollable instance with the service and listens for its scrolled events. When the\n * scrollable is scrolled, the service emits the event to its scrolled observable.\n * @param scrollable Scrollable instance to be registered.\n */\n register(scrollable) {\n if (!this.scrollContainers.has(scrollable)) {\n this.scrollContainers.set(scrollable, scrollable.elementScrolled().subscribe(() => this._scrolled.next(scrollable)));\n }\n }\n /**\n * De-registers a Scrollable reference and unsubscribes from its scroll event observable.\n * @param scrollable Scrollable instance to be deregistered.\n */\n deregister(scrollable) {\n const scrollableReference = this.scrollContainers.get(scrollable);\n if (scrollableReference) {\n scrollableReference.unsubscribe();\n this.scrollContainers.delete(scrollable);\n }\n }\n /**\n * Returns an observable that emits an event whenever any of the registered Scrollable\n * references (or window, document, or body) fire a scrolled event. Can provide a time in ms\n * to override the default \"throttle\" time.\n *\n * **Note:** in order to avoid hitting change detection for every scroll event,\n * all of the events emitted from this stream will be run outside the Angular zone.\n * If you need to update any data bindings as a result of a scroll event, you have\n * to run the callback using `NgZone.run`.\n */\n scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {\n if (!this._platform.isBrowser) {\n return of();\n }\n return new Observable((observer) => {\n if (!this._globalSubscription) {\n this._addGlobalListener();\n }\n // In the case of a 0ms delay, use an observable without auditTime\n // since it does add a perceptible delay in processing overhead.\n const subscription = auditTimeInMs > 0\n ? this._scrolled.pipe(auditTime(auditTimeInMs)).subscribe(observer)\n : this._scrolled.subscribe(observer);\n this._scrolledCount++;\n return () => {\n subscription.unsubscribe();\n this._scrolledCount--;\n if (!this._scrolledCount) {\n this._removeGlobalListener();\n }\n };\n });\n }\n ngOnDestroy() {\n this._removeGlobalListener();\n this.scrollContainers.forEach((_, container) => this.deregister(container));\n this._scrolled.complete();\n }\n /**\n * Returns an observable that emits whenever any of the\n * scrollable ancestors of an element are scrolled.\n * @param elementOrElementRef Element whose ancestors to listen for.\n * @param auditTimeInMs Time to throttle the scroll events.\n */\n ancestorScrolled(elementOrElementRef, auditTimeInMs) {\n const ancestors = this.getAncestorScrollContainers(elementOrElementRef);\n return this.scrolled(auditTimeInMs).pipe(filter(target => {\n return !target || ancestors.indexOf(target) > -1;\n }));\n }\n /** Returns all registered Scrollables that contain the provided element. */\n getAncestorScrollContainers(elementOrElementRef) {\n const scrollingContainers = [];\n this.scrollContainers.forEach((_subscription, scrollable) => {\n if (this._scrollableContainsElement(scrollable, elementOrElementRef)) {\n scrollingContainers.push(scrollable);\n }\n });\n return scrollingContainers;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Returns true if the element is contained within the provided Scrollable. */\n _scrollableContainsElement(scrollable, elementOrElementRef) {\n let element = coerceElement(elementOrElementRef);\n let scrollableElement = scrollable.getElementRef().nativeElement;\n // Traverse through the element parents until we reach null, checking if any of the elements\n // are the scrollable's element.\n do {\n if (element == scrollableElement) {\n return true;\n }\n } while ((element = element.parentElement));\n return false;\n }\n /** Sets up the global scroll listeners. */\n _addGlobalListener() {\n this._globalSubscription = this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n return fromEvent(window.document, 'scroll').subscribe(() => this._scrolled.next());\n });\n }\n /** Cleans up the global scroll listener. */\n _removeGlobalListener() {\n if (this._globalSubscription) {\n this._globalSubscription.unsubscribe();\n this._globalSubscription = null;\n }\n }\n}\nScrollDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollDispatcher, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: i1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Sends an event when the directive's element is scrolled. Registers itself with the\n * ScrollDispatcher service to include itself as part of its collection of scrolling events that it\n * can be listened to through the service.\n */\nclass CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n this.elementRef = elementRef;\n this.scrollDispatcher = scrollDispatcher;\n this.ngZone = ngZone;\n this.dir = dir;\n this._destroyed = new Subject();\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(this.elementRef.nativeElement, 'scroll')\n .pipe(takeUntil(this._destroyed))\n .subscribe(observer)));\n }\n ngOnInit() {\n this.scrollDispatcher.register(this);\n }\n ngOnDestroy() {\n this.scrollDispatcher.deregister(this);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Returns observable that emits when a scroll event is fired on the host element. */\n elementScrolled() {\n return this._elementScrolled;\n }\n /** Gets the ElementRef for the viewport. */\n getElementRef() {\n return this.elementRef;\n }\n /**\n * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo\n * method, since browsers are not consistent about what scrollLeft means in RTL. For this method\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param options specified the offsets to scroll to.\n */\n scrollTo(options) {\n const el = this.elementRef.nativeElement;\n const isRtl = this.dir && this.dir.value == 'rtl';\n // Rewrite start & end offsets as right or left offsets.\n if (options.left == null) {\n options.left = isRtl ? options.end : options.start;\n }\n if (options.right == null) {\n options.right = isRtl ? options.start : options.end;\n }\n // Rewrite the bottom offset as a top offset.\n if (options.bottom != null) {\n options.top =\n el.scrollHeight - el.clientHeight - options.bottom;\n }\n // Rewrite the right offset as a left offset.\n if (isRtl && getRtlScrollAxisType() != 0 /* RtlScrollAxisType.NORMAL */) {\n if (options.left != null) {\n options.right =\n el.scrollWidth - el.clientWidth - options.left;\n }\n if (getRtlScrollAxisType() == 2 /* RtlScrollAxisType.INVERTED */) {\n options.left = options.right;\n }\n else if (getRtlScrollAxisType() == 1 /* RtlScrollAxisType.NEGATED */) {\n options.left = options.right ? -options.right : options.right;\n }\n }\n else {\n if (options.right != null) {\n options.left =\n el.scrollWidth - el.clientWidth - options.right;\n }\n }\n this._applyScrollToOptions(options);\n }\n _applyScrollToOptions(options) {\n const el = this.elementRef.nativeElement;\n if (supportsScrollBehavior()) {\n el.scrollTo(options);\n }\n else {\n if (options.top != null) {\n el.scrollTop = options.top;\n }\n if (options.left != null) {\n el.scrollLeft = options.left;\n }\n }\n }\n /**\n * Measures the scroll offset relative to the specified edge of the viewport. This method can be\n * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent\n * about what scrollLeft means in RTL. The values returned by this method are normalized such that\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param from The edge to measure from.\n */\n measureScrollOffset(from) {\n const LEFT = 'left';\n const RIGHT = 'right';\n const el = this.elementRef.nativeElement;\n if (from == 'top') {\n return el.scrollTop;\n }\n if (from == 'bottom') {\n return el.scrollHeight - el.clientHeight - el.scrollTop;\n }\n // Rewrite start & end as left or right offsets.\n const isRtl = this.dir && this.dir.value == 'rtl';\n if (from == 'start') {\n from = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n from = isRtl ? LEFT : RIGHT;\n }\n if (isRtl && getRtlScrollAxisType() == 2 /* RtlScrollAxisType.INVERTED */) {\n // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n else {\n return el.scrollLeft;\n }\n }\n else if (isRtl && getRtlScrollAxisType() == 1 /* RtlScrollAxisType.NEGATED */) {\n // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft + el.scrollWidth - el.clientWidth;\n }\n else {\n return -el.scrollLeft;\n }\n }\n else {\n // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and\n // (scrollWidth - clientWidth) when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft;\n }\n else {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n }\n }\n}\nCdkScrollable.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkScrollable.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkScrollable, isStandalone: true, selector: \"[cdk-scrollable], [cdkScrollable]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollable, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-scrollable], [cdkScrollable]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the resize events by default. */\nconst DEFAULT_RESIZE_TIME = 20;\n/**\n * Simple utility for getting the bounds of the browser viewport.\n * @docs-private\n */\nclass ViewportRuler {\n constructor(_platform, ngZone, document) {\n this._platform = _platform;\n /** Stream of viewport change events. */\n this._change = new Subject();\n /** Event listener that will be used to handle the viewport change events. */\n this._changeListener = (event) => {\n this._change.next(event);\n };\n this._document = document;\n ngZone.runOutsideAngular(() => {\n if (_platform.isBrowser) {\n const window = this._getWindow();\n // Note that bind the events ourselves, rather than going through something like RxJS's\n // `fromEvent` so that we can ensure that they're bound outside of the NgZone.\n window.addEventListener('resize', this._changeListener);\n window.addEventListener('orientationchange', this._changeListener);\n }\n // Clear the cached position so that the viewport is re-measured next time it is required.\n // We don't need to keep track of the subscription, because it is completed on destroy.\n this.change().subscribe(() => (this._viewportSize = null));\n });\n }\n ngOnDestroy() {\n if (this._platform.isBrowser) {\n const window = this._getWindow();\n window.removeEventListener('resize', this._changeListener);\n window.removeEventListener('orientationchange', this._changeListener);\n }\n this._change.complete();\n }\n /** Returns the viewport's width and height. */\n getViewportSize() {\n if (!this._viewportSize) {\n this._updateViewportSize();\n }\n const output = { width: this._viewportSize.width, height: this._viewportSize.height };\n // If we're not on a browser, don't cache the size since it'll be mocked out anyway.\n if (!this._platform.isBrowser) {\n this._viewportSize = null;\n }\n return output;\n }\n /** Gets a ClientRect for the viewport's bounds. */\n getViewportRect() {\n // Use the document element's bounding rect rather than the window scroll properties\n // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll\n // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different\n // conceptual viewports. Under most circumstances these viewports are equivalent, but they\n // can disagree when the page is pinch-zoomed (on devices that support touch).\n // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4\n // We use the documentElement instead of the body because, by default (without a css reset)\n // browsers typically give the document body an 8px margin, which is not included in\n // getBoundingClientRect().\n const scrollPosition = this.getViewportScrollPosition();\n const { width, height } = this.getViewportSize();\n return {\n top: scrollPosition.top,\n left: scrollPosition.left,\n bottom: scrollPosition.top + height,\n right: scrollPosition.left + width,\n height,\n width,\n };\n }\n /** Gets the (top, left) scroll position of the viewport. */\n getViewportScrollPosition() {\n // While we can get a reference to the fake document\n // during SSR, it doesn't have getBoundingClientRect.\n if (!this._platform.isBrowser) {\n return { top: 0, left: 0 };\n }\n // The top-left-corner of the viewport is determined by the scroll position of the document\n // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about\n // whether `document.body` or `document.documentElement` is the scrolled element, so reading\n // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of\n // `document.documentElement` works consistently, where the `top` and `left` values will\n // equal negative the scroll position.\n const document = this._document;\n const window = this._getWindow();\n const documentElement = document.documentElement;\n const documentRect = documentElement.getBoundingClientRect();\n const top = -documentRect.top ||\n document.body.scrollTop ||\n window.scrollY ||\n documentElement.scrollTop ||\n 0;\n const left = -documentRect.left ||\n document.body.scrollLeft ||\n window.scrollX ||\n documentElement.scrollLeft ||\n 0;\n return { top, left };\n }\n /**\n * Returns a stream that emits whenever the size of the viewport changes.\n * This stream emits outside of the Angular zone.\n * @param throttleTime Time in milliseconds to throttle the stream.\n */\n change(throttleTime = DEFAULT_RESIZE_TIME) {\n return throttleTime > 0 ? this._change.pipe(auditTime(throttleTime)) : this._change;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Updates the cached viewport size. */\n _updateViewportSize() {\n const window = this._getWindow();\n this._viewportSize = this._platform.isBrowser\n ? { width: window.innerWidth, height: window.innerHeight }\n : { width: 0, height: 0 };\n }\n}\nViewportRuler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ViewportRuler, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nViewportRuler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ViewportRuler, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ViewportRuler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst VIRTUAL_SCROLLABLE = new InjectionToken('VIRTUAL_SCROLLABLE');\n/**\n * Extending the {@link CdkScrollable} to be used as scrolling container for virtual scrolling.\n */\nclass CdkVirtualScrollable extends CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n /**\n * Measure the viewport size for the provided orientation.\n *\n * @param orientation The orientation to measure the size from.\n */\n measureViewportSize(orientation) {\n const viewportEl = this.elementRef.nativeElement;\n return orientation === 'horizontal' ? viewportEl.clientWidth : viewportEl.clientHeight;\n }\n}\nCdkVirtualScrollable.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualScrollable.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollable, usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollable, decorators: [{\n type: Directive\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Checks if the given ranges are equal. */\nfunction rangesEqual(r1, r2) {\n return r1.start == r2.start && r1.end == r2.end;\n}\n/**\n * Scheduler to be used for scroll events. Needs to fall back to\n * something that doesn't rely on requestAnimationFrame on environments\n * that don't support it (e.g. server-side rendering).\n */\nconst SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? animationFrameScheduler : asapScheduler;\n/** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */\nclass CdkVirtualScrollViewport extends CdkVirtualScrollable {\n /** The direction the viewport scrolls. */\n get orientation() {\n return this._orientation;\n }\n set orientation(orientation) {\n if (this._orientation !== orientation) {\n this._orientation = orientation;\n this._calculateSpacerSize();\n }\n }\n /**\n * Whether rendered items should persist in the DOM after scrolling out of view. By default, items\n * will be removed.\n */\n get appendOnly() {\n return this._appendOnly;\n }\n set appendOnly(value) {\n this._appendOnly = coerceBooleanProperty(value);\n }\n constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, viewportRuler, scrollable) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n this.elementRef = elementRef;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollStrategy = _scrollStrategy;\n this.scrollable = scrollable;\n this._platform = inject(Platform);\n /** Emits when the viewport is detached from a CdkVirtualForOf. */\n this._detachedSubject = new Subject();\n /** Emits when the rendered range changes. */\n this._renderedRangeSubject = new Subject();\n this._orientation = 'vertical';\n this._appendOnly = false;\n // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll\n // strategy lazily (i.e. only if the user is actually listening to the events). We do this because\n // depending on how the strategy calculates the scrolled index, it may come at a cost to\n // performance.\n /** Emits when the index of the first element visible in the viewport changes. */\n this.scrolledIndexChange = new Observable((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index)))));\n /** A stream that emits whenever the rendered range changes. */\n this.renderedRangeStream = this._renderedRangeSubject;\n /**\n * The total size of all content (in pixels), including content that is not currently rendered.\n */\n this._totalContentSize = 0;\n /** A string representing the `style.width` property value to be used for the spacer element. */\n this._totalContentWidth = '';\n /** A string representing the `style.height` property value to be used for the spacer element. */\n this._totalContentHeight = '';\n /** The currently rendered range of indices. */\n this._renderedRange = { start: 0, end: 0 };\n /** The length of the data bound to this viewport (in number of items). */\n this._dataLength = 0;\n /** The size of the viewport (in pixels). */\n this._viewportSize = 0;\n /** The last rendered content offset that was set. */\n this._renderedContentOffset = 0;\n /**\n * Whether the last rendered content offset was to the end of the content (and therefore needs to\n * be rewritten as an offset to the start of the content).\n */\n this._renderedContentOffsetNeedsRewrite = false;\n /** Whether there is a pending change detection cycle. */\n this._isChangeDetectionPending = false;\n /** A list of functions to run after the next change detection cycle. */\n this._runAfterChangeDetection = [];\n /** Subscription to changes in the viewport size. */\n this._viewportChanges = Subscription.EMPTY;\n if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Error: cdk-virtual-scroll-viewport requires the \"itemSize\" property to be set.');\n }\n this._viewportChanges = viewportRuler.change().subscribe(() => {\n this.checkViewportSize();\n });\n if (!this.scrollable) {\n // No scrollable is provided, so the virtual-scroll-viewport needs to become a scrollable\n this.elementRef.nativeElement.classList.add('cdk-virtual-scrollable');\n this.scrollable = this;\n }\n }\n ngOnInit() {\n // Scrolling depends on the element dimensions which we can't get during SSR.\n if (!this._platform.isBrowser) {\n return;\n }\n if (this.scrollable === this) {\n super.ngOnInit();\n }\n // It's still too early to measure the viewport at this point. Deferring with a promise allows\n // the Viewport to be rendered with the correct size before we measure. We run this outside the\n // zone to avoid causing more change detection cycles. We handle the change detection loop\n // ourselves instead.\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._measureViewportSize();\n this._scrollStrategy.attach(this);\n this.scrollable\n .elementScrolled()\n .pipe(\n // Start off with a fake scroll event so we properly detect our initial position.\n startWith(null), \n // Collect multiple events into one until the next animation frame. This way if\n // there are multiple scroll events in the same frame we only need to recheck\n // our layout once.\n auditTime(0, SCROLL_SCHEDULER))\n .subscribe(() => this._scrollStrategy.onContentScrolled());\n this._markChangeDetectionNeeded();\n }));\n }\n ngOnDestroy() {\n this.detach();\n this._scrollStrategy.detach();\n // Complete all subjects\n this._renderedRangeSubject.complete();\n this._detachedSubject.complete();\n this._viewportChanges.unsubscribe();\n super.ngOnDestroy();\n }\n /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */\n attach(forOf) {\n if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CdkVirtualScrollViewport is already attached.');\n }\n // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length\n // changes. Run outside the zone to avoid triggering change detection, since we're managing the\n // change detection loop ourselves.\n this.ngZone.runOutsideAngular(() => {\n this._forOf = forOf;\n this._forOf.dataStream.pipe(takeUntil(this._detachedSubject)).subscribe(data => {\n const newLength = data.length;\n if (newLength !== this._dataLength) {\n this._dataLength = newLength;\n this._scrollStrategy.onDataLengthChanged();\n }\n this._doChangeDetection();\n });\n });\n }\n /** Detaches the current `CdkVirtualForOf`. */\n detach() {\n this._forOf = null;\n this._detachedSubject.next();\n }\n /** Gets the length of the data bound to this viewport (in number of items). */\n getDataLength() {\n return this._dataLength;\n }\n /** Gets the size of the viewport (in pixels). */\n getViewportSize() {\n return this._viewportSize;\n }\n // TODO(mmalerba): This is technically out of sync with what's really rendered until a render\n // cycle happens. I'm being careful to only call it after the render cycle is complete and before\n // setting it to something else, but its error prone and should probably be split into\n // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.\n /** Get the current rendered range of items. */\n getRenderedRange() {\n return this._renderedRange;\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n /**\n * Sets the total size of all content (in pixels), including content that is not currently\n * rendered.\n */\n setTotalContentSize(size) {\n if (this._totalContentSize !== size) {\n this._totalContentSize = size;\n this._calculateSpacerSize();\n this._markChangeDetectionNeeded();\n }\n }\n /** Sets the currently rendered range of indices. */\n setRenderedRange(range) {\n if (!rangesEqual(this._renderedRange, range)) {\n if (this.appendOnly) {\n range = { start: 0, end: Math.max(this._renderedRange.end, range.end) };\n }\n this._renderedRangeSubject.next((this._renderedRange = range));\n this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered());\n }\n }\n /**\n * Gets the offset from the start of the viewport to the start of the rendered data (in pixels).\n */\n getOffsetToRenderedContentStart() {\n return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;\n }\n /**\n * Sets the offset from the start of the viewport to either the start or end of the rendered data\n * (in pixels).\n */\n setRenderedContentOffset(offset, to = 'to-start') {\n // In appendOnly, we always start from the top\n offset = this.appendOnly && to === 'to-start' ? 0 : offset;\n // For a horizontal viewport in a right-to-left language we need to translate along the x-axis\n // in the negative direction.\n const isRtl = this.dir && this.dir.value == 'rtl';\n const isHorizontal = this.orientation == 'horizontal';\n const axis = isHorizontal ? 'X' : 'Y';\n const axisDirection = isHorizontal && isRtl ? -1 : 1;\n let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;\n this._renderedContentOffset = offset;\n if (to === 'to-end') {\n transform += ` translate${axis}(-100%)`;\n // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise\n // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would\n // expand upward).\n this._renderedContentOffsetNeedsRewrite = true;\n }\n if (this._renderedContentTransform != transform) {\n // We know this value is safe because we parse `offset` with `Number()` before passing it\n // into the string.\n this._renderedContentTransform = transform;\n this._markChangeDetectionNeeded(() => {\n if (this._renderedContentOffsetNeedsRewrite) {\n this._renderedContentOffset -= this.measureRenderedContentSize();\n this._renderedContentOffsetNeedsRewrite = false;\n this.setRenderedContentOffset(this._renderedContentOffset);\n }\n else {\n this._scrollStrategy.onRenderedOffsetChanged();\n }\n });\n }\n }\n /**\n * Scrolls to the given offset from the start of the viewport. Please note that this is not always\n * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left\n * direction, this would be the equivalent of setting a fictional `scrollRight` property.\n * @param offset The offset to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToOffset(offset, behavior = 'auto') {\n const options = { behavior };\n if (this.orientation === 'horizontal') {\n options.start = offset;\n }\n else {\n options.top = offset;\n }\n this.scrollable.scrollTo(options);\n }\n /**\n * Scrolls to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToIndex(index, behavior = 'auto') {\n this._scrollStrategy.scrollToIndex(index, behavior);\n }\n /**\n * Gets the current scroll offset from the start of the scrollable (in pixels).\n * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'\n * in horizontal mode.\n */\n measureScrollOffset(from) {\n // This is to break the call cycle\n let measureScrollOffset;\n if (this.scrollable == this) {\n measureScrollOffset = (_from) => super.measureScrollOffset(_from);\n }\n else {\n measureScrollOffset = (_from) => this.scrollable.measureScrollOffset(_from);\n }\n return Math.max(0, measureScrollOffset(from ?? (this.orientation === 'horizontal' ? 'start' : 'top')) -\n this.measureViewportOffset());\n }\n /**\n * Measures the offset of the viewport from the scrolling container\n * @param from The edge to measure from.\n */\n measureViewportOffset(from) {\n let fromRect;\n const LEFT = 'left';\n const RIGHT = 'right';\n const isRtl = this.dir?.value == 'rtl';\n if (from == 'start') {\n fromRect = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n fromRect = isRtl ? LEFT : RIGHT;\n }\n else if (from) {\n fromRect = from;\n }\n else {\n fromRect = this.orientation === 'horizontal' ? 'left' : 'top';\n }\n const scrollerClientRect = this.scrollable.measureBoundingClientRectWithScrollOffset(fromRect);\n const viewportClientRect = this.elementRef.nativeElement.getBoundingClientRect()[fromRect];\n return viewportClientRect - scrollerClientRect;\n }\n /** Measure the combined size of all of the rendered items. */\n measureRenderedContentSize() {\n const contentEl = this._contentWrapper.nativeElement;\n return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;\n }\n /**\n * Measure the total combined size of the given range. Throws if the range includes items that are\n * not rendered.\n */\n measureRangeSize(range) {\n if (!this._forOf) {\n return 0;\n }\n return this._forOf.measureRangeSize(range, this.orientation);\n }\n /** Update the viewport dimensions and re-render. */\n checkViewportSize() {\n // TODO: Cleanup later when add logic for handling content resize\n this._measureViewportSize();\n this._scrollStrategy.onDataLengthChanged();\n }\n /** Measure the viewport size. */\n _measureViewportSize() {\n this._viewportSize = this.scrollable.measureViewportSize(this.orientation);\n }\n /** Queue up change detection to run. */\n _markChangeDetectionNeeded(runAfter) {\n if (runAfter) {\n this._runAfterChangeDetection.push(runAfter);\n }\n // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of\n // properties sequentially we only have to run `_doChangeDetection` once at the end.\n if (!this._isChangeDetectionPending) {\n this._isChangeDetectionPending = true;\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._doChangeDetection();\n }));\n }\n }\n /** Run change detection. */\n _doChangeDetection() {\n this._isChangeDetectionPending = false;\n // Apply the content transform. The transform can't be set via an Angular binding because\n // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of\n // string literals, a variable that can only be 'X' or 'Y', and user input that is run through\n // the `Number` function first to coerce it to a numeric value.\n this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;\n // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection\n // from the root, since the repeated items are content projected in. Calling `detectChanges`\n // instead does not properly check the projected content.\n this.ngZone.run(() => this._changeDetectorRef.markForCheck());\n const runAfterChangeDetection = this._runAfterChangeDetection;\n this._runAfterChangeDetection = [];\n for (const fn of runAfterChangeDetection) {\n fn();\n }\n }\n /** Calculates the `style.width` and `style.height` for the spacer element. */\n _calculateSpacerSize() {\n this._totalContentHeight =\n this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;\n this._totalContentWidth =\n this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';\n }\n}\nCdkVirtualScrollViewport.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollViewport, deps: [{ token: i0.ElementRef }, { token: i0.ChangeDetectorRef }, { token: i0.NgZone }, { token: VIRTUAL_SCROLL_STRATEGY, optional: true }, { token: i2.Directionality, optional: true }, { token: ScrollDispatcher }, { token: ViewportRuler }, { token: VIRTUAL_SCROLLABLE, optional: true }], target: i0.ɵɵFactoryTarget.Component });\nCdkVirtualScrollViewport.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollViewport, isStandalone: true, selector: \"cdk-virtual-scroll-viewport\", inputs: { orientation: \"orientation\", appendOnly: \"appendOnly\" }, outputs: { scrolledIndexChange: \"scrolledIndexChange\" }, host: { properties: { \"class.cdk-virtual-scroll-orientation-horizontal\": \"orientation === \\\"horizontal\\\"\", \"class.cdk-virtual-scroll-orientation-vertical\": \"orientation !== \\\"horizontal\\\"\" }, classAttribute: \"cdk-virtual-scroll-viewport\" }, providers: [\n {\n provide: CdkScrollable,\n useFactory: (virtualScrollable, viewport) => virtualScrollable || viewport,\n deps: [[new Optional(), new Inject(VIRTUAL_SCROLLABLE)], CdkVirtualScrollViewport],\n },\n ], viewQueries: [{ propertyName: \"_contentWrapper\", first: true, predicate: [\"contentWrapper\"], descendants: true, static: true }], usesInheritance: true, ngImport: i0, template: \"\\n
\\n\\n\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"] }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }, { type: CdkVirtualScrollable, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLLABLE]\n }] }]; }, propDecorators: { orientation: [{\n type: Input\n }], appendOnly: [{\n type: Input\n }], scrolledIndexChange: [{\n type: Output\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn\n ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)\n : undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges.pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n if (this.viewChange.observers.length) {\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n }\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode\n ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode)\n : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), record => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false,\n },\n index,\n };\n }\n}\nCdkVirtualForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: _VIEW_REPEATER_STRATEGY }, { token: CdkVirtualScrollViewport, skipSelf: true }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualForOf, isStandalone: true, selector: \"[cdkVirtualFor][cdkVirtualForOf]\", inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: i2$1._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: i0.NgZone }]; }, propDecorators: { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides a virtual scrollable for the element it is attached to.\n */\nclass CdkVirtualScrollableElement extends CdkVirtualScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return (this.getElementRef().nativeElement.getBoundingClientRect()[from] -\n this.measureScrollOffset(from));\n }\n}\nCdkVirtualScrollableElement.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableElement, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualScrollableElement.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollableElement, isStandalone: true, selector: \"[cdkVirtualScrollingElement]\", host: { classAttribute: \"cdk-virtual-scrollable\" }, providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableElement, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualScrollingElement]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }],\n standalone: true,\n host: {\n 'class': 'cdk-virtual-scrollable',\n },\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides as virtual scrollable for the global / window scrollbar.\n */\nclass CdkVirtualScrollableWindow extends CdkVirtualScrollable {\n constructor(scrollDispatcher, ngZone, dir) {\n super(new ElementRef(document.documentElement), scrollDispatcher, ngZone, dir);\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(document, 'scroll').pipe(takeUntil(this._destroyed)).subscribe(observer)));\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n}\nCdkVirtualScrollableWindow.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableWindow, deps: [{ token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualScrollableWindow.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollableWindow, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[scrollWindow]\", providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableWindow, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[scrollWindow]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }],\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkScrollableModule {\n}\nCdkScrollableModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCdkScrollableModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule, imports: [CdkScrollable], exports: [CdkScrollable] });\nCdkScrollableModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n imports: [CdkScrollable],\n }]\n }] });\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n}\nScrollingModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nScrollingModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, imports: [BidiModule, CdkScrollableModule, CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement], exports: [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement] });\nScrollingModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, imports: [BidiModule,\n CdkScrollableModule,\n CdkVirtualScrollViewport, BidiModule, CdkScrollableModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [\n BidiModule,\n CdkScrollableModule,\n CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, CdkVirtualScrollable, CdkVirtualScrollableElement, CdkVirtualScrollableWindow, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLLABLE, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n","/**\n * @license Angular v15.2.10\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, Renderer2, ElementRef, Injector, PLATFORM_ID, NgZone } from '@angular/core';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this._location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this._location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n this._baseHref = href ?? this._platformLocation.getBaseHrefFromDOM() ??\n inject(DOCUMENT).location?.origin ?? '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(locationStrategy) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n /** @internal */\n this._urlChangeSubscription = null;\n this._locationStrategy = locationStrategy;\n const baseHref = this._locationStrategy.getBaseHref();\n // Note: This class's interaction with base HREF does not fully follow the rules\n // outlined in the spec https://www.freesoft.org/CIE/RFC/1808/18.htm.\n // Instead of trying to fix individual bugs with more and more code, we should\n // investigate using the URL constructor and providing the base as a second\n // argument.\n // https://developer.mozilla.org/en-US/docs/Web/API/URL/URL#parameters\n this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));\n this._locationStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n this._locationStrategy.historyGo?.(relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n return () => {\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBasePath(basePath, url) {\n if (!basePath || !url.startsWith(basePath)) {\n return url;\n }\n const strippedUrl = url.substring(basePath.length);\n if (strippedUrl === '' || ['/', ';', '?', '#'].includes(strippedUrl[0])) {\n return strippedUrl;\n }\n return url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\nfunction _stripOrigin(baseHref) {\n // DO NOT REFACTOR! Previously, this check looked like this:\n // `/^(https?:)?\\/\\//.test(baseHref)`, but that resulted in\n // syntactically incorrect code after Closure Compiler minification.\n // This was likely caused by a bug in Closure Compiler, but\n // for now, the check is rewritten to use `new RegExp` instead.\n const isAbsoluteUrl = (new RegExp('^(https?:)?//')).test(baseHref);\n if (isAbsoluteUrl) {\n const [, pathname] = baseHref.split(/\\/\\/[^\\/]+/);\n return pathname;\n }\n return baseHref;\n}\n\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\nNgLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(\n // leaving references to differs in place since flex layout is extending NgClass...\n _iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this.initialClasses = EMPTY_ARRAY;\n this.stateMap = new Map();\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n const { _viewContainerRef: viewContainerRef, ngComponentOutletNgModule: ngModule, ngComponentOutletNgModuleFactory: ngModuleFactory, } = this;\n viewContainerRef.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModule'] || changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (ngModule) {\n this._moduleRef = createNgModule(ngModule, getParentInjector(injector));\n }\n else if (ngModuleFactory) {\n this._moduleRef = ngModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = viewContainerRef.createComponent(this.ngComponentOutlet, {\n index: viewContainerRef.length,\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
` element.\n *\n * ```\n *
...
\n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
...
\n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
\n * {{i}}/{{users.length}}. {{user}} default\n *
\n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if (NG_DEV_MODE && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (NG_DEV_MODE) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
Content to render when condition is true.
\n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
{{value}}
\n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
\n * ...\n *
\n *\n * \n *
Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
\n * ...\n *
\n * \n *\n * \n *
Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultViews = [];\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; } });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n this.ngTemplateOutletInjector = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet'] || changes['ngTemplateOutletInjector']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n if (this.ngTemplateOutlet) {\n const { ngTemplateOutlet: template, ngTemplateOutletContext: context, ngTemplateOutletInjector: injector } = this;\n this._viewRef = viewContainerRef.createEmbeddedView(template, context, injector ? { injector } : undefined);\n }\n else {\n this._viewRef = null;\n }\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(ref) {\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n // Note: `this._ref` is only cleared in `ngOnDestroy` so is known to be available when a\n // value is being updated.\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n standalone: true,\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.slice(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n standalone: true,\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n standalone: true,\n }]\n }] });\n\n/**\n * The default date format of Angular date pipe, which corresponds to the following format:\n * `'MMM d,y'` (e.g. `Jun 15, 2015`)\n */\nconst DEFAULT_DATE_FORMAT = 'mediumDate';\n\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n *\n * @deprecated use DATE_PIPE_DEFAULT_OPTIONS token to configure DatePipe\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n/**\n * DI token that allows to provide default configuration for the `DatePipe` instances in an\n * application. The value is an object which can include the following fields:\n * - `dateFormat`: configures the default date format. If not provided, the `DatePipe`\n * will use the 'mediumDate' as a value.\n * - `timezone`: configures the default timezone. If not provided, the `DatePipe` will\n * use the end-user's local system timezone.\n *\n * @see `DatePipeConfig`\n *\n * @usageNotes\n *\n * Various date pipe default values can be overwritten by providing this token with\n * the value that has this interface.\n *\n * For example:\n *\n * Override the default date format by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {dateFormat: 'shortDate'}}\n * ]\n * ```\n *\n * Override the default timezone by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {timezone: '-1200'}}\n * ]\n * ```\n */\nconst DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken('DATE_PIPE_DEFAULT_OPTIONS');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_OPTIONS`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale, defaultTimezone, defaultOptions) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n this.defaultOptions = defaultOptions;\n }\n transform(value, format, timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;\n const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? undefined;\n return formatDate(value, _format, locale || this.locale, _timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }, { token: DATE_PIPE_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Pipe });\nDatePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_OPTIONS]\n }, {\n type: Optional\n }] }]; } });\n\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * https://unicode-org.github.io/icu/userguide/format_parse/messages/.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe });\nI18nPluralPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; } });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nI18nSelectPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n pure: true,\n standalone: true,\n }]\n }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nJsonPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n standalone: true,\n }]\n }] });\n\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe });\nKeyValuePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.KeyValueDiffers }]; } });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format: \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format: \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
b
\n *
c
\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.10\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: CommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('15.2.10');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n let urlSegments;\n if (width) {\n const params = `tr:w-${width}`;\n urlSegments = [path, params, src];\n }\n else {\n urlSegments = [path, src];\n }\n return urlSegments.join('/');\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc ? `(activated on an element with the \\`ngSrc=\"${ngSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n // Keep track of images for which `console.warn` was produced.\n this.alreadyWarned = new Set();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const imgNgSrc = this.images.get(imgSrc);\n if (imgNgSrc && !this.alreadyWarned.has(imgSrc)) {\n this.alreadyWarned.add(imgSrc);\n logMissingPriorityWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc) {\n if (!this.observer)\n return;\n this.images.set(getUrl(rewrittenSrc, this.window).href, originalNgSrc);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n this.alreadyWarned.clear();\n }\n}\nLCPImageObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLCPImageObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\n\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n this.document = inject(DOCUMENT);\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n}\nPreconnectLinkChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreconnectLinkChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * In SSR scenarios, a preload `` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken('NG_OPTIMIZED_PRELOADED_IMAGES', { providedIn: 'root', factory: () => new Set() });\n\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n constructor() {\n this.preloadedImages = inject(PRELOADED_IMAGES);\n this.document = inject(DOCUMENT);\n }\n /**\n * @description Add a preload `` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload `` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the `` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* RuntimeErrorCode.TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n}\nPreloadLinkCreator.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreloadLinkCreator.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo];\nconst defaultConfig = {\n breakpoints: [16, 32, 48, 64, 96, 128, 256, 384, 640, 750, 828, 1080, 1200, 1920, 2048, 3840],\n};\n/**\n * Injection token that configures the image optimized image functionality.\n *\n * @see `NgOptimizedImage`\n * @publicApi\n * @developerPreview\n */\nconst IMAGE_CONFIG = new InjectionToken('ImageConfig', { providedIn: 'root', factory: () => defaultConfig });\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/standalone-components) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * \n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.config = processConfig(inject(IMAGE_CONFIG));\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n this.isServer = isPlatformServer(inject(PLATFORM_ID));\n this.preloadLinkChecker = inject(PreloadLinkCreator);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n this._priority = false;\n this._disableOptimizedSrcset = false;\n this._fill = false;\n }\n /**\n * For responsive images: the intrinsic width of the image in pixels.\n * For fixed size images: the desired rendered width of the image in pixels.\n */\n set width(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'width');\n this._width = inputToInteger(value);\n }\n get width() {\n return this._width;\n }\n /**\n * For responsive images: the intrinsic height of the image in pixels.\n * For fixed size images: the desired rendered height of the image in pixels.* The intrinsic\n * height of the image in pixels.\n */\n set height(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'height');\n this._height = inputToInteger(value);\n }\n get height() {\n return this._height;\n }\n /**\n * Indicates whether this image should have a high priority.\n */\n set priority(value) {\n this._priority = inputToBoolean(value);\n }\n get priority() {\n return this._priority;\n }\n /**\n * Disables automatic srcset generation for this image.\n */\n set disableOptimizedSrcset(value) {\n this._disableOptimizedSrcset = inputToBoolean(value);\n }\n get disableOptimizedSrcset() {\n return this._disableOptimizedSrcset;\n }\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n *\n * @developerPreview\n */\n set fill(value) {\n this._fill = inputToBoolean(value);\n }\n get fill() {\n return this._fill;\n }\n /** @nodoc */\n ngOnInit() {\n if (ngDevMode) {\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n assertNonZeroRenderedHeight(this, this.imgElement, this.renderer);\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n assertNoImageDistortion(this, this.imgElement, this.renderer);\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n }\n else {\n // Monitor whether an image is an LCP element only in case\n // the `priority` attribute is missing. Otherwise, an image\n // has the necessary settings and no extra checks are required.\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc);\n });\n }\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n if (!this.sizes) {\n this.sizes = '100vw';\n }\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.sizes) {\n this.setHostAttribute('sizes', this.sizes);\n }\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n if (this.isServer && this.priority) {\n this.preloadLinkChecker.createPreloadLinkTag(this.renderer, rewrittenSrc, rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrc',\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter(bp => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map(bp => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map(multiplier => `${this.callImageLoader({\n src: this.ngSrc,\n width: this.width * multiplier\n })} ${multiplier}x`);\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n return !this._disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader &&\n !(this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n}\nNgOptimizedImage.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgOptimizedImage.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.10\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc]\", inputs: { ngSrc: \"ngSrc\", ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: \"width\", height: \"height\", loading: \"loading\", priority: \"priority\", loaderParams: \"loaderParams\", disableOptimizedSrcset: \"disableOptimizedSrcset\", fill: \"fill\", src: \"src\", srcset: \"srcset\" }, host: { properties: { \"style.position\": \"fill ? \\\"absolute\\\" : null\", \"style.width\": \"fill ? \\\"100%\\\" : null\", \"style.height\": \"fill ? \\\"100%\\\" : null\", \"style.inset\": \"fill ? \\\"0px\\\" : null\" } }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[ngSrc]',\n host: {\n '[style.position]': 'fill ? \"absolute\" : null',\n '[style.width]': 'fill ? \"100%\" : null',\n '[style.height]': 'fill ? \"100%\" : null',\n '[style.inset]': 'fill ? \"0px\" : null'\n }\n }]\n }], propDecorators: { ngSrc: [{\n type: Input\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input\n }], height: [{\n type: Input\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input\n }], fill: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Convert input value to integer.\n */\nfunction inputToInteger(value) {\n return typeof value === 'string' ? parseInt(value, 10) : value;\n}\n/**\n * Convert input value to boolean.\n */\nfunction inputToBoolean(value) {\n return value != null && `${value}` !== 'false';\n}\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, defaultConfig, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason = `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason = `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value ` +\n `(\\`${inputValue}\\`). To fix this, provide \\`${inputName}\\` ` +\n `as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const computedStyle = window.getComputedStyle(img);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n const boxSizing = computedStyle.getPropertyValue('box-sizing');\n if (boxSizing === 'border-box') {\n const paddingTop = computedStyle.getPropertyValue('padding-top');\n const paddingRight = computedStyle.getPropertyValue('padding-right');\n const paddingBottom = computedStyle.getPropertyValue('padding-bottom');\n const paddingLeft = computedStyle.getPropertyValue('padding-left');\n renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);\n renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);\n }\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${suppliedAspectRatio}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${renderedAspectRatio}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n });\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* RuntimeErrorCode.MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\n\n// These exports represent the set of symbols exposed as a public API.\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, BrowserPlatformLocation, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_OPTIONS, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_CONFIG, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v15.2.10\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue, XhrFactory as XhrFactory$1 } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Inject, PLATFORM_ID, makeEnvironmentProviders, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertValidHeaders(headers);\n }\n this.headers = new Map();\n Object.entries(headers).forEach(([name, values]) => {\n let headerValues;\n if (typeof values === 'string') {\n headerValues = [values];\n }\n else if (typeof values === 'number') {\n headerValues = [values.toString()];\n }\n else {\n headerValues = values.map((value) => value.toString());\n }\n if (headerValues.length > 0) {\n const key = name.toLowerCase();\n this.headers.set(key, headerValues);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or override for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n/**\n * Verifies that the headers object has the right shape: the values\n * must be either strings, numbers or arrays. Throws an error if an invalid\n * header value is present.\n */\nfunction assertValidHeaders(headers) {\n for (const [key, value] of Object.entries(headers)) {\n if (!(typeof value === 'string' || typeof value === 'number') && !Array.isArray(value)) {\n throw new Error(`Unexpected value of the \\`${key}\\` header provided. ` +\n `Expecting either a string, a number or an array, but got: \\`${value}\\`.`);\n }\n }\n}\n\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n // convert the values to strings\n const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];\n this.map.set(key, values);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* HttpStatusCode.Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/tour-of-heroes/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpClient.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HttpClient });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\nfunction interceptorChainEndFn(req, finalHandlerFn) {\n return finalHandlerFn(req);\n}\n/**\n * Constructs a `ChainedInterceptorFn` which adapts a legacy `HttpInterceptor` to the\n * `ChainedInterceptorFn` interface.\n */\nfunction adaptLegacyInterceptorToChain(chainTailFn, interceptor) {\n return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {\n handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn),\n });\n}\n/**\n * Constructs a `ChainedInterceptorFn` which wraps and invokes a functional interceptor in the given\n * injector.\n */\nfunction chainedInterceptorFn(chainTailFn, interceptorFn, injector) {\n // clang-format off\n return (initialRequest, finalHandlerFn) => injector.runInContext(() => interceptorFn(initialRequest, downstreamRequest => chainTailFn(downstreamRequest, finalHandlerFn)));\n // clang-format on\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\n/**\n * A multi-provided token of `HttpInterceptorFn`s.\n */\nconst HTTP_INTERCEPTOR_FNS = new InjectionToken('HTTP_INTERCEPTOR_FNS');\n/**\n * Creates an `HttpInterceptorFn` which lazily initializes an interceptor chain from the legacy\n * class-based interceptors and runs the request through it.\n */\nfunction legacyInterceptorFnFactory() {\n let chain = null;\n return (req, handler) => {\n if (chain === null) {\n const interceptors = inject(HTTP_INTERCEPTORS, { optional: true }) ?? [];\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `interceptors` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);\n }\n return chain(req, handler);\n };\n}\nclass HttpInterceptorHandler extends HttpHandler {\n constructor(backend, injector) {\n super();\n this.backend = backend;\n this.injector = injector;\n this.chain = null;\n }\n handle(initialRequest) {\n if (this.chain === null) {\n const dedupedInterceptorFns = Array.from(new Set(this.injector.get(HTTP_INTERCEPTOR_FNS)));\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `dedupedInterceptorFns` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);\n }\n return this.chain(initialRequest, downstreamRequest => this.backend.handle(downstreamRequest));\n }\n}\nHttpInterceptorHandler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HttpInterceptorHandler, deps: [{ token: HttpBackend }, { token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpInterceptorHandler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HttpInterceptorHandler });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.10\", ngImport: i0, type: HttpInterceptorHandler, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpBackend }, { type: i0.EnvironmentInjector }]; } });\n\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending